-
Notifications
You must be signed in to change notification settings - Fork 1
/
Reducers-160511060618878897.json
1 lines (1 loc) · 464 KB
/
Reducers-160511060618878897.json
1
{"apiReducers":{"target_id_list":[{"id":2,"title":"NUDT7A","project_id":[2],"protein_set":[15617,15618,15619,15620,15621,15622,15623,15624,15625,15626,15627,15628,15629,15630,15631],"template_protein":"/media/pdbs/NUDT7A-x0140_1_apo_hYaNUGN.pdb","metadata":null,"zip_archive":null},{"id":4,"title":"ATAD","project_id":[2],"protein_set":[13044,13045,13046,13047,13048,13049,13050,13051],"template_protein":"/media/pdbs/ATAD2A-x1712_1_apo_QcCBCZx.pdb","metadata":null,"zip_archive":null},{"id":5,"title":"BRD1A","project_id":[2],"protein_set":[13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065,13066,13067,13068,13069,13070,13071,13072,13073],"template_protein":"/media/pdbs/BRD1A-x0900_1_apo_X36iTCu.pdb","metadata":null,"zip_archive":null},{"id":7,"title":"DCP2B","project_id":[2],"protein_set":[14666,14667,14668,14669,14670,14671,14672,14673,14674,14675,14676,14677,14678,14679,14680,14681,14682,14683,14684,14685,14686,14687,14688,14689,14690,14691,14692,14693,14694,14695,14696,14697,14698,14699,14700,14701,14702,14703,14704,14705,14706,14707,14708,14709,14710,14711,14712,14713,14714,14715,14716,14717,14718,14719,14720,14721,14722,14723,14724,14725,14726,14727,14728,14729,14730,14731,14732,14733,14734,14735,14736,14737,14738],"template_protein":"/media/pdbs/DCP2B-x0020_1_apo_5td9srg.pdb","metadata":null,"zip_archive":null},{"id":8,"title":"FAM83BA","project_id":[2],"protein_set":[13325,13326,13327,13328,13329,13330,13331,13332,13333,13334,13335,13336,13337,13338],"template_protein":"/media/pdbs/FAM83BA-x0131_1_apo_G2blbbF.pdb","metadata":null,"zip_archive":null},{"id":12,"title":"MURD","project_id":[2],"protein_set":[6378,6379,6380,6381],"template_protein":"/media/pdbs/MURD-x0349_apo_0Z35oUA.pdb","metadata":null,"zip_archive":null},{"id":15,"title":"NUDT4A","project_id":[2],"protein_set":[13536,13537,13538,13539,13540,13541,13542,13543],"template_protein":"/media/pdbs/NUDT4A-x0159_1_apo_MptlW5D.pdb","metadata":null,"zip_archive":null},{"id":17,"title":"OXA10OTA","project_id":[2],"protein_set":[13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967,13968,13969,13970],"template_protein":"/media/pdbs/OXA10OTA-x0038_1_apo_b0APxOF.pdb","metadata":null,"zip_archive":null},{"id":18,"title":"PARP14A","project_id":[2],"protein_set":[13971,13972,13973,13974,13975,13976,13977,13978,13979,13980,13981,13982,13983,13984,13985,13986,13987,13988],"template_protein":"/media/pdbs/PARP14A-x0137_1_apo_RiuanPQ.pdb","metadata":null,"zip_archive":null},{"id":19,"title":"PHIPA","project_id":[2],"protein_set":[32628,32655,32616,32629,32620,32640,32611,32630,32623,32653,32617,32631,32618,32648,32641,32619,32632,32634,32654,32659,32622,32642,32615,32612,32625,32660,32621,32626,32649,32643,32627,32663,32635,32644,32662,32656,32650,32639,32645,32646,32657,32651,32647,32614,32652,32613,32636,32658,32624,32661,32638,32633,32637],"template_protein":"/media/pdbs/PHIPA-x20442_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_oHB8XOf.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/PHIPA.zip"},{"id":20,"title":"PTP1B","project_id":[2],"protein_set":[6480,6481,6482,6483,6484,6485,6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,6614,6615,6616,6617,6618],"template_protein":"/media/pdbs/PTP1B-y0049_apo_N9naW4T.pdb","metadata":null,"zip_archive":null},{"id":22,"title":"SMTGR","project_id":[2],"protein_set":[7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213,7214,7215],"template_protein":"/media/pdbs/smTGR-x2053_apo_zrHDWbw.pdb","metadata":null,"zip_archive":null},{"id":29,"title":"ATAD2A","project_id":[2],"protein_set":[13052,13053,13054],"template_protein":"/media/pdbs/ATAD2A-x1803_1_apo_D4wOsMM.pdb","metadata":null,"zip_archive":null},{"id":30,"title":"CAMK1DA","project_id":[2],"protein_set":[13074,13075,13076,13077,13078,13079,13080,13081,13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092],"template_protein":"/media/pdbs/CAMK1DA-x0049_1_apo_Xd3Xer3.pdb","metadata":null,"zip_archive":null},{"id":31,"title":"DCLRE1AA","project_id":[2],"protein_set":[13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,13228,13229,13230,13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,13241,13242,13243,13244,13245,13246,13247,13248,13249,13250,13251],"template_protein":"/media/pdbs/DCLRE1AA-x0128_1_apo_SgxAg9F.pdb","metadata":null,"zip_archive":null},{"id":32,"title":"FALZA","project_id":[2],"protein_set":[6928,6929,6930,6931,6932,6933,6934,6935],"template_protein":"/media/pdbs/FALZA-x0079_1_apo_pDzqSU5.pdb","metadata":null,"zip_archive":null},{"id":35,"title":"HAO1A","project_id":[2],"protein_set":[6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968,6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983],"template_protein":"/media/pdbs/HAO1A-x0208_1_apo_MQrMrik.pdb","metadata":null,"zip_archive":null},{"id":37,"title":"MUREECA","project_id":[2],"protein_set":[17944,17945,17946,17947,17948,17949,17950,17951,17952,17953,17954,17955,17956,17957,17958,17959,17960,17961,17962,17963,17964,17965],"template_protein":"/media/pdbs/MUREECA-x0114_1_apo_SbbuYzF.pdb","metadata":null,"zip_archive":null},{"id":38,"title":"NUDT21A","project_id":[2],"protein_set":[13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506,13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522,13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535],"template_protein":"/media/pdbs/NUDT21A-x0159_1_apo_VSKfMPI.pdb","metadata":null,"zip_archive":null},{"id":39,"title":"NUDT4","project_id":[2],"protein_set":[7069,7070,7071,7072,7073,7074],"template_protein":"/media/pdbs/NUDT4A-x0159_apo_Z09M2Hp.pdb","metadata":null,"zip_archive":null},{"id":40,"title":"NUDT5A","project_id":[2],"protein_set":[18136,18137,18138,18139,18140,18141,18142,18143,18144,18145,18146,18147,18148,18149,18150,18151,18152,18153,18154,18155,18156,18157,18158,18159,18160,18161,18162,18163,18164,18165,18166,18167,18168,18169,18170,18171,18172,18173,18174,18175,18176,18177,18178,18179,18180,18181,18182,18183,18184,18185,18186,18187,18188,18189,18190,18191,18192,18193,18194,18195,18196,18197,18198,18199,18200,18201,18202,18203,18204,18205,18206,18207,18208,18209,18210,18211,18212,18213,18214,18215,18216,18217,18218,18219,18220,18221,18222,18223,18224,18225,18226,18227,18228,18229,18230,18231,18232,18233,18234,18235,18236,18237,18238,18239,18240,18241,18242,18243,18244,18245,18246,18247,18248,18249,18250,18251,18252,18253,18254,18255,18256,18257,18258,18259,18260,18261,18262,18263,18264,18265,18266,18267,18268,18269,18270,18271,18272,18273,18274,18275,18276,18277,18278,18279,18280,18281,18282,18283,18284,18285,18286,18287,18288,18289,18290,18291,18292,18293,18294,18295,18296,18297,18298,18299,18300,18301,18302,18303,18304],"template_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","metadata":null,"zip_archive":null},{"id":41,"title":"NUDT7A_CRUDE","project_id":[2],"protein_set":[13657,13658,13659,13660,13661,13662,13663,13664,13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680,13681,13682,13683,13684,13685,13686,13687,13688,13689,13690,13691,13692,13693,13694,13695,13696,13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712,13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728,13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744,13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760,13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,13775,13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791,13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807,13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823,13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839,13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855,13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871,13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887,13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903,13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919,13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935,13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951],"template_protein":"/media/pdbs/NUDT7A_Crude-x0005_1_apo_by2s3Tn.pdb","metadata":null,"zip_archive":null},{"id":46,"title":"smTGRNEW","project_id":[2],"protein_set":[7216,7217,7218,7219,7220,7221,7222,7223,7224],"template_protein":"/media/pdbs/smTGR-x20531_apo_ddCGiaP.pdb","metadata":null,"zip_archive":null},{"id":47,"title":"STAG1A","project_id":[2],"protein_set":[14789,14790,14791,14792,14793,14794,14795,14796,14797,14798,14799,14800,14801,14802,14803,14804,14805,14806,14807,14808,14809],"template_protein":"/media/pdbs/STAG1A-x0237_1_apo_T6h9LGK.pdb","metadata":null,"zip_archive":null},{"id":48,"title":"TBXTA","project_id":[2],"protein_set":[14810,14811,14812,14813,14814,14815,14816,14817,14818,14819,14820,14821,14822,14823,14824,14825,14826,14827,14828,14829,14830,14831,14832,14833,14834,14835,14836,14837,14838,14839,14840,14841,14842,14843,14844,14845,14846,14847,14848,14849,14850,14851,14852,14853,14854,14855,14856,14857,14858,14859,14860,14861,14862],"template_protein":"/media/pdbs/TBXTA-x0024_1_apo_kFHAPSk.pdb","metadata":null,"zip_archive":null},{"id":50,"title":"VIM2","project_id":[2],"protein_set":[14410,14411,14412,14413,14414,14415,14416,14417,14418,14419,14420,14421,14422,14423,14424,14425,14426,14427,14428,14429,14430,14431,14432,14433,14434,14435,14436,14437,14438,14439,14440,14441,14442,14443,14444,14445,14446,14447,14448,14449,14450,14451,14452,14453,14454,14455,14456,14457,14458,14459,14460,14461,14462,14463,14464,14465,14466,14467,14468,14469,14470,14471,14472,14473,14474,14475,14476,14477,14478,14479,14480,14481,14482,14483,14484,14485,14486,14487,14488,14489,14490,14491,14492,14493,14494,14495,14496,14497,14498,14499,14500,14501,14502,14503,14504,14505,14506,14507,14508,14509,14510,14511,14512,14513,14514,14515,14516,14517,14518,14519,14520,14521,14522,14523,14524,14525,14526,14527,14528,14529,14530,14531,14532,14533,14534,14535,14536,14537,14538,14539,14540,14541,14542,14543,14544,14545,14546,14547,14548,14549,14550,14551,14552,14553,14554,14555,14556,14557,14558,14559,14560,14561,14562,14563,14564,14565,14566,14567,14568,14569,14570,14571,14572,14573],"template_protein":"/media/pdbs/VIM2-MB-105_1_apo_SBlf6ub.pdb","metadata":null,"zip_archive":null},{"id":51,"title":"XX02KALRNA","project_id":[2],"protein_set":[14902,14903,14904,14905,14906,14907,14908,14909,14910,14911,14912,14913],"template_protein":"/media/pdbs/XX02KALRNA-x1376_1_apo_9VSCvR8.pdb","metadata":null,"zip_archive":null},{"id":52,"title":"TNCA","project_id":[2],"protein_set":[14354,14355,14356,14357,14358,14359,14360,14361,14362,14363,14364,14365,14366,14367,14368,14369,14370],"template_protein":"/media/pdbs/TNCA-x0062_1_apo_Vc9bxy2.pdb","metadata":null,"zip_archive":null},{"id":53,"title":"ALAS2A","project_id":[2],"protein_set":[17966],"template_protein":"NOT AVAILABLE","metadata":null,"zip_archive":null},{"id":54,"title":"EPB41L3A","project_id":[2],"protein_set":[18435,18460,31217,31218,31234,31244,31219,31220,31235,31252,31221,31222,18428,31245,31223,31236,31224,31261,31225,31237,31226,31246,31227,31238,31228,31253,31229,31239,31230,31247,31231,31240,31232,31258,31233,31241,31248,31242,31254,31243,31249,31264,31250,31255,31251,31259,31262,31256,31257,31260,31263,31265],"template_protein":"/media/pdbs/EPB41L3A-x0306_1_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_NJuLr98.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/EPB41L3A.zip"},{"id":61,"title":"mArh","project_id":[2],"protein_set":[31678,31674,31681,31675,31671,31672,31679,31676,31673,31683,31677,31682,31680,31686,31685,31684,31687,31688,31689,31690,31691,31692,31693,31694,31695,31696,31697,31698,31700,31704,31701,31707,31702,31699,31705,31703,31710,31706,31709,31708,31711,31712,31713,31714,31715,31716,31717,31718,31719,31720,31721,31722,31723,31724,31725,31726,31727,31728,31729,31730,31731,31732,31733,31734,31747,31735,31756,31736,31748,31737,31738,31749,31739,31762,31757,31740,31750,31741,31742,31751,31743,31766,31758,31744,31752,31745,31746,31753,31763,31759,31754,31755,31769,31760,31764,31761,31767,31765,31772,31768,31771,31770,31773,31774,31775,31776,31777,31778,31779,31780,31794,31781,31810,31782,31795,31783,31804,31784,31796,31785,31818,31786,31815,31797,31787,31805,31788,31798,31789,31811,31790,31799,31791,31806,31792,31800,31793,31807,31801,31812,31802,31808,31803,31816,31809,31813,31822,31819,31814,31817,31821,31820,31823,31825,31824,31826,31827,31828,31829,31830,31831,31854,31832,31845,31833,31865,31834,31846,31835,31855,31836,31847,31837,31861,31838,31848,31839,31856,31840,31849,31841,31868,31842,31850,31843,31857,31844,31851,31862,31852,31858,31853,31866,31863,31859,31860,31872,31864,31867,31869,31871,31870,31916,31887,31898,31888,31873,31906,31874,31889,31875,31899,31876,31890,31877,31912,31878,31891,31879,31900,31880,31892,31881,31907,31882,31893,31883,31901,31884,31894,31885,31886,31919,31902,31895,31908,31896,31903,31897,31913,31909,31904,31905,31917,31914,31910,31911,31921,31915,31918,31920,31924,31922,31923,31925,31926,31927,31928,31929,31930,31931,31969,31932,31949,31933,31961,31934,31950,31935,31975,31936,31951,31937,31962,31938,31952,31939,31970,31940,31953,31941,31963,31942,31954,31943,31979,31944,31955,31945,31964,31946,31956,31947,31971,31948,31965,31957,31958,31976,31966,31959,31960,31972,31967,31982,31968,31973,31977,31980,31974,31984,31978,31983,31981,31987,31985,31986,31988,31989,31990,31991,31992,31993,31994,31996,31995,31997,31998,31999,32000,32001,32002,32003,32004,32005],"template_protein":"/media/pdbs/mArh-3ew5_B_0B_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_7AuLXgA.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/mArh.zip"},{"id":62,"title":"Mpro","project_id":[2],"protein_set":[30179,30140,32009,32314,30155,30164,30174,30203,30212,30182,30144,30176,30135,30152,30178,30183,30161,30169,30184,30175,30180,30181,30185,30186,30187,30202,30194,30193,30195,30196,30197,30198,30199,30201,30204,30205,30206,30207,30210,30211,30213,30216,30217,30218,30219,30220,32312,30222,30215,32313,30200,32315,30214,30221,32664,32666,32667,32665,32668,32677,32672,32675,32671,32676,32673,32670,32669,32674,30157,30145,30165,30131,30147,30130,30143,30137,30149,30151,30138,30133,30158,30166,30154,30146,30173,30129,30139,30159,30167,30156,30141,30132,30150,30177,30134,30160,30148,30153,30142,30168,30162,30163,30170,30171,30172,32680,32679,32678,32709,32687,32688,32697,32713,32706,32710,32721,32722,32696,32717,32716,32702,32685,32683,32705,32714,32701,32700,32695,32691,32694,32699,32707,32704,32698,32711,32715,32712,32689,32682,32681,32686,32703,32719,32720,32718,32684,32690,32692,32693,32708,32724,32726,32727,32723,32732,32729,32736,32731,32733,32737,32738,32734,32739,32740,32741,32735,32728,32744,32747,32748,32750,32745,32746,32754,32778,32799,32798,32755,32781,32756,32763,32758,32779,32801,32790,32759,32793,32800,32760,32771,32762,32780,32770,32772,32757,32769,32752,32773,32795,32782,32786,32774,32765,32775,32766,32777,32783,32785,32791,32792,32796,32753,32788,32797,32768,32784,32794,32789,32761,32810,32843,30136,32812,32828,32007,32832,32010,32813,32831,32823,32011,32814,32012,32847,32013,32816,32014,32824,32015,32808,32819,32805,32806,32815,32807,32835,32825,32809,32837,32836,32829,32822,32826,32827,32833,32830,32838,32841,32821,32842,32845,32817,32811,32820,32846,32848,32839,32849,32850,32844,32868,32896,32853,32870,32871,32854,32855,32864,32888,32857,32877,32884,32858,32897,32860,32885,32872,32875,32876,32880,32873,32862,32852,32887,32874,32861,32863,32878,32866,32903,32879,32856,32851,32889,32898,32881,32899,32900,32883,32886,32901,32869,32902,32893,32895,32892,32905,32904,32907,32891,32865,32939,32918,32908,32933,32932,32943,32937,32912,32956,32936,32911,32950,32927,32925,32916,32957,32917,32952,32919,32946,32958,32944,32938,32920,32910,32921,32922,32949,32923,32940,32924,32945,32934,32909,32931,32954,32935,32914,32941,32948,32928,32947,32913,32926,32942,32951,32953,32929,32915,32776,32787,32804,32730,32764,32742,32749,32867,32882,32818,32834,32859,32803,32802,32894,32906,32725,32890,32743,32751,32840,32767,32930,32955],"template_protein":"/media/pdbs/Mpro-6xqu_0A_apo_d2RXJbV.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_frXD4iS.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/Mpro.zip"},{"id":65,"title":"INPP5DA","project_id":[2],"protein_set":[31499,31508,31500,31501,31509,31517,31531,31503,31510,31504,31505,31518,31506,31523,31507,31512,31513,31519,31527,31514,31515,31524,31516,31521,31525,31522,31528,31526,31530,31532,31533,31534,31535,31536,31537,31539,31540,31541,31562,31542,31549,31578,31543,31544,31550,31546,31551,31547,31548,31552,31564,31583,31553,31565,31573,31555,31556,31566,31579,31557,31558,31567,31574,31559,31560,31568,31586,31561,31569,31575,31570,31580,31571,31576,31584,31577,31588,31582,31585,31587,31591,31589,31592,31593,31594,31595,31596,31597,31598,31599,31600,31601,31602,31603,31604,31605,31606,31607,31502,31511,31520,31529,31538,31545,31554,31563,31572,31581,31590],"template_protein":"/media/pdbs/INPP5DA-x0019_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_MR1dz1c.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/INPP5DA.zip"},{"id":66,"title":"nsp13","project_id":[2],"protein_set":[31608,31609,31613,31617,31614,31610,31611,31615,31612,31618,31620,31616,31622,31619,31623,31621,31624,31625,31626,31627,31628,31629,31630,31631,31632,31636,31633,31639,31634,31637,31635,31641,31638,31640,31642,31643,31644,31645,31646,31647,31648,31649,31650,31652,31666,31653,31654,31667,31655,31656,31668,31657,31658,31669,31659,31660,31670,31661,31662,31663,31651,31664,31665],"template_protein":"/media/pdbs/nsp13-x0020_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_ahVc7pn.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/nsp13.zip"},{"id":67,"title":"Mac1","project_id":[2],"protein_set":[32975,33004,32964,32985,32979,32990,32995,32974,32960,32988,33007,32965,32967,32966,32968,32969,32980,33009,32970,32983,32971,32984,32961,32987,32986,33006,32996,32972,32962,32993,32989,32978,33013,32977,32976,32998,32997,33003,33002,33012,32999,33000,33010,32994,33008,32991,32959,33005,32981,33061,33062,33051,33030,33067,33046,33024,33029,33044,33043,33048,33033,33018,33049,33031,33032,33059,33050,33054,33025,33040,33042,33026,33023,33022,33036,33063,33039,33068,33035,33017,33064,33045,33015,33052,33053,33055,33056,33021,33058,33037,33060,33020,33014,33034,33065,33041,33027,33016,33097,33103,33089,33087,33072,33100,33096,33070,33118,33108,33088,33076,33086,33092,33110,33075,33079,33105,33073,33071,33107,33095,33098,33085,33077,33117,33101,33082,33091,33090,33099,33104,33094,33111,33113,33114,33084,33116,33120,33109,33119,33123,33115,33122,33078,33069,33080,33081,33106,33127,33156,33152,33177,33125,33142,33144,33153,33128,33164,33150,33137,33139,33135,33124,33134,33160,33147,33154,33140,33168,33141,33130,33155,33133,33151,33146,33145,33126,33143,33132,33161,33166,33175,33149,33165,33162,33171,33136,33158,33174,33159,33163,33172,33170,33178,33169,33131,33173,33179,33202,33196,33180,33188,33227,33191,33187,33183,33232,33197,33182,33189,33200,33225,33181,33198,33208,33226,33207,33213,33209,33230,33190,33233,33224,33215,33194,33221,33204,33211,33216,33218,33199,33217,33210,33192,33228,33223,33205,33220,33214,33201,33219,33185,33195,33186,33229,33206,33234,33235,33203,33193,33184,33121,33129,33212,32982,33028,33222,33019,33001,33011,33148,33176,33066,33038,33083,32992,33047,33074,33057,32973,32963,33093,33102,33157,33112,33231,33138,33167],"template_protein":"/media/pdbs/Mac1-DLS-EU0569_0A_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/Mac1.zip"}],"mol_group_list":[{"id":220881,"group_type":"MC","mol_id":[18220,18224,18228,18232,18236,18271,18275,18278,18283,18287,18291],"target_id":40,"x_com":-10.4955049680239,"y_com":-9.68024546470901,"z_com":-8.32242130242049,"description":"c_of_m"},{"id":220882,"group_type":"MC","mol_id":[18123,18132,18135,18138,18148,18153,18157,18158,18162,18167,18170,18172,18174,18180,18181,18186,18189,18191,18196,18198,18200,18204,18206,18207,18211,18214,18240,18244,18247,18251,18255,18259,18263,18267],"target_id":40,"x_com":-2.81713538840293,"y_com":3.04881164113424,"z_com":3.68988223433862,"description":"c_of_m"},{"id":220883,"group_type":"MC","mol_id":[18124,18131,18134,18139,18145,18146,18150,18154,18160,18166,18168,18177,18182,18184,18193,18201,18202,18208,18212,18239,18243,18246,18250,18254,18258,18262,18266],"target_id":40,"x_com":-22.4835233187594,"y_com":28.4053233460983,"z_com":-57.027099634933,"description":"c_of_m"},{"id":220884,"group_type":"MC","mol_id":[18125,18133,18137,18141,18144,18149,18152,18156,18163,18164,18171,18175,18179,18183,18188,18195,18205,18209,18215,18237,18241,18248,18252,18256,18260,18264],"target_id":40,"x_com":-29.077335188903,"y_com":6.01824404431039,"z_com":-63.9042831677937,"description":"c_of_m"},{"id":220885,"group_type":"MC","mol_id":[18126,18129,18130,18136,18140,18142,18143,18147,18151,18155,18159,18161,18165,18169,18173,18176,18178,18185,18190,18192,18194,18197,18199,18203,18210,18213,18216,18238,18242,18245,18249,18253,18257,18261,18265],"target_id":40,"x_com":-17.0403378328045,"y_com":-14.5791312624094,"z_com":-4.79678133325591,"description":"c_of_m"},{"id":220886,"group_type":"MC","mol_id":[18127],"target_id":40,"x_com":-52.3928823529412,"y_com":9.81782352941177,"z_com":-44.0535294117647,"description":"c_of_m"},{"id":220887,"group_type":"MC","mol_id":[18128],"target_id":40,"x_com":-6.39705882352941,"y_com":15.7078235294118,"z_com":-24.2612352941176,"description":"c_of_m"},{"id":220888,"group_type":"MC","mol_id":[18187],"target_id":40,"x_com":12.4376428571429,"y_com":5.258,"z_com":-4.62571428571429,"description":"c_of_m"},{"id":220889,"group_type":"MC","mol_id":[18217,18221,18225,18229,18233,18268,18272,18276,18279,18280,18284,18288],"target_id":40,"x_com":-25.3682771564328,"y_com":21.5258951736469,"z_com":-52.7491056544548,"description":"c_of_m"},{"id":220890,"group_type":"MC","mol_id":[18218,18222,18226,18230,18234,18269,18273,18277,18281,18285,18289],"target_id":40,"x_com":-8.16724968062983,"y_com":2.81894853371173,"z_com":-2.84670969915877,"description":"c_of_m"},{"id":220891,"group_type":"MC","mol_id":[18219,18223,18227,18231,18235,18270,18274,18282,18286,18290],"target_id":40,"x_com":-33.276049496474,"y_com":12.3248778435673,"z_com":-59.8326882142243,"description":"c_of_m"}],"molecule_list":{"0":{"id":18123,"smiles":"C[C@H]1CCO[C@@H]1C(=O)Nc1cnns1","cmpd_id":560,"prot_id":18136,"protein_code":"NUDT5A-x0114_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -2.7300 3.7860 3.7330 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1910 6.0780 1.6730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0600 7.0640 3.3390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6680 6.0480 1.8670 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.9370 7.1970 1.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6560 7.3090 2.0060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2230 6.2560 3.3530 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.9440 4.9160 4.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6290 2.5300 4.2500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3880 1.4370 3.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0400 0.3230 4.6900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1320 0.5000 5.5280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0670 4.8760 4.9710 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4860 2.1180 5.5360 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 1\n 5 4 1 0\n 6 5 1 0\n 6 3 1 0\n 7 4 1 0\n 7 3 1 0\n 7 8 1 6\n 8 1 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 8 2 0\n 14 9 1 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.06,"logp":0.9,"tpsa":64.11,"ha":14,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":76,"number":114},"1":{"id":18132,"smiles":"C[C@H]1CO[C@H](C)CN1C(=O)c1cnsn1","cmpd_id":562,"prot_id":18145,"protein_code":"NUDT5A-x0169_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0169_3_apo_jWc8kNh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -3.1890 4.9970 3.4880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6630 4.0160 5.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8370 5.8770 4.3240 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5300 5.2350 5.3940 C 0 0 1 0 0 0 0 0 0 0 0 0\n -3.0020 4.8440 4.9630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8390 6.3770 2.9570 C 0 0 1 0 0 0 0 0 0 0 0 0\n -4.0270 7.3470 3.0900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5640 6.9190 3.6880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6050 3.9910 2.5790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8390 2.5660 2.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8350 1.7520 3.7030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1830 0.5080 3.8580 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9180 1.9010 2.6490 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8220 4.2510 1.3900 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7010 0.3210 3.1610 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 6\n 4 3 1 0\n 5 4 1 0\n 5 1 1 0\n 6 1 1 0\n 6 7 1 1\n 8 6 1 0\n 8 3 1 0\n 9 1 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 10 2 0\n 14 9 2 0\n 15 13 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.07,"logp":0.79,"tpsa":55.32,"ha":15,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":82,"number":169},"2":{"id":18135,"smiles":"Cc1nc(C(=O)N2CCCC2)c(C)s1","cmpd_id":563,"prot_id":18148,"protein_code":"NUDT5A-x0171_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0171_2_apo_9ctjMk2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -4.5150 2.1220 1.8060 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2700 -0.1560 1.9970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3650 4.5700 0.7090 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4330 0.9500 2.3750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5670 2.9700 2.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4940 4.3810 1.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8870 5.4420 4.3080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7500 6.6970 4.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1730 7.7250 3.5140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5230 6.8860 2.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8170 2.3990 3.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7480 2.9850 4.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6310 5.4720 2.8320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2400 0.7740 3.6560 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 5 1 1 0\n 6 5 1 0\n 6 3 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 5 2 0\n 12 11 1 0\n 13 7 1 0\n 13 6 1 0\n 13 10 1 0\n 14 11 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.08,"logp":2,"tpsa":33.2,"ha":14,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":76,"number":171},"3":{"id":18138,"smiles":"CN(C[C@H]1CCOC1)c1ncncc1Cl","cmpd_id":564,"prot_id":18151,"protein_code":"NUDT5A-x0176_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0176_1_apo_2eZIexK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -3.9560 4.1370 3.8900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2550 4.6320 3.3690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3400 6.6210 1.5870 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8890 5.1450 4.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8810 6.4280 3.3860 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.7020 7.3310 3.7980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0030 7.6470 2.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6270 6.1410 1.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6800 2.7730 4.1230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3630 1.2970 5.4350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8960 0.3590 4.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3060 1.6080 3.5450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6750 2.5590 5.0940 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9310 0.1580 4.9390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5010 1.5140 2.3250 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 1 1\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 5 1 0\n 8 3 1 0\n 9 1 1 0\n 12 11 1 0\n 12 9 2 0\n 13 10 2 0\n 13 9 1 0\n 14 11 2 0\n 14 10 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.08,"logp":1.6,"tpsa":38.25,"ha":15,"hacc":4,"hdon":0,"rots":3,"rings":2,"velec":82,"number":176},"4":{"id":18148,"smiles":"c1nc(N2CCC2)c2[nH]cnc2n1","cmpd_id":127,"prot_id":18161,"protein_code":"NUDT5A-x0262_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0262_3_apo_65PhH1c.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 15 0 0 0 0 0 0 0 0999 V2000\n -3.0990 4.3000 2.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2950 6.2840 2.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2110 4.9920 2.1760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2470 5.5350 3.1150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8750 3.0160 3.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8150 1.4980 4.9030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4230 0.6430 3.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9320 0.4650 2.0380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6310 1.9430 3.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9550 2.7850 4.4270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5090 0.3770 4.5480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2440 -0.2500 2.9390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5790 1.8160 2.0480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 1 1 0\n 4 2 1 0\n 5 1 1 0\n 9 7 1 0\n 9 5 2 0\n 10 6 2 0\n 10 5 1 0\n 11 7 2 0\n 11 6 1 0\n 12 8 2 0\n 12 7 1 0\n 13 9 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.09,"logp":0.56,"tpsa":57.7,"ha":13,"hacc":4,"hdon":1,"rots":1,"rings":3,"velec":66,"number":262},"5":{"id":18153,"smiles":"Cc1cccc(Nc2ncnc3c2cnn3C)c1","cmpd_id":313,"prot_id":18166,"protein_code":"NUDT5A-x0286_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0286_4_apo_jKaULXK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n -0.6540 4.2530 4.7580 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9840 8.5000 2.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9670 7.5260 3.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9510 1.4280 4.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1940 2.5750 3.9980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1100 6.4180 3.7870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8280 7.6950 4.9400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8600 6.7370 5.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0320 5.6060 5.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1420 5.4340 4.8390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6320 3.8580 3.8450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1330 4.1360 2.0640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2470 2.1910 3.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4410 0.1100 2.6070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1190 4.6480 2.8410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7600 2.9300 2.1220 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5560 0.9090 3.3760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7880 0.4300 4.4070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 5 4 1 0\n 6 3 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 1 1 0\n 10 6 1 0\n 10 9 2 0\n 11 5 2 0\n 11 1 1 0\n 13 5 1 0\n 15 12 2 0\n 15 11 1 0\n 16 13 2 0\n 16 12 1 0\n 17 14 1 0\n 17 13 1 0\n 18 17 1 0\n 18 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.12,"logp":2.42,"tpsa":55.63,"ha":18,"hacc":5,"hdon":1,"rots":2,"rings":3,"velec":90,"number":286},"6":{"id":18157,"smiles":"CC(C)N(C)c1ncnc2c1cnn2C","cmpd_id":130,"prot_id":18170,"protein_code":"NUDT5A-x0299_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0299_4_apo_qL3BYkk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -0.9350 4.6290 4.7690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7360 5.7870 3.3710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2290 5.9740 4.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1150 7.2470 4.3150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1510 3.6980 5.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9280 4.0710 3.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4280 4.3570 1.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3890 2.2960 2.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6740 0.1540 2.4900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1530 1.4760 4.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3850 2.6870 3.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4750 4.8840 2.8640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9340 3.0980 1.9380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6810 0.9740 3.1670 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9260 0.4790 4.1930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 1 1 0\n 6 1 1 0\n 11 10 1 0\n 11 8 1 0\n 11 6 2 0\n 12 7 2 0\n 12 6 1 0\n 13 8 2 0\n 13 7 1 0\n 14 9 1 0\n 14 8 1 0\n 15 14 1 0\n 15 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.1,"logp":1.12,"tpsa":46.84,"ha":16,"hacc":6,"hdon":1,"rots":3,"rings":2,"velec":86,"number":299},"7":{"id":18158,"smiles":"Cc1nsc(N2CCO[C@@H](C)[C@H]2C)n1","cmpd_id":566,"prot_id":18171,"protein_code":"NUDT5A-x0319_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0319_1_apo_ET734rK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -2.0930 4.1930 3.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1740 6.3470 3.6130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1880 6.8280 3.4440 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2330 5.7650 3.3110 C 0 0 2 0 0 0 0 0 0 0 0 0\n -2.5260 6.4720 3.0760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0640 5.3330 3.9980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6340 4.5500 4.2530 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.4650 4.8070 5.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5110 2.8560 3.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6040 0.9570 3.4120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6120 0.1930 2.6530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5090 2.3560 3.1570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7620 0.3990 4.2880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7170 1.5920 4.9020 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 4 2 1 1\n 5 3 1 0\n 6 1 1 0\n 6 5 1 0\n 7 1 1 0\n 7 4 1 0\n 7 8 1 1\n 9 1 1 0\n 11 10 1 0\n 12 10 1 0\n 12 9 2 0\n 13 10 2 0\n 14 13 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":1.46,"tpsa":38.25,"ha":14,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":78,"number":319},"8":{"id":18162,"smiles":"CC(C)C(=O)Nc1nnn(C)n1","cmpd_id":567,"prot_id":18175,"protein_code":"NUDT5A-x0320_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0320_3_apo_qu1huFH.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -2.1000 4.0710 3.7420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6740 6.6350 2.5080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5690 4.9090 2.1690 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0450 6.5570 3.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0240 7.6630 2.6930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6690 5.1280 2.9620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4900 2.7320 3.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4800 -0.0050 2.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8940 1.6720 4.5160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5570 0.5950 4.2560 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5370 0.9140 3.3360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5310 2.2310 2.9870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 3 2 0\n 6 1 1 0\n 6 4 1 0\n 7 1 1 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 11 8 1 0\n 12 11 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.1,"logp":-0.2,"tpsa":72.7,"ha":12,"hacc":5,"hdon":1,"rots":2,"rings":1,"velec":66,"number":320},"9":{"id":18167,"smiles":"Cc1nsc(N2CCCNCC2)n1","cmpd_id":568,"prot_id":18180,"protein_code":"NUDT5A-x0333_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0333_4_apo_v1qMY5T.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n -2.7080 0.5070 4.3600 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5690 0.3480 2.7440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4860 1.0880 3.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2440 2.9070 3.8960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7910 5.2970 3.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6580 6.1140 2.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3260 6.8940 2.3610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3550 5.6670 3.8500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4810 4.5760 4.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2700 2.4460 3.1370 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7850 4.2080 3.9380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4520 6.8840 3.5670 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5890 1.6220 4.9360 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 6 1 0\n 9 8 1 0\n 10 4 2 0\n 10 3 1 0\n 11 9 1 0\n 11 5 1 0\n 11 4 1 0\n 12 8 1 0\n 12 7 1 0\n 13 4 1 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.09,"logp":0.65,"tpsa":41.05,"ha":13,"hacc":5,"hdon":1,"rots":1,"rings":2,"velec":72,"number":333},"10":{"id":18170,"smiles":"CCN(CC)c1cc(C)nc2ncnn12","cmpd_id":133,"prot_id":18183,"protein_code":"NUDT5A-x0339_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0339_3_apo_eFH6vYt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -2.2100 4.5520 3.3530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2660 5.3760 2.2450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7760 5.0240 2.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7560 5.6650 4.2760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3410 6.1360 3.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3370 3.2250 3.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2290 2.3220 3.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3220 0.9750 3.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2480 0.0720 2.9360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7320 1.3170 5.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3240 2.2920 6.5260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6060 0.4470 4.6410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9380 1.0920 6.3190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6650 3.3120 5.6890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5770 2.7020 4.8710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 1 0\n 6 1 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 12 10 1 0\n 12 8 2 0\n 13 10 2 0\n 13 11 1 0\n 14 11 2 0\n 15 10 1 0\n 15 6 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.13,"logp":1.28,"tpsa":46.32,"ha":15,"hacc":5,"hdon":0,"rots":3,"rings":2,"velec":80,"number":339},"11":{"id":18172,"smiles":"CC(=O)N1CCC[C@@H](C(N)=O)C1","cmpd_id":569,"prot_id":18185,"protein_code":"NUDT5A-x0392_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0392_1_apo_PALKu9A.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -2.8770 4.8280 3.6070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5860 7.0390 2.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4310 5.5600 2.0450 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3730 5.7720 2.6560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2540 5.2510 4.8960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0770 4.3090 5.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6510 2.9060 5.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4170 2.4200 4.1890 C 0 0 2 0 0 0 0 0 0 0 0 0\n -3.4490 3.4640 3.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2500 1.1610 4.4540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4000 0.7390 5.7560 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8060 0.5280 3.5370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 4 3 2 0\n 4 2 1 0\n 5 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 10 1 1\n 9 8 1 0\n 9 1 1 0\n 11 10 1 0\n 12 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.11,"logp":-0.27,"tpsa":63.4,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":68,"number":392},"12":{"id":18174,"smiles":"COC(=O)Nc1sc(C)nc1-c1ccccc1","cmpd_id":570,"prot_id":18187,"protein_code":"NUDT5A-x0403_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0403_1_apo_ts4FiSK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -1.8530 3.1430 5.3570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5450 2.8830 8.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2940 3.3390 7.0460 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1290 2.4490 6.3390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2490 6.7030 2.0880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3710 5.3510 2.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7740 2.5530 4.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2900 1.1800 3.1060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0600 0.0910 2.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3690 3.2210 3.3700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2350 4.6530 2.9510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9920 5.3570 3.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8960 6.7030 2.6600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0260 7.3780 2.1890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2340 2.3890 2.6150 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2050 1.2510 6.5950 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3470 0.8830 4.5110 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 1 1 0\n 4 3 1 0\n 6 5 2 0\n 7 1 1 0\n 9 8 1 0\n 10 7 2 0\n 11 10 1 0\n 11 6 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 5 1 0\n 15 10 1 0\n 15 8 2 0\n 16 4 2 0\n 17 8 1 0\n 17 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":280.03,"logp":3.59,"tpsa":51.22,"ha":18,"hacc":5,"hdon":2,"rots":2,"rings":2,"velec":94,"number":403},"13":{"id":18180,"smiles":"CC(C)c1ncc(Cl)c(C(N)=O)n1","cmpd_id":418,"prot_id":18193,"protein_code":"NUDT5A-x0463_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0463_4_apo_ECUQWtJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -2.3620 5.1340 4.2470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3980 6.1120 1.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3270 0.2730 5.4470 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2000 5.3020 2.6780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3270 4.5190 2.0460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2490 4.4250 3.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5240 4.4930 5.0560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5530 3.1230 5.1950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5280 2.4260 4.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8160 0.9530 4.5640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3620 3.0660 3.5640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7070 0.4370 3.6440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4260 2.4710 6.2480 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 4 1 0\n 6 1 2 0\n 7 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 10 3 2 0\n 11 9 2 0\n 11 6 1 0\n 12 10 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.05,"logp":1.35,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":70,"number":463},"14":{"id":18181,"smiles":"CNc1nccc(OC)n1","cmpd_id":571,"prot_id":18194,"protein_code":"NUDT5A-x0469_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0469_1_apo_K35s4Hl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -4.1000 -0.0840 3.1120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1090 0.0960 2.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8180 1.4960 6.0080 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3780 0.9510 3.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8410 3.2080 3.5510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8770 3.0570 4.5000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7210 1.7290 5.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0890 2.4550 6.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6020 2.2120 3.0890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4500 0.6300 4.5800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 3 1 0\n 8 3 1 0\n 9 5 1 0\n 9 4 2 0\n 10 7 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.07,"logp":0.53,"tpsa":47.04,"ha":10,"hacc":4,"hdon":1,"rots":2,"rings":1,"velec":54,"number":469},"15":{"id":18186,"smiles":"NC(=O)N1CCN(C(=O)c2ccco2)CC1","cmpd_id":572,"prot_id":18199,"protein_code":"NUDT5A-x0525_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0525_3_apo_ft9IW7f.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 0.8140 6.6580 5.3450 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1950 6.2790 6.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4910 6.9400 7.2230 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0430 3.9060 5.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7240 2.5930 5.7320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3330 3.8460 4.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8570 5.1810 4.7950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6520 1.3400 4.7970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6670 1.1170 3.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3030 1.8720 2.7790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1320 0.9590 2.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9590 -0.2320 2.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8550 5.0380 5.8650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9780 2.5850 4.9240 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3970 0.4120 5.5580 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0750 -0.1680 3.6750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 5 4 1 0\n 7 6 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 7 1 0\n 13 4 1 0\n 13 2 1 0\n 14 8 1 0\n 14 6 1 0\n 14 5 1 0\n 15 8 2 0\n 16 12 1 0\n 16 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.1,"logp":0.12,"tpsa":79.78,"ha":16,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":86,"number":525},"16":{"id":18189,"smiles":"Cc1n[nH]c(C)c1S(=O)(=O)N(C)C","cmpd_id":57,"prot_id":18202,"protein_code":"NUDT5A-x0552_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0552_2_apo_CWa7xGy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -6.4080 3.5540 2.4410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7250 3.4300 3.1080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0320 4.3990 2.3050 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5470 3.6140 1.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3340 2.2120 3.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7250 0.8750 2.9270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7740 0.4250 1.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2110 1.9850 4.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3140 2.9700 4.7870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9220 -0.0270 3.4530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0110 0.6630 4.2020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2000 4.2790 4.4430 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9440 3.6990 3.1640 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 8 1 0\n 10 6 2 0\n 11 10 1 0\n 11 8 1 0\n 13 1 1 0\n 13 12 2 0\n 13 5 1 0\n 13 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.07,"logp":0.28,"tpsa":66.06,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":74,"number":552},"17":{"id":18191,"smiles":"Cc1n[nH]c(C)c1-c1ccccc1N","cmpd_id":575,"prot_id":18204,"protein_code":"NUDT5A-x0554_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0554_1_apo_8GE6k9K.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -5.0430 5.7270 1.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4890 3.5200 0.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7000 4.4110 1.3200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0830 1.5880 3.0750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8630 5.1920 3.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8880 5.4030 4.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5780 4.0420 2.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2180 2.7340 3.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9480 2.5830 3.7600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5070 1.3350 4.2060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3390 0.2190 4.0740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6120 0.3300 3.5240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1360 6.1810 2.4900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3690 1.6580 2.5630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 5 2 0\n 7 3 1 0\n 8 7 1 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 4 1 0\n 13 5 1 0\n 13 1 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":187.11,"logp":2.28,"tpsa":54.7,"ha":14,"hacc":2,"hdon":2,"rots":1,"rings":2,"velec":72,"number":554},"18":{"id":18196,"smiles":"c1csc(-c2nnc[nH]2)n1","cmpd_id":64,"prot_id":18209,"protein_code":"NUDT5A-x0574_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0574_4_apo_TKCEDq4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -2.1250 3.9110 4.1540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1320 4.5110 4.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4660 3.6560 5.7880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1400 2.6000 4.3790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9790 1.6520 3.7410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5350 0.7140 2.5020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0360 0.3300 4.0750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9840 -0.2150 3.3230 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9110 1.9180 2.7490 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0310 2.0280 5.5620 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 2 0\n 5 4 1 0\n 7 5 2 0\n 8 7 1 0\n 8 6 2 0\n 9 6 1 0\n 9 5 1 0\n 10 4 1 0\n 10 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.02,"logp":0.93,"tpsa":54.46,"ha":10,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":50,"number":574},"19":{"id":18198,"smiles":"CC(=O)Nc1cc(C)n[nH]1","cmpd_id":89,"prot_id":18211,"protein_code":"NUDT5A-x0605_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0605_1_apo_xEuLmmn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -2.1080 2.2180 4.6050 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7050 4.0200 5.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6250 4.3570 3.9910 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8940 3.5870 4.6220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1380 1.5950 3.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0380 1.9490 2.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7260 0.7080 2.5430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7890 0.4090 1.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2770 -0.2560 3.3240 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3530 0.2870 4.0910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 2 0\n 4 1 1 0\n 4 2 1 0\n 5 1 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 7 2 0\n 10 9 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.07,"logp":0.68,"tpsa":57.78,"ha":10,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":54,"number":605},"20":{"id":18200,"smiles":"CCNC(=O)N1CCN(C(C)=O)CC1","cmpd_id":506,"prot_id":18213,"protein_code":"NUDT5A-x0627_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0627_2_apo_6CE9WAa.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 1.6260 5.7240 4.0810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0210 5.3560 4.1380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1460 6.2240 2.4150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8430 5.8180 3.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3820 5.6350 3.4720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7260 4.3420 3.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7300 3.5420 4.0970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0780 2.7120 5.6680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0720 3.7750 5.1590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7250 1.0550 4.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8400 0.6410 3.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6190 4.8110 4.1960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0700 2.3290 4.5850 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3870 0.2620 5.4830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 1 0\n 5 3 2 0\n 5 1 1 0\n 7 6 1 0\n 9 8 1 0\n 11 10 1 0\n 12 9 1 0\n 12 6 1 0\n 12 5 1 0\n 13 10 1 0\n 13 7 1 0\n 13 8 1 0\n 14 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.13,"logp":-0.12,"tpsa":52.65,"ha":14,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":80,"number":627},"21":{"id":18204,"smiles":"CCNc1ccc(C)nn1","cmpd_id":402,"prot_id":18217,"protein_code":"NUDT5A-x0637_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0637_3_apo_WbQXeCx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -4.1720 0.2500 3.5650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9570 -0.1710 1.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9110 0.7920 2.4190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3080 1.0370 4.3040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0700 2.4160 3.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1230 3.1120 4.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4260 2.4620 5.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3180 3.1610 6.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7080 1.1440 6.0420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5880 0.4380 5.3880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 4 1 0\n 10 9 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.1,"logp":1.22,"tpsa":37.81,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":637},"22":{"id":18206,"smiles":"Cc1ccc(C(N)=O)c(F)c1","cmpd_id":576,"prot_id":18219,"protein_code":"NUDT5A-x0651_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0651_1_apo_zmnaQEb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -4.0770 -0.0050 2.9870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8330 6.4990 2.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5440 0.2910 4.6330 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9880 5.0320 3.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9990 4.3550 3.7270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0970 2.9840 3.9560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1870 2.2430 3.4570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2400 0.7850 3.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1940 2.9210 2.7240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1090 4.3300 2.5000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2120 2.2440 2.2010 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 3 2 0\n 8 1 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":153.06,"logp":1.23,"tpsa":43.09,"ha":11,"hacc":1,"hdon":1,"rots":1,"rings":1,"velec":58,"number":651},"23":{"id":18207,"smiles":"Cn1cc(Oc2ncncc2Cl)cn1","cmpd_id":196,"prot_id":18220,"protein_code":"NUDT5A-x0673_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0673_1_apo_DigKuyT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -3.1980 7.1440 2.3500 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4220 8.3440 1.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3470 3.7460 2.3180 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0650 5.8480 1.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0330 5.0860 2.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6890 2.7000 2.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0620 1.9970 4.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5430 0.4090 3.5660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1550 1.3820 2.8020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6940 5.9780 3.4410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6100 3.0340 3.7420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4840 0.6870 4.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1700 7.2290 3.3120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3770 0.9260 1.7160 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 3 1 0\n 5 4 2 0\n 6 3 1 0\n 9 8 1 0\n 9 6 2 0\n 10 5 1 0\n 11 7 2 0\n 11 6 1 0\n 12 8 2 0\n 12 7 1 0\n 13 10 2 0\n 13 1 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.03,"logp":1.66,"tpsa":52.83,"ha":14,"hacc":5,"hdon":0,"rots":2,"rings":2,"velec":72,"number":673},"24":{"id":18211,"smiles":"CCNCc1cn(C)nn1","cmpd_id":577,"prot_id":18224,"protein_code":"NUDT5A-x0681_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0681_1_apo_C0cEPEv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -0.1970 4.0500 5.1030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8670 5.1670 4.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6310 5.2980 5.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3590 4.1270 4.1470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0920 2.8380 4.0370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1560 2.5010 3.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4440 0.3190 2.8330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4490 1.1560 3.4890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5960 0.7330 4.4950 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7980 1.7040 4.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 1 0\n 6 5 2 0\n 8 7 1 0\n 8 6 1 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":172.08,"logp":0.18,"tpsa":42.74,"ha":11,"hacc":5,"hdon":2,"rots":3,"rings":1,"velec":62,"number":681},"25":{"id":18214,"smiles":"COc1ccc2cn[nH]c(=O)c2c1OC","cmpd_id":578,"prot_id":18227,"protein_code":"NUDT5A-x0685_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0685_3_apo_ekyctVo.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -2.8580 0.6020 4.3140 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0500 7.3140 3.4080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3690 6.9320 3.8150 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5330 5.5600 4.0830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 4.9870 5.1780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9710 3.6290 5.4470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8420 2.8200 4.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0490 1.4220 4.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4510 2.4060 2.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5610 3.3490 3.5330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3920 4.7670 3.2510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4070 5.6870 2.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5220 1.0710 3.2570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1040 2.6070 1.7550 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9930 5.4090 2.1730 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 1 2 0\n 10 9 1 0\n 10 7 1 0\n 11 10 2 0\n 11 4 1 0\n 13 9 1 0\n 13 1 1 0\n 14 9 2 0\n 15 11 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.07,"logp":0.94,"tpsa":64.21,"ha":15,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":78,"number":685},"26":{"id":18240,"smiles":"Nc1nccc(C(F)(F)F)n1","cmpd_id":1533,"prot_id":18253,"protein_code":"NUDT5A-x1072_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1072_4_apo_c3Gm5zA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -3.9240 2.1160 2.7910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0650 4.4030 2.9230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0450 2.9490 3.3980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8430 0.8140 3.2320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1390 1.2530 4.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1230 2.5960 4.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2000 4.6530 1.9610 F 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7530 5.2710 3.8980 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2760 4.8020 2.4590 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6660 -0.0830 2.6130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9620 0.3400 4.2190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 6 3 1 0\n 8 2 1 0\n 9 2 1 0\n 10 4 1 0\n 11 5 1 0\n 11 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":163.04,"logp":1.08,"tpsa":51.8,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":60,"number":1072},"27":{"id":18244,"smiles":"O=c1[nH]cnc2cc(F)ccc12","cmpd_id":1534,"prot_id":18257,"protein_code":"NUDT5A-x1078_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1078_4_apo_TvriHwm.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.7330 1.8420 1.7730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3400 5.0110 2.8800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4340 0.4500 4.9040 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4990 4.6070 3.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4340 3.2600 4.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0860 4.0700 2.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9870 2.7140 2.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6460 0.5400 2.1180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1710 2.3130 3.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0950 0.9090 3.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4240 6.3050 2.4710 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8740 0.0280 3.1730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 2 1 0\n 7 6 2 0\n 7 1 1 0\n 8 1 2 0\n 9 7 1 0\n 9 5 2 0\n 10 9 1 0\n 10 3 2 0\n 11 2 1 0\n 12 10 1 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.06,"tpsa":45.75,"ha":12,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1078},"28":{"id":18247,"smiles":"Fc1cnc2[nH]ccc2c1","cmpd_id":1535,"prot_id":18260,"protein_code":"NUDT5A-x1083_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1083_3_apo_9wnu9h2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -2.5530 0.3060 4.8320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8060 2.6190 5.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7620 1.2180 5.4060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4590 0.8260 3.9500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1340 1.0200 2.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6730 2.3090 2.7000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6030 2.2200 3.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7320 3.1550 4.2470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9050 3.3750 5.7780 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4040 0.1010 3.2100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 4 2 0\n 8 7 1 0\n 8 2 2 0\n 9 2 1 0\n 10 5 1 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":136.04,"logp":1.7,"tpsa":28.68,"ha":10,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":50,"number":1083},"29":{"id":18251,"smiles":"FC(F)c1nnc2c(C(F)(F)F)cccn12","cmpd_id":1536,"prot_id":18264,"protein_code":"NUDT5A-x1093_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1093_4_apo_l9mQwEl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -3.2790 2.3910 3.8400 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6300 4.3070 5.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7570 4.0170 4.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3270 4.9830 4.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3780 4.6530 3.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8470 3.3740 3.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2300 2.6810 4.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5010 1.0440 3.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4960 0.2210 3.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4270 5.6100 6.0250 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5780 3.8310 5.5780 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3420 0.4130 1.9430 F 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7160 0.7010 3.4220 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8210 3.8180 7.1050 F 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8820 1.5050 5.3900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6450 0.5360 4.9100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 1 1 0\n 7 3 1 0\n 7 1 1 0\n 8 1 1 0\n 9 8 1 0\n 9 12 1 0\n 11 2 1 0\n 13 9 1 0\n 14 2 1 0\n 15 7 2 0\n 16 15 1 0\n 16 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.03,"logp":2.69,"tpsa":30.19,"ha":16,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":86,"number":1093},"30":{"id":18255,"smiles":"N#Cc1c(C(F)(F)F)cn2ccnc2c1Cl","cmpd_id":1537,"prot_id":18268,"protein_code":"NUDT5A-x1211_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1211_4_apo_JvlT7yI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -2.9990 0.3970 4.4110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7400 2.4920 4.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7100 1.6840 4.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0970 0.1820 3.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4780 1.3050 2.9270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5200 3.5810 2.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5290 4.3740 3.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3670 5.8310 2.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6240 3.8000 4.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5890 4.5290 5.0620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4680 6.2580 2.1130 F 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1350 6.8430 3.6520 F 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3660 5.9440 1.8950 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5930 2.2710 3.2810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2350 5.1510 5.5360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7640 1.7820 5.9500 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 5 4 2 0\n 7 6 2 0\n 8 7 1 0\n 8 11 1 0\n 9 7 1 0\n 9 2 2 0\n 10 9 1 0\n 12 8 1 0\n 13 8 1 0\n 14 6 1 0\n 14 5 1 0\n 14 3 1 0\n 15 10 3 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245,"logp":2.88,"tpsa":41.09,"ha":16,"hacc":3,"hdon":0,"rots":0,"rings":2,"velec":82,"number":1211},"31":{"id":18259,"smiles":"Oc1ncnc2cccc(F)c12","cmpd_id":1538,"prot_id":18272,"protein_code":"NUDT5A-x1212_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1212_4_apo_D0YYCLz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.6020 1.9310 1.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2450 3.3260 4.3440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4060 0.3730 4.9300 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3220 4.6600 4.0250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1790 5.0950 2.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9280 4.1940 2.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8490 2.7890 2.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5500 0.6370 2.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0930 0.9340 3.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0250 2.3460 3.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3650 2.9540 5.2860 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8440 0.0630 3.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 1 2 0\n 8 1 1 0\n 9 3 1 0\n 10 9 2 0\n 10 7 1 0\n 10 2 1 0\n 11 2 1 0\n 12 9 1 0\n 12 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1212},"32":{"id":18263,"smiles":"Oc1ncnc2ccc(F)cc12","cmpd_id":1539,"prot_id":18276,"protein_code":"NUDT5A-x1213_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1213_4_apo_iQ9eLrd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.6930 1.7840 1.7650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2400 4.3710 4.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3980 0.2800 4.8860 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1250 4.8790 2.9950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9380 4.0260 2.2820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9010 2.6220 2.5430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6300 0.5180 2.1650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2100 3.0520 4.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0650 2.1730 3.5840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1360 0.7900 3.8630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3990 5.2400 4.5870 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9160 -0.0560 3.1800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 6 1 2 0\n 7 1 1 0\n 8 2 2 0\n 9 8 1 0\n 9 6 1 0\n 10 9 2 0\n 10 3 1 0\n 11 2 1 0\n 12 10 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1213},"33":{"id":18267,"smiles":"CSc1nc(C(F)(F)F)cc(=O)n1C","cmpd_id":1540,"prot_id":18280,"protein_code":"NUDT5A-x1214_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1214_4_apo_5KjViIv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -2.8000 2.2680 4.0720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6680 5.3220 1.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3220 0.2760 5.0090 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6670 2.9540 3.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6540 2.9030 4.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9050 1.0430 2.8050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0650 0.3890 2.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1580 0.2870 3.6100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0380 0.8790 4.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9810 0.6910 0.7320 F 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1270 -0.9580 2.1010 F 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2980 0.8320 2.4250 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6940 2.3910 2.5830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4000 4.6750 2.9280 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 5 1 1 0\n 7 6 1 0\n 7 10 1 0\n 8 6 2 0\n 9 8 1 0\n 9 3 2 0\n 9 1 1 0\n 11 7 1 0\n 12 7 1 0\n 13 6 1 0\n 13 4 2 0\n 14 4 1 0\n 14 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.02,"logp":1.52,"tpsa":34.89,"ha":14,"hacc":4,"hdon":0,"rots":1,"rings":1,"velec":78,"number":1214}},"cached_mol_lists":{},"all_mol_lists":{"220881":[{"id":18220,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18233,"protein_code":"NUDT5A-x1004_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1004_4_apo_hYlijTI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -11.1920 -8.6800 -9.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.4820 -10.4380 -8.7400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8820 -10.4240 -8.4640 O 0 0 0 0 0 0 0 0 0 0 0 0\n -12.6830 -11.2590 -9.7850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9890 -9.2060 -5.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7720 -8.6960 -5.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2320 -9.1550 -4.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9380 -10.1150 -3.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6420 -10.1640 -4.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -13.7090 -12.2510 -10.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.9420 -10.3720 -10.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.9350 -10.7260 -12.2000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4080 -9.8890 -13.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8610 -8.6650 -12.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7960 -8.2890 -11.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.3100 -9.1250 -10.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4890 -9.3820 -8.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5550 -8.7370 -6.9720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1300 -10.6170 -3.7970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 1 1 0\n 16 15 2 0\n 17 1 1 0\n 17 3 2 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1004},{"id":18224,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18237,"protein_code":"NUDT5A-x1024_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1024_4_apo_pgDwPeW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -11.0860 -8.6940 -9.2230 N 0 0 0 0 0 0 0 0 0 0 0 0\n -12.9760 -10.9790 -8.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9620 -10.5470 -8.3980 O 0 0 0 0 0 0 0 0 0 0 0 0\n -12.7230 -11.3130 -10.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1170 -9.2680 -5.7670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9730 -8.7410 -5.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6010 -9.2190 -3.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.3930 -10.2040 -3.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8650 -10.2580 -5.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.1480 -11.5320 -10.5260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.8780 -10.3250 -10.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.8660 -10.5900 -12.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.3250 -9.7040 -13.2200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7630 -8.5110 -12.8140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6900 -8.2200 -11.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2160 -9.0980 -10.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4880 -9.4450 -8.2190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5680 -8.7750 -6.9910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5170 -10.7270 -3.8520 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 1 1 0\n 16 15 2 0\n 17 1 1 0\n 17 3 2 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1024},{"id":18228,"smiles":"N#Cc1ccc(NC(=O)Nc2cccnc2)cc1","cmpd_id":1553,"prot_id":18241,"protein_code":"NUDT5A-x1028_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1028_4_apo_luOapot.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -10.8250 -8.9800 -7.3960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5590 -9.5270 -8.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9130 -10.5350 -8.8180 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3080 -9.4100 -6.1890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4930 -8.4090 -13.2960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9110 -9.6110 -13.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4860 -10.2310 -11.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.3180 -8.5110 -5.9030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5380 -8.6280 -4.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7010 -9.6580 -3.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7430 -9.6320 -3.0230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7150 -10.6290 -4.1890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5520 -10.5020 -5.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.0460 -9.0050 -11.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.5670 -8.0960 -11.9560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9140 -9.5090 -2.2990 N 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1060 -8.7720 -9.6770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4200 -10.5310 -12.8180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 13 4 1 0\n 13 12 2 0\n 14 7 1 0\n 15 14 2 0\n 15 5 1 0\n 16 11 3 0\n 17 14 1 0\n 17 2 1 0\n 18 6 1 0\n 18 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.6,"tpsa":77.81,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1028},{"id":18232,"smiles":"O=C(Nc1cccnc1)N[C@H]1CCNC1","cmpd_id":1550,"prot_id":18245,"protein_code":"NUDT5A-x1039_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1039_4_apo_OPS58jq.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -10.5920 -8.8290 -9.6880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5540 -9.6070 -8.5350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9020 -10.7910 -8.5650 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2200 -9.3120 -10.9080 C 0 0 1 0 0 0 0 0 0 0 0 0\n -11.0230 -8.3080 -12.0410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1830 -9.1540 -13.3020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5420 -10.6080 -11.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7660 -9.4980 -6.0940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0020 -8.7400 -5.2020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7990 -9.1900 -3.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4130 -10.3860 -3.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3610 -10.6910 -5.5800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8020 -10.5540 -12.9070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9210 -8.9860 -7.4200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1940 -11.1230 -4.3020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 1\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 6 1 0\n 13 7 1 0\n 14 8 1 0\n 14 2 1 0\n 15 12 2 0\n 15 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.12,"logp":0.56,"tpsa":66.05,"ha":15,"hacc":3,"hdon":3,"rots":2,"rings":2,"velec":80,"number":1039},{"id":18236,"smiles":"O=C(Nc1cccnc1)N[C@@H]1CCSC1","cmpd_id":1545,"prot_id":18249,"protein_code":"NUDT5A-x1066_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1066_4_apo_p116c16.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -11.0600 -8.6540 -9.6960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8140 -9.5320 -8.6520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6650 -10.7280 -8.8200 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6020 -8.8820 -11.0290 C 0 0 2 0 0 0 0 0 0 0 0 0\n -11.2960 -7.8660 -11.9320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.0720 -8.2510 -13.3310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.0220 -10.2200 -11.5590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5290 -9.5660 -6.2220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.3120 -9.4030 -5.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0860 -10.1150 -4.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0870 -10.9630 -3.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.5280 -10.4410 -5.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7350 -8.9060 -7.4120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -11.3070 -11.1410 -4.4930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9270 -10.0270 -13.3470 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 1\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 8 1 0\n 13 2 1 0\n 14 12 2 0\n 14 11 1 0\n 15 7 1 0\n 15 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.08,"logp":1.71,"tpsa":54.02,"ha":15,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1066},{"id":18271,"smiles":"C#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1541,"prot_id":18284,"protein_code":"NUDT5A-x1217_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1217_4_apo_jRB2adq.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -11.0840 -8.8630 -9.8470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9540 -9.7600 -8.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8480 -10.9720 -8.9390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1240 -9.1870 -11.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4430 -10.2380 -4.4910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2120 -10.0390 -3.8360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1670 -9.8420 -3.3460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.6540 -9.5630 -5.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8650 -10.4660 -11.6910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9260 -10.6000 -13.0630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2220 -9.4710 -13.8400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4260 -8.1220 -12.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8350 -9.7740 -6.3570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.8280 -10.6390 -5.8540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.5960 -11.3040 -4.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3980 -11.1080 -3.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4710 -8.2470 -13.3360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9590 -9.1090 -7.5670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 6 3 0\n 8 5 2 0\n 9 4 2 0\n 10 9 1 0\n 11 10 2 0\n 12 4 1 0\n 13 8 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 5 1 0\n 17 12 2 0\n 17 11 1 0\n 18 2 1 0\n 18 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.09,"logp":2.71,"tpsa":54.02,"ha":18,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1217},{"id":18275,"smiles":"O=C(Nc1cccnc1)Nc1cccc(Br)c1","cmpd_id":1547,"prot_id":18288,"protein_code":"NUDT5A-x1219_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1219_4_apo_lDUNPHW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -10.7410 -9.1300 -7.5550 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.1870 -10.0720 -4.4140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8050 -10.9950 -8.9550 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0070 -11.0760 -3.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2010 -8.0770 -12.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4270 -9.4060 -5.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1390 -11.4290 -4.6530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4160 -10.7960 -5.8540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5550 -9.7880 -6.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8160 -9.7700 -8.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.0320 -9.1850 -11.1860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8850 -10.4760 -11.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8990 -10.5770 -13.1320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.0630 -9.4080 -13.8940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9520 -8.8680 -9.8350 N 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2170 -8.1630 -13.3680 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5990 -9.6010 -3.4100 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 6 2 1 0\n 7 4 1 0\n 8 7 2 0\n 9 8 1 0\n 9 6 2 0\n 9 1 1 0\n 10 3 2 0\n 10 1 1 0\n 11 5 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 11 1 0\n 15 10 1 0\n 16 14 2 0\n 16 5 1 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1219},{"id":18278,"smiles":"N#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1542,"prot_id":18291,"protein_code":"NUDT5A-x1223_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1223_3_apo_11XOxL7.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -10.5500 -8.6970 -6.6080 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8470 -9.3100 -7.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.7840 -10.1220 -7.9420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0950 -9.3810 -5.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1430 -9.0640 -12.1990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.6750 -8.1900 -13.1060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7410 -8.5770 -10.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9100 -8.9430 -4.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4860 -9.5460 -3.7370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2790 -10.5640 -3.1880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8280 -10.4290 -4.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.2300 -9.4740 -10.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0930 -10.8130 -10.3790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5270 -11.2710 -11.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.0520 -10.4090 -12.5530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4340 -11.0180 -3.7600 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9890 -8.9580 -8.8200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -12.1190 -7.5520 -13.8610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 4 1 0\n 12 7 1 0\n 13 12 2 0\n 14 13 1 0\n 15 5 1 0\n 15 14 2 0\n 16 11 2 0\n 16 10 1 0\n 17 12 1 0\n 17 2 1 0\n 18 6 3 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.61,"tpsa":81.3,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1223},{"id":18283,"smiles":"COc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1548,"prot_id":18296,"protein_code":"NUDT5A-x1242_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1242_4_apo_bJPV5cw.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -10.4690 -9.0870 -7.3720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1990 -9.2570 -3.4320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9750 -10.4220 -3.4430 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0870 -10.4580 -4.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4210 -9.3010 -13.6610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1700 -7.9620 -11.8140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2530 -9.6780 -5.4050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0570 -11.3980 -3.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2050 -11.5440 -4.6310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.3890 -10.7860 -5.7910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3990 -9.8590 -6.1780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8830 -9.6200 -8.6030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9020 -9.0700 -10.9930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9170 -10.3550 -11.5470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1850 -10.4730 -12.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5800 -8.7860 -9.6760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4270 -8.0550 -13.1400 N 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4590 -10.7070 -8.7340 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 7 4 2 0\n 8 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 1 1 0\n 11 7 1 0\n 12 1 1 0\n 13 6 1 0\n 14 13 2 0\n 15 14 1 0\n 15 5 2 0\n 16 13 1 0\n 16 12 1 0\n 17 6 2 0\n 17 5 1 0\n 18 12 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":1242},{"id":18287,"smiles":"S=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":1549,"prot_id":18300,"protein_code":"NUDT5A-x1291_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1291_4_apo_NmVy8S5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -10.1300 -8.6950 -7.2320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3990 -9.4390 -8.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0000 -9.2110 -5.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2870 -9.6460 -13.3630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5560 -10.3040 -11.2650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9710 -10.1010 -5.4190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8000 -10.6440 -4.1540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.6850 -10.3060 -3.3900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7440 -9.4070 -3.8900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9000 -8.8440 -5.1460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7480 -8.9950 -10.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2270 -8.0000 -11.6210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.5030 -8.3250 -12.9460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4630 -8.6320 -9.4620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8300 -10.6300 -12.5460 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5840 -11.0750 -8.3680 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 6 3 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 3 1 0\n 10 9 2 0\n 11 5 1 0\n 12 11 2 0\n 13 12 1 0\n 13 4 2 0\n 14 11 1 0\n 14 2 1 0\n 15 4 1 0\n 15 5 2 0\n 16 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.07,"logp":2.89,"tpsa":36.95,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1291},{"id":18291,"smiles":"O=C(Nc1ccccc1)Nc1cncc(Br)c1","cmpd_id":1544,"prot_id":18304,"protein_code":"NUDT5A-x1298_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1298_4_apo_r1F6ZSX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -11.2450 -7.6180 -12.5770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9700 -9.9360 -12.3030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8970 -10.4700 -8.3360 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2390 -8.8350 -13.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4490 -10.6060 -5.2800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7000 -9.8780 -10.9700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9770 -7.5200 -11.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7070 -8.6180 -10.4130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1580 -9.3210 -8.0770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7500 -9.4340 -5.6220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7830 -8.9010 -4.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5150 -9.5320 -3.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2170 -10.6890 -3.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1780 -11.2250 -4.0600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5350 -8.3880 -9.0460 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0940 -8.7570 -6.8070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9710 -11.6280 -13.0970 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 6 2 2 0\n 7 1 1 0\n 8 7 2 0\n 8 6 1 0\n 9 3 2 0\n 10 5 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 5 1 0\n 15 9 1 0\n 15 8 1 0\n 16 10 1 0\n 16 9 1 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1298}],"220882":[{"id":18123,"smiles":"C[C@H]1CCO[C@@H]1C(=O)Nc1cnns1","cmpd_id":560,"prot_id":18136,"protein_code":"NUDT5A-x0114_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -2.7300 3.7860 3.7330 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1910 6.0780 1.6730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0600 7.0640 3.3390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6680 6.0480 1.8670 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.9370 7.1970 1.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6560 7.3090 2.0060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2230 6.2560 3.3530 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.9440 4.9160 4.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6290 2.5300 4.2500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3880 1.4370 3.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0400 0.3230 4.6900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1320 0.5000 5.5280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0670 4.8760 4.9710 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4860 2.1180 5.5360 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 1\n 5 4 1 0\n 6 5 1 0\n 6 3 1 0\n 7 4 1 0\n 7 3 1 0\n 7 8 1 6\n 8 1 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 8 2 0\n 14 9 1 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.06,"logp":0.9,"tpsa":64.11,"ha":14,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":76,"number":114},{"id":18132,"smiles":"C[C@H]1CO[C@H](C)CN1C(=O)c1cnsn1","cmpd_id":562,"prot_id":18145,"protein_code":"NUDT5A-x0169_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0169_3_apo_jWc8kNh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -3.1890 4.9970 3.4880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6630 4.0160 5.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8370 5.8770 4.3240 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5300 5.2350 5.3940 C 0 0 1 0 0 0 0 0 0 0 0 0\n -3.0020 4.8440 4.9630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8390 6.3770 2.9570 C 0 0 1 0 0 0 0 0 0 0 0 0\n -4.0270 7.3470 3.0900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5640 6.9190 3.6880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6050 3.9910 2.5790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8390 2.5660 2.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8350 1.7520 3.7030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1830 0.5080 3.8580 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9180 1.9010 2.6490 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8220 4.2510 1.3900 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7010 0.3210 3.1610 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 6\n 4 3 1 0\n 5 4 1 0\n 5 1 1 0\n 6 1 1 0\n 6 7 1 1\n 8 6 1 0\n 8 3 1 0\n 9 1 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 10 2 0\n 14 9 2 0\n 15 13 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.07,"logp":0.79,"tpsa":55.32,"ha":15,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":82,"number":169},{"id":18135,"smiles":"Cc1nc(C(=O)N2CCCC2)c(C)s1","cmpd_id":563,"prot_id":18148,"protein_code":"NUDT5A-x0171_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0171_2_apo_9ctjMk2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -4.5150 2.1220 1.8060 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2700 -0.1560 1.9970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3650 4.5700 0.7090 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4330 0.9500 2.3750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5670 2.9700 2.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4940 4.3810 1.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8870 5.4420 4.3080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7500 6.6970 4.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1730 7.7250 3.5140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5230 6.8860 2.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8170 2.3990 3.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7480 2.9850 4.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6310 5.4720 2.8320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2400 0.7740 3.6560 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 5 1 1 0\n 6 5 1 0\n 6 3 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 5 2 0\n 12 11 1 0\n 13 7 1 0\n 13 6 1 0\n 13 10 1 0\n 14 11 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.08,"logp":2,"tpsa":33.2,"ha":14,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":76,"number":171},{"id":18138,"smiles":"CN(C[C@H]1CCOC1)c1ncncc1Cl","cmpd_id":564,"prot_id":18151,"protein_code":"NUDT5A-x0176_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0176_1_apo_2eZIexK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -3.9560 4.1370 3.8900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2550 4.6320 3.3690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3400 6.6210 1.5870 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8890 5.1450 4.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8810 6.4280 3.3860 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.7020 7.3310 3.7980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0030 7.6470 2.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6270 6.1410 1.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6800 2.7730 4.1230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3630 1.2970 5.4350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8960 0.3590 4.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3060 1.6080 3.5450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6750 2.5590 5.0940 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9310 0.1580 4.9390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5010 1.5140 2.3250 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 1 1\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 5 1 0\n 8 3 1 0\n 9 1 1 0\n 12 11 1 0\n 12 9 2 0\n 13 10 2 0\n 13 9 1 0\n 14 11 2 0\n 14 10 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.08,"logp":1.6,"tpsa":38.25,"ha":15,"hacc":4,"hdon":0,"rots":3,"rings":2,"velec":82,"number":176},{"id":18148,"smiles":"c1nc(N2CCC2)c2[nH]cnc2n1","cmpd_id":127,"prot_id":18161,"protein_code":"NUDT5A-x0262_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0262_3_apo_65PhH1c.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 15 0 0 0 0 0 0 0 0999 V2000\n -3.0990 4.3000 2.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2950 6.2840 2.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2110 4.9920 2.1760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2470 5.5350 3.1150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8750 3.0160 3.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8150 1.4980 4.9030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4230 0.6430 3.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9320 0.4650 2.0380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6310 1.9430 3.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9550 2.7850 4.4270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5090 0.3770 4.5480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2440 -0.2500 2.9390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5790 1.8160 2.0480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 1 1 0\n 4 2 1 0\n 5 1 1 0\n 9 7 1 0\n 9 5 2 0\n 10 6 2 0\n 10 5 1 0\n 11 7 2 0\n 11 6 1 0\n 12 8 2 0\n 12 7 1 0\n 13 9 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.09,"logp":0.56,"tpsa":57.7,"ha":13,"hacc":4,"hdon":1,"rots":1,"rings":3,"velec":66,"number":262},{"id":18153,"smiles":"Cc1cccc(Nc2ncnc3c2cnn3C)c1","cmpd_id":313,"prot_id":18166,"protein_code":"NUDT5A-x0286_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0286_4_apo_jKaULXK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n -0.6540 4.2530 4.7580 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9840 8.5000 2.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9670 7.5260 3.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9510 1.4280 4.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1940 2.5750 3.9980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1100 6.4180 3.7870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8280 7.6950 4.9400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8600 6.7370 5.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0320 5.6060 5.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1420 5.4340 4.8390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6320 3.8580 3.8450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1330 4.1360 2.0640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2470 2.1910 3.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4410 0.1100 2.6070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1190 4.6480 2.8410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7600 2.9300 2.1220 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5560 0.9090 3.3760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7880 0.4300 4.4070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 5 4 1 0\n 6 3 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 1 1 0\n 10 6 1 0\n 10 9 2 0\n 11 5 2 0\n 11 1 1 0\n 13 5 1 0\n 15 12 2 0\n 15 11 1 0\n 16 13 2 0\n 16 12 1 0\n 17 14 1 0\n 17 13 1 0\n 18 17 1 0\n 18 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.12,"logp":2.42,"tpsa":55.63,"ha":18,"hacc":5,"hdon":1,"rots":2,"rings":3,"velec":90,"number":286},{"id":18157,"smiles":"CC(C)N(C)c1ncnc2c1cnn2C","cmpd_id":130,"prot_id":18170,"protein_code":"NUDT5A-x0299_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0299_4_apo_qL3BYkk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -0.9350 4.6290 4.7690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7360 5.7870 3.3710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2290 5.9740 4.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1150 7.2470 4.3150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1510 3.6980 5.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9280 4.0710 3.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4280 4.3570 1.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3890 2.2960 2.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6740 0.1540 2.4900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1530 1.4760 4.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3850 2.6870 3.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4750 4.8840 2.8640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9340 3.0980 1.9380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6810 0.9740 3.1670 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9260 0.4790 4.1930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 1 1 0\n 6 1 1 0\n 11 10 1 0\n 11 8 1 0\n 11 6 2 0\n 12 7 2 0\n 12 6 1 0\n 13 8 2 0\n 13 7 1 0\n 14 9 1 0\n 14 8 1 0\n 15 14 1 0\n 15 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.1,"logp":1.12,"tpsa":46.84,"ha":16,"hacc":6,"hdon":1,"rots":3,"rings":2,"velec":86,"number":299},{"id":18158,"smiles":"Cc1nsc(N2CCO[C@@H](C)[C@H]2C)n1","cmpd_id":566,"prot_id":18171,"protein_code":"NUDT5A-x0319_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0319_1_apo_ET734rK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -2.0930 4.1930 3.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1740 6.3470 3.6130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1880 6.8280 3.4440 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2330 5.7650 3.3110 C 0 0 2 0 0 0 0 0 0 0 0 0\n -2.5260 6.4720 3.0760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0640 5.3330 3.9980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6340 4.5500 4.2530 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.4650 4.8070 5.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5110 2.8560 3.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6040 0.9570 3.4120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6120 0.1930 2.6530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5090 2.3560 3.1570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7620 0.3990 4.2880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7170 1.5920 4.9020 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 4 2 1 1\n 5 3 1 0\n 6 1 1 0\n 6 5 1 0\n 7 1 1 0\n 7 4 1 0\n 7 8 1 1\n 9 1 1 0\n 11 10 1 0\n 12 10 1 0\n 12 9 2 0\n 13 10 2 0\n 14 13 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":1.46,"tpsa":38.25,"ha":14,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":78,"number":319},{"id":18162,"smiles":"CC(C)C(=O)Nc1nnn(C)n1","cmpd_id":567,"prot_id":18175,"protein_code":"NUDT5A-x0320_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0320_3_apo_qu1huFH.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -2.1000 4.0710 3.7420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6740 6.6350 2.5080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5690 4.9090 2.1690 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0450 6.5570 3.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0240 7.6630 2.6930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6690 5.1280 2.9620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4900 2.7320 3.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4800 -0.0050 2.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8940 1.6720 4.5160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5570 0.5950 4.2560 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5370 0.9140 3.3360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5310 2.2310 2.9870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 3 2 0\n 6 1 1 0\n 6 4 1 0\n 7 1 1 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 11 8 1 0\n 12 11 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.1,"logp":-0.2,"tpsa":72.7,"ha":12,"hacc":5,"hdon":1,"rots":2,"rings":1,"velec":66,"number":320},{"id":18167,"smiles":"Cc1nsc(N2CCCNCC2)n1","cmpd_id":568,"prot_id":18180,"protein_code":"NUDT5A-x0333_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0333_4_apo_v1qMY5T.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n -2.7080 0.5070 4.3600 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5690 0.3480 2.7440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4860 1.0880 3.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2440 2.9070 3.8960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7910 5.2970 3.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6580 6.1140 2.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3260 6.8940 2.3610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3550 5.6670 3.8500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4810 4.5760 4.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2700 2.4460 3.1370 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7850 4.2080 3.9380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4520 6.8840 3.5670 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5890 1.6220 4.9360 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 6 1 0\n 9 8 1 0\n 10 4 2 0\n 10 3 1 0\n 11 9 1 0\n 11 5 1 0\n 11 4 1 0\n 12 8 1 0\n 12 7 1 0\n 13 4 1 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.09,"logp":0.65,"tpsa":41.05,"ha":13,"hacc":5,"hdon":1,"rots":1,"rings":2,"velec":72,"number":333},{"id":18170,"smiles":"CCN(CC)c1cc(C)nc2ncnn12","cmpd_id":133,"prot_id":18183,"protein_code":"NUDT5A-x0339_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0339_3_apo_eFH6vYt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -2.2100 4.5520 3.3530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2660 5.3760 2.2450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7760 5.0240 2.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7560 5.6650 4.2760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3410 6.1360 3.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3370 3.2250 3.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2290 2.3220 3.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3220 0.9750 3.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2480 0.0720 2.9360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7320 1.3170 5.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3240 2.2920 6.5260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6060 0.4470 4.6410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9380 1.0920 6.3190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6650 3.3120 5.6890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5770 2.7020 4.8710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 1 0\n 6 1 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 12 10 1 0\n 12 8 2 0\n 13 10 2 0\n 13 11 1 0\n 14 11 2 0\n 15 10 1 0\n 15 6 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.13,"logp":1.28,"tpsa":46.32,"ha":15,"hacc":5,"hdon":0,"rots":3,"rings":2,"velec":80,"number":339},{"id":18172,"smiles":"CC(=O)N1CCC[C@@H](C(N)=O)C1","cmpd_id":569,"prot_id":18185,"protein_code":"NUDT5A-x0392_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0392_1_apo_PALKu9A.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -2.8770 4.8280 3.6070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5860 7.0390 2.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4310 5.5600 2.0450 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3730 5.7720 2.6560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2540 5.2510 4.8960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0770 4.3090 5.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6510 2.9060 5.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4170 2.4200 4.1890 C 0 0 2 0 0 0 0 0 0 0 0 0\n -3.4490 3.4640 3.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2500 1.1610 4.4540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4000 0.7390 5.7560 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8060 0.5280 3.5370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 4 3 2 0\n 4 2 1 0\n 5 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 10 1 1\n 9 8 1 0\n 9 1 1 0\n 11 10 1 0\n 12 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.11,"logp":-0.27,"tpsa":63.4,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":68,"number":392},{"id":18174,"smiles":"COC(=O)Nc1sc(C)nc1-c1ccccc1","cmpd_id":570,"prot_id":18187,"protein_code":"NUDT5A-x0403_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0403_1_apo_ts4FiSK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -1.8530 3.1430 5.3570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5450 2.8830 8.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2940 3.3390 7.0460 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1290 2.4490 6.3390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2490 6.7030 2.0880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3710 5.3510 2.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7740 2.5530 4.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2900 1.1800 3.1060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0600 0.0910 2.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3690 3.2210 3.3700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2350 4.6530 2.9510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9920 5.3570 3.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8960 6.7030 2.6600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0260 7.3780 2.1890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2340 2.3890 2.6150 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2050 1.2510 6.5950 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3470 0.8830 4.5110 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 1 1 0\n 4 3 1 0\n 6 5 2 0\n 7 1 1 0\n 9 8 1 0\n 10 7 2 0\n 11 10 1 0\n 11 6 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 5 1 0\n 15 10 1 0\n 15 8 2 0\n 16 4 2 0\n 17 8 1 0\n 17 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":280.03,"logp":3.59,"tpsa":51.22,"ha":18,"hacc":5,"hdon":2,"rots":2,"rings":2,"velec":94,"number":403},{"id":18180,"smiles":"CC(C)c1ncc(Cl)c(C(N)=O)n1","cmpd_id":418,"prot_id":18193,"protein_code":"NUDT5A-x0463_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0463_4_apo_ECUQWtJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -2.3620 5.1340 4.2470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3980 6.1120 1.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3270 0.2730 5.4470 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2000 5.3020 2.6780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3270 4.5190 2.0460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2490 4.4250 3.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5240 4.4930 5.0560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5530 3.1230 5.1950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5280 2.4260 4.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8160 0.9530 4.5640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3620 3.0660 3.5640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7070 0.4370 3.6440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4260 2.4710 6.2480 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 4 1 0\n 6 1 2 0\n 7 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 10 3 2 0\n 11 9 2 0\n 11 6 1 0\n 12 10 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.05,"logp":1.35,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":70,"number":463},{"id":18181,"smiles":"CNc1nccc(OC)n1","cmpd_id":571,"prot_id":18194,"protein_code":"NUDT5A-x0469_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0469_1_apo_K35s4Hl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -4.1000 -0.0840 3.1120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1090 0.0960 2.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8180 1.4960 6.0080 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3780 0.9510 3.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8410 3.2080 3.5510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8770 3.0570 4.5000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7210 1.7290 5.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0890 2.4550 6.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6020 2.2120 3.0890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4500 0.6300 4.5800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 3 1 0\n 8 3 1 0\n 9 5 1 0\n 9 4 2 0\n 10 7 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.07,"logp":0.53,"tpsa":47.04,"ha":10,"hacc":4,"hdon":1,"rots":2,"rings":1,"velec":54,"number":469},{"id":18186,"smiles":"NC(=O)N1CCN(C(=O)c2ccco2)CC1","cmpd_id":572,"prot_id":18199,"protein_code":"NUDT5A-x0525_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0525_3_apo_ft9IW7f.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 0.8140 6.6580 5.3450 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1950 6.2790 6.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4910 6.9400 7.2230 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0430 3.9060 5.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7240 2.5930 5.7320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3330 3.8460 4.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8570 5.1810 4.7950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6520 1.3400 4.7970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6670 1.1170 3.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3030 1.8720 2.7790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1320 0.9590 2.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9590 -0.2320 2.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8550 5.0380 5.8650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9780 2.5850 4.9240 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3970 0.4120 5.5580 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0750 -0.1680 3.6750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 5 4 1 0\n 7 6 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 7 1 0\n 13 4 1 0\n 13 2 1 0\n 14 8 1 0\n 14 6 1 0\n 14 5 1 0\n 15 8 2 0\n 16 12 1 0\n 16 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.1,"logp":0.12,"tpsa":79.78,"ha":16,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":86,"number":525},{"id":18189,"smiles":"Cc1n[nH]c(C)c1S(=O)(=O)N(C)C","cmpd_id":57,"prot_id":18202,"protein_code":"NUDT5A-x0552_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0552_2_apo_CWa7xGy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -6.4080 3.5540 2.4410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7250 3.4300 3.1080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0320 4.3990 2.3050 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5470 3.6140 1.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3340 2.2120 3.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7250 0.8750 2.9270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7740 0.4250 1.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2110 1.9850 4.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3140 2.9700 4.7870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9220 -0.0270 3.4530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0110 0.6630 4.2020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2000 4.2790 4.4430 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9440 3.6990 3.1640 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 8 1 0\n 10 6 2 0\n 11 10 1 0\n 11 8 1 0\n 13 1 1 0\n 13 12 2 0\n 13 5 1 0\n 13 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.07,"logp":0.28,"tpsa":66.06,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":74,"number":552},{"id":18191,"smiles":"Cc1n[nH]c(C)c1-c1ccccc1N","cmpd_id":575,"prot_id":18204,"protein_code":"NUDT5A-x0554_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0554_1_apo_8GE6k9K.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -5.0430 5.7270 1.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4890 3.5200 0.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7000 4.4110 1.3200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0830 1.5880 3.0750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8630 5.1920 3.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8880 5.4030 4.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5780 4.0420 2.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2180 2.7340 3.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9480 2.5830 3.7600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5070 1.3350 4.2060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3390 0.2190 4.0740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6120 0.3300 3.5240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1360 6.1810 2.4900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3690 1.6580 2.5630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 5 2 0\n 7 3 1 0\n 8 7 1 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 4 1 0\n 13 5 1 0\n 13 1 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":187.11,"logp":2.28,"tpsa":54.7,"ha":14,"hacc":2,"hdon":2,"rots":1,"rings":2,"velec":72,"number":554},{"id":18196,"smiles":"c1csc(-c2nnc[nH]2)n1","cmpd_id":64,"prot_id":18209,"protein_code":"NUDT5A-x0574_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0574_4_apo_TKCEDq4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -2.1250 3.9110 4.1540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1320 4.5110 4.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4660 3.6560 5.7880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1400 2.6000 4.3790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9790 1.6520 3.7410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5350 0.7140 2.5020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0360 0.3300 4.0750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9840 -0.2150 3.3230 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9110 1.9180 2.7490 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0310 2.0280 5.5620 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 2 0\n 5 4 1 0\n 7 5 2 0\n 8 7 1 0\n 8 6 2 0\n 9 6 1 0\n 9 5 1 0\n 10 4 1 0\n 10 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.02,"logp":0.93,"tpsa":54.46,"ha":10,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":50,"number":574},{"id":18198,"smiles":"CC(=O)Nc1cc(C)n[nH]1","cmpd_id":89,"prot_id":18211,"protein_code":"NUDT5A-x0605_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0605_1_apo_xEuLmmn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -2.1080 2.2180 4.6050 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7050 4.0200 5.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6250 4.3570 3.9910 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8940 3.5870 4.6220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1380 1.5950 3.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0380 1.9490 2.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7260 0.7080 2.5430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7890 0.4090 1.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2770 -0.2560 3.3240 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3530 0.2870 4.0910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 2 0\n 4 1 1 0\n 4 2 1 0\n 5 1 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 7 2 0\n 10 9 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.07,"logp":0.68,"tpsa":57.78,"ha":10,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":54,"number":605},{"id":18200,"smiles":"CCNC(=O)N1CCN(C(C)=O)CC1","cmpd_id":506,"prot_id":18213,"protein_code":"NUDT5A-x0627_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0627_2_apo_6CE9WAa.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 1.6260 5.7240 4.0810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0210 5.3560 4.1380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1460 6.2240 2.4150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8430 5.8180 3.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3820 5.6350 3.4720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7260 4.3420 3.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7300 3.5420 4.0970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0780 2.7120 5.6680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0720 3.7750 5.1590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7250 1.0550 4.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8400 0.6410 3.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6190 4.8110 4.1960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0700 2.3290 4.5850 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3870 0.2620 5.4830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 1 0\n 5 3 2 0\n 5 1 1 0\n 7 6 1 0\n 9 8 1 0\n 11 10 1 0\n 12 9 1 0\n 12 6 1 0\n 12 5 1 0\n 13 10 1 0\n 13 7 1 0\n 13 8 1 0\n 14 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.13,"logp":-0.12,"tpsa":52.65,"ha":14,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":80,"number":627},{"id":18204,"smiles":"CCNc1ccc(C)nn1","cmpd_id":402,"prot_id":18217,"protein_code":"NUDT5A-x0637_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0637_3_apo_WbQXeCx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -4.1720 0.2500 3.5650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9570 -0.1710 1.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9110 0.7920 2.4190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3080 1.0370 4.3040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0700 2.4160 3.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1230 3.1120 4.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4260 2.4620 5.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3180 3.1610 6.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7080 1.1440 6.0420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5880 0.4380 5.3880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 4 1 0\n 10 9 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.1,"logp":1.22,"tpsa":37.81,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":637},{"id":18206,"smiles":"Cc1ccc(C(N)=O)c(F)c1","cmpd_id":576,"prot_id":18219,"protein_code":"NUDT5A-x0651_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0651_1_apo_zmnaQEb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -4.0770 -0.0050 2.9870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8330 6.4990 2.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5440 0.2910 4.6330 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9880 5.0320 3.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9990 4.3550 3.7270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0970 2.9840 3.9560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1870 2.2430 3.4570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2400 0.7850 3.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1940 2.9210 2.7240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1090 4.3300 2.5000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2120 2.2440 2.2010 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 3 2 0\n 8 1 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":153.06,"logp":1.23,"tpsa":43.09,"ha":11,"hacc":1,"hdon":1,"rots":1,"rings":1,"velec":58,"number":651},{"id":18207,"smiles":"Cn1cc(Oc2ncncc2Cl)cn1","cmpd_id":196,"prot_id":18220,"protein_code":"NUDT5A-x0673_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0673_1_apo_DigKuyT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -3.1980 7.1440 2.3500 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4220 8.3440 1.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3470 3.7460 2.3180 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0650 5.8480 1.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0330 5.0860 2.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6890 2.7000 2.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0620 1.9970 4.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5430 0.4090 3.5660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1550 1.3820 2.8020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6940 5.9780 3.4410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6100 3.0340 3.7420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4840 0.6870 4.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1700 7.2290 3.3120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3770 0.9260 1.7160 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 3 1 0\n 5 4 2 0\n 6 3 1 0\n 9 8 1 0\n 9 6 2 0\n 10 5 1 0\n 11 7 2 0\n 11 6 1 0\n 12 8 2 0\n 12 7 1 0\n 13 10 2 0\n 13 1 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.03,"logp":1.66,"tpsa":52.83,"ha":14,"hacc":5,"hdon":0,"rots":2,"rings":2,"velec":72,"number":673},{"id":18211,"smiles":"CCNCc1cn(C)nn1","cmpd_id":577,"prot_id":18224,"protein_code":"NUDT5A-x0681_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0681_1_apo_C0cEPEv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -0.1970 4.0500 5.1030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8670 5.1670 4.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6310 5.2980 5.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3590 4.1270 4.1470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0920 2.8380 4.0370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1560 2.5010 3.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4440 0.3190 2.8330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4490 1.1560 3.4890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5960 0.7330 4.4950 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7980 1.7040 4.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 1 0\n 6 5 2 0\n 8 7 1 0\n 8 6 1 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":172.08,"logp":0.18,"tpsa":42.74,"ha":11,"hacc":5,"hdon":2,"rots":3,"rings":1,"velec":62,"number":681},{"id":18214,"smiles":"COc1ccc2cn[nH]c(=O)c2c1OC","cmpd_id":578,"prot_id":18227,"protein_code":"NUDT5A-x0685_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0685_3_apo_ekyctVo.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -2.8580 0.6020 4.3140 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0500 7.3140 3.4080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3690 6.9320 3.8150 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5330 5.5600 4.0830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 4.9870 5.1780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9710 3.6290 5.4470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8420 2.8200 4.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0490 1.4220 4.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4510 2.4060 2.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5610 3.3490 3.5330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3920 4.7670 3.2510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4070 5.6870 2.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5220 1.0710 3.2570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1040 2.6070 1.7550 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9930 5.4090 2.1730 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 1 2 0\n 10 9 1 0\n 10 7 1 0\n 11 10 2 0\n 11 4 1 0\n 13 9 1 0\n 13 1 1 0\n 14 9 2 0\n 15 11 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.07,"logp":0.94,"tpsa":64.21,"ha":15,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":78,"number":685},{"id":18240,"smiles":"Nc1nccc(C(F)(F)F)n1","cmpd_id":1533,"prot_id":18253,"protein_code":"NUDT5A-x1072_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1072_4_apo_c3Gm5zA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -3.9240 2.1160 2.7910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0650 4.4030 2.9230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0450 2.9490 3.3980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8430 0.8140 3.2320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1390 1.2530 4.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1230 2.5960 4.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2000 4.6530 1.9610 F 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7530 5.2710 3.8980 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2760 4.8020 2.4590 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6660 -0.0830 2.6130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9620 0.3400 4.2190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 6 3 1 0\n 8 2 1 0\n 9 2 1 0\n 10 4 1 0\n 11 5 1 0\n 11 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":163.04,"logp":1.08,"tpsa":51.8,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":60,"number":1072},{"id":18244,"smiles":"O=c1[nH]cnc2cc(F)ccc12","cmpd_id":1534,"prot_id":18257,"protein_code":"NUDT5A-x1078_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1078_4_apo_TvriHwm.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.7330 1.8420 1.7730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3400 5.0110 2.8800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4340 0.4500 4.9040 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4990 4.6070 3.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4340 3.2600 4.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0860 4.0700 2.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9870 2.7140 2.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6460 0.5400 2.1180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1710 2.3130 3.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0950 0.9090 3.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4240 6.3050 2.4710 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8740 0.0280 3.1730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 2 1 0\n 7 6 2 0\n 7 1 1 0\n 8 1 2 0\n 9 7 1 0\n 9 5 2 0\n 10 9 1 0\n 10 3 2 0\n 11 2 1 0\n 12 10 1 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.06,"tpsa":45.75,"ha":12,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1078},{"id":18247,"smiles":"Fc1cnc2[nH]ccc2c1","cmpd_id":1535,"prot_id":18260,"protein_code":"NUDT5A-x1083_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1083_3_apo_9wnu9h2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -2.5530 0.3060 4.8320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8060 2.6190 5.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7620 1.2180 5.4060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4590 0.8260 3.9500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1340 1.0200 2.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6730 2.3090 2.7000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6030 2.2200 3.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7320 3.1550 4.2470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9050 3.3750 5.7780 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4040 0.1010 3.2100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 4 2 0\n 8 7 1 0\n 8 2 2 0\n 9 2 1 0\n 10 5 1 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":136.04,"logp":1.7,"tpsa":28.68,"ha":10,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":50,"number":1083},{"id":18251,"smiles":"FC(F)c1nnc2c(C(F)(F)F)cccn12","cmpd_id":1536,"prot_id":18264,"protein_code":"NUDT5A-x1093_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1093_4_apo_l9mQwEl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -3.2790 2.3910 3.8400 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6300 4.3070 5.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7570 4.0170 4.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3270 4.9830 4.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3780 4.6530 3.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8470 3.3740 3.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2300 2.6810 4.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5010 1.0440 3.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4960 0.2210 3.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4270 5.6100 6.0250 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5780 3.8310 5.5780 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3420 0.4130 1.9430 F 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7160 0.7010 3.4220 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8210 3.8180 7.1050 F 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8820 1.5050 5.3900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6450 0.5360 4.9100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 1 1 0\n 7 3 1 0\n 7 1 1 0\n 8 1 1 0\n 9 8 1 0\n 9 12 1 0\n 11 2 1 0\n 13 9 1 0\n 14 2 1 0\n 15 7 2 0\n 16 15 1 0\n 16 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.03,"logp":2.69,"tpsa":30.19,"ha":16,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":86,"number":1093},{"id":18255,"smiles":"N#Cc1c(C(F)(F)F)cn2ccnc2c1Cl","cmpd_id":1537,"prot_id":18268,"protein_code":"NUDT5A-x1211_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1211_4_apo_JvlT7yI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -2.9990 0.3970 4.4110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7400 2.4920 4.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7100 1.6840 4.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0970 0.1820 3.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4780 1.3050 2.9270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5200 3.5810 2.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5290 4.3740 3.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3670 5.8310 2.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6240 3.8000 4.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5890 4.5290 5.0620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4680 6.2580 2.1130 F 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1350 6.8430 3.6520 F 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3660 5.9440 1.8950 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5930 2.2710 3.2810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2350 5.1510 5.5360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7640 1.7820 5.9500 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 5 4 2 0\n 7 6 2 0\n 8 7 1 0\n 8 11 1 0\n 9 7 1 0\n 9 2 2 0\n 10 9 1 0\n 12 8 1 0\n 13 8 1 0\n 14 6 1 0\n 14 5 1 0\n 14 3 1 0\n 15 10 3 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245,"logp":2.88,"tpsa":41.09,"ha":16,"hacc":3,"hdon":0,"rots":0,"rings":2,"velec":82,"number":1211},{"id":18259,"smiles":"Oc1ncnc2cccc(F)c12","cmpd_id":1538,"prot_id":18272,"protein_code":"NUDT5A-x1212_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1212_4_apo_D0YYCLz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.6020 1.9310 1.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2450 3.3260 4.3440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4060 0.3730 4.9300 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3220 4.6600 4.0250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1790 5.0950 2.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9280 4.1940 2.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8490 2.7890 2.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5500 0.6370 2.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0930 0.9340 3.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0250 2.3460 3.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3650 2.9540 5.2860 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8440 0.0630 3.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 1 2 0\n 8 1 1 0\n 9 3 1 0\n 10 9 2 0\n 10 7 1 0\n 10 2 1 0\n 11 2 1 0\n 12 9 1 0\n 12 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1212},{"id":18263,"smiles":"Oc1ncnc2ccc(F)cc12","cmpd_id":1539,"prot_id":18276,"protein_code":"NUDT5A-x1213_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1213_4_apo_iQ9eLrd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.6930 1.7840 1.7650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2400 4.3710 4.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3980 0.2800 4.8860 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1250 4.8790 2.9950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9380 4.0260 2.2820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9010 2.6220 2.5430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6300 0.5180 2.1650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2100 3.0520 4.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0650 2.1730 3.5840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1360 0.7900 3.8630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3990 5.2400 4.5870 F 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9160 -0.0560 3.1800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 6 1 2 0\n 7 1 1 0\n 8 2 2 0\n 9 8 1 0\n 9 6 1 0\n 10 9 2 0\n 10 3 1 0\n 11 2 1 0\n 12 10 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1213},{"id":18267,"smiles":"CSc1nc(C(F)(F)F)cc(=O)n1C","cmpd_id":1540,"prot_id":18280,"protein_code":"NUDT5A-x1214_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1214_4_apo_5KjViIv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -2.8000 2.2680 4.0720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6680 5.3220 1.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3220 0.2760 5.0090 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6670 2.9540 3.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6540 2.9030 4.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9050 1.0430 2.8050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0650 0.3890 2.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1580 0.2870 3.6100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0380 0.8790 4.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9810 0.6910 0.7320 F 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1270 -0.9580 2.1010 F 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2980 0.8320 2.4250 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6940 2.3910 2.5830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4000 4.6750 2.9280 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 5 1 1 0\n 7 6 1 0\n 7 10 1 0\n 8 6 2 0\n 9 8 1 0\n 9 3 2 0\n 9 1 1 0\n 11 7 1 0\n 12 7 1 0\n 13 6 1 0\n 13 4 2 0\n 14 4 1 0\n 14 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.02,"logp":1.52,"tpsa":34.89,"ha":14,"hacc":4,"hdon":0,"rots":1,"rings":1,"velec":78,"number":1214}],"220883":[{"id":18124,"smiles":"C[C@H]1CCO[C@@H]1C(=O)Nc1cnns1","cmpd_id":560,"prot_id":18137,"protein_code":"NUDT5A-x0114_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0114_2_apo_Y03ueHi.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -22.2420 28.9880 -56.3380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3770 27.9220 -53.5560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7200 31.3960 -53.7840 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2690 29.1530 -53.4250 C 0 0 1 0 0 0 0 0 0 0 0 0\n -22.1600 29.8390 -52.0710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8410 31.2040 -52.3700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8470 30.4000 -54.2540 C 0 0 1 0 0 0 0 0 0 0 0 0\n -21.8460 30.2380 -55.7920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2540 28.6090 -57.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6350 27.3780 -58.0480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4980 27.2270 -59.4300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0600 28.2400 -60.0200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5100 31.1970 -56.4760 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7180 29.6090 -58.9750 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 1\n 5 4 1 0\n 6 5 1 0\n 6 3 1 0\n 7 4 1 0\n 7 3 1 0\n 7 8 1 6\n 8 1 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 8 2 0\n 14 12 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.06,"logp":0.9,"tpsa":64.11,"ha":14,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":76,"number":114},{"id":18131,"smiles":"C[C@H]1CO[C@H](C)CN1C(=O)c1cnsn1","cmpd_id":562,"prot_id":18144,"protein_code":"NUDT5A-x0169_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0169_2_apo_UkiOIiv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -21.7890 29.7480 -56.5390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4540 28.2960 -53.1790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4840 30.5890 -53.8960 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5870 29.2530 -54.3580 C 0 0 1 0 0 0 0 0 0 0 0 0\n -21.4030 29.0490 -55.3170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7080 31.2500 -56.2570 C 0 0 1 0 0 0 0 0 0 0 0 0\n -22.2080 32.2560 -57.3520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5660 31.5640 -54.9390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3030 29.1610 -57.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8290 27.7400 -57.8050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2330 26.8390 -56.6870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7470 25.7210 -57.0730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0680 27.2010 -58.9740 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2340 29.7580 -58.7660 O 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7660 25.6970 -58.7290 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 4 2 1 1\n 5 4 1 0\n 5 1 1 0\n 6 1 1 0\n 6 7 1 6\n 8 3 1 0\n 8 6 1 0\n 9 1 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 10 2 0\n 14 9 2 0\n 15 13 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.07,"logp":0.79,"tpsa":55.32,"ha":15,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":82,"number":169},{"id":18134,"smiles":"Cc1nc(C(=O)N2CCCC2)c(C)s1","cmpd_id":563,"prot_id":18147,"protein_code":"NUDT5A-x0171_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0171_1_apo_WRr75xP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -23.5370 25.5810 -56.4650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8490 24.0710 -58.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.1500 27.1350 -54.0750 O 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5040 25.3410 -57.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1820 26.9170 -56.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1660 27.4060 -54.8030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.7280 28.3240 -54.8890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.7770 28.3830 -53.6840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.6150 29.0350 -52.5670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0880 28.7160 -52.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8950 27.6490 -57.3670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5550 29.0690 -57.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0480 28.0800 -54.2660 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0450 26.6740 -58.7530 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 5 1 1 0\n 6 5 1 0\n 6 3 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 5 2 0\n 12 11 1 0\n 13 6 1 0\n 13 10 1 0\n 13 7 1 0\n 14 4 1 0\n 14 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.08,"logp":2,"tpsa":33.2,"ha":14,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":76,"number":171},{"id":18139,"smiles":"CN(C[C@H]1CCOC1)c1ncncc1Cl","cmpd_id":564,"prot_id":18152,"protein_code":"NUDT5A-x0176_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0176_2_apo_pNNAK09.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -22.3760 28.9760 -55.7360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0660 27.9910 -54.6670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8660 31.6780 -52.3200 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3410 30.4610 -55.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2970 30.8360 -53.8860 C 0 0 1 0 0 0 0 0 0 0 0 0\n -22.0740 32.3510 -53.7040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3180 32.8210 -52.9350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.6440 30.5700 -53.1640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6540 28.6150 -57.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5290 29.3930 -59.3250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2140 27.2150 -59.0250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1090 27.3440 -57.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3740 29.6520 -58.0070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9320 28.2070 -59.8930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5620 25.9210 -56.8560 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 1 6\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 5 1 0\n 8 3 1 0\n 9 1 1 0\n 12 11 1 0\n 12 9 2 0\n 13 10 2 0\n 13 9 1 0\n 14 11 2 0\n 14 10 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.08,"logp":1.6,"tpsa":38.25,"ha":15,"hacc":4,"hdon":0,"rots":3,"rings":2,"velec":82,"number":176},{"id":18145,"smiles":"COC(=O)c1cccc(NS(C)(=O)=O)c1","cmpd_id":287,"prot_id":18158,"protein_code":"NUDT5A-x0256_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0256_2_apo_011DDVS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n -21.8650 32.6980 -57.4950 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1050 25.3040 -58.4120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8860 26.4900 -57.6610 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5090 27.7110 -58.2260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3200 28.9170 -57.3340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4010 28.7220 -55.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3270 29.8310 -55.0620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1680 31.1350 -55.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0680 31.3480 -56.9790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2460 35.0670 -58.4720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1420 30.2120 -57.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3610 27.7220 -59.4370 O 0 0 0 0 0 0 0 0 0 0 0 0\n -24.0590 34.0350 -57.0620 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0640 34.7640 -55.9390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6530 34.1710 -57.0850 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 1 1 0\n 11 9 2 0\n 11 5 1 0\n 12 4 2 0\n 15 1 1 0\n 15 14 2 0\n 15 13 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.04,"logp":0.84,"tpsa":72.47,"ha":15,"hacc":4,"hdon":1,"rots":3,"rings":1,"velec":82,"number":256},{"id":18146,"smiles":"c1nc(N2CCC2)c2[nH]cnc2n1","cmpd_id":127,"prot_id":18159,"protein_code":"NUDT5A-x0262_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0262_1_apo_rQqwW5c.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 15 0 0 0 0 0 0 0 0999 V2000\n -22.6390 28.1560 -55.7160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0400 28.6410 -53.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2110 27.3090 -54.5520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0530 29.4030 -55.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5100 27.8900 -57.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1990 28.5000 -59.2930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8440 26.3750 -58.9920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5170 24.5640 -58.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8560 26.6180 -57.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1700 28.8470 -57.9630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4970 27.3410 -59.8770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2670 25.0660 -59.2570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2890 25.4650 -57.0480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 1 1 0\n 4 2 1 0\n 5 1 1 0\n 9 7 1 0\n 9 5 2 0\n 10 6 2 0\n 10 5 1 0\n 11 7 2 0\n 11 6 1 0\n 12 8 2 0\n 12 7 1 0\n 13 9 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.09,"logp":0.56,"tpsa":57.7,"ha":13,"hacc":4,"hdon":1,"rots":1,"rings":3,"velec":66,"number":262},{"id":18150,"smiles":"Cc1cccc(Nc2ncnc3c2cnn3C)c1","cmpd_id":313,"prot_id":18163,"protein_code":"NUDT5A-x0286_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0286_1_apo_z9OdkD6.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n -21.7330 30.8740 -56.9970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8050 32.8890 -52.5560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3240 33.0810 -53.9710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9150 28.4850 -59.1640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0800 28.5530 -57.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1520 31.9300 -54.7690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0430 34.3760 -54.5000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5720 34.4940 -55.8140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3870 33.3490 -56.6370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7000 32.0460 -56.1350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0160 29.5100 -56.7100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6760 27.8190 -55.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5020 27.2440 -57.3950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0400 25.1090 -58.5840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3050 29.1010 -55.4420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8190 26.8240 -56.1290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5790 26.5070 -58.5250 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2140 27.2480 -59.6230 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 5 4 1 0\n 6 3 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 6 1 0\n 10 1 1 0\n 10 9 2 0\n 11 5 2 0\n 11 1 1 0\n 13 5 1 0\n 15 12 2 0\n 15 11 1 0\n 16 13 2 0\n 16 12 1 0\n 17 14 1 0\n 17 13 1 0\n 18 17 1 0\n 18 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.12,"logp":2.42,"tpsa":55.63,"ha":18,"hacc":5,"hdon":1,"rots":2,"rings":3,"velec":90,"number":286},{"id":18154,"smiles":"CC(C)N(C)c1ncnc2c1cnn2C","cmpd_id":130,"prot_id":18167,"protein_code":"NUDT5A-x0299_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0299_1_apo_EwiD2OM.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -22.6060 30.8620 -56.5970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3900 33.2640 -55.8260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2360 31.7380 -55.4900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4810 31.5800 -54.1300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1130 31.4540 -57.9000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8750 29.4400 -56.4950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5040 27.6510 -55.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4150 27.2120 -57.2930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8900 25.1230 -58.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8040 28.5190 -59.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9900 28.5480 -57.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1260 28.9430 -55.2360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.6940 26.7210 -56.0390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4700 26.5140 -58.4600 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0930 27.3010 -59.5140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 1 1 0\n 6 1 1 0\n 11 8 1 0\n 11 10 1 0\n 11 6 2 0\n 12 7 2 0\n 12 6 1 0\n 13 8 2 0\n 13 7 1 0\n 14 9 1 0\n 14 8 1 0\n 15 14 1 0\n 15 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.1,"logp":1.12,"tpsa":46.84,"ha":16,"hacc":6,"hdon":1,"rots":3,"rings":2,"velec":86,"number":299},{"id":18160,"smiles":"CC(C)C(=O)Nc1nnn(C)n1","cmpd_id":567,"prot_id":18173,"protein_code":"NUDT5A-x0320_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0320_1_apo_xmg6Dgk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -21.9690 28.9140 -56.3650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7750 31.1640 -54.3600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5120 27.7620 -54.3940 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6940 30.0810 -54.1710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.4320 29.7400 -52.6650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1000 28.7890 -54.9470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2220 27.9430 -57.3100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1550 24.7320 -58.4090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1070 28.1080 -58.7260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4020 26.9840 -59.2470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7040 26.1080 -58.2480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5960 26.6550 -57.0320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 1 1 0\n 6 3 2 0\n 6 4 1 0\n 7 1 1 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 11 8 1 0\n 12 11 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.1,"logp":-0.2,"tpsa":72.7,"ha":12,"hacc":5,"hdon":1,"rots":2,"rings":1,"velec":66,"number":320},{"id":18166,"smiles":"Cc1nsc(N2CCCNCC2)n1","cmpd_id":568,"prot_id":18179,"protein_code":"NUDT5A-x0333_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0333_3_apo_5G80XbA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n -22.8740 27.6010 -59.2780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.6690 25.4380 -58.3570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2140 26.8420 -58.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7140 28.6550 -57.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9250 28.8880 -54.5350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2430 29.4070 -53.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8830 30.7060 -52.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1670 31.8380 -54.8150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4400 30.9560 -56.0770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1440 27.3770 -56.9530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5020 29.4660 -55.8810 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2170 31.6230 -53.7980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4200 29.1320 -58.7190 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 6 1 0\n 9 8 1 0\n 10 3 1 0\n 10 4 2 0\n 11 9 1 0\n 11 5 1 0\n 11 4 1 0\n 12 8 1 0\n 12 7 1 0\n 13 4 1 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.09,"logp":0.65,"tpsa":41.05,"ha":13,"hacc":5,"hdon":1,"rots":1,"rings":2,"velec":72,"number":333},{"id":18168,"smiles":"CCN(CC)c1cc(C)nc2ncnn12","cmpd_id":133,"prot_id":18181,"protein_code":"NUDT5A-x0339_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0339_1_apo_sxbX1Kg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -22.1920 29.2400 -55.5790 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8430 27.5200 -53.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8560 28.5300 -54.4610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3780 30.4480 -55.1780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2100 31.6930 -54.9360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1320 28.6710 -56.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5320 27.3470 -57.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5850 26.7860 -58.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0490 25.3980 -58.5710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8010 28.7580 -59.3220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.0850 30.7890 -59.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2270 27.4390 -59.5510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3440 29.6900 -60.2020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3140 30.6630 -58.1300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7650 29.3730 -58.0180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 1 1 0\n 5 4 1 0\n 6 1 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 12 8 2 0\n 12 10 1 0\n 13 10 2 0\n 13 11 1 0\n 14 11 2 0\n 15 10 1 0\n 15 6 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.13,"logp":1.28,"tpsa":46.32,"ha":15,"hacc":5,"hdon":0,"rots":3,"rings":2,"velec":80,"number":339},{"id":18177,"smiles":"CC(C)c1ncc(Cl)c(C(N)=O)n1","cmpd_id":418,"prot_id":18190,"protein_code":"NUDT5A-x0463_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0463_1_apo_VgncjyY.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -21.4290 29.7520 -55.7480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8420 28.7610 -53.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8930 27.8750 -60.4090 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9760 27.7980 -54.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5830 26.3790 -54.3610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8060 28.4290 -55.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.2890 30.3610 -56.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5080 29.6990 -58.1340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8890 28.3310 -58.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1560 27.4900 -59.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0370 27.6840 -56.8780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7070 26.2470 -59.1000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3070 30.5870 -59.5200 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 4 1 0\n 6 1 2 0\n 7 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 3 2 0\n 10 9 1 0\n 11 9 2 0\n 11 6 1 0\n 12 10 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.05,"logp":1.35,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":70,"number":463},{"id":18182,"smiles":"CNc1nccc(OC)n1","cmpd_id":571,"prot_id":18195,"protein_code":"NUDT5A-x0469_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0469_2_apo_04fpI6z.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -22.7180 25.5140 -58.8160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0740 24.3830 -57.9620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3540 29.8910 -59.7240 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3330 26.7380 -58.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9470 28.1850 -56.5400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6570 29.2460 -57.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7110 28.9360 -58.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.8990 31.2210 -59.4380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2780 26.9360 -56.9730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0500 27.7080 -59.3060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 3 1 0\n 8 3 1 0\n 9 4 2 0\n 9 5 1 0\n 10 4 1 0\n 10 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.07,"logp":0.53,"tpsa":47.04,"ha":10,"hacc":4,"hdon":1,"rots":2,"rings":1,"velec":54,"number":469},{"id":18184,"smiles":"NC(=O)N1CCN(C(=O)c2ccco2)CC1","cmpd_id":572,"prot_id":18197,"protein_code":"NUDT5A-x0525_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0525_1_apo_H02pR8P.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -24.0130 32.8720 -54.3870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4380 33.0930 -55.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2390 34.2570 -55.9950 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4820 30.7330 -55.7240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7200 29.4050 -56.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9060 30.8040 -58.4530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4390 32.1100 -57.7470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6120 28.3520 -58.8360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0910 27.0090 -58.3680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4250 26.4320 -57.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8210 25.0890 -57.4530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.6920 24.9360 -58.7800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1140 31.8790 -56.4280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5300 29.5080 -57.9730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2950 28.4360 -60.0200 O 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2570 26.0890 -59.3570 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 5 4 1 0\n 7 6 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 7 1 0\n 13 4 1 0\n 13 2 1 0\n 14 8 1 0\n 14 6 1 0\n 14 5 1 0\n 15 8 2 0\n 16 12 1 0\n 16 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.1,"logp":0.12,"tpsa":79.78,"ha":16,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":86,"number":525},{"id":18193,"smiles":"c1csc(-c2nnc[nH]2)n1","cmpd_id":64,"prot_id":18206,"protein_code":"NUDT5A-x0574_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0574_1_apo_E9ycoQL.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -22.0830 28.9980 -56.8540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6310 30.3410 -56.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.4300 30.8880 -58.1120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2030 28.5930 -58.0750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6690 27.3090 -58.3700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4300 25.2330 -58.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8730 26.7920 -59.5780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3450 25.5120 -59.4130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0080 26.3670 -57.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7820 29.7550 -59.3120 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 2 0\n 5 4 1 0\n 7 5 2 0\n 8 7 1 0\n 8 6 2 0\n 9 6 1 0\n 9 5 1 0\n 10 4 1 0\n 10 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.02,"logp":0.93,"tpsa":54.46,"ha":10,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":50,"number":574},{"id":18201,"smiles":"CCNC(=O)N1CCN(C(C)=O)CC1","cmpd_id":506,"prot_id":18214,"protein_code":"NUDT5A-x0627_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0627_3_apo_JfzKhMA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -23.2790 33.2170 -56.3540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -24.0840 35.5200 -56.5230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5370 31.7420 -54.5690 O 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7810 34.3590 -55.5860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3190 31.9120 -55.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2500 31.0290 -57.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9710 29.7810 -58.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7430 28.3110 -56.7850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5220 29.5680 -56.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6250 27.3570 -59.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2300 26.0400 -58.5700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0730 30.7590 -56.7020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2740 28.4080 -58.1980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4210 27.5260 -60.2400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 1 0\n 5 3 2 0\n 5 1 1 0\n 7 6 1 0\n 9 8 1 0\n 11 10 1 0\n 12 9 1 0\n 12 6 1 0\n 12 5 1 0\n 13 10 1 0\n 13 8 1 0\n 13 7 1 0\n 14 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.13,"logp":-0.12,"tpsa":52.65,"ha":14,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":80,"number":627},{"id":18202,"smiles":"CCNc1ccc(C)nn1","cmpd_id":402,"prot_id":18215,"protein_code":"NUDT5A-x0637_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0637_1_apo_1xu4rcs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -23.2480 26.5050 -58.8170 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7070 24.2780 -57.9680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5960 25.7430 -57.6440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7800 27.7840 -58.7550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5860 28.5350 -57.5420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1060 29.8280 -57.6370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8400 30.3680 -58.9120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.3880 31.7670 -59.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0390 29.6020 -60.0250 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4800 28.3820 -59.9900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.1,"logp":1.22,"tpsa":37.81,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":637},{"id":18208,"smiles":"Cn1cc(Oc2ncncc2Cl)cn1","cmpd_id":196,"prot_id":18221,"protein_code":"NUDT5A-x0673_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0673_2_apo_5LgcHmn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -20.8720 28.5760 -53.2630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.0330 29.6350 -52.2500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8430 26.0850 -55.6310 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8920 27.9890 -54.0250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.2440 26.9920 -54.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8530 26.3410 -56.9900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6010 27.9310 -58.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1910 25.7880 -59.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1770 25.3740 -57.9690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.8670 27.0400 -54.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5480 27.6500 -57.3200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9150 27.0530 -59.6610 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.6450 28.0200 -53.5120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5340 23.7500 -57.6590 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 3 1 0\n 5 4 2 0\n 6 3 1 0\n 9 8 1 0\n 9 6 2 0\n 10 5 1 0\n 11 6 1 0\n 11 7 2 0\n 12 8 2 0\n 12 7 1 0\n 13 10 2 0\n 13 1 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.03,"logp":1.66,"tpsa":52.83,"ha":14,"hacc":5,"hdon":0,"rots":2,"rings":2,"velec":72,"number":673},{"id":18212,"smiles":"COc1ccc2cn[nH]c(=O)c2c1OC","cmpd_id":578,"prot_id":18225,"protein_code":"NUDT5A-x0685_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0685_1_apo_rHflHzN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -22.5720 26.9240 -59.6110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -20.6920 31.4490 -54.1320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9330 30.9570 -54.6440 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9270 30.2760 -55.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.4420 30.8970 -57.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.4870 30.1870 -58.2650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0130 28.8700 -58.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0940 28.1330 -59.5100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0680 26.8720 -57.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5010 28.2430 -57.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4520 28.9690 -55.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9990 27.8120 -53.8630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0490 26.2980 -58.5070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5900 26.2070 -56.2800 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9500 28.4640 -54.6980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 1 2 0\n 8 7 1 0\n 10 9 1 0\n 10 7 1 0\n 11 10 2 0\n 11 4 1 0\n 13 9 1 0\n 13 1 1 0\n 14 9 2 0\n 15 11 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.07,"logp":0.94,"tpsa":64.21,"ha":15,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":78,"number":685},{"id":18239,"smiles":"Nc1nccc(C(F)(F)F)n1","cmpd_id":1533,"prot_id":18252,"protein_code":"NUDT5A-x1072_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1072_3_apo_d651MBc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -23.2120 26.7870 -57.0930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6060 28.5060 -55.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7310 28.0410 -56.8990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2740 26.3930 -58.4390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4130 28.3900 -59.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3260 28.9000 -57.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0130 27.6360 -54.6230 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7940 28.7660 -54.8580 F 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9010 29.6570 -55.3020 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8210 25.1760 -58.7220 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8680 27.1690 -59.5200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0\n 3 1 2 0\n 3 2 1 0\n 4 1 1 0\n 6 5 2 0\n 6 3 1 0\n 8 2 1 0\n 9 2 1 0\n 10 4 1 0\n 11 4 2 0\n 11 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":163.04,"logp":1.08,"tpsa":51.8,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":60,"number":1072},{"id":18243,"smiles":"O=c1[nH]cnc2cc(F)ccc12","cmpd_id":1534,"prot_id":18256,"protein_code":"NUDT5A-x1078_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1078_3_apo_xNLvo9n.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -23.5960 25.4360 -56.6100 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2200 28.3690 -54.8330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4540 27.6970 -59.7860 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8470 29.2270 -55.9250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0410 28.7910 -57.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7810 27.1180 -55.0560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9810 26.7020 -56.3970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7900 25.0530 -57.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5930 27.5340 -57.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8000 27.0830 -58.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0300 28.7840 -53.5570 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4260 25.8140 -58.9380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 2 1 0\n 7 6 2 0\n 7 1 1 0\n 8 1 2 0\n 9 7 1 0\n 9 5 2 0\n 10 9 1 0\n 10 3 2 0\n 11 2 1 0\n 12 10 1 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.06,"tpsa":45.75,"ha":12,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1078},{"id":18246,"smiles":"Fc1cnc2[nH]ccc2c1","cmpd_id":1535,"prot_id":18259,"protein_code":"NUDT5A-x1083_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1083_2_apo_xc0I39Y.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -22.5960 27.7300 -59.6960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0240 29.3720 -57.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1610 28.9470 -59.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8920 26.9170 -58.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5280 25.1510 -57.3830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1550 26.1470 -56.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7580 27.2670 -57.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3130 28.5390 -56.9250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6300 30.6070 -57.7610 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3760 25.6150 -58.6960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 4 2 0\n 8 7 1 0\n 8 2 2 0\n 9 2 1 0\n 10 5 1 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":136.04,"logp":1.7,"tpsa":28.68,"ha":10,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":50,"number":1083},{"id":18250,"smiles":"FC(F)c1nnc2c(C(F)(F)F)cccn12","cmpd_id":1536,"prot_id":18263,"protein_code":"NUDT5A-x1093_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1093_3_apo_HoJHGXz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -22.4370 27.5150 -57.2360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.2680 31.0770 -57.8010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7120 29.8350 -57.0560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7940 29.7540 -55.7000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2070 28.5300 -55.0960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5240 27.4260 -55.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0350 28.7140 -57.8570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6790 26.6380 -58.2910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1370 25.1990 -58.2770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0940 32.1460 -57.7300 F 0 0 0 0 0 0 0 0 0 0 0 0\n -21.1020 30.8310 -59.1400 F 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4050 25.1560 -57.8390 F 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4700 24.4580 -57.3690 F 0 0 0 0 0 0 0 0 0 0 0 0\n -20.1060 31.5310 -57.3240 F 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0550 28.5280 -59.2100 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4360 27.3020 -59.4540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 1 1 0\n 7 1 1 0\n 7 3 1 0\n 8 1 1 0\n 9 8 1 0\n 9 12 1 0\n 11 2 1 0\n 13 9 1 0\n 14 2 1 0\n 15 7 2 0\n 16 8 2 0\n 16 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.03,"logp":2.69,"tpsa":30.19,"ha":16,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":86,"number":1093},{"id":18254,"smiles":"N#Cc1c(C(F)(F)F)cn2ccnc2c1Cl","cmpd_id":1537,"prot_id":18267,"protein_code":"NUDT5A-x1211_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1211_3_apo_4BTz6JJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -22.7130 26.9620 -59.3830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1040 29.1210 -58.1930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4990 27.7580 -58.3100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1180 25.7290 -58.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1580 25.7490 -57.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7150 27.6440 -55.8460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3990 28.9710 -55.7500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4820 29.6790 -54.3470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0590 29.7190 -56.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7060 31.0980 -56.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0290 30.9860 -54.2620 F 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8420 28.9700 -53.3980 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7390 29.7590 -53.8310 F 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7780 27.0450 -57.1020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.4320 32.2190 -57.0280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6620 29.9810 -59.5800 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 2 0\n 3 2 1 0\n 4 1 1 0\n 5 4 2 0\n 7 6 2 0\n 8 7 1 0\n 8 11 1 0\n 9 7 1 0\n 9 2 2 0\n 10 9 1 0\n 12 8 1 0\n 13 8 1 0\n 14 5 1 0\n 14 6 1 0\n 14 3 1 0\n 15 10 3 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245,"logp":2.88,"tpsa":41.09,"ha":16,"hacc":3,"hdon":0,"rots":0,"rings":2,"velec":82,"number":1211},{"id":18258,"smiles":"Oc1ncnc2cccc(F)c12","cmpd_id":1538,"prot_id":18271,"protein_code":"NUDT5A-x1212_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1212_3_apo_yQgQP4b.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -23.2430 25.3100 -56.6860 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.8410 28.7330 -57.3650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3020 27.5650 -59.9370 O 0 0 0 0 0 0 0 0 0 0 0 0\n -21.6270 29.1830 -56.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.9350 28.3250 -54.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4580 27.0570 -55.1780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6970 26.5920 -56.5070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4520 24.9200 -57.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6360 26.8770 -58.8660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3800 27.4260 -57.5970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5190 29.5160 -58.4200 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1740 25.6600 -59.0880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 1 2 0\n 8 1 1 0\n 9 3 1 0\n 10 9 2 0\n 10 7 1 0\n 10 2 1 0\n 11 2 1 0\n 12 9 1 0\n 12 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1212},{"id":18262,"smiles":"Oc1ncnc2ccc(F)cc12","cmpd_id":1539,"prot_id":18275,"protein_code":"NUDT5A-x1213_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1213_3_apo_tY2l33o.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -23.4300 25.0970 -56.8440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0280 29.0130 -56.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4120 27.4370 -60.0390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3330 28.1970 -55.1430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7670 26.9170 -55.3360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9500 26.4060 -56.6640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.6040 24.7060 -58.1150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1700 28.5660 -57.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6370 27.2600 -57.7150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8330 26.7330 -58.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5710 30.2780 -56.0590 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3460 25.4590 -59.2430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 6 1 2 0\n 7 1 1 0\n 8 2 2 0\n 9 6 1 0\n 9 8 1 0\n 10 3 1 0\n 10 9 2 0\n 11 2 1 0\n 12 10 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1213},{"id":18266,"smiles":"CSc1nc(C(F)(F)F)cc(=O)n1C","cmpd_id":1540,"prot_id":18279,"protein_code":"NUDT5A-x1214_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1214_3_apo_QxJQysE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -22.5760 28.4740 -57.8600 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9400 27.3450 -53.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5610 28.2790 -60.1360 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7980 27.7850 -56.6660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2040 29.9150 -57.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2720 25.8340 -57.7470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5240 24.3820 -57.5320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1020 26.3410 -58.9770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7340 27.7340 -59.0900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4410 23.7750 -57.0380 F 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4700 24.0680 -56.6680 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8320 23.7750 -58.6730 F 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1510 26.5180 -56.5930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5510 28.5670 -55.1170 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 5 1 1 0\n 7 6 1 0\n 7 10 1 0\n 8 6 2 0\n 9 8 1 0\n 9 3 2 0\n 9 1 1 0\n 11 7 1 0\n 12 7 1 0\n 13 6 1 0\n 13 4 2 0\n 14 4 1 0\n 14 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.02,"logp":1.52,"tpsa":34.89,"ha":14,"hacc":4,"hdon":0,"rots":1,"rings":1,"velec":78,"number":1214}],"220884":[{"id":18125,"smiles":"C[C@H]1CCO[C@@H]1C(=O)Nc1cnns1","cmpd_id":560,"prot_id":18138,"protein_code":"NUDT5A-x0114_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0114_3_apo_4bs2Eox.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -29.7210 5.1080 -63.9440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1200 1.4200 -65.7380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.3550 4.2720 -63.4470 O 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1450 2.9190 -65.4240 C 0 0 1 0 0 0 0 0 0 0 0 0\n -33.5610 3.5680 -65.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.4090 4.6780 -64.3250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5300 3.2840 -64.0390 C 0 0 1 0 0 0 0 0 0 0 0 0\n -30.0640 3.7560 -64.2700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.4710 5.7300 -64.0910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1090 7.0310 -63.7420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.7490 7.3080 -64.0480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.1180 6.3750 -64.5730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.2560 2.9400 -64.7040 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0620 4.9230 -64.8090 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 1\n 5 4 1 0\n 6 5 1 0\n 6 3 1 0\n 7 4 1 0\n 7 3 1 0\n 7 8 1 6\n 8 1 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 8 2 0\n 14 9 1 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.06,"logp":0.9,"tpsa":64.11,"ha":14,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":76,"number":114},{"id":18133,"smiles":"C[C@H]1CO[C@H](C)CN1C(=O)c1cnsn1","cmpd_id":562,"prot_id":18146,"protein_code":"NUDT5A-x0169_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0169_4_apo_zGtixN9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -30.3190 5.7740 -63.9320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.6940 3.7550 -65.0660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.9280 3.1260 -64.5590 O 0 0 0 0 0 0 0 0 0 0 0 0\n -29.1750 3.9960 -65.4140 C 0 0 1 0 0 0 0 0 0 0 0 0\n -29.6070 5.5120 -65.2450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4230 4.7670 -63.5750 C 0 0 1 0 0 0 0 0 0 0 0 0\n -32.8510 5.3510 -63.7030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.2940 3.4670 -64.4350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0210 6.7940 -62.9880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8160 7.6750 -63.0910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5040 7.1320 -63.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5370 8.0310 -63.4160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8010 8.9800 -62.8730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.7870 7.0200 -62.0730 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1930 9.5490 -63.0450 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 4 2 1 1\n 5 4 1 0\n 5 1 1 0\n 6 1 1 0\n 6 7 1 6\n 8 6 1 0\n 8 3 1 0\n 9 1 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 10 2 0\n 14 9 2 0\n 15 13 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.07,"logp":0.79,"tpsa":55.32,"ha":15,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":82,"number":169},{"id":18137,"smiles":"Cc1nc(C(=O)N2CCCC2)c(C)s1","cmpd_id":563,"prot_id":18150,"protein_code":"NUDT5A-x0171_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0171_4_apo_KXzBe71.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -30.0470 7.9770 -62.8350 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2250 9.6620 -62.7210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.0370 6.0430 -61.8910 O 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7800 8.3410 -63.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.2090 6.6440 -63.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5370 5.9890 -63.0300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.5920 4.6770 -63.8720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.9370 4.0830 -65.2570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.2420 5.0310 -66.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.9020 5.3560 -65.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.0760 6.0290 -63.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9650 4.6300 -64.2220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.2750 5.3590 -64.0630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7180 7.1200 -63.6790 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 5 1 1 0\n 6 5 1 0\n 6 3 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 5 2 0\n 12 11 1 0\n 13 7 1 0\n 13 10 1 0\n 13 6 1 0\n 14 11 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.08,"logp":2,"tpsa":33.2,"ha":14,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":76,"number":171},{"id":18141,"smiles":"CCNC(=O)c1c[nH]nn1","cmpd_id":129,"prot_id":18154,"protein_code":"NUDT5A-x0177_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0177_1_apo_ULByJ8z.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -27.8450 8.4520 -63.2970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0620 10.6450 -62.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.9690 7.5870 -63.3030 O 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2730 9.7380 -62.7790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7560 7.4590 -63.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2220 6.2190 -64.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9300 5.0430 -64.3100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.0130 4.2240 -64.9420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8180 4.8820 -65.0630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9130 6.0500 -64.5500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 4 2 1 0\n 5 3 2 0\n 5 1 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 6 1 0\n 10 9 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":140.07,"logp":-0.45,"tpsa":70.67,"ha":10,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":54,"number":177},{"id":18144,"smiles":"COC(=O)c1cccc(NS(C)(=O)=O)c1","cmpd_id":287,"prot_id":18157,"protein_code":"NUDT5A-x0256_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0256_1_apo_VlQOas4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n -30.0670 2.4150 -64.3910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2860 8.9760 -62.6050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3940 8.1360 -63.3100 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.6510 6.8370 -63.7940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9500 6.0050 -63.7470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.2180 6.5750 -63.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3720 5.7570 -63.3760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3090 4.3930 -63.6710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0660 3.8030 -64.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.4390 1.2820 -62.0260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8730 4.6020 -64.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6240 6.3830 -64.2790 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0180 -0.1270 -64.0430 O 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1840 1.2420 -63.2190 O 0 0 0 0 0 0 0 0 0 0 0 0\n -29.5680 1.0940 -63.4650 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 1 1 0\n 11 9 2 0\n 11 5 1 0\n 12 4 2 0\n 15 14 2 0\n 15 13 2 0\n 15 10 1 0\n 15 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.04,"logp":0.84,"tpsa":72.47,"ha":15,"hacc":4,"hdon":1,"rots":3,"rings":1,"velec":82,"number":256},{"id":18149,"smiles":"c1nc(N2CCC2)c2[nH]cnc2n1","cmpd_id":127,"prot_id":18162,"protein_code":"NUDT5A-x0262_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0262_4_apo_SutM9OP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 15 0 0 0 0 0 0 0 0999 V2000\n -30.5270 5.6280 -63.5790 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.5150 5.0250 -63.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.7860 6.4040 -63.7380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.1440 4.3540 -64.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.1830 5.9780 -63.9010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9760 5.5120 -64.5150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3380 7.5850 -63.6720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.3350 9.2940 -62.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7250 7.2400 -63.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.3080 5.0890 -64.4220 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.4270 6.7040 -64.1730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1180 8.8840 -63.2150 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.3090 8.3170 -62.9720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 2 1 0\n 4 1 1 0\n 5 1 1 0\n 9 7 1 0\n 9 5 2 0\n 10 5 1 0\n 10 6 2 0\n 11 7 2 0\n 11 6 1 0\n 12 8 2 0\n 12 7 1 0\n 13 9 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.09,"logp":0.56,"tpsa":57.7,"ha":13,"hacc":4,"hdon":1,"rots":1,"rings":3,"velec":66,"number":262},{"id":18152,"smiles":"Cc1cccc(Nc2ncnc3c2cnn3C)c1","cmpd_id":313,"prot_id":18165,"protein_code":"NUDT5A-x0286_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0286_3_apo_Zk9VayV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n -28.9890 3.7350 -63.8040 N 0 0 0 0 0 0 0 0 0 0 0 0\n -33.3690 1.3600 -63.8790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.8660 1.3160 -63.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9140 6.1410 -64.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2990 6.0450 -63.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.1470 2.5300 -63.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.1890 0.0850 -63.9120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8020 0.0800 -63.9610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.0720 1.2810 -63.9570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.7400 2.5100 -63.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.3400 5.0640 -63.5730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.7180 6.6860 -62.6060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6190 7.3180 -63.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3860 9.4290 -62.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5800 5.4190 -63.0690 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8130 7.6960 -62.5800 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4840 8.0760 -63.1910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.4290 7.3830 -63.7470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 5 4 1 0\n 6 3 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 6 1 0\n 10 1 1 0\n 11 1 1 0\n 11 5 2 0\n 13 5 1 0\n 15 11 1 0\n 15 12 2 0\n 16 13 2 0\n 16 12 1 0\n 17 14 1 0\n 17 13 1 0\n 18 17 1 0\n 18 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.12,"logp":2.42,"tpsa":55.63,"ha":18,"hacc":5,"hdon":1,"rots":2,"rings":3,"velec":90,"number":286},{"id":18156,"smiles":"CC(C)N(C)c1ncnc2c1cnn2C","cmpd_id":130,"prot_id":18169,"protein_code":"NUDT5A-x0299_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0299_3_apo_kWEYZOS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -29.6290 3.1440 -64.2690 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.3730 0.8860 -63.5860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6600 2.0500 -64.5760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1830 2.3710 -64.6180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2750 2.8210 -64.8240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.9290 4.5080 -63.8540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4470 6.1110 -63.0190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.3630 6.8390 -63.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1780 9.0330 -63.0440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5290 5.7590 -64.1380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9340 5.5540 -63.8460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.1920 4.8290 -63.4190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6160 7.1670 -62.9770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2520 7.6530 -63.4290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1420 7.0050 -63.8800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 3 1 0\n 5 1 1 0\n 6 1 1 0\n 11 6 2 0\n 11 10 1 0\n 11 8 1 0\n 12 6 1 0\n 12 7 2 0\n 13 8 2 0\n 13 7 1 0\n 14 9 1 0\n 14 8 1 0\n 15 14 1 0\n 15 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.1,"logp":1.12,"tpsa":46.84,"ha":16,"hacc":6,"hdon":1,"rots":3,"rings":2,"velec":86,"number":299},{"id":18163,"smiles":"CC(C)C(=O)Nc1nnn(C)n1","cmpd_id":567,"prot_id":18176,"protein_code":"NUDT5A-x0320_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0320_4_apo_TfIp2MB.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -29.4610 5.0120 -64.1020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -33.1400 4.2350 -64.4430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3400 6.0880 -63.2910 O 0 0 0 0 0 0 0 0 0 0 0 0\n -31.6460 3.8740 -64.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4190 2.8400 -63.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8500 5.1180 -63.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5180 6.0100 -63.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3750 9.2360 -62.8950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1020 5.9050 -64.1200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5700 7.0340 -63.8000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5610 7.8570 -63.3470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8120 7.2620 -63.3550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 4 1 0\n 6 1 1 0\n 6 3 2 0\n 7 1 1 0\n 9 7 1 0\n 10 9 2 0\n 11 8 1 0\n 11 10 1 0\n 12 11 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.1,"logp":-0.2,"tpsa":72.7,"ha":12,"hacc":5,"hdon":1,"rots":2,"rings":1,"velec":66,"number":320},{"id":18164,"smiles":"Cc1nsc(N2CCCNCC2)n1","cmpd_id":568,"prot_id":18177,"protein_code":"NUDT5A-x0333_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0333_1_apo_NHYacaB.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n -26.6920 7.4840 -63.7630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7480 9.4620 -62.7370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7510 8.0630 -63.2230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8030 6.1090 -63.5750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.3670 3.6600 -63.5470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.9190 2.7350 -64.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4610 2.7220 -64.7580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.2510 4.5040 -63.0270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.2440 5.4890 -63.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9640 7.3340 -63.0900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.7760 5.1140 -63.6270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.0730 3.0820 -63.4470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1340 5.9000 -64.1790 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 6 1 0\n 9 8 1 0\n 10 4 2 0\n 10 3 1 0\n 11 5 1 0\n 11 9 1 0\n 11 4 1 0\n 12 8 1 0\n 12 7 1 0\n 13 4 1 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.09,"logp":0.65,"tpsa":41.05,"ha":13,"hacc":5,"hdon":1,"rots":1,"rings":2,"velec":72,"number":333},{"id":18171,"smiles":"CCN(CC)c1cc(C)nc2ncnn12","cmpd_id":133,"prot_id":18184,"protein_code":"NUDT5A-x0339_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0339_4_apo_aKNKByS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -30.2830 5.0870 -63.6690 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1500 6.6640 -63.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3310 5.6710 -62.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.7060 3.9130 -64.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5470 2.5480 -63.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9740 5.7150 -63.8490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7470 7.0090 -63.4150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4640 7.6230 -63.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3320 9.0230 -63.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5660 5.7680 -64.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.4300 3.7660 -65.3150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3700 7.0550 -64.0350 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.6930 4.9250 -65.0880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7220 3.8210 -64.9250 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.8430 5.0790 -64.4180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 1 1 0\n 5 4 1 0\n 6 1 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 12 8 2 0\n 12 10 1 0\n 13 11 1 0\n 13 10 2 0\n 14 11 2 0\n 15 14 1 0\n 15 6 1 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.13,"logp":1.28,"tpsa":46.32,"ha":15,"hacc":5,"hdon":0,"rots":3,"rings":2,"velec":80,"number":339},{"id":18175,"smiles":"CNC(=O)c1cnc(C)s1","cmpd_id":137,"prot_id":18188,"protein_code":"NUDT5A-x0412_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0412_1_apo_ItP3e1w.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -29.3410 3.0290 -64.6300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6660 2.9820 -64.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3490 3.9150 -65.2420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -28.4220 4.1220 -64.6860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6580 5.4900 -64.1120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8190 6.0780 -63.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.3700 7.7760 -63.3870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.8390 9.1080 -63.0660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.6550 7.3990 -63.2070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3370 6.5970 -64.0400 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 3 2 0\n 4 1 1 0\n 5 4 1 0\n 6 5 2 0\n 8 7 1 0\n 9 7 2 0\n 9 6 1 0\n 10 7 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":156.04,"logp":0.81,"tpsa":41.99,"ha":10,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":54,"number":412},{"id":18179,"smiles":"CC(C)c1ncc(Cl)c(C(N)=O)n1","cmpd_id":418,"prot_id":18192,"protein_code":"NUDT5A-x0463_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0463_3_apo_vQF4kwP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -30.2950 4.7080 -64.4810 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5760 7.9850 -63.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.4910 6.4160 -64.6570 O 0 0 0 0 0 0 0 0 0 0 0 0\n -31.2990 6.6770 -63.2560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.5880 5.8210 -63.1520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.1310 5.9830 -63.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.1640 4.0660 -64.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.8730 4.6570 -64.7880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.8190 5.9940 -64.3190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5560 6.8200 -64.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9400 6.6530 -63.9040 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6550 8.0910 -63.7650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5340 3.6740 -65.1110 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 1 2 0\n 6 4 1 0\n 7 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 10 3 2 0\n 11 9 2 0\n 11 6 1 0\n 12 10 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.05,"logp":1.35,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":70,"number":463},{"id":18183,"smiles":"CNc1nccc(OC)n1","cmpd_id":571,"prot_id":18196,"protein_code":"NUDT5A-x0469_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0469_3_apo_2XpIelA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -26.7980 9.2210 -63.0530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7010 10.2290 -62.4940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.9240 4.9410 -64.7040 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.2810 8.0140 -63.4830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.0880 6.5590 -63.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2330 5.5450 -64.2200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8320 5.8740 -64.2540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.2520 3.6080 -65.1790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6760 7.7870 -63.4280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3120 7.0960 -63.8870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 2 0\n 7 6 1 0\n 7 3 1 0\n 8 3 1 0\n 9 5 1 0\n 9 4 2 0\n 10 4 1 0\n 10 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.07,"logp":0.53,"tpsa":47.04,"ha":10,"hacc":4,"hdon":1,"rots":2,"rings":1,"velec":54,"number":469},{"id":18188,"smiles":"Cc1n[nH]c(C)c1S(=O)(=O)N(C)C","cmpd_id":57,"prot_id":18201,"protein_code":"NUDT5A-x0552_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0552_1_apo_M0DIpDQ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -31.1580 8.1880 -64.7300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.9110 7.5030 -65.7940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9140 8.1900 -62.2090 O 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0880 9.6460 -64.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9190 7.5940 -63.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.9970 8.6940 -63.2910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2720 10.0100 -62.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.0910 6.6250 -64.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.4080 5.2990 -64.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.7530 8.3800 -63.7000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8500 7.1270 -64.2630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8650 6.0800 -63.4170 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5140 7.4600 -63.3640 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 8 1 0\n 10 6 2 0\n 11 8 1 0\n 11 10 1 0\n 13 12 2 0\n 13 5 1 0\n 13 3 2 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.07,"logp":0.28,"tpsa":66.06,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":74,"number":552},{"id":18195,"smiles":"c1csc(-c2nnc[nH]2)n1","cmpd_id":64,"prot_id":18208,"protein_code":"NUDT5A-x0574_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0574_3_apo_ua34DO8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -29.6200 4.8950 -64.3730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.5460 3.5800 -64.8720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2880 3.1660 -65.2290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.3980 5.4210 -64.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1060 6.7290 -63.9180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.3780 8.7850 -63.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8830 7.3320 -63.9060 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0560 8.5800 -63.4410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.0760 7.6130 -63.4360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1250 4.3950 -64.9640 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 2 0\n 5 4 1 0\n 7 5 2 0\n 8 6 2 0\n 8 7 1 0\n 9 6 1 0\n 9 5 1 0\n 10 4 1 0\n 10 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.02,"logp":0.93,"tpsa":54.46,"ha":10,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":50,"number":574},{"id":18205,"smiles":"CCNc1ccc(C)nn1","cmpd_id":402,"prot_id":18218,"protein_code":"NUDT5A-x0637_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0637_4_apo_zgcC3n2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -27.5590 8.7020 -63.5230 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9130 10.2410 -62.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9200 8.9540 -63.0360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1630 7.4910 -64.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.9730 6.3110 -64.1680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4080 5.1860 -64.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.0860 5.3000 -65.3470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.3540 4.2010 -66.0800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.3710 6.4890 -65.1780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8520 7.5000 -64.5740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.1,"logp":1.22,"tpsa":37.81,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":637},{"id":18209,"smiles":"Cn1cc(Oc2ncncc2Cl)cn1","cmpd_id":196,"prot_id":18222,"protein_code":"NUDT5A-x0673_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0673_3_apo_aKPce2w.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -32.4610 4.4040 -64.3750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -33.5990 3.5050 -64.1280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.9940 6.9560 -63.8080 O 0 0 0 0 0 0 0 0 0 0 0 0\n -31.7840 5.2300 -63.4530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8280 5.9060 -64.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6360 6.8360 -63.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8150 5.4680 -64.4170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3790 7.6400 -63.7040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7420 7.8810 -63.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9710 5.4160 -65.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1740 5.5970 -64.3170 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8760 6.4440 -64.1290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.9700 4.5170 -65.6380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1650 9.3790 -62.9540 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 2 0\n 5 3 1 0\n 6 3 1 0\n 9 6 2 0\n 9 8 1 0\n 10 5 1 0\n 11 6 1 0\n 11 7 2 0\n 12 8 2 0\n 12 7 1 0\n 13 10 2 0\n 13 1 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.03,"logp":1.66,"tpsa":52.83,"ha":14,"hacc":5,"hdon":0,"rots":2,"rings":2,"velec":72,"number":673},{"id":18215,"smiles":"COc1ccc2cn[nH]c(=O)c2c1OC","cmpd_id":578,"prot_id":18228,"protein_code":"NUDT5A-x0685_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0685_4_apo_9VdEaE5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -26.9750 6.8000 -63.9890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.9900 1.6570 -65.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.6940 2.3820 -64.6300 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5660 3.2040 -64.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.3250 2.6910 -65.0580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1900 3.4940 -65.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2500 4.7980 -64.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0460 5.5970 -64.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.4060 6.7150 -63.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.4610 5.3530 -64.0640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6540 4.5540 -64.0840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.7960 4.3820 -62.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1020 7.3370 -63.4810 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.3060 7.3440 -62.9280 O 0 0 0 0 0 0 0 0 0 0 0 0\n -31.8710 5.1390 -63.6980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 1 2 0\n 10 7 1 0\n 10 9 1 0\n 11 10 2 0\n 11 4 1 0\n 13 9 1 0\n 13 1 1 0\n 14 9 2 0\n 15 12 1 0\n 15 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.07,"logp":0.94,"tpsa":64.21,"ha":15,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":78,"number":685},{"id":18237,"smiles":"Nc1nccc(C(F)(F)F)n1","cmpd_id":1533,"prot_id":18250,"protein_code":"NUDT5A-x1072_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1072_1_apo_wcjDpCl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -29.4320 7.1400 -63.2830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3200 5.6510 -63.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8250 5.9430 -63.7780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.0620 7.4140 -63.4420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.6360 5.3870 -64.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.9980 5.0040 -64.4060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1080 6.6010 -64.0890 F 0 0 0 0 0 0 0 0 0 0 0 0\n -31.6510 5.5490 -62.3200 F 0 0 0 0 0 0 0 0 0 0 0 0\n -31.7440 4.4890 -64.1810 F 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5880 8.6040 -62.9270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1370 6.5620 -64.0580 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 6 3 1 0\n 8 2 1 0\n 9 2 1 0\n 10 4 1 0\n 11 5 1 0\n 11 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":163.04,"logp":1.08,"tpsa":51.8,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":60,"number":1072},{"id":18241,"smiles":"O=c1[nH]cnc2cc(F)ccc12","cmpd_id":1534,"prot_id":18254,"protein_code":"NUDT5A-x1078_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1078_1_apo_6hT0ud8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -29.9280 8.4750 -62.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.7010 5.5420 -63.9930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6780 6.4830 -64.3100 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6400 4.7240 -64.5140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.3250 5.1950 -64.4800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4280 6.8010 -63.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.1200 7.2460 -63.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7040 8.9380 -62.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.0660 6.4670 -63.9490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.6980 7.0080 -63.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.9940 5.0760 -63.9550 F 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5720 8.2810 -63.3290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 2 1 0\n 7 6 2 0\n 7 1 1 0\n 8 1 2 0\n 9 5 2 0\n 9 7 1 0\n 10 9 1 0\n 10 3 2 0\n 11 2 1 0\n 12 10 1 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.06,"tpsa":45.75,"ha":12,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1078},{"id":18248,"smiles":"FC(F)c1nnc2c(C(F)(F)F)cccn12","cmpd_id":1536,"prot_id":18261,"protein_code":"NUDT5A-x1093_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1093_1_apo_20ikqR5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -28.7620 6.7460 -63.8730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.9120 3.3840 -65.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7280 4.4870 -64.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0650 4.3800 -64.5720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.7640 5.4720 -63.9460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.1250 6.6390 -63.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.0330 5.6820 -64.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.8070 7.7370 -63.6630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.9930 9.0950 -63.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8680 3.8390 -66.2630 F 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6460 2.6400 -66.3880 F 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8040 9.7100 -62.9850 F 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7320 9.9100 -63.8400 F 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3960 2.4890 -64.6670 F 0 0 0 0 0 0 0 0 0 0 0 0\n -26.7120 6.0720 -64.6260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5850 7.2880 -64.1290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 1 1 0\n 7 3 1 0\n 7 1 1 0\n 8 1 1 0\n 9 8 1 0\n 9 12 1 0\n 11 2 1 0\n 13 9 1 0\n 14 2 1 0\n 15 7 2 0\n 16 8 2 0\n 16 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.03,"logp":2.69,"tpsa":30.19,"ha":16,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":86,"number":1093},{"id":18252,"smiles":"N#Cc1c(C(F)(F)F)cn2ccnc2c1Cl","cmpd_id":1537,"prot_id":18265,"protein_code":"NUDT5A-x1211_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1211_1_apo_3oHcfRJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -26.9500 7.1130 -63.9640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2630 4.9230 -64.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.0650 6.3050 -63.9790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4430 8.3760 -63.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8340 8.3410 -63.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5290 6.4580 -63.4970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6680 5.1280 -63.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.0530 4.4390 -63.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.4990 4.3380 -64.2240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.5630 2.9160 -64.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.0690 5.2100 -63.3370 F 0 0 0 0 0 0 0 0 0 0 0 0\n -32.0590 3.2990 -63.0950 F 0 0 0 0 0 0 0 0 0 0 0 0\n -32.4830 4.0510 -65.0520 F 0 0 0 0 0 0 0 0 0 0 0 0\n -29.2510 7.0330 -63.5590 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.5980 1.7490 -64.4090 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9760 4.0490 -64.9060 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 5 4 2 0\n 7 6 2 0\n 8 7 1 0\n 8 11 1 0\n 9 7 1 0\n 9 2 2 0\n 10 9 1 0\n 12 8 1 0\n 13 8 1 0\n 14 6 1 0\n 14 5 1 0\n 14 3 1 0\n 15 10 3 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245,"logp":2.88,"tpsa":41.09,"ha":16,"hacc":3,"hdon":0,"rots":0,"rings":2,"velec":82,"number":1211},{"id":18256,"smiles":"Oc1ncnc2cccc(F)c12","cmpd_id":1538,"prot_id":18269,"protein_code":"NUDT5A-x1212_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1212_1_apo_krzn2iR.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -29.7830 8.1080 -63.0090 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6140 4.9010 -64.4920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.1470 6.5620 -64.1540 O 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8070 4.2310 -64.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0170 4.8880 -64.1190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9920 6.1710 -63.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.7640 6.8580 -63.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5920 8.7220 -62.8810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3570 7.0100 -63.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5490 6.2370 -63.9810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4920 4.2910 -64.9040 F 0 0 0 0 0 0 0 0 0 0 0 0\n -27.3460 8.2270 -63.2600 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 1 2 0\n 8 1 1 0\n 9 3 1 0\n 10 2 1 0\n 10 9 2 0\n 10 7 1 0\n 11 2 1 0\n 12 9 1 0\n 12 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1212},{"id":18260,"smiles":"Oc1ncnc2ccc(F)cc12","cmpd_id":1539,"prot_id":18273,"protein_code":"NUDT5A-x1213_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1213_1_apo_2LT7ouH.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -29.4980 8.5540 -62.8870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.7850 4.6990 -64.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.0630 6.7040 -64.1800 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9650 5.3930 -63.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8550 6.6840 -63.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.5830 7.2870 -63.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2730 9.1190 -62.8920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5760 5.2730 -64.3350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.4740 6.5760 -63.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.2180 7.2760 -63.7940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8670 3.4440 -64.7760 F 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0820 8.5410 -63.3500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 6 1 2 0\n 7 1 1 0\n 8 2 2 0\n 9 8 1 0\n 9 6 1 0\n 10 9 2 0\n 10 3 1 0\n 11 2 1 0\n 12 7 2 0\n 12 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1213},{"id":18264,"smiles":"CSc1nc(C(F)(F)F)cc(=O)n1C","cmpd_id":1540,"prot_id":18277,"protein_code":"NUDT5A-x1214_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1214_1_apo_pSyxEGO.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -28.2670 6.0130 -64.1270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.3960 6.1310 -63.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.0390 6.6880 -64.3750 O 0 0 0 0 0 0 0 0 0 0 0 0\n -29.5710 6.4240 -63.7360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.9640 4.6190 -64.5810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8300 8.5650 -63.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.2090 9.9150 -62.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5480 8.3260 -63.5890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1840 6.9950 -64.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0280 9.7010 -61.5970 F 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1750 10.6450 -62.1940 F 0 0 0 0 0 0 0 0 0 0 0 0\n -29.9270 10.7300 -63.5010 F 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8770 7.6470 -63.3060 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9100 5.2840 -63.7950 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 5 1 1 0\n 7 6 1 0\n 7 10 1 0\n 8 6 2 0\n 9 8 1 0\n 9 1 1 0\n 9 3 2 0\n 11 7 1 0\n 12 7 1 0\n 13 6 1 0\n 13 4 2 0\n 14 4 1 0\n 14 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.02,"logp":1.52,"tpsa":34.89,"ha":14,"hacc":4,"hdon":0,"rots":1,"rings":1,"velec":78,"number":1214}],"220885":[{"id":18126,"smiles":"C[C@H]1CCO[C@@H]1C(=O)Nc1cnns1","cmpd_id":560,"prot_id":18139,"protein_code":"NUDT5A-x0114_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0114_4_apo_ZDQmod2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -16.9370 -14.9630 -5.2050 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.3090 -15.1220 -7.3410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4140 -16.4090 -8.5600 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7280 -14.9010 -7.8310 C 0 0 1 0 0 0 0 0 0 0 0 0\n -15.8080 -14.8890 -9.3460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5830 -16.1920 -9.6650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6340 -16.1050 -7.4390 C 0 0 1 0 0 0 0 0 0 0 0 0\n -17.4820 -15.8460 -6.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4640 -14.6290 -4.0390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9550 -13.7600 -3.1310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7160 -13.7720 -1.9770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.6820 -14.5430 -1.9770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.5910 -16.3890 -6.0420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -18.8740 -15.4220 -3.4110 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 6\n 5 4 1 0\n 6 3 1 0\n 6 5 1 0\n 7 3 1 0\n 7 4 1 0\n 7 8 1 1\n 8 1 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 8 2 0\n 14 12 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.06,"logp":0.9,"tpsa":64.11,"ha":14,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":76,"number":114},{"id":18129,"smiles":"CN1CCN(C(=O)c2ccc(F)c(F)c2)CC1","cmpd_id":561,"prot_id":18142,"protein_code":"NUDT5A-x0158_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0158_1_apo_s5SAx42.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -20.2570 -18.0960 -5.1170 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3640 -19.1460 -5.7230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.5800 -14.5870 -1.9400 O 0 0 0 0 0 0 0 0 0 0 0 0\n -19.9780 -17.9110 -3.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7070 -12.1480 -3.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9360 -12.7630 -3.3060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.2750 -16.4450 -3.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0680 -15.9050 -5.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.2140 -16.7920 -5.9080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3850 -14.7380 -3.1440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1340 -14.0920 -3.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1240 -14.7870 -4.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.8980 -14.1550 -4.6970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6800 -12.8320 -4.2510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -13.4990 -12.2220 -4.3600 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4860 -10.9150 -3.2190 F 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3360 -15.4890 -3.9400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 2 0\n 7 4 1 0\n 9 1 1 0\n 9 8 1 0\n 10 3 2 0\n 11 10 1 0\n 11 6 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 5 1 0\n 15 14 1 0\n 16 5 1 0\n 17 7 1 0\n 17 10 1 0\n 17 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":240.11,"logp":1.35,"tpsa":23.55,"ha":17,"hacc":2,"hdon":0,"rots":1,"rings":2,"velec":92,"number":158},{"id":18130,"smiles":"C[C@H]1CO[C@H](C)CN1C(=O)c1cnsn1","cmpd_id":562,"prot_id":18143,"protein_code":"NUDT5A-x0169_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0169_1_apo_GHobqff.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -17.0680 -15.1770 -6.2510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -20.0530 -16.0930 -5.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.9140 -17.2850 -6.8480 O 0 0 0 0 0 0 0 0 0 0 0 0\n -18.8130 -16.9120 -5.4560 C 0 0 1 0 0 0 0 0 0 0 0 0\n -17.5020 -16.1150 -5.1580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2240 -15.7270 -7.6450 C 0 0 1 0 0 0 0 0 0 0 0 0\n -16.1760 -16.8230 -7.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.6610 -16.2790 -7.8020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5220 -13.9010 -6.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3940 -13.2440 -4.7720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4350 -13.2470 -3.7110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1570 -12.4980 -2.7090 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.3670 -12.5060 -4.5080 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0590 -13.2760 -7.0720 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6790 -11.8180 -3.0350 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 4 2 1 6\n 5 4 1 0\n 5 1 1 0\n 6 1 1 0\n 6 7 1 1\n 8 3 1 0\n 8 6 1 0\n 9 1 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 10 2 0\n 14 9 2 0\n 15 12 1 0\n 15 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.07,"logp":0.79,"tpsa":55.32,"ha":15,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":82,"number":169},{"id":18136,"smiles":"Cc1nc(C(=O)N2CCCC2)c(C)s1","cmpd_id":563,"prot_id":18149,"protein_code":"NUDT5A-x0171_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0171_3_apo_zTsdhf5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -14.9500 -12.7400 -5.2630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.2350 -11.2220 -3.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8760 -13.5450 -7.8100 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1170 -12.2200 -4.0890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9390 -13.6850 -5.4970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9410 -14.3040 -6.8270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6560 -16.6860 -5.9360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1710 -17.9240 -6.6970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4200 -17.6750 -8.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1420 -16.3190 -8.2940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8460 -13.8720 -4.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9810 -14.7990 -4.4000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8880 -15.6700 -6.9840 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4680 -12.8220 -3.1690 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 5 1 1 0\n 6 5 1 0\n 6 3 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 5 2 0\n 12 11 1 0\n 13 7 1 0\n 13 10 1 0\n 13 6 1 0\n 14 11 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.08,"logp":2,"tpsa":33.2,"ha":14,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":76,"number":171},{"id":18140,"smiles":"CN(C[C@H]1CCOC1)c1ncncc1Cl","cmpd_id":564,"prot_id":18153,"protein_code":"NUDT5A-x0176_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0176_3_apo_BIK1hOI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -16.3250 -15.2820 -5.7280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1590 -14.8970 -6.5200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.1020 -15.9210 -9.0160 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9070 -16.6390 -6.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4930 -16.8210 -7.5080 C 0 0 1 0 0 0 0 0 0 0 0 0\n -18.8090 -17.6460 -7.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3760 -17.2870 -8.8580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9310 -15.5550 -8.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8460 -14.4950 -4.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.5720 -14.2820 -3.0840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8120 -12.8350 -2.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1980 -13.3920 -4.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0840 -14.9180 -4.1680 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9920 -13.2530 -2.4160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.7280 -12.6230 -4.4280 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 1 1\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 5 1 0\n 8 3 1 0\n 9 1 1 0\n 12 11 1 0\n 12 9 2 0\n 13 10 2 0\n 13 9 1 0\n 14 11 2 0\n 14 10 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.08,"logp":1.6,"tpsa":38.25,"ha":15,"hacc":4,"hdon":0,"rots":3,"rings":2,"velec":82,"number":176},{"id":18142,"smiles":"CCNC(=O)c1c[nH]nn1","cmpd_id":129,"prot_id":18155,"protein_code":"NUDT5A-x0177_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0177_2_apo_RsywP5V.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -15.5240 -11.9460 -3.1990 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.0650 -11.5680 -3.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2090 -13.2060 -5.0700 O 0 0 0 0 0 0 0 0 0 0 0 0\n -14.4370 -10.9900 -3.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8190 -12.9950 -4.0150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9100 -13.8590 -3.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4490 -14.9140 -4.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.4440 -15.4050 -3.5440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.5180 -14.6770 -2.3510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.6180 -13.7550 -2.3650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 1 0\n 5 3 2 0\n 5 1 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 2 0\n 10 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":140.07,"logp":-0.45,"tpsa":70.67,"ha":10,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":54,"number":177},{"id":18143,"smiles":"COC(=O)CNC(=O)c1cc(C)on1","cmpd_id":393,"prot_id":18156,"protein_code":"NUDT5A-x0244_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0244_1_apo_3RpBopD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -18.7290 -15.5120 -4.1250 N 0 0 0 0 0 0 0 0 0 0 0 0\n -20.5320 -19.9750 -3.3250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.0770 -18.6530 -2.9840 O 0 0 0 0 0 0 0 0 0 0 0 0\n -19.8320 -17.7030 -3.9620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.9480 -16.2230 -3.6520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0490 -14.6110 -3.3010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8570 -13.9560 -3.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0940 -12.9420 -3.1580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1000 -12.6360 -4.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -13.9640 -11.7140 -3.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3080 -14.2050 -5.0380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.5190 -18.1280 -5.0640 O 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3950 -14.3520 -2.1700 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2380 -13.4010 -5.1670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 5 1 1 0\n 6 1 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 7 2 0\n 12 4 2 0\n 13 6 2 0\n 14 11 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.06,"logp":-0.11,"tpsa":81.43,"ha":14,"hacc":5,"hdon":1,"rots":3,"rings":1,"velec":76,"number":244},{"id":18147,"smiles":"c1nc(N2CCC2)c2[nH]cnc2n1","cmpd_id":127,"prot_id":18160,"protein_code":"NUDT5A-x0262_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0262_2_apo_puQy5nV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 15 0 0 0 0 0 0 0 0999 V2000\n -16.2260 -15.1970 -6.0650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8490 -16.0010 -7.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.3030 -14.7790 -7.1470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0370 -16.1490 -6.9240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6620 -14.5640 -4.9150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0100 -14.4330 -3.0370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2840 -12.9240 -3.1440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6270 -11.7190 -3.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9170 -13.4700 -4.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7250 -15.0510 -4.2270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3550 -13.4150 -2.4380 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4410 -11.8190 -2.8410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.8770 -12.6780 -4.8360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 2 1 0\n 4 1 1 0\n 5 1 1 0\n 9 5 2 0\n 9 7 1 0\n 10 6 2 0\n 10 5 1 0\n 11 6 1 0\n 11 7 2 0\n 12 8 2 0\n 12 7 1 0\n 13 9 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.09,"logp":0.56,"tpsa":57.7,"ha":13,"hacc":4,"hdon":1,"rots":1,"rings":3,"velec":66,"number":262},{"id":18151,"smiles":"Cc1cccc(Nc2ncnc3c2cnn3C)c1","cmpd_id":313,"prot_id":18164,"protein_code":"NUDT5A-x0286_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0286_2_apo_KbF14TN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n -18.3660 -16.1300 -5.3680 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.8050 -17.7080 -9.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.8700 -17.7820 -8.4130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4010 -14.1550 -3.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9480 -14.3860 -4.4830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0280 -16.9630 -7.6260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.7670 -18.6910 -7.8390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.8300 -18.7990 -6.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.0160 -18.0030 -5.6520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0980 -17.0580 -6.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3350 -15.1670 -5.5920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5820 -14.1130 -6.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8500 -13.4850 -4.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.7860 -11.7110 -3.3370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6190 -14.9980 -6.7750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.0910 -13.3080 -5.8680 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7340 -12.7890 -3.5230 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6530 -13.1850 -2.5970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 5 4 1 0\n 6 3 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 6 1 0\n 10 1 1 0\n 11 5 2 0\n 11 1 1 0\n 13 5 1 0\n 15 11 1 0\n 15 12 2 0\n 16 12 1 0\n 16 13 2 0\n 17 14 1 0\n 17 13 1 0\n 18 4 2 0\n 18 17 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.12,"logp":2.42,"tpsa":55.63,"ha":18,"hacc":5,"hdon":1,"rots":2,"rings":3,"velec":90,"number":286},{"id":18155,"smiles":"CC(C)N(C)c1ncnc2c1cnn2C","cmpd_id":130,"prot_id":18168,"protein_code":"NUDT5A-x0299_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0299_2_apo_0zOQ2mD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -19.3060 -16.1380 -5.7950 N 0 0 0 0 0 0 0 0 0 0 0 0\n -20.0030 -18.4730 -6.7020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.5820 -17.0110 -7.0460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.6340 -16.3810 -7.9450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.1120 -16.3290 -4.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1120 -15.2720 -5.7620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2070 -14.3500 -6.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5870 -13.6430 -4.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.3990 -11.9530 -3.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.2130 -14.1680 -3.2690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7530 -14.4700 -4.6170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3030 -15.1910 -6.9060 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7780 -13.5520 -5.9050 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4440 -12.9460 -3.6070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4110 -13.2630 -2.7000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 3 1 0\n 5 1 1 0\n 6 1 1 0\n 11 6 2 0\n 11 10 1 0\n 11 8 1 0\n 12 6 1 0\n 12 7 2 0\n 13 8 2 0\n 13 7 1 0\n 14 8 1 0\n 14 9 1 0\n 15 14 1 0\n 15 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.1,"logp":1.12,"tpsa":46.84,"ha":16,"hacc":6,"hdon":1,"rots":3,"rings":2,"velec":86,"number":299},{"id":18159,"smiles":"Cc1nsc(N2CCO[C@@H](C)[C@H]2C)n1","cmpd_id":566,"prot_id":18172,"protein_code":"NUDT5A-x0319_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0319_2_apo_53jHsup.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -17.8590 -15.2600 -5.7220 N 0 0 0 0 0 0 0 0 0 0 0 0\n -20.6700 -17.2770 -7.5620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.9420 -15.9130 -8.3700 O 0 0 0 0 0 0 0 0 0 0 0 0\n -19.9310 -15.9300 -7.3270 C 0 0 2 0 0 0 0 0 0 0 0 0\n -17.5960 -16.1730 -8.0210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1060 -15.1300 -7.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3790 -15.6430 -5.8150 C 0 0 1 0 0 0 0 0 0 0 0 0\n -19.6660 -16.7700 -4.8110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4580 -14.3720 -4.7020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3240 -12.8570 -3.5040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2200 -11.9040 -3.3060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4000 -13.5410 -4.7330 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2240 -13.0950 -2.5790 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3080 -14.2490 -3.1520 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 1\n 4 3 1 0\n 5 3 1 0\n 6 5 1 0\n 6 1 1 0\n 7 4 1 0\n 7 1 1 0\n 7 8 1 1\n 9 1 1 0\n 11 10 1 0\n 12 9 2 0\n 12 10 1 0\n 13 10 2 0\n 14 13 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":1.46,"tpsa":38.25,"ha":14,"hacc":5,"hdon":0,"rots":1,"rings":2,"velec":78,"number":319},{"id":18161,"smiles":"CC(C)C(=O)Nc1nnn(C)n1","cmpd_id":567,"prot_id":18174,"protein_code":"NUDT5A-x0320_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0320_2_apo_9h5hxeV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -17.2010 -15.2390 -5.5430 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0380 -16.9270 -8.7600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6980 -14.5970 -7.1650 O 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1300 -16.5010 -7.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.4170 -16.0410 -8.4470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5820 -15.3550 -6.8260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8520 -14.2900 -4.5940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.9070 -11.6410 -3.3160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4430 -14.1420 -3.3120 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8340 -13.1740 -2.7510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8770 -12.6980 -3.5930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8460 -13.3480 -4.7630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 4 1 0\n 6 1 1 0\n 6 3 2 0\n 7 1 1 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 11 8 1 0\n 12 7 2 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.1,"logp":-0.2,"tpsa":72.7,"ha":12,"hacc":5,"hdon":1,"rots":2,"rings":1,"velec":66,"number":320},{"id":18165,"smiles":"Cc1nsc(N2CCCNCC2)n1","cmpd_id":568,"prot_id":18178,"protein_code":"NUDT5A-x0333_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0333_2_apo_MwWO77i.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n -16.8680 -12.9780 -2.6270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.8510 -11.8120 -3.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9680 -12.7550 -3.5650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0940 -14.2750 -4.7420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.9980 -15.3830 -5.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3800 -16.8340 -6.0610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.2820 -17.2240 -7.5370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3440 -15.8070 -8.2700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6850 -15.1360 -7.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0280 -13.4470 -4.7870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.5050 -15.1080 -5.7540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8680 -17.1460 -7.9450 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9590 -14.1440 -3.1680 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 2 0\n 3 2 1 0\n 6 5 1 0\n 7 6 1 0\n 9 8 1 0\n 10 4 2 0\n 10 3 1 0\n 11 9 1 0\n 11 5 1 0\n 11 4 1 0\n 12 7 1 0\n 12 8 1 0\n 13 4 1 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.09,"logp":0.65,"tpsa":41.05,"ha":13,"hacc":5,"hdon":1,"rots":1,"rings":2,"velec":72,"number":333},{"id":18169,"smiles":"CCN(CC)c1cc(C)nc2ncnn12","cmpd_id":133,"prot_id":18182,"protein_code":"NUDT5A-x0339_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0339_2_apo_67e5DLF.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -16.7670 -15.5570 -6.3840 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6170 -15.4750 -7.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0250 -14.9310 -7.4920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4090 -16.9050 -6.7080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.7890 -16.8780 -7.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8680 -14.9410 -5.0890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0090 -13.8920 -4.7320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0890 -13.2440 -3.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1170 -12.1500 -3.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8490 -14.6040 -2.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3700 -16.1640 -2.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9710 -13.5580 -2.5340 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.8450 -15.1770 -2.1510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.7750 -16.2670 -4.1740 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8080 -15.2920 -4.1220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0\n 3 2 1 0\n 4 1 1 0\n 5 4 1 0\n 6 1 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 12 10 1 0\n 12 8 2 0\n 13 11 1 0\n 13 10 2 0\n 14 11 2 0\n 15 14 1 0\n 15 10 1 0\n 15 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.13,"logp":1.28,"tpsa":46.32,"ha":15,"hacc":5,"hdon":0,"rots":3,"rings":2,"velec":80,"number":339},{"id":18173,"smiles":"CC(=O)N1CCC[C@@H](C(N)=O)C1","cmpd_id":569,"prot_id":18186,"protein_code":"NUDT5A-x0392_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0392_2_apo_TtSNHdF.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -17.0950 -15.6720 -6.0330 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8660 -15.9330 -8.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0910 -14.0360 -7.2850 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6550 -15.1390 -7.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1560 -16.7420 -5.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.4280 -16.2010 -5.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0310 -15.4640 -3.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9640 -14.3810 -4.1850 C 0 0 2 0 0 0 0 0 0 0 0 0\n -16.7300 -15.0380 -4.7800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4570 -13.6790 -2.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7220 -14.2310 -1.7700 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8120 -12.6360 -3.0080 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 1 0\n 4 3 2 0\n 5 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 10 1 1\n 9 1 1 0\n 9 8 1 0\n 11 10 1 0\n 12 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.11,"logp":-0.27,"tpsa":63.4,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":68,"number":392},{"id":18176,"smiles":"CNC(=O)c1cnc(C)s1","cmpd_id":137,"prot_id":18189,"protein_code":"NUDT5A-x0412_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0412_2_apo_uwJ181D.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -19.2680 -15.9320 -4.0390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.2560 -16.3200 -5.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.6170 -14.8980 -2.1430 O 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3960 -15.0520 -3.3360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2530 -14.3040 -3.9040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6260 -14.4010 -5.1250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4610 -12.7210 -4.2210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.4650 -11.6570 -4.0500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5870 -13.4760 -5.3100 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5320 -13.0500 -2.9490 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 3 2 0\n 4 1 1 0\n 5 4 1 0\n 6 5 2 0\n 8 7 1 0\n 9 6 1 0\n 9 7 2 0\n 10 5 1 0\n 10 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":156.04,"logp":0.81,"tpsa":41.99,"ha":10,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":54,"number":412},{"id":18178,"smiles":"CC(C)c1ncc(Cl)c(C(N)=O)n1","cmpd_id":418,"prot_id":18191,"protein_code":"NUDT5A-x0463_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0463_2_apo_IxADCQl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -17.1150 -16.4160 -5.9750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9280 -15.0330 -8.2160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.6040 -14.0710 -1.6170 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1540 -15.3160 -6.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.1140 -14.2390 -6.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1780 -15.4400 -5.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1230 -16.5220 -5.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.2040 -15.6920 -3.9840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1630 -14.7270 -3.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0580 -13.8300 -2.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1490 -14.5800 -4.7340 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3020 -12.7330 -2.8500 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.4980 -15.9040 -2.9710 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 1 0\n 6 1 2 0\n 6 4 1 0\n 7 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 10 3 2 0\n 11 9 2 0\n 11 6 1 0\n 12 10 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.05,"logp":1.35,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":70,"number":463},{"id":18185,"smiles":"NC(=O)N1CCN(C(=O)c2ccco2)CC1","cmpd_id":572,"prot_id":18198,"protein_code":"NUDT5A-x0525_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0525_2_apo_zmlw58f.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -20.0060 -18.8210 -6.9880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.9700 -18.7020 -5.6140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.3640 -19.6360 -4.8830 O 0 0 0 0 0 0 0 0 0 0 0 0\n -20.3390 -16.6390 -4.2910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.5370 -15.8020 -3.3150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8590 -15.4320 -5.2740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.7080 -16.5160 -6.0170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7290 -14.1650 -3.0150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5620 -13.3590 -3.4010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5250 -13.4820 -4.3050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6910 -12.3260 -4.0910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2590 -11.6100 -3.1240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.4420 -17.4220 -5.0920 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3790 -15.0400 -3.9010 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1510 -14.0480 -1.8590 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4080 -12.2190 -2.6760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 5 4 1 0\n 7 6 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 7 1 0\n 13 2 1 0\n 13 4 1 0\n 14 8 1 0\n 14 6 1 0\n 14 5 1 0\n 15 8 2 0\n 16 9 1 0\n 16 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.1,"logp":0.12,"tpsa":79.78,"ha":16,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":86,"number":525},{"id":18190,"smiles":"Cc1n[nH]c(C)c1S(=O)(=O)N(C)C","cmpd_id":57,"prot_id":18203,"protein_code":"NUDT5A-x0552_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0552_3_apo_f3Zv95b.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -14.6300 -14.8860 -5.7800 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6060 -16.2410 -5.2360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6510 -13.0150 -7.0660 O 0 0 0 0 0 0 0 0 0 0 0 0\n -13.3270 -14.2390 -5.8640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3870 -13.5980 -4.7040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4250 -14.0900 -3.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3820 -15.2010 -3.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7790 -12.5620 -3.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6410 -11.6900 -4.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4210 -13.3890 -2.6530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4170 -12.4790 -2.7900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8710 -15.0770 -6.7170 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9780 -14.1060 -6.2080 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 8 1 0\n 10 6 2 0\n 11 10 1 0\n 11 8 1 0\n 13 12 2 0\n 13 5 1 0\n 13 3 2 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.07,"logp":0.28,"tpsa":66.06,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":74,"number":552},{"id":18192,"smiles":"Cc1n[nH]c(C)c1-c1ccccc1N","cmpd_id":575,"prot_id":18205,"protein_code":"NUDT5A-x0554_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0554_2_apo_BGTjEPw.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -15.2910 -15.2460 -7.5360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5600 -16.3680 -5.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6200 -15.2040 -6.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6760 -12.4580 -3.7940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8950 -13.1120 -6.9880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1540 -11.6730 -7.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0060 -13.8810 -5.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4420 -13.4040 -4.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7050 -13.8030 -4.1010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.2400 -13.2590 -2.9310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4990 -12.3130 -2.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2340 -11.9190 -2.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4630 -13.9730 -7.9890 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.4020 -12.0500 -4.1440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 6 5 1 0\n 7 5 2 0\n 7 3 1 0\n 8 7 1 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 4 1 0\n 13 5 1 0\n 13 1 1 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":187.11,"logp":2.28,"tpsa":54.7,"ha":14,"hacc":2,"hdon":2,"rots":1,"rings":2,"velec":72,"number":554},{"id":18194,"smiles":"c1csc(-c2nnc[nH]2)n1","cmpd_id":64,"prot_id":18207,"protein_code":"NUDT5A-x0574_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0574_2_apo_GGIjdCj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -17.3600 -15.5450 -5.2470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.4450 -16.4590 -5.3330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3420 -16.4070 -4.3070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.5170 -14.8260 -4.1340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6560 -13.7680 -3.7840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.0340 -12.3060 -3.8910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.7870 -12.9200 -2.7480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7980 -12.0480 -2.8270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5560 -13.4130 -4.5230 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.8900 -15.1990 -3.1740 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 2 0\n 5 4 1 0\n 7 5 2 0\n 8 7 1 0\n 8 6 2 0\n 9 5 1 0\n 9 6 1 0\n 10 3 1 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.02,"logp":0.93,"tpsa":54.46,"ha":10,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":50,"number":574},{"id":18197,"smiles":"CNc1ncccn1","cmpd_id":298,"prot_id":18210,"protein_code":"NUDT5A-x0600_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0600_1_apo_NpI4ysS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n -15.1680 -12.1270 -3.0110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.9760 -11.6770 -3.7200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9680 -13.1960 -3.3580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8630 -14.4900 -2.9410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.6560 -15.2480 -4.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5140 -14.9030 -4.8640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0680 -13.4670 -2.5350 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6630 -13.8970 -4.5160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 5 4 2 0\n 6 5 1 0\n 7 4 1 0\n 7 3 2 0\n 8 6 2 0\n 8 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":109.06,"logp":0.52,"tpsa":37.81,"ha":8,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":42,"number":600},{"id":18199,"smiles":"CCNC(=O)N1CCN(C(C)=O)CC1","cmpd_id":506,"prot_id":18212,"protein_code":"NUDT5A-x0627_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0627_1_apo_WzAEcwt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -21.8470 -16.1210 -6.7490 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8460 -18.3430 -7.2860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.9350 -16.3910 -8.0610 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7860 -16.8400 -7.6310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.4500 -16.1270 -6.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.4180 -14.9260 -5.9520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2990 -15.3670 -5.0640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.1120 -15.7930 -3.3460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.8010 -16.5200 -4.5190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3360 -14.0650 -2.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2660 -13.0530 -3.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.6710 -15.7480 -5.7840 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.7920 -15.0960 -3.7080 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8500 -14.0390 -1.7530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 1 0\n 5 1 1 0\n 5 3 2 0\n 7 6 1 0\n 9 8 1 0\n 11 10 1 0\n 12 9 1 0\n 12 6 1 0\n 12 5 1 0\n 13 10 1 0\n 13 8 1 0\n 13 7 1 0\n 14 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.13,"logp":-0.12,"tpsa":52.65,"ha":14,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":80,"number":627},{"id":18203,"smiles":"CCNc1ccc(C)nn1","cmpd_id":402,"prot_id":18216,"protein_code":"NUDT5A-x0637_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0637_2_apo_xwNED2s.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -16.2710 -12.6970 -2.9590 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.3160 -11.3160 -3.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.3920 -12.2530 -4.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1860 -13.7140 -3.1330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3500 -14.4540 -4.3340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3770 -15.3930 -4.3930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.2110 -15.5830 -3.2880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.2940 -16.6200 -3.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0270 -14.8480 -2.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0610 -13.9660 -2.0770 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 1 0\n 4 1 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.1,"logp":1.22,"tpsa":37.81,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":637},{"id":18210,"smiles":"Cn1cc(Oc2ncncc2Cl)cn1","cmpd_id":196,"prot_id":18223,"protein_code":"NUDT5A-x0673_4","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0673_4_apo_mmZRmpR.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -15.3600 -16.4690 -8.3570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9430 -16.9780 -9.6340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.3890 -14.1440 -5.8270 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.3010 -15.1430 -7.9150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.6850 -15.2120 -6.6630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2280 -13.9110 -4.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1500 -14.5090 -3.5760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8970 -12.7200 -2.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.9930 -12.8790 -3.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.3980 -16.5840 -6.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3250 -14.7620 -4.6270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9850 -13.5040 -2.6470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.8190 -17.3420 -7.4570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.6650 -11.8400 -3.9990 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 2 0\n 5 3 1 0\n 6 3 1 0\n 9 8 1 0\n 9 6 2 0\n 10 5 1 0\n 11 7 2 0\n 11 6 1 0\n 12 7 1 0\n 12 8 2 0\n 13 10 2 0\n 13 1 1 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.03,"logp":1.66,"tpsa":52.83,"ha":14,"hacc":5,"hdon":0,"rots":2,"rings":2,"velec":72,"number":673},{"id":18213,"smiles":"COc1ccc2cn[nH]c(=O)c2c1OC","cmpd_id":578,"prot_id":18226,"protein_code":"NUDT5A-x0685_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0685_2_apo_xQv9RIU.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -17.2870 -13.3000 -2.6620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.3530 -17.8520 -8.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1020 -17.4970 -7.4520 O 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1320 -16.7010 -6.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0220 -17.0140 -5.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0000 -16.2380 -4.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0960 -15.1550 -4.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0680 -14.3360 -2.8180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3100 -13.6290 -4.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2120 -14.8170 -5.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2510 -15.6040 -6.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1560 -15.6960 -7.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4480 -12.9470 -3.6310 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5060 -13.1610 -5.7150 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5080 -15.2680 -7.4010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 1 2 0\n 10 7 1 0\n 10 9 1 0\n 11 4 1 0\n 11 10 2 0\n 13 1 1 0\n 13 9 1 0\n 14 9 2 0\n 15 11 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.07,"logp":0.94,"tpsa":64.21,"ha":15,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":78,"number":685},{"id":18216,"smiles":"Cn1cc(C(N)=O)c([C@@H]2CCCNC2)n1","cmpd_id":579,"prot_id":18229,"protein_code":"NUDT5A-x0692_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0692_1_apo_81vxlsC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -16.7720 -13.4490 -3.5790 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1880 -12.2250 -3.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3320 -16.1750 -6.8970 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2850 -14.1580 -4.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0900 -15.2620 -4.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8700 -16.2700 -5.7610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1040 -15.1640 -3.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.2560 -16.0880 -3.3410 C 0 0 2 0 0 0 0 0 0 0 0 0\n -19.2650 -17.4510 -4.0690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.3390 -18.3450 -3.4410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7150 -17.6720 -3.6020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.6080 -15.4470 -3.6590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0730 -17.3590 -5.4050 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.8700 -14.0160 -2.9830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -21.7420 -16.2560 -3.1590 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 4 1 1 0\n 5 4 2 0\n 6 3 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 1 6\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 8 1 0\n 13 6 1 0\n 14 7 2 0\n 14 1 1 0\n 15 11 1 0\n 15 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":208.13,"logp":-0.01,"tpsa":72.94,"ha":15,"hacc":4,"hdon":2,"rots":2,"rings":2,"velec":82,"number":692},{"id":18238,"smiles":"Nc1nccc(C(F)(F)F)n1","cmpd_id":1533,"prot_id":18251,"protein_code":"NUDT5A-x1072_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1072_2_apo_wCtYFmi.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -15.8600 -13.2300 -4.7070 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2570 -14.9690 -6.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6250 -14.2880 -4.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1830 -12.6040 -3.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9190 -14.0720 -3.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.6760 -14.7820 -4.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5830 -14.3020 -7.3620 F 0 0 0 0 0 0 0 0 0 0 0 0\n -16.8020 -16.1910 -6.4630 F 0 0 0 0 0 0 0 0 0 0 0 0\n -14.9420 -15.1250 -6.3820 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4210 -11.5340 -3.1690 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2110 -12.9870 -2.6410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 6 3 1 0\n 8 2 1 0\n 9 2 1 0\n 10 4 1 0\n 11 5 1 0\n 11 4 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":163.04,"logp":1.08,"tpsa":51.8,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":60,"number":1072},{"id":18242,"smiles":"O=c1[nH]cnc2cc(F)ccc12","cmpd_id":1534,"prot_id":18255,"protein_code":"NUDT5A-x1078_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1078_2_apo_SO3e7Ha.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -14.9000 -12.4540 -5.1300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1670 -15.3380 -6.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4420 -13.8400 -2.2650 O 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1000 -15.8920 -5.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2680 -15.2880 -4.7170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4220 -14.1940 -6.5980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6150 -13.5970 -5.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.0980 -11.8620 -3.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5270 -14.1390 -4.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.7090 -13.4870 -3.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9850 -15.9480 -8.0110 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9670 -12.3280 -2.9920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 2 1 0\n 7 6 2 0\n 7 1 1 0\n 8 1 2 0\n 9 5 2 0\n 9 7 1 0\n 10 9 1 0\n 10 3 2 0\n 11 2 1 0\n 12 10 1 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.06,"tpsa":45.75,"ha":12,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1078},{"id":18245,"smiles":"Fc1cnc2[nH]ccc2c1","cmpd_id":1535,"prot_id":18258,"protein_code":"NUDT5A-x1083_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1083_1_apo_1ds3f6s.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -17.7410 -13.6180 -2.3720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -18.2970 -15.2220 -4.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.5280 -14.5840 -2.8580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6940 -13.2730 -3.1650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.8800 -12.2230 -4.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2520 -13.1680 -4.9410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3960 -13.8480 -4.4280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2230 -14.8620 -4.9060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.1490 -16.1790 -4.4870 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7500 -12.2720 -2.9050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 6 5 2 0\n 7 4 2 0\n 7 6 1 0\n 8 7 1 0\n 8 2 2 0\n 9 2 1 0\n 10 4 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":136.04,"logp":1.7,"tpsa":28.68,"ha":10,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":50,"number":1083},{"id":18249,"smiles":"FC(F)c1nnc2c(C(F)(F)F)cccn12","cmpd_id":1536,"prot_id":18262,"protein_code":"NUDT5A-x1093_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1093_2_apo_D70L64p.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -16.5910 -14.3090 -4.4190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.2730 -17.0190 -4.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0900 -16.1360 -4.9960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3910 -16.2980 -6.1560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2720 -15.4580 -6.4560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.8690 -14.4770 -5.5980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.6990 -15.1140 -4.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4860 -13.4330 -3.3630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5230 -12.3290 -3.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.4040 -16.3530 -4.4500 F 0 0 0 0 0 0 0 0 0 0 0 0\n -19.1290 -17.6190 -3.3760 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5950 -11.6990 -4.4290 F 0 0 0 0 0 0 0 0 0 0 0 0\n -14.2570 -12.7620 -3.2430 F 0 0 0 0 0 0 0 0 0 0 0 0\n -19.5240 -18.0250 -5.4330 F 0 0 0 0 0 0 0 0 0 0 0 0\n -18.1980 -14.6980 -2.8660 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.4680 -13.7020 -2.4460 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 1 1 0\n 6 5 2 0\n 7 3 1 0\n 7 1 1 0\n 8 1 1 0\n 9 8 1 0\n 9 12 1 0\n 11 2 1 0\n 13 9 1 0\n 14 2 1 0\n 15 7 2 0\n 16 15 1 0\n 16 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.03,"logp":2.69,"tpsa":30.19,"ha":16,"hacc":3,"hdon":0,"rots":1,"rings":2,"velec":86,"number":1093},{"id":18253,"smiles":"N#Cc1c(C(F)(F)F)cn2ccnc2c1Cl","cmpd_id":1537,"prot_id":18266,"protein_code":"NUDT5A-x1211_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1211_2_apo_JH8jkcg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -16.8450 -13.1430 -2.6260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9920 -14.9020 -3.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0210 -13.9640 -3.6880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.7110 -12.4310 -2.9820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.2100 -12.7700 -4.2160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9690 -14.4410 -5.9120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.9690 -15.3320 -6.1360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.0620 -16.0300 -7.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9900 -15.5830 -5.1120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -19.0160 -16.5680 -5.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3120 -17.3490 -7.4050 F 0 0 0 0 0 0 0 0 0 0 0 0\n -17.9820 -15.6140 -8.3680 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9700 -15.8560 -8.2490 F 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0110 -13.7530 -4.7030 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.7980 -17.3780 -5.4260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -19.1890 -15.1150 -2.7430 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 3 1 2 0\n 4 1 1 0\n 5 4 2 0\n 7 6 2 0\n 8 7 1 0\n 8 11 1 0\n 9 7 1 0\n 9 2 2 0\n 10 9 1 0\n 12 8 1 0\n 13 8 1 0\n 14 3 1 0\n 14 6 1 0\n 14 5 1 0\n 15 10 3 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245,"logp":2.88,"tpsa":41.09,"ha":16,"hacc":3,"hdon":0,"rots":0,"rings":2,"velec":82,"number":1211},{"id":18257,"smiles":"Oc1ncnc2cccc(F)c12","cmpd_id":1538,"prot_id":18270,"protein_code":"NUDT5A-x1212_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1212_2_apo_5xE7RmR.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -14.9050 -12.6350 -5.1300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3740 -15.3690 -4.7550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.5800 -13.8480 -2.2790 O 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1640 -16.0470 -5.9180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.1640 -15.5760 -6.8340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4210 -14.4580 -6.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.6420 -13.7720 -5.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1540 -11.9950 -3.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.7510 -13.4790 -3.2320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6150 -14.2380 -4.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.3820 -15.7180 -3.9860 F 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0560 -12.3700 -2.9740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 1 2 0\n 8 1 1 0\n 9 3 1 0\n 10 9 2 0\n 10 2 1 0\n 10 7 1 0\n 11 2 1 0\n 12 9 1 0\n 12 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1212},{"id":18261,"smiles":"Oc1ncnc2ccc(F)cc12","cmpd_id":1539,"prot_id":18274,"protein_code":"NUDT5A-x1213_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1213_2_apo_6AFoxoU.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -14.7590 -12.7170 -5.1020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -17.2520 -15.9070 -5.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.5740 -13.7630 -2.3410 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.2370 -15.4820 -6.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4100 -14.4700 -6.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.5590 -13.8270 -5.3070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.9930 -12.0460 -3.9800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3960 -15.3200 -4.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.5390 -14.2670 -4.4090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.6660 -13.4890 -3.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.0720 -16.8990 -6.2860 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9290 -12.3970 -3.0240 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 6 1 2 0\n 7 1 1 0\n 8 2 2 0\n 9 8 1 0\n 9 6 1 0\n 10 9 2 0\n 10 3 1 0\n 11 2 1 0\n 12 10 1 0\n 12 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.04,"logp":1.47,"tpsa":46.01,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":1213},{"id":18265,"smiles":"CSc1nc(C(F)(F)F)cc(=O)n1C","cmpd_id":1540,"prot_id":18278,"protein_code":"NUDT5A-x1214_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1214_2_apo_aTuw5AN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -17.4620 -14.6070 -4.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1400 -14.7190 -7.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.2170 -14.1140 -2.3320 O 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4740 -14.3590 -5.3570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -18.6100 -15.5520 -4.6100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4350 -12.7960 -4.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.3100 -11.7710 -4.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3030 -12.9390 -3.0530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3910 -13.8880 -3.1770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -14.1870 -11.0860 -5.1780 F 0 0 0 0 0 0 0 0 0 0 0 0\n -14.4590 -10.8450 -3.0700 F 0 0 0 0 0 0 0 0 0 0 0 0\n -13.0830 -12.3340 -3.8700 F 0 0 0 0 0 0 0 0 0 0 0 0\n -15.4850 -13.4980 -5.2440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4930 -15.2480 -6.8220 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 0\n 5 1 1 0\n 7 6 1 0\n 7 10 1 0\n 8 6 2 0\n 9 3 2 0\n 9 1 1 0\n 9 8 1 0\n 11 7 1 0\n 12 7 1 0\n 13 4 2 0\n 13 6 1 0\n 14 4 1 0\n 14 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.02,"logp":1.52,"tpsa":34.89,"ha":14,"hacc":4,"hdon":0,"rots":1,"rings":1,"velec":78,"number":1214}],"220886":[{"id":18127,"smiles":"COC(=O)[C@@H]1C[C@@H](O)CN1C(=O)c1ccco1","cmpd_id":178,"prot_id":18140,"protein_code":"NUDT5A-x0125_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0125_1_apo_UmTDJOo.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -52.6040 10.0700 -44.2190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -55.6780 10.7300 -41.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -55.4150 9.4750 -41.7570 O 0 0 0 0 0 0 0 0 0 0 0 0\n -54.5640 9.2570 -42.8350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -48.2070 8.8750 -44.7420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -53.7990 10.4870 -43.4470 C 0 0 2 0 0 0 0 0 0 0 0 0\n -54.7110 11.2260 -44.4800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -53.8660 11.3690 -45.7880 C 0 0 2 0 0 0 0 0 0 0 0 0\n -52.8110 10.2610 -45.6830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -51.4640 9.5510 -43.5790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -50.3560 9.1340 -44.4090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -50.2330 8.6000 -45.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -48.8320 8.4400 -45.8950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -54.4710 8.1040 -43.2300 O 0 0 0 0 0 0 0 0 0 0 0 0\n -53.1450 12.5660 -45.8780 O 0 0 0 0 0 0 0 0 0 0 0 0\n -51.3900 9.4530 -42.3680 O 0 0 0 0 0 0 0 0 0 0 0 0\n -49.1330 9.3050 -43.8180 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 6 4 1 6\n 6 1 1 0\n 7 6 1 0\n 8 7 1 0\n 8 15 1 1\n 9 1 1 0\n 9 8 1 0\n 10 1 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 13 5 2 0\n 14 4 2 0\n 16 10 2 0\n 17 11 1 0\n 17 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.08,"logp":0.03,"tpsa":79.98,"ha":17,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":92,"number":125}],"220887":[{"id":18128,"smiles":"COC(=O)[C@@H]1C[C@@H](O)CN1C(=O)c1ccco1","cmpd_id":178,"prot_id":18141,"protein_code":"NUDT5A-x0125_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0125_2_apo_FeORfBx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -6.7840 15.7580 -24.2830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2860 17.4500 -28.3980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2750 17.7660 -27.4160 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1720 17.3030 -26.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2910 12.7860 -21.7150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2340 16.3140 -25.5750 C 0 0 2 0 0 0 0 0 0 0 0 0\n -8.5460 17.0760 -25.2790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7670 17.0300 -23.7500 C 0 0 2 0 0 0 0 0 0 0 0 0\n -7.4870 16.4060 -23.1510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7740 14.8000 -24.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2880 14.3180 -22.9470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2170 14.8340 -21.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5660 13.8240 -20.8800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2380 17.7100 -25.4170 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8390 16.2020 -23.3920 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2660 14.3980 -25.2370 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7200 13.0580 -22.9840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 6 1 1 0\n 6 4 1 1\n 7 6 1 0\n 8 7 1 0\n 8 15 1 6\n 9 1 1 0\n 9 8 1 0\n 10 1 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 13 5 2 0\n 14 4 2 0\n 16 10 2 0\n 17 11 1 0\n 17 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":239.08,"logp":0.03,"tpsa":79.98,"ha":17,"hacc":5,"hdon":1,"rots":2,"rings":2,"velec":92,"number":125}],"220888":[{"id":18187,"smiles":"O=C([O-])c1ccccc1OC(F)(F)F","cmpd_id":573,"prot_id":18200,"protein_code":"NUDT5A-x0526_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x0526_1_apo_esHBGsT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 13.5550 3.5810 -3.9100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6920 3.1140 -3.9760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4850 5.1330 -3.9510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2610 5.8910 -3.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1070 7.2840 -2.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1770 7.9540 -3.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4320 7.2480 -4.6900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6140 5.8500 -4.7940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6660 4.9370 -5.9190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5170 4.2190 -7.0560 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9560 6.0300 -6.1320 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1420 4.2460 -4.9040 F 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5010 2.9040 -3.7990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0220 5.2210 -5.8770 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 3 1 0\n 8 7 2 0\n 9 10 1 0\n 11 9 1 0\n 12 9 1 0\n 13 1 2 0\n 14 9 1 0\n 14 8 1 0\nM CHG 1 2 -1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.02,"logp":2.28,"tpsa":46.53,"ha":14,"hacc":2,"hdon":1,"rots":2,"rings":1,"velec":76,"number":526}],"220889":[{"id":18217,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18230,"protein_code":"NUDT5A-x1004_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1004_1_apo_tS77Xlh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -26.4430 21.7200 -52.3110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7130 25.4850 -52.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.1080 21.8520 -52.4950 O 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2350 24.0560 -52.3470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.3480 20.3550 -54.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.1990 18.9960 -55.3000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2040 18.6070 -56.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3870 19.6010 -56.7420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4830 21.2880 -55.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.7790 24.0320 -52.2320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5460 23.5240 -51.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7900 24.1410 -49.8670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1030 23.7510 -48.7210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.1650 22.7330 -48.7940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.9060 22.0860 -49.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6050 22.4630 -51.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.2090 21.4860 -52.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.3780 20.7370 -54.1170 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5190 20.9190 -56.4530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 1 1 0\n 16 15 2 0\n 17 1 1 0\n 17 3 2 0\n 18 5 1 0\n 18 17 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1004},{"id":18221,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18234,"protein_code":"NUDT5A-x1024_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1024_1_apo_3Jhw3fw.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -26.5330 22.2640 -52.3040 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.6760 25.0000 -52.9880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.3020 21.5830 -52.1110 O 0 0 0 0 0 0 0 0 0 0 0 0\n -25.0220 24.7960 -51.6000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4290 20.6600 -54.8360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.3620 19.2720 -54.9880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3970 18.7330 -55.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5360 19.6110 -56.4980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5080 21.4770 -55.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5930 24.3140 -51.8570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8780 23.9360 -50.6370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.0010 24.3490 -49.3100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9230 23.7730 -48.4350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.7480 22.7480 -48.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.6190 22.2620 -50.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6830 22.8340 -51.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.3360 21.6940 -52.7690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.4600 21.2310 -54.0870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5810 20.9660 -56.3510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\n 16 1 1 0\n 17 3 2 0\n 17 1 1 0\n 18 5 1 0\n 18 17 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1024},{"id":18225,"smiles":"N#Cc1ccc(NC(=O)Nc2cccnc2)cc1","cmpd_id":1553,"prot_id":18238,"protein_code":"NUDT5A-x1028_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1028_1_apo_WPi1rO9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -25.5500 21.2360 -54.0570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.4480 21.7800 -52.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.3860 21.8430 -52.1860 O 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4680 20.6770 -54.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.0950 23.5020 -48.7600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4310 23.4820 -48.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1430 22.8330 -50.4430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4130 21.5250 -55.1640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3230 20.9820 -55.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2850 19.6020 -56.0460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.2400 19.0770 -56.7880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3010 18.7590 -55.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.3980 19.3000 -55.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8050 22.8010 -50.9360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.7700 23.1580 -50.0560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -20.3980 18.6550 -57.4200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6500 22.2330 -52.2180 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.4620 23.1560 -49.1630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 13 12 2 0\n 13 4 1 0\n 14 7 1 0\n 15 14 2 0\n 15 5 1 0\n 16 11 3 0\n 17 2 1 0\n 17 14 1 0\n 18 7 2 0\n 18 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.6,"tpsa":77.81,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1028},{"id":18229,"smiles":"O=C(Nc1cccnc1)N[C@H]1CCNC1","cmpd_id":1550,"prot_id":18242,"protein_code":"NUDT5A-x1039_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1039_1_apo_ENWGuON.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -26.6880 21.3830 -51.9540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.5990 21.5240 -52.8090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.8990 22.5340 -52.7760 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0560 22.4540 -51.0190 C 0 0 1 0 0 0 0 0 0 0 0 0\n -28.2250 22.0150 -50.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.9920 22.7490 -48.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8790 22.7120 -50.0130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.2980 20.2900 -54.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.1770 19.0440 -55.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1220 18.8250 -56.1420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2200 19.8650 -56.3920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3430 21.3040 -54.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.5060 22.9200 -48.6780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.3390 20.4100 -53.6370 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.3310 21.0880 -55.8250 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 6\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 6 1 0\n 13 7 1 0\n 14 8 1 0\n 14 2 1 0\n 15 12 2 0\n 15 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.12,"logp":0.56,"tpsa":66.05,"ha":15,"hacc":3,"hdon":3,"rots":2,"rings":2,"velec":80,"number":1039},{"id":18233,"smiles":"O=C(Nc1cccnc1)N[C@@H]1CCSC1","cmpd_id":1545,"prot_id":18246,"protein_code":"NUDT5A-x1066_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1066_1_apo_JoVGB2O.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -26.7690 22.1140 -51.9280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.5220 21.9870 -52.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4980 22.4520 -52.0600 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0180 21.9880 -50.4910 C 0 0 2 0 0 0 0 0 0 0 0 0\n -28.4330 22.5110 -50.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6390 22.6550 -48.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.1180 22.8640 -49.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4160 21.0650 -54.5550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.0580 19.7130 -54.7980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8990 19.4180 -55.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.1250 20.4810 -55.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5890 22.0880 -55.0900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.5560 21.3080 -53.7650 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4650 21.7890 -55.7880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1000 23.3160 -48.1600 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 6\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 8 1 0\n 13 2 1 0\n 14 11 1 0\n 14 12 2 0\n 15 6 1 0\n 15 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.08,"logp":1.71,"tpsa":54.02,"ha":15,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1066},{"id":18268,"smiles":"C#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1541,"prot_id":18281,"protein_code":"NUDT5A-x1217_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1217_1_apo_8m9uAwS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -27.1300 21.9370 -51.9970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8600 21.5680 -52.4900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.8940 21.3290 -51.7620 O 0 0 0 0 0 0 0 0 0 0 0 0\n -27.4160 22.1420 -50.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1990 19.4160 -55.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8540 18.0740 -55.5670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.6210 16.9130 -55.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.3250 19.7630 -54.7330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.4670 22.6340 -49.7170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8880 22.8860 -48.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2200 22.6520 -48.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.7420 21.9220 -50.2160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.6710 21.1230 -54.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8950 22.1170 -55.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7920 21.7290 -56.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4330 20.3850 -56.1130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.1550 22.1800 -48.9520 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8290 21.4600 -53.8880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 6 3 0\n 8 5 2 0\n 9 4 2 0\n 10 9 1 0\n 11 10 2 0\n 12 4 1 0\n 13 8 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 5 1 0\n 17 12 2 0\n 17 11 1 0\n 18 13 1 0\n 18 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.09,"logp":2.71,"tpsa":54.02,"ha":18,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1217},{"id":18272,"smiles":"O=C(Nc1cccnc1)Nc1cccc(Br)c1","cmpd_id":1547,"prot_id":18285,"protein_code":"NUDT5A-x1219_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1219_1_apo_ToeBaLk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -25.6920 20.8110 -53.6640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0400 19.2340 -55.6260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.6900 22.0580 -51.9750 O 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2970 20.2800 -56.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6300 21.8690 -50.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.1630 19.3980 -54.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.7120 21.5880 -55.8290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8350 21.8190 -55.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.5620 20.7100 -54.5190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.6820 21.4720 -52.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.2590 21.9480 -50.4510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3410 22.5210 -49.5420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8240 22.9670 -48.3120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1880 22.8430 -48.0130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9360 21.4050 -51.7340 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.1090 22.3090 -48.8520 N 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4840 17.4040 -55.9490 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 6 2 1 0\n 7 4 1 0\n 8 7 2 0\n 9 6 2 0\n 9 1 1 0\n 9 8 1 0\n 10 1 1 0\n 10 3 2 0\n 11 5 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 11 1 0\n 15 10 1 0\n 16 5 1 0\n 16 14 2 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1219},{"id":18276,"smiles":"N#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1542,"prot_id":18289,"protein_code":"NUDT5A-x1223_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1223_1_apo_NA05bJJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -25.6080 21.1280 -54.1810 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.5770 21.8590 -52.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.7370 22.7240 -52.7390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4560 20.7400 -54.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5240 22.4840 -49.1760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8580 22.3910 -48.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.1890 21.9690 -50.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.2250 19.3710 -55.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.0760 18.9730 -55.7450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2090 19.9570 -56.2210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.5290 21.6820 -55.3980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8690 22.0520 -50.8550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8980 22.6480 -50.0510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.2650 23.1640 -48.8030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5780 23.0770 -48.3470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4220 21.2980 -56.0580 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6110 21.4850 -52.1130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9490 22.2970 -48.4090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 4 1 0\n 12 7 1 0\n 13 12 2 0\n 14 13 1 0\n 15 5 1 0\n 15 14 2 0\n 16 11 2 0\n 16 10 1 0\n 17 12 1 0\n 17 2 1 0\n 18 6 3 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.61,"tpsa":81.3,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1223},{"id":18279,"smiles":"COc1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1554,"prot_id":18292,"protein_code":"NUDT5A-x1235_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1235_1_apo_FaVSojb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -25.8590 21.3470 -54.1580 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.7200 24.0800 -55.9860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.8740 23.1950 -54.8790 O 0 0 0 0 0 0 0 0 0 0 0 0\n -23.6700 21.8600 -55.1610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.6180 22.4490 -48.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5410 23.0760 -48.2030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.2340 22.9840 -50.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4760 21.4440 -55.7620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2760 20.0860 -56.0130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2550 19.1590 -55.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4490 19.5580 -55.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.6740 20.9130 -54.8140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8680 21.5820 -52.7790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.2790 22.3380 -50.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.4870 22.0700 -50.1950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0930 22.0260 -52.2300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3590 23.3430 -48.8180 N 0 0 0 0 0 0 0 0 0 0 0 0\n -24.8850 21.3870 -52.0980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 6 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 1 1 0\n 12 4 1 0\n 13 1 1 0\n 14 7 1 0\n 15 14 2 0\n 15 5 1 0\n 16 14 1 0\n 16 13 1 0\n 17 6 1 0\n 17 7 2 0\n 18 13 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":1235},{"id":18280,"smiles":"COc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1548,"prot_id":18293,"protein_code":"NUDT5A-x1242_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1242_1_apo_Q0n9K7x.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -25.8590 20.9790 -53.9130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3280 17.1620 -56.3690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5430 18.3290 -56.2580 O 0 0 0 0 0 0 0 0 0 0 0 0\n -23.1240 19.5020 -55.8620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.8930 22.9770 -48.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5140 21.9330 -50.1420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.2780 19.6030 -55.0850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.4080 20.6390 -56.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.8590 21.8980 -55.9110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.0020 22.0470 -55.1230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.7040 20.8960 -54.7150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.8170 21.4010 -52.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.2610 22.2150 -50.7240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.2990 22.9190 -49.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6280 23.3010 -48.6710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0640 21.7700 -52.0440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -28.8400 22.3100 -48.8800 N 0 0 0 0 0 0 0 0 0 0 0 0\n -24.7820 21.4460 -51.9420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 7 4 2 0\n 8 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 7 1 0\n 11 1 1 0\n 11 10 2 0\n 12 1 1 0\n 13 6 1 0\n 14 13 2 0\n 15 5 2 0\n 15 14 1 0\n 16 13 1 0\n 16 12 1 0\n 17 6 2 0\n 17 5 1 0\n 18 12 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":1242},{"id":18284,"smiles":"S=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":1549,"prot_id":18297,"protein_code":"NUDT5A-x1291_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1291_1_apo_A3dsIPI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -25.7990 20.8670 -54.1500 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.6300 21.3280 -52.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.7170 20.5050 -55.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.5290 23.2130 -48.4520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.1030 22.9560 -50.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.9620 21.5560 -55.5930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.9000 21.2370 -56.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.5870 19.9060 -56.6720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.3420 18.8810 -56.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.4180 19.1700 -55.2710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.0520 22.1490 -50.9430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.2810 21.8900 -50.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5210 22.4340 -49.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.8300 21.6350 -52.2530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3360 23.4770 -49.0350 N 0 0 0 0 0 0 0 0 0 0 0 0\n -24.1510 21.4730 -52.2090 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 6 3 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 3 1 0\n 11 5 1 0\n 12 11 2 0\n 13 12 1 0\n 13 4 2 0\n 14 2 1 0\n 14 11 1 0\n 15 4 1 0\n 15 5 2 0\n 16 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.07,"logp":2.89,"tpsa":36.95,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1291},{"id":18288,"smiles":"O=C(Nc1ccccc1)Nc1cncc(Br)c1","cmpd_id":1544,"prot_id":18301,"protein_code":"NUDT5A-x1298_1","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1298_1_apo_dxSFgYy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -29.1200 22.2770 -50.1750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -26.9630 22.9030 -49.4970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -24.5350 22.0600 -52.8790 O 0 0 0 0 0 0 0 0 0 0 0 0\n -28.3290 22.8440 -49.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.4550 19.0270 -55.3570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.3290 22.3840 -50.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -28.5360 21.7610 -51.2770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -27.1380 21.7720 -51.5200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -25.3690 21.2400 -53.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.9840 20.3110 -55.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -23.2970 21.4650 -55.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.0820 21.2950 -56.2270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -21.5540 20.0290 -56.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -22.2460 18.9000 -56.0130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -26.6250 21.0730 -52.6300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.1850 20.3600 -54.3340 N 0 0 0 0 0 0 0 0 0 0 0 0\n -25.9160 23.7960 -48.2370 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 2 0\n 4 2 1 0\n 6 2 2 0\n 7 1 1 0\n 8 7 2 0\n 8 6 1 0\n 9 3 2 0\n 10 5 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 5 1 0\n 14 13 2 0\n 15 9 1 0\n 15 8 1 0\n 16 10 1 0\n 16 9 1 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1298}],"220890":[{"id":18218,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18231,"protein_code":"NUDT5A-x1004_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1004_2_apo_lhMxu5r.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -7.3060 2.8830 -4.1130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9590 3.9860 -2.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8230 3.7890 -2.5560 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7860 5.2770 -3.0140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8030 1.0570 -1.3400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1320 0.6680 -1.4700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7910 0.1220 -0.3630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0940 -0.0050 0.8440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1670 0.8920 -0.0940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8480 6.4810 -2.8500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4430 5.2090 -4.4060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3460 6.2770 -5.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8030 6.1520 -6.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3800 4.9740 -7.0790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5430 3.9340 -6.1970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0950 4.0350 -4.8970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1530 2.8280 -2.9970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1220 1.5300 -2.4570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8000 0.3740 0.9920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\n 16 1 1 0\n 17 3 2 0\n 17 1 1 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1004},{"id":18222,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18235,"protein_code":"NUDT5A-x1024_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1024_2_apo_J8udfez.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -7.7220 3.3030 -4.1870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1360 5.4270 -1.4370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5730 3.9560 -2.1190 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4660 4.4470 -2.5700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2010 1.2230 -1.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.2880 0.3550 -1.5320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7260 -0.1510 -0.3110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0510 0.2120 0.8680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5740 1.5510 -0.3110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2040 3.6840 -2.9470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1150 5.1370 -3.7920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.6190 6.3550 -4.2540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1710 6.9820 -5.3740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2210 6.4080 -6.0740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7440 5.1930 -5.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2120 4.5690 -4.5370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3110 3.0560 -2.9460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6780 1.7050 -2.7620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9850 1.0480 0.8770 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\n 16 1 1 0\n 17 3 2 0\n 17 1 1 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1024},{"id":18226,"smiles":"N#Cc1ccc(NC(=O)Nc2cccnc2)cc1","cmpd_id":1553,"prot_id":18239,"protein_code":"NUDT5A-x1028_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1028_2_apo_rDT8cYt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -8.6090 2.1440 -2.4020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7190 1.6440 -1.1060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9010 1.7380 -0.2000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6760 2.9210 -3.0170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7460 -0.5080 2.1570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.8900 -1.1500 1.7480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.7440 -0.2970 -0.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0170 4.2700 -2.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5050 5.1320 -3.9000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6500 4.6310 -4.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3690 5.4260 -5.9960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2200 3.3040 -4.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7330 2.4410 -3.8890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5320 0.3450 -0.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0350 0.2510 1.2790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1500 6.0430 -6.9420 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9360 0.9780 -1.0520 N 0 0 0 0 0 0 0 0 0 0 0 0\n -12.4130 -1.0330 0.5220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 13 12 2 0\n 13 4 1 0\n 14 7 1 0\n 15 14 2 0\n 15 5 1 0\n 16 11 3 0\n 17 14 1 0\n 17 2 1 0\n 18 7 2 0\n 18 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.6,"tpsa":77.81,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1028},{"id":18230,"smiles":"O=C(Nc1cccnc1)N[C@H]1CCNC1","cmpd_id":1550,"prot_id":18243,"protein_code":"NUDT5A-x1039_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1039_2_apo_RyNBHJ8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -7.8590 3.0280 -4.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8560 2.6570 -3.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0890 3.1860 -2.4820 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9360 4.0470 -5.0790 C 0 0 1 0 0 0 0 0 0 0 0 0\n -7.0570 4.2710 -6.5960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6940 5.7330 -6.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3190 5.4400 -4.4470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0450 1.1210 -1.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1200 0.2120 -1.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4980 -0.2760 -0.2270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7680 0.1200 0.9040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3440 1.4430 -0.3870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1200 6.4410 -5.5310 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8160 1.6820 -2.8880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7010 0.9510 0.8300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 1\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 7 1 0\n 13 6 1 0\n 14 8 1 0\n 14 2 1 0\n 15 12 2 0\n 15 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.12,"logp":0.56,"tpsa":66.05,"ha":15,"hacc":3,"hdon":3,"rots":2,"rings":2,"velec":80,"number":1039},{"id":18234,"smiles":"O=C(Nc1cccnc1)N[C@H]1CCSC1","cmpd_id":1546,"prot_id":18247,"protein_code":"NUDT5A-x1066_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1066_2_apo_eyewRMO.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -6.8860 2.9660 -4.3290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5870 2.9850 -3.1190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0140 4.0270 -2.6390 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2420 4.1420 -4.9850 C 0 0 1 0 0 0 0 0 0 0 0 0\n -6.9550 4.3400 -6.3670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8490 5.7860 -6.7310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2590 5.5090 -4.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4040 1.3440 -1.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.6920 0.8200 -1.4050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3580 0.4260 -0.2300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7000 0.5630 1.0120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8100 1.4630 -0.0290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7500 1.6860 -2.5510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4490 1.0730 1.1250 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2850 6.6230 -5.1880 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 1\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 8 1 0\n 13 2 1 0\n 14 12 2 0\n 14 11 1 0\n 15 6 1 0\n 15 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.08,"logp":1.71,"tpsa":54.02,"ha":15,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1066},{"id":18269,"smiles":"C#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1541,"prot_id":18282,"protein_code":"NUDT5A-x1217_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1217_2_apo_mvg4BH8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -7.2170 2.9120 -4.4970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7840 2.8180 -3.2260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2020 3.8200 -2.6380 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1360 4.1250 -5.2070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.2470 0.6320 -0.1480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.5990 0.3180 -0.1430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -12.7340 0.0290 -0.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.6560 0.8690 -1.3840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2510 5.4240 -4.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2350 6.5140 -5.4910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0960 6.2800 -6.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9760 4.0070 -6.6090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3150 1.2000 -1.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5590 1.2770 -0.2410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1820 1.0300 0.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5230 0.7070 1.0450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9560 5.0370 -7.4320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7800 1.5070 -2.6980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 6 3 0\n 8 5 2 0\n 9 4 2 0\n 10 9 1 0\n 11 10 2 0\n 12 4 1 0\n 13 8 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 5 1 0\n 17 12 2 0\n 17 11 1 0\n 18 13 1 0\n 18 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.09,"logp":2.71,"tpsa":54.02,"ha":18,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1217},{"id":18273,"smiles":"O=C(Nc1cccnc1)Nc1cccc(Br)c1","cmpd_id":1547,"prot_id":18286,"protein_code":"NUDT5A-x1219_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1219_2_apo_yQh6z8o.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -7.6960 1.5530 -2.7530 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0360 0.3960 -0.2080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2520 3.8010 -2.7550 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.3870 0.6040 0.9930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7610 4.0330 -6.6760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5270 0.7080 -1.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1240 1.1620 0.9350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5500 1.4930 -0.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2590 1.2590 -1.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7290 2.8410 -3.3150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0360 4.1550 -5.2910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2560 5.4460 -4.7520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2280 6.5180 -5.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9690 6.2800 -6.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1130 2.9460 -4.5660 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7250 5.0550 -7.5140 N 0 0 0 0 0 0 0 0 0 0 0 0\n -11.7650 -0.4430 -0.1800 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 6 2 1 0\n 7 4 1 0\n 8 7 2 0\n 9 8 1 0\n 9 6 2 0\n 9 1 1 0\n 10 3 2 0\n 10 1 1 0\n 11 5 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 11 1 0\n 15 10 1 0\n 16 5 1 0\n 16 14 2 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1219},{"id":18277,"smiles":"N#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1542,"prot_id":18290,"protein_code":"NUDT5A-x1223_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1223_2_apo_GpZoKVp.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -8.4830 1.2830 -2.5130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5250 2.5840 -3.0290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2710 3.4530 -2.5790 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8880 0.9680 -1.2040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8490 5.0180 -6.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4400 4.8970 -8.2470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0640 3.8660 -6.1510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1560 0.4140 -1.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5580 0.0580 0.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.6710 0.2690 1.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0490 1.1610 -0.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4690 3.9880 -4.8010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6460 5.2530 -4.2230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4170 6.3910 -5.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0280 6.2920 -6.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4330 0.8140 1.1780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6370 2.7790 -4.0930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1180 4.7810 -9.3730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 4 1 0\n 12 7 1 0\n 13 12 2 0\n 14 13 1 0\n 15 5 1 0\n 15 14 2 0\n 16 11 2 0\n 16 10 1 0\n 17 12 1 0\n 17 2 1 0\n 18 6 3 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.61,"tpsa":81.3,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1223},{"id":18281,"smiles":"COc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1548,"prot_id":18294,"protein_code":"NUDT5A-x1242_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1242_2_apo_DqOABZD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -8.1780 1.4490 -2.5180 N 0 0 0 0 0 0 0 0 0 0 0 0\n -12.6770 0.4680 -0.2700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.6150 -0.1680 0.4280 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3630 0.3260 0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0060 6.1920 -6.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0300 3.9190 -6.3200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8970 0.6370 -1.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5740 0.5050 1.3450 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2910 1.0130 1.1890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7920 1.3420 -0.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6050 1.1490 -1.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2970 2.7200 -3.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3360 4.0780 -4.9380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4780 5.3740 -4.4110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3010 6.4470 -5.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4240 2.9050 -4.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8630 4.9450 -7.1720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0830 3.5830 -2.6990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 7 4 2 0\n 8 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 7 1 0\n 11 1 1 0\n 12 1 1 0\n 13 6 1 0\n 14 13 2 0\n 15 14 1 0\n 15 5 2 0\n 16 13 1 0\n 16 12 1 0\n 17 6 2 0\n 17 5 1 0\n 18 12 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":1242},{"id":18285,"smiles":"S=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":1549,"prot_id":18298,"protein_code":"NUDT5A-x1291_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1291_2_apo_IHsOygJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -8.5470 1.3490 -2.6570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3930 2.6630 -3.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0440 0.9410 -1.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0240 6.2420 -6.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5960 5.2950 -4.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2060 1.0980 -0.2710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6450 0.6810 0.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9030 0.1060 1.1110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7280 -0.0390 -0.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3030 0.3800 -1.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5650 3.9910 -5.0400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2220 3.8660 -6.4110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9520 4.9890 -7.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8740 2.7930 -4.3100 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3300 6.4030 -5.2130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8090 3.8930 -2.0170 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 6 3 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 3 1 0\n 11 5 1 0\n 12 11 2 0\n 13 12 1 0\n 13 4 2 0\n 14 11 1 0\n 14 2 1 0\n 15 5 2 0\n 15 4 1 0\n 16 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.07,"logp":2.89,"tpsa":36.95,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1291},{"id":18289,"smiles":"O=C(Nc1ccccc1)Nc1cncc(Br)c1","cmpd_id":1544,"prot_id":18302,"protein_code":"NUDT5A-x1298_2","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1298_2_apo_s5hTaxr.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -6.6860 4.2940 -7.3560 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7790 5.7470 -5.4820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7570 3.3450 -2.7570 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6290 5.5300 -6.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1150 1.1980 0.0530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9990 4.7610 -4.5760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9000 3.2830 -6.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0660 3.4710 -5.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0700 2.3840 -3.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7590 0.8980 -1.1640 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0350 0.3290 -1.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6540 0.0650 0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0190 0.3580 1.2790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7510 0.9220 1.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2320 2.3900 -4.1980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0350 1.1730 -2.3620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6550 7.4920 -4.7910 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 2 0\n 4 2 1 0\n 6 2 2 0\n 7 1 1 0\n 8 7 2 0\n 8 6 1 0\n 9 3 2 0\n 10 5 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 5 1 0\n 15 9 1 0\n 15 8 1 0\n 16 10 1 0\n 16 9 1 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1298}],"220891":[{"id":18219,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18232,"protein_code":"NUDT5A-x1004_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1004_3_apo_N6skOyp.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -33.3990 11.9220 -58.4430 N 0 0 0 0 0 0 0 0 0 0 0 0\n -36.3620 11.0530 -60.8150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.0810 12.9070 -60.4150 O 0 0 0 0 0 0 0 0 0 0 0 0\n -35.3780 10.2300 -59.9800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.2460 13.3200 -61.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.2470 14.7130 -61.1170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6310 15.3010 -62.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0200 14.4570 -63.1920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6240 12.5380 -62.0120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.5700 8.7100 -60.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.5590 10.6980 -58.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.6830 10.2780 -57.7990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.8580 10.7150 -56.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.9480 11.5830 -55.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.8420 11.9990 -56.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.6370 11.5610 -57.9060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.1880 12.5540 -59.6510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.8100 12.7380 -59.8730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0150 13.0910 -63.0850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 15 2 0\n 16 1 1 0\n 17 3 2 0\n 17 1 1 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1004},{"id":18223,"smiles":"CC(C)c1ccccc1NC(=O)Nc1cccnc1","cmpd_id":1552,"prot_id":18236,"protein_code":"NUDT5A-x1024_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1024_3_apo_X2X8Ohg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -33.4710 12.0280 -58.4360 N 0 0 0 0 0 0 0 0 0 0 0 0\n -36.6620 11.1550 -60.6510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.1800 12.8320 -60.5320 O 0 0 0 0 0 0 0 0 0 0 0 0\n -35.6540 10.3430 -59.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4280 13.5610 -60.9980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.2290 14.9540 -60.9320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5950 15.5850 -62.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.1870 14.7940 -63.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0180 12.8420 -62.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.9430 8.8450 -59.9300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.7140 10.8440 -58.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.8400 10.5280 -57.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.8960 10.9510 -56.2840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.8550 11.6960 -55.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.7660 12.0120 -56.5140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.6760 11.6080 -57.8290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.3030 12.6300 -59.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.9490 12.9410 -59.8760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.4040 13.4490 -63.1770 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 15 2 0\n 16 1 1 0\n 17 3 2 0\n 17 1 1 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.14,"logp":3.85,"tpsa":54.02,"ha":19,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":98,"number":1024},{"id":18227,"smiles":"N#Cc1ccc(NC(=O)Nc2cccnc2)cc1","cmpd_id":1553,"prot_id":18240,"protein_code":"NUDT5A-x1028_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1028_3_apo_JvDbEEP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -33.2040 12.1480 -60.2550 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1600 13.0780 -60.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5150 13.3820 -59.2690 O 0 0 0 0 0 0 0 0 0 0 0 0\n -33.7820 11.5470 -59.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.4110 16.0960 -63.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.7350 16.8420 -62.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.3420 15.3450 -61.0630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.0960 11.1250 -59.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.9280 10.8420 -58.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.4580 10.9740 -57.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.3830 10.8380 -56.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.1440 11.3150 -56.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.2860 11.5910 -57.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0740 14.5560 -61.9860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0590 14.9290 -63.3040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.2050 10.7320 -55.3170 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.9480 13.5700 -61.5410 N 0 0 0 0 0 0 0 0 0 0 0 0\n -29.6730 16.4690 -61.4100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 2 0\n 8 4 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 13 12 2 0\n 13 4 1 0\n 14 7 1 0\n 15 14 2 0\n 15 5 1 0\n 16 11 3 0\n 17 14 1 0\n 17 2 1 0\n 18 7 2 0\n 18 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.09,"logp":2.6,"tpsa":77.81,"ha":18,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1028},{"id":18231,"smiles":"O=C(Nc1cccnc1)N[C@H]1CCNC1","cmpd_id":1550,"prot_id":18244,"protein_code":"NUDT5A-x1039_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1039_3_apo_U1fKQM2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -33.6890 12.0470 -58.2730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -33.0740 12.0600 -59.5580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.3000 11.1900 -60.4070 O 0 0 0 0 0 0 0 0 0 0 0 0\n -34.5600 10.9600 -57.8290 C 0 0 1 0 0 0 0 0 0 0 0 0\n -35.2390 11.2890 -56.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.5120 10.4510 -56.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.7830 10.7560 -58.7820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5140 13.5450 -60.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8520 14.7940 -60.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.2250 15.2610 -62.1390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.2380 14.4490 -63.2820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4440 12.7870 -62.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.8110 10.1090 -57.9020 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.2640 13.2120 -59.8000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8250 13.2320 -63.2950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 6\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 7 1 0\n 13 6 1 0\n 14 2 1 0\n 14 8 1 0\n 15 12 2 0\n 15 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.12,"logp":0.56,"tpsa":66.05,"ha":15,"hacc":3,"hdon":3,"rots":2,"rings":2,"velec":80,"number":1039},{"id":18235,"smiles":"O=C(Nc1cccnc1)N[C@H]1CCSC1","cmpd_id":1546,"prot_id":18248,"protein_code":"NUDT5A-x1066_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1066_3_apo_sHj8v76.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -33.2510 11.9070 -58.2910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.8490 12.0490 -59.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.4750 11.5920 -60.5540 O 0 0 0 0 0 0 0 0 0 0 0 0\n -34.3520 11.0690 -57.8540 C 0 0 1 0 0 0 0 0 0 0 0 0\n -34.8700 11.6050 -56.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.1730 10.9000 -56.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.5580 11.0700 -58.7950 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0890 13.0530 -60.9840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0150 14.4210 -61.2880 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5870 14.8200 -62.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.2280 13.8290 -63.4740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6920 12.1080 -61.9500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.6400 12.7490 -59.7470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.2630 12.4890 -63.1830 N 0 0 0 0 0 0 0 0 0 0 0 0\n -36.8690 10.2990 -57.7950 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 6\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 2 1 0\n 13 8 1 0\n 14 12 2 0\n 14 11 1 0\n 15 7 1 0\n 15 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":223.08,"logp":1.71,"tpsa":54.02,"ha":15,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1066},{"id":18270,"smiles":"C#Cc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1541,"prot_id":18283,"protein_code":"NUDT5A-x1217_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1217_3_apo_wYadSYj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -33.8330 11.6980 -58.1440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -33.4260 11.8430 -59.4700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.1150 11.5170 -60.4360 O 0 0 0 0 0 0 0 0 0 0 0 0\n -35.0670 11.1920 -57.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9490 14.2870 -62.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8650 15.6580 -62.8020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8210 16.7990 -63.1120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3990 13.9470 -61.1980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.0360 10.6280 -58.6060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.2010 10.1140 -58.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.3360 10.1890 -56.6100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.3130 11.2180 -56.3580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.6150 12.5990 -60.8850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.3540 11.5690 -61.8170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.8690 11.9280 -63.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6660 13.2910 -63.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.4160 10.7270 -55.7880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -32.1520 12.3660 -59.6060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 1 1 0\n 6 5 1 0\n 7 6 3 0\n 8 5 2 0\n 9 4 2 0\n 10 9 1 0\n 11 10 2 0\n 12 4 1 0\n 13 8 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 5 1 0\n 17 11 1 0\n 17 12 2 0\n 18 2 1 0\n 18 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.09,"logp":2.71,"tpsa":54.02,"ha":18,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":88,"number":1217},{"id":18274,"smiles":"O=C(Nc1cccnc1)Nc1cccc(Br)c1","cmpd_id":1547,"prot_id":18287,"protein_code":"NUDT5A-x1219_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1219_3_apo_8XxjeIs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -32.0790 12.4400 -59.7210 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6310 14.2920 -62.4900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.9400 11.3230 -60.5490 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.3000 13.3100 -63.4210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.1390 11.1680 -56.3830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.1950 14.0080 -61.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5650 11.9580 -63.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.1540 11.6300 -61.8620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4670 12.6660 -60.9580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.3220 11.7830 -59.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.9370 11.1090 -57.7890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.9210 10.5060 -58.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.0540 10.0080 -57.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.1500 10.1290 -56.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.7460 11.6940 -58.2510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -36.2170 10.6910 -55.7620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.3150 16.1770 -62.9070 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 2 0\n 6 2 1 0\n 7 4 1 0\n 8 7 2 0\n 9 8 1 0\n 9 6 2 0\n 9 1 1 0\n 10 3 2 0\n 10 1 1 0\n 11 5 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 11 1 0\n 15 10 1 0\n 16 14 2 0\n 16 5 1 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1219},{"id":18282,"smiles":"COc1cccc(NC(=O)Nc2cccnc2)c1","cmpd_id":1548,"prot_id":18295,"protein_code":"NUDT5A-x1242_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1242_3_apo_5DmHtQE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n -32.3310 12.4080 -59.8030 N 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5310 16.2720 -62.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.5650 15.0680 -63.4250 O 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9510 13.8840 -62.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.2870 10.1980 -56.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.2450 11.2120 -56.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5250 13.7660 -61.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6580 12.7510 -63.6120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9300 11.4810 -63.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4910 11.3290 -61.8360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.7790 12.4790 -61.0850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.6040 11.8860 -59.5940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.1280 11.2280 -57.7470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.1700 10.6840 -58.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.2710 10.1520 -57.8490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.9200 11.7440 -58.2430 N 0 0 0 0 0 0 0 0 0 0 0 0\n -36.3040 10.7040 -55.6820 N 0 0 0 0 0 0 0 0 0 0 0 0\n -34.3630 11.5990 -60.5210 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 1 0\n 7 4 2 0\n 8 4 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 7 1 0\n 11 1 1 0\n 12 1 1 0\n 13 6 1 0\n 14 13 2 0\n 15 14 1 0\n 15 5 2 0\n 16 13 1 0\n 16 12 1 0\n 17 5 1 0\n 17 6 2 0\n 18 12 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":1242},{"id":18286,"smiles":"S=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":1549,"prot_id":18299,"protein_code":"NUDT5A-x1291_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1291_3_apo_5IRJnnq.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -32.2790 12.7030 -59.8780 N 0 0 0 0 0 0 0 0 0 0 0 0\n -33.5860 12.2900 -59.7350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.7570 13.2190 -61.0790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -37.3090 10.3320 -56.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.8910 10.5240 -58.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.5810 12.3380 -62.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.0650 12.8460 -63.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.7290 14.2070 -63.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9140 15.0620 -62.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4320 14.5730 -61.1530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.0410 11.3650 -57.9570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.3670 11.6780 -56.6440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -36.5100 11.1530 -56.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.8310 11.8470 -58.4600 N 0 0 0 0 0 0 0 0 0 0 0 0\n -37.0290 10.0090 -58.1730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -34.6980 12.3170 -60.9490 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 6 3 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 3 1 0\n 11 5 1 0\n 12 11 2 0\n 13 4 2 0\n 13 12 1 0\n 14 11 1 0\n 14 2 1 0\n 15 5 2 0\n 15 4 1 0\n 16 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.07,"logp":2.89,"tpsa":36.95,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":1291},{"id":18290,"smiles":"O=C(Nc1ccccc1)Nc1cncc(Br)c1","cmpd_id":1544,"prot_id":18303,"protein_code":"NUDT5A-x1298_3","mol_type":"PR","molecule_protein":"/media/pdbs/NUDT5A-x1298_3_apo_YYk2liG.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -35.3730 11.0760 -55.7790 N 0 0 0 0 0 0 0 0 0 0 0 0\n -36.1090 10.4220 -57.9140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -33.3350 12.0380 -60.6670 O 0 0 0 0 0 0 0 0 0 0 0 0\n -36.2700 10.4770 -56.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6760 12.5160 -62.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -35.0720 10.9670 -58.6150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.3150 11.6370 -56.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -34.1180 11.6130 -57.8340 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.6650 12.4430 -59.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.9110 13.5030 -61.0820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.6130 14.8370 -61.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.0790 15.2050 -62.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -29.8410 14.2410 -63.5520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -30.1410 12.8980 -63.2910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -32.9900 12.2380 -58.3590 N 0 0 0 0 0 0 0 0 0 0 0 0\n -31.4560 13.1410 -59.8480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -37.3950 9.5170 -58.8790 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 4 1 2 0\n 6 2 2 0\n 7 1 1 0\n 8 7 2 0\n 8 6 1 0\n 9 3 2 0\n 10 5 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 5 1 0\n 15 8 1 0\n 15 9 1 0\n 16 10 1 0\n 16 9 1 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":291,"logp":3.49,"tpsa":54.02,"ha":17,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":86,"number":1298}]},"duck_yank_data":{},"pandda_event_list":[],"pandda_site_list":[],"mol_group_on":220882,"target_on":40,"target_on_name":"NUDT5A","isFetching":false,"app_on":"PREVIEW","group_type":"MC","hotspot_list":[],"savingState":"UNSET","seshListSaving":false,"targetUnrecognised":false,"uuid":"UNSET","sessionIdList":[],"direct_access":{},"direct_access_processed":false},"nglReducers":{"objectsInView":{"PROTEIN_40":{"name":"PROTEIN_40","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"summary_view","representations":[{"lastKnownID":"E68C9B71-2F81-4D6A-873E-D79C1A94324A","uuid":"E68C9B71-2F81-4D6A-873E-D79C1A94324A","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"PROTEIN_40_MAIN":{"name":"PROTEIN_40_MAIN","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"major_view","representations":[{"lastKnownID":"3C0398B1-6773-4B86-A150-8B16078CABC1","uuid":"3C0398B1-6773-4B86-A150-8B16078CABC1","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220883":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220883","radius":6,"colour":[0,0,1],"coords":[-22.4835233187594,28.4053233460983,-57.027099634933],"representations":[{"lastKnownID":"4C8717FB-79E7-47FD-8EAE-3848E2FDD41C","uuid":"4C8717FB-79E7-47FD-8EAE-3848E2FDD41C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220884":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220884","radius":6,"colour":[0,0,1],"coords":[-29.077335188903,6.01824404431039,-63.9042831677937],"representations":[{"lastKnownID":"9A1D3568-5108-4068-ADC7-627797D9BEFD","uuid":"9A1D3568-5108-4068-ADC7-627797D9BEFD","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220885":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220885","radius":6,"colour":[0,0,1],"coords":[-17.0403378328045,-14.5791312624094,-4.79678133325591],"representations":[{"lastKnownID":"1E898E28-DE37-446B-AD9F-B51D72B944DD","uuid":"1E898E28-DE37-446B-AD9F-B51D72B944DD","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220886":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220886","radius":2,"colour":[0,0,1],"coords":[-52.3928823529412,9.81782352941177,-44.0535294117647],"representations":[{"lastKnownID":"E70390EC-FB25-4CE4-B266-383B2FF8A2BD","uuid":"E70390EC-FB25-4CE4-B266-383B2FF8A2BD","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220887":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220887","radius":2,"colour":[0,0,1],"coords":[-6.39705882352941,15.7078235294118,-24.2612352941176],"representations":[{"lastKnownID":"DA748419-76FC-4CE8-9186-8B024FDE0E7B","uuid":"DA748419-76FC-4CE8-9186-8B024FDE0E7B","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220888":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220888","radius":2,"colour":[0,0,1],"coords":[12.4376428571429,5.258,-4.62571428571429],"representations":[{"lastKnownID":"8999BFA5-8D27-458B-BA4E-55D612F4F42C","uuid":"8999BFA5-8D27-458B-BA4E-55D612F4F42C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220889":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220889","radius":6,"colour":[0,0,1],"coords":[-25.3682771564328,21.5258951736469,-52.7491056544548],"representations":[{"lastKnownID":"97A2DA89-38F2-4E56-96D3-B4F8497D807C","uuid":"97A2DA89-38F2-4E56-96D3-B4F8497D807C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220890":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220890","radius":6,"colour":[0,0,1],"coords":[-8.16724968062983,2.81894853371173,-2.84670969915877],"representations":[{"lastKnownID":"5733F57C-346E-453B-806E-6FE1DCCE96A4","uuid":"5733F57C-346E-453B-806E-6FE1DCCE96A4","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220891":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220891","radius":4,"colour":[0,0,1],"coords":[-33.276049496474,12.3248778435673,-59.8326882142243],"representations":[{"lastKnownID":"7002A955-846A-40C9-B376-BA0CE9E2E347","uuid":"7002A955-846A-40C9-B376-BA0CE9E2E347","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220881":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220881","radius":6,"colour":[0,1,0],"coords":[-10.4955049680239,-9.68024546470901,-8.32242130242049],"representations":[{"lastKnownID":"5066E1FF-5AAC-47FB-AE01-F8FE422C2600","uuid":"5066E1FF-5AAC-47FB-AE01-F8FE422C2600","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"NUDT5A-x1004_4_LIGAND":{"display_div":"major_view","name":"NUDT5A-x1004_4_LIGAND","OBJECT_TYPE":"LIGAND","colour":"#1F75FE","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -11.1920 -8.6800 -9.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.4820 -10.4380 -8.7400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8820 -10.4240 -8.4640 O 0 0 0 0 0 0 0 0 0 0 0 0\n -12.6830 -11.2590 -9.7850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9890 -9.2060 -5.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7720 -8.6960 -5.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2320 -9.1550 -4.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9380 -10.1150 -3.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6420 -10.1640 -4.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -13.7090 -12.2510 -10.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.9420 -10.3720 -10.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.9350 -10.7260 -12.2000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4080 -9.8890 -13.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8610 -8.6650 -12.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7960 -8.2890 -11.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.3100 -9.1250 -10.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4890 -9.3820 -8.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5550 -8.7370 -6.9720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1300 -10.6170 -3.7970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 1 1 0\n 16 15 2 0\n 17 1 1 0\n 17 3 2 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","moleculeId":18220,"selectionType":"LIGAND","representations":[{"lastKnownID":"3AD96A68-BBE5-43F3-BF78-95D8259070C4","uuid":"3AD96A68-BBE5-43F3-BF78-95D8259070C4","type":"ball+stick","params":{"lazy":false,"visible":true,"quality":"medium","sphereDetail":1,"radialSegments":10,"openEnded":true,"disableImpostor":false,"aspectRatio":2,"lineOnly":false,"cylinderOnly":false,"multipleBond":true,"bondScale":0.4,"bondSpacing":1,"linewidth":2,"radiusType":"size","radiusData":{},"radiusSize":0.15,"radiusScale":1,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"element","colorScale":"","colorReverse":false,"colorValue":"#1F75FE","colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"sphereDetail":{"type":"integer","max":3,"min":0,"rebuild":"impostor"},"radialSegments":{"type":"integer","max":25,"min":5,"rebuild":"impostor"},"openEnded":{"type":"boolean","rebuild":"impostor","buffer":true},"disableImpostor":{"type":"boolean","rebuild":true},"aspectRatio":{"type":"number","precision":1,"max":10,"min":1},"lineOnly":{"type":"boolean","rebuild":true},"cylinderOnly":{"type":"boolean","rebuild":true},"multipleBond":{"type":"select","rebuild":true,"options":{"off":"off","symmetric":"symmetric","offset":"offset"}},"bondScale":{"type":"number","precision":2,"max":1,"min":0.01},"bondSpacing":{"type":"number","precision":2,"max":2,"min":0.5},"linewidth":{"type":"integer","max":50,"min":1,"buffer":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"NUDT5A-x1004_4_HIT_PROTEIN":{"display_div":"major_view","name":"NUDT5A-x1004_4_HIT_PROTEIN","OBJECT_TYPE":"HIT_PROTEIN","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n -11.1920 -8.6800 -9.2110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.4820 -10.4380 -8.7400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8820 -10.4240 -8.4640 O 0 0 0 0 0 0 0 0 0 0 0 0\n -12.6830 -11.2590 -9.7850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9890 -9.2060 -5.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7720 -8.6960 -5.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2320 -9.1550 -4.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9380 -10.1150 -3.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.6420 -10.1640 -4.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -13.7090 -12.2510 -10.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.9420 -10.3720 -10.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.9350 -10.7260 -12.2000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.4080 -9.8890 -13.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8610 -8.6650 -12.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7960 -8.2890 -11.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.3100 -9.1250 -10.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4890 -9.3820 -8.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5550 -8.7370 -6.9720 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1300 -10.6170 -3.7970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 4 1 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 1 1 0\n 16 15 2 0\n 17 1 1 0\n 17 3 2 0\n 18 17 1 0\n 18 5 1 0\n 19 9 2 0\n 19 8 1 0\nM END\n","colour":"#1F75FE","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/NUDT5A-x1004_4_apo_hYlijTI.pdb","moleculeId":18220,"selectionType":"PROTEIN","representations":[{"lastKnownID":"0F00E012-0CB3-4F37-A7E5-AE0E7131603C","uuid":"0F00E012-0CB3-4F37-A7E5-AE0E7131603C","type":"line","params":{"lazy":false,"visible":true,"quality":"medium","multipleBond":"off","bondSpacing":1,"linewidth":4,"lines":true,"crosses":"lone","crossSize":0.4,"radiusType":"vdw","radiusData":{},"radiusSize":1,"radiusScale":1,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"opacity":1,"depthWrite":true,"colorScheme":"element","colorScale":"","colorReverse":false,"colorValue":"#1F75FE","colorMode":"hcl","diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":"/0"},"templateParams":{"multipleBond":{"type":"select","rebuild":true,"options":{"off":"off","symmetric":"symmetric","offset":"offset"}},"bondSpacing":{"type":"number","precision":2,"max":2,"min":0.5},"linewidth":{"type":"integer","max":50,"min":1,"buffer":true},"lines":{"type":"boolean","rebuild":true},"crosses":{"type":"select","rebuild":true,"options":{"off":"off","lone":"lone","all":"all"}},"crossSize":{"type":"number","precision":2,"max":2,"min":0.1},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":null,"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":null,"wireframe":null,"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":null,"metalness":null,"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220882":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220882","radius":6,"colour":[0,1,0],"coords":[-2.81713538840293,3.04881164113424,3.68988223433862],"representations":[{"lastKnownID":"44F742FD-7B61-41E9-96A4-3512E4CE6D0C","uuid":"44F742FD-7B61-41E9-96A4-3512E4CE6D0C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]}},"nglOrientations":{"summary_view":{"elements":[151.57246581831345,0,0,0,0,151.57246581831345,0,0,0,0,151.57246581831345,0,20.63599967956543,-9.788999557495117,30.652498722076416,1]},"major_view":{"elements":[27.21625004809499,0,0,0,0,27.21625004809499,0,0,0,0,27.21625004809499,0,10.970499992370605,10.269999980926514,8.281000137329102,1]}},"viewParams":{"backgroundColor":"black","clipNear":42,"clipFar":100,"clipDist":10,"fogNear":50,"fogFar":62},"countOfRemainingMoleculeGroups":0,"proteinsHasLoaded":true,"countOfPendingNglObjects":{"major_view":0,"summary_view":0},"moleculeOrientations":{"18220":{"elements":[27.21625004809499,0,0,0,0,27.21625004809499,0,0,0,0,27.21625004809499,0,10.970499992370605,10.269999980926514,8.281000137329102,1]}}},"selectionReducers":{"to_buy_list":[],"vector_list":[],"fragmentDisplayList":[18220],"proteinList":[18220],"complexList":[],"surfaceList":[],"densityList":[],"vectorOnList":[],"countOfPendingVectorLoadRequests":0,"mol_group_selection":[220881,220882],"filter":{"active":false,"predefined":"none","filter":{"site":{"priority":0,"order":1,"minValue":1,"maxValue":1,"isFloat":false},"number":{"priority":0,"order":1,"minValue":1004,"maxValue":1298,"isFloat":true},"MW":{"priority":0,"order":1,"minValue":206.12,"maxValue":291,"isFloat":true},"logP":{"priority":0,"order":1,"minValue":0.56,"maxValue":3.85,"isFloat":true},"TPSA":{"priority":0,"order":1,"minValue":36.95,"maxValue":81.3,"isFloat":true},"HA":{"priority":0,"order":1,"minValue":15,"maxValue":19,"isFloat":false},"Hacc":{"priority":0,"order":1,"minValue":2,"maxValue":3,"isFloat":false},"Hdon":{"priority":0,"order":1,"minValue":2,"maxValue":3,"isFloat":false},"Rots":{"priority":0,"order":1,"minValue":2,"maxValue":3,"isFloat":false},"Rings":{"priority":0,"order":1,"minValue":2,"maxValue":2,"isFloat":false},"Velec":{"priority":0,"order":1,"minValue":80,"maxValue":98,"isFloat":false},"#cpd":{"priority":0,"order":1,"minValue":0,"maxValue":0,"isFloat":false}},"priorityOrder":["site","number","MW","logP","TPSA","HA","Hacc","Hdon","Rots","Rings","Velec","#cpd"]},"compoundsOfVectors":null,"bondColorMapOfVectors":null,"currentVector":null},"targetReducers":{"oldUrl":"https://fragalysis.diamond.ac.uk/api/targets/","isTargetLoading":false},"snapshotReducers":{"saveType":"","nextUuid":"","newSessionFlag":0,"openSavingDialog":false,"dialogCurrentStep":0,"isLoadingSnapshotDialog":false,"listOfSnapshots":[],"isLoadingListOfSnapshots":false,"sharedSnapshotURL":null,"sharedSnapshot":{"url":null,"title":null,"description":null,"disableRedirect":false},"isOpenModalSaveSnapshotBeforeExit":false,"selectedSnapshotToSwitch":null,"disableRedirect":false},"previewReducers":{"summary":{"oldUrl":"","compoundImage":"<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" width=\"150px\" height=\"150px\"/>","width":150,"height":150,"countOfPicked":0,"countOfExploredVectors":0,"countOfExploredSeries":0,"estimatedCost":0},"compounds":{"currentPage":-1,"compoundsPerPage":20,"currentCompounds":[],"currentCompoundClass":"blue","selectedCompoundsClass":{"blue":[],"red":[],"green":[],"purple":[],"apricot":[]},"highlightedCompoundId":null,"showedCompoundList":[],"configuration":{}},"molecule":{"sortDialogOpen":false}},"projectReducers":{"currentProject":{"projectID":null,"authorID":null,"title":null,"description":null,"targetID":null,"tags":[],"type":null},"isLoadingCurrentSnapshot":false,"currentSnapshot":{"id":null,"type":"INIT","title":"Initial Snapshot","author":null,"description":"Auto generated initial snapshot","created":"2020-11-11T15:59:30.602Z","parent":null,"children":[],"data":{"apiReducers":{"target_id_list":[{"id":2,"title":"NUDT7A","project_id":[2],"protein_set":[15617,15618,15619,15620,15621,15622,15623,15624,15625,15626,15627,15628,15629,15630,15631],"template_protein":"/media/pdbs/NUDT7A-x0140_1_apo_hYaNUGN.pdb","metadata":null,"zip_archive":null},{"id":4,"title":"ATAD","project_id":[2],"protein_set":[13044,13045,13046,13047,13048,13049,13050,13051],"template_protein":"/media/pdbs/ATAD2A-x1712_1_apo_QcCBCZx.pdb","metadata":null,"zip_archive":null},{"id":5,"title":"BRD1A","project_id":[2],"protein_set":[13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065,13066,13067,13068,13069,13070,13071,13072,13073],"template_protein":"/media/pdbs/BRD1A-x0900_1_apo_X36iTCu.pdb","metadata":null,"zip_archive":null},{"id":7,"title":"DCP2B","project_id":[2],"protein_set":[14666,14667,14668,14669,14670,14671,14672,14673,14674,14675,14676,14677,14678,14679,14680,14681,14682,14683,14684,14685,14686,14687,14688,14689,14690,14691,14692,14693,14694,14695,14696,14697,14698,14699,14700,14701,14702,14703,14704,14705,14706,14707,14708,14709,14710,14711,14712,14713,14714,14715,14716,14717,14718,14719,14720,14721,14722,14723,14724,14725,14726,14727,14728,14729,14730,14731,14732,14733,14734,14735,14736,14737,14738],"template_protein":"/media/pdbs/DCP2B-x0020_1_apo_5td9srg.pdb","metadata":null,"zip_archive":null},{"id":8,"title":"FAM83BA","project_id":[2],"protein_set":[13325,13326,13327,13328,13329,13330,13331,13332,13333,13334,13335,13336,13337,13338],"template_protein":"/media/pdbs/FAM83BA-x0131_1_apo_G2blbbF.pdb","metadata":null,"zip_archive":null},{"id":12,"title":"MURD","project_id":[2],"protein_set":[6378,6379,6380,6381],"template_protein":"/media/pdbs/MURD-x0349_apo_0Z35oUA.pdb","metadata":null,"zip_archive":null},{"id":15,"title":"NUDT4A","project_id":[2],"protein_set":[13536,13537,13538,13539,13540,13541,13542,13543],"template_protein":"/media/pdbs/NUDT4A-x0159_1_apo_MptlW5D.pdb","metadata":null,"zip_archive":null},{"id":17,"title":"OXA10OTA","project_id":[2],"protein_set":[13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967,13968,13969,13970],"template_protein":"/media/pdbs/OXA10OTA-x0038_1_apo_b0APxOF.pdb","metadata":null,"zip_archive":null},{"id":18,"title":"PARP14A","project_id":[2],"protein_set":[13971,13972,13973,13974,13975,13976,13977,13978,13979,13980,13981,13982,13983,13984,13985,13986,13987,13988],"template_protein":"/media/pdbs/PARP14A-x0137_1_apo_RiuanPQ.pdb","metadata":null,"zip_archive":null},{"id":19,"title":"PHIPA","project_id":[2],"protein_set":[32628,32655,32616,32629,32620,32640,32611,32630,32623,32653,32617,32631,32618,32648,32641,32619,32632,32634,32654,32659,32622,32642,32615,32612,32625,32660,32621,32626,32649,32643,32627,32663,32635,32644,32662,32656,32650,32639,32645,32646,32657,32651,32647,32614,32652,32613,32636,32658,32624,32661,32638,32633,32637],"template_protein":"/media/pdbs/PHIPA-x20442_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_oHB8XOf.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/PHIPA.zip"},{"id":20,"title":"PTP1B","project_id":[2],"protein_set":[6480,6481,6482,6483,6484,6485,6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,6614,6615,6616,6617,6618],"template_protein":"/media/pdbs/PTP1B-y0049_apo_N9naW4T.pdb","metadata":null,"zip_archive":null},{"id":22,"title":"SMTGR","project_id":[2],"protein_set":[7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213,7214,7215],"template_protein":"/media/pdbs/smTGR-x2053_apo_zrHDWbw.pdb","metadata":null,"zip_archive":null},{"id":29,"title":"ATAD2A","project_id":[2],"protein_set":[13052,13053,13054],"template_protein":"/media/pdbs/ATAD2A-x1803_1_apo_D4wOsMM.pdb","metadata":null,"zip_archive":null},{"id":30,"title":"CAMK1DA","project_id":[2],"protein_set":[13074,13075,13076,13077,13078,13079,13080,13081,13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092],"template_protein":"/media/pdbs/CAMK1DA-x0049_1_apo_Xd3Xer3.pdb","metadata":null,"zip_archive":null},{"id":31,"title":"DCLRE1AA","project_id":[2],"protein_set":[13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,13228,13229,13230,13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,13241,13242,13243,13244,13245,13246,13247,13248,13249,13250,13251],"template_protein":"/media/pdbs/DCLRE1AA-x0128_1_apo_SgxAg9F.pdb","metadata":null,"zip_archive":null},{"id":32,"title":"FALZA","project_id":[2],"protein_set":[6928,6929,6930,6931,6932,6933,6934,6935],"template_protein":"/media/pdbs/FALZA-x0079_1_apo_pDzqSU5.pdb","metadata":null,"zip_archive":null},{"id":35,"title":"HAO1A","project_id":[2],"protein_set":[6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968,6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983],"template_protein":"/media/pdbs/HAO1A-x0208_1_apo_MQrMrik.pdb","metadata":null,"zip_archive":null},{"id":37,"title":"MUREECA","project_id":[2],"protein_set":[17944,17945,17946,17947,17948,17949,17950,17951,17952,17953,17954,17955,17956,17957,17958,17959,17960,17961,17962,17963,17964,17965],"template_protein":"/media/pdbs/MUREECA-x0114_1_apo_SbbuYzF.pdb","metadata":null,"zip_archive":null},{"id":38,"title":"NUDT21A","project_id":[2],"protein_set":[13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506,13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522,13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535],"template_protein":"/media/pdbs/NUDT21A-x0159_1_apo_VSKfMPI.pdb","metadata":null,"zip_archive":null},{"id":39,"title":"NUDT4","project_id":[2],"protein_set":[7069,7070,7071,7072,7073,7074],"template_protein":"/media/pdbs/NUDT4A-x0159_apo_Z09M2Hp.pdb","metadata":null,"zip_archive":null},{"id":40,"title":"NUDT5A","project_id":[2],"protein_set":[18136,18137,18138,18139,18140,18141,18142,18143,18144,18145,18146,18147,18148,18149,18150,18151,18152,18153,18154,18155,18156,18157,18158,18159,18160,18161,18162,18163,18164,18165,18166,18167,18168,18169,18170,18171,18172,18173,18174,18175,18176,18177,18178,18179,18180,18181,18182,18183,18184,18185,18186,18187,18188,18189,18190,18191,18192,18193,18194,18195,18196,18197,18198,18199,18200,18201,18202,18203,18204,18205,18206,18207,18208,18209,18210,18211,18212,18213,18214,18215,18216,18217,18218,18219,18220,18221,18222,18223,18224,18225,18226,18227,18228,18229,18230,18231,18232,18233,18234,18235,18236,18237,18238,18239,18240,18241,18242,18243,18244,18245,18246,18247,18248,18249,18250,18251,18252,18253,18254,18255,18256,18257,18258,18259,18260,18261,18262,18263,18264,18265,18266,18267,18268,18269,18270,18271,18272,18273,18274,18275,18276,18277,18278,18279,18280,18281,18282,18283,18284,18285,18286,18287,18288,18289,18290,18291,18292,18293,18294,18295,18296,18297,18298,18299,18300,18301,18302,18303,18304],"template_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","metadata":null,"zip_archive":null},{"id":41,"title":"NUDT7A_CRUDE","project_id":[2],"protein_set":[13657,13658,13659,13660,13661,13662,13663,13664,13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680,13681,13682,13683,13684,13685,13686,13687,13688,13689,13690,13691,13692,13693,13694,13695,13696,13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712,13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728,13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744,13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760,13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,13775,13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791,13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807,13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823,13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839,13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855,13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871,13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887,13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903,13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919,13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935,13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951],"template_protein":"/media/pdbs/NUDT7A_Crude-x0005_1_apo_by2s3Tn.pdb","metadata":null,"zip_archive":null},{"id":46,"title":"smTGRNEW","project_id":[2],"protein_set":[7216,7217,7218,7219,7220,7221,7222,7223,7224],"template_protein":"/media/pdbs/smTGR-x20531_apo_ddCGiaP.pdb","metadata":null,"zip_archive":null},{"id":47,"title":"STAG1A","project_id":[2],"protein_set":[14789,14790,14791,14792,14793,14794,14795,14796,14797,14798,14799,14800,14801,14802,14803,14804,14805,14806,14807,14808,14809],"template_protein":"/media/pdbs/STAG1A-x0237_1_apo_T6h9LGK.pdb","metadata":null,"zip_archive":null},{"id":48,"title":"TBXTA","project_id":[2],"protein_set":[14810,14811,14812,14813,14814,14815,14816,14817,14818,14819,14820,14821,14822,14823,14824,14825,14826,14827,14828,14829,14830,14831,14832,14833,14834,14835,14836,14837,14838,14839,14840,14841,14842,14843,14844,14845,14846,14847,14848,14849,14850,14851,14852,14853,14854,14855,14856,14857,14858,14859,14860,14861,14862],"template_protein":"/media/pdbs/TBXTA-x0024_1_apo_kFHAPSk.pdb","metadata":null,"zip_archive":null},{"id":50,"title":"VIM2","project_id":[2],"protein_set":[14410,14411,14412,14413,14414,14415,14416,14417,14418,14419,14420,14421,14422,14423,14424,14425,14426,14427,14428,14429,14430,14431,14432,14433,14434,14435,14436,14437,14438,14439,14440,14441,14442,14443,14444,14445,14446,14447,14448,14449,14450,14451,14452,14453,14454,14455,14456,14457,14458,14459,14460,14461,14462,14463,14464,14465,14466,14467,14468,14469,14470,14471,14472,14473,14474,14475,14476,14477,14478,14479,14480,14481,14482,14483,14484,14485,14486,14487,14488,14489,14490,14491,14492,14493,14494,14495,14496,14497,14498,14499,14500,14501,14502,14503,14504,14505,14506,14507,14508,14509,14510,14511,14512,14513,14514,14515,14516,14517,14518,14519,14520,14521,14522,14523,14524,14525,14526,14527,14528,14529,14530,14531,14532,14533,14534,14535,14536,14537,14538,14539,14540,14541,14542,14543,14544,14545,14546,14547,14548,14549,14550,14551,14552,14553,14554,14555,14556,14557,14558,14559,14560,14561,14562,14563,14564,14565,14566,14567,14568,14569,14570,14571,14572,14573],"template_protein":"/media/pdbs/VIM2-MB-105_1_apo_SBlf6ub.pdb","metadata":null,"zip_archive":null},{"id":51,"title":"XX02KALRNA","project_id":[2],"protein_set":[14902,14903,14904,14905,14906,14907,14908,14909,14910,14911,14912,14913],"template_protein":"/media/pdbs/XX02KALRNA-x1376_1_apo_9VSCvR8.pdb","metadata":null,"zip_archive":null},{"id":52,"title":"TNCA","project_id":[2],"protein_set":[14354,14355,14356,14357,14358,14359,14360,14361,14362,14363,14364,14365,14366,14367,14368,14369,14370],"template_protein":"/media/pdbs/TNCA-x0062_1_apo_Vc9bxy2.pdb","metadata":null,"zip_archive":null},{"id":53,"title":"ALAS2A","project_id":[2],"protein_set":[17966],"template_protein":"NOT AVAILABLE","metadata":null,"zip_archive":null},{"id":54,"title":"EPB41L3A","project_id":[2],"protein_set":[18435,18460,31217,31218,31234,31244,31219,31220,31235,31252,31221,31222,18428,31245,31223,31236,31224,31261,31225,31237,31226,31246,31227,31238,31228,31253,31229,31239,31230,31247,31231,31240,31232,31258,31233,31241,31248,31242,31254,31243,31249,31264,31250,31255,31251,31259,31262,31256,31257,31260,31263,31265],"template_protein":"/media/pdbs/EPB41L3A-x0306_1_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_NJuLr98.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/EPB41L3A.zip"},{"id":61,"title":"mArh","project_id":[2],"protein_set":[31678,31674,31681,31675,31671,31672,31679,31676,31673,31683,31677,31682,31680,31686,31685,31684,31687,31688,31689,31690,31691,31692,31693,31694,31695,31696,31697,31698,31700,31704,31701,31707,31702,31699,31705,31703,31710,31706,31709,31708,31711,31712,31713,31714,31715,31716,31717,31718,31719,31720,31721,31722,31723,31724,31725,31726,31727,31728,31729,31730,31731,31732,31733,31734,31747,31735,31756,31736,31748,31737,31738,31749,31739,31762,31757,31740,31750,31741,31742,31751,31743,31766,31758,31744,31752,31745,31746,31753,31763,31759,31754,31755,31769,31760,31764,31761,31767,31765,31772,31768,31771,31770,31773,31774,31775,31776,31777,31778,31779,31780,31794,31781,31810,31782,31795,31783,31804,31784,31796,31785,31818,31786,31815,31797,31787,31805,31788,31798,31789,31811,31790,31799,31791,31806,31792,31800,31793,31807,31801,31812,31802,31808,31803,31816,31809,31813,31822,31819,31814,31817,31821,31820,31823,31825,31824,31826,31827,31828,31829,31830,31831,31854,31832,31845,31833,31865,31834,31846,31835,31855,31836,31847,31837,31861,31838,31848,31839,31856,31840,31849,31841,31868,31842,31850,31843,31857,31844,31851,31862,31852,31858,31853,31866,31863,31859,31860,31872,31864,31867,31869,31871,31870,31916,31887,31898,31888,31873,31906,31874,31889,31875,31899,31876,31890,31877,31912,31878,31891,31879,31900,31880,31892,31881,31907,31882,31893,31883,31901,31884,31894,31885,31886,31919,31902,31895,31908,31896,31903,31897,31913,31909,31904,31905,31917,31914,31910,31911,31921,31915,31918,31920,31924,31922,31923,31925,31926,31927,31928,31929,31930,31931,31969,31932,31949,31933,31961,31934,31950,31935,31975,31936,31951,31937,31962,31938,31952,31939,31970,31940,31953,31941,31963,31942,31954,31943,31979,31944,31955,31945,31964,31946,31956,31947,31971,31948,31965,31957,31958,31976,31966,31959,31960,31972,31967,31982,31968,31973,31977,31980,31974,31984,31978,31983,31981,31987,31985,31986,31988,31989,31990,31991,31992,31993,31994,31996,31995,31997,31998,31999,32000,32001,32002,32003,32004,32005],"template_protein":"/media/pdbs/mArh-3ew5_B_0B_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_7AuLXgA.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/mArh.zip"},{"id":62,"title":"Mpro","project_id":[2],"protein_set":[30179,30140,32009,32314,30155,30164,30174,30203,30212,30182,30144,30176,30135,30152,30178,30183,30161,30169,30184,30175,30180,30181,30185,30186,30187,30202,30194,30193,30195,30196,30197,30198,30199,30201,30204,30205,30206,30207,30210,30211,30213,30216,30217,30218,30219,30220,32312,30222,30215,32313,30200,32315,30214,30221,32664,32666,32667,32665,32668,32677,32672,32675,32671,32676,32673,32670,32669,32674,30157,30145,30165,30131,30147,30130,30143,30137,30149,30151,30138,30133,30158,30166,30154,30146,30173,30129,30139,30159,30167,30156,30141,30132,30150,30177,30134,30160,30148,30153,30142,30168,30162,30163,30170,30171,30172,32680,32679,32678,32709,32687,32688,32697,32713,32706,32710,32721,32722,32696,32717,32716,32702,32685,32683,32705,32714,32701,32700,32695,32691,32694,32699,32707,32704,32698,32711,32715,32712,32689,32682,32681,32686,32703,32719,32720,32718,32684,32690,32692,32693,32708,32724,32726,32727,32723,32732,32729,32736,32731,32733,32737,32738,32734,32739,32740,32741,32735,32728,32744,32747,32748,32750,32745,32746,32754,32778,32799,32798,32755,32781,32756,32763,32758,32779,32801,32790,32759,32793,32800,32760,32771,32762,32780,32770,32772,32757,32769,32752,32773,32795,32782,32786,32774,32765,32775,32766,32777,32783,32785,32791,32792,32796,32753,32788,32797,32768,32784,32794,32789,32761,32810,32843,30136,32812,32828,32007,32832,32010,32813,32831,32823,32011,32814,32012,32847,32013,32816,32014,32824,32015,32808,32819,32805,32806,32815,32807,32835,32825,32809,32837,32836,32829,32822,32826,32827,32833,32830,32838,32841,32821,32842,32845,32817,32811,32820,32846,32848,32839,32849,32850,32844,32868,32896,32853,32870,32871,32854,32855,32864,32888,32857,32877,32884,32858,32897,32860,32885,32872,32875,32876,32880,32873,32862,32852,32887,32874,32861,32863,32878,32866,32903,32879,32856,32851,32889,32898,32881,32899,32900,32883,32886,32901,32869,32902,32893,32895,32892,32905,32904,32907,32891,32865,32939,32918,32908,32933,32932,32943,32937,32912,32956,32936,32911,32950,32927,32925,32916,32957,32917,32952,32919,32946,32958,32944,32938,32920,32910,32921,32922,32949,32923,32940,32924,32945,32934,32909,32931,32954,32935,32914,32941,32948,32928,32947,32913,32926,32942,32951,32953,32929,32915,32776,32787,32804,32730,32764,32742,32749,32867,32882,32818,32834,32859,32803,32802,32894,32906,32725,32890,32743,32751,32840,32767,32930,32955],"template_protein":"/media/pdbs/Mpro-6xqu_0A_apo_d2RXJbV.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_frXD4iS.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/Mpro.zip"},{"id":65,"title":"INPP5DA","project_id":[2],"protein_set":[31499,31508,31500,31501,31509,31517,31531,31503,31510,31504,31505,31518,31506,31523,31507,31512,31513,31519,31527,31514,31515,31524,31516,31521,31525,31522,31528,31526,31530,31532,31533,31534,31535,31536,31537,31539,31540,31541,31562,31542,31549,31578,31543,31544,31550,31546,31551,31547,31548,31552,31564,31583,31553,31565,31573,31555,31556,31566,31579,31557,31558,31567,31574,31559,31560,31568,31586,31561,31569,31575,31570,31580,31571,31576,31584,31577,31588,31582,31585,31587,31591,31589,31592,31593,31594,31595,31596,31597,31598,31599,31600,31601,31602,31603,31604,31605,31606,31607,31502,31511,31520,31529,31538,31545,31554,31563,31572,31581,31590],"template_protein":"/media/pdbs/INPP5DA-x0019_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_MR1dz1c.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/INPP5DA.zip"},{"id":66,"title":"nsp13","project_id":[2],"protein_set":[31608,31609,31613,31617,31614,31610,31611,31615,31612,31618,31620,31616,31622,31619,31623,31621,31624,31625,31626,31627,31628,31629,31630,31631,31632,31636,31633,31639,31634,31637,31635,31641,31638,31640,31642,31643,31644,31645,31646,31647,31648,31649,31650,31652,31666,31653,31654,31667,31655,31656,31668,31657,31658,31669,31659,31660,31670,31661,31662,31663,31651,31664,31665],"template_protein":"/media/pdbs/nsp13-x0020_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_ahVc7pn.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/nsp13.zip"},{"id":67,"title":"Mac1","project_id":[2],"protein_set":[32975,33004,32964,32985,32979,32990,32995,32974,32960,32988,33007,32965,32967,32966,32968,32969,32980,33009,32970,32983,32971,32984,32961,32987,32986,33006,32996,32972,32962,32993,32989,32978,33013,32977,32976,32998,32997,33003,33002,33012,32999,33000,33010,32994,33008,32991,32959,33005,32981,33061,33062,33051,33030,33067,33046,33024,33029,33044,33043,33048,33033,33018,33049,33031,33032,33059,33050,33054,33025,33040,33042,33026,33023,33022,33036,33063,33039,33068,33035,33017,33064,33045,33015,33052,33053,33055,33056,33021,33058,33037,33060,33020,33014,33034,33065,33041,33027,33016,33097,33103,33089,33087,33072,33100,33096,33070,33118,33108,33088,33076,33086,33092,33110,33075,33079,33105,33073,33071,33107,33095,33098,33085,33077,33117,33101,33082,33091,33090,33099,33104,33094,33111,33113,33114,33084,33116,33120,33109,33119,33123,33115,33122,33078,33069,33080,33081,33106,33127,33156,33152,33177,33125,33142,33144,33153,33128,33164,33150,33137,33139,33135,33124,33134,33160,33147,33154,33140,33168,33141,33130,33155,33133,33151,33146,33145,33126,33143,33132,33161,33166,33175,33149,33165,33162,33171,33136,33158,33174,33159,33163,33172,33170,33178,33169,33131,33173,33179,33202,33196,33180,33188,33227,33191,33187,33183,33232,33197,33182,33189,33200,33225,33181,33198,33208,33226,33207,33213,33209,33230,33190,33233,33224,33215,33194,33221,33204,33211,33216,33218,33199,33217,33210,33192,33228,33223,33205,33220,33214,33201,33219,33185,33195,33186,33229,33206,33234,33235,33203,33193,33184,33121,33129,33212,32982,33028,33222,33019,33001,33011,33148,33176,33066,33038,33083,32992,33047,33074,33057,32973,32963,33093,33102,33157,33112,33231,33138,33167],"template_protein":"/media/pdbs/Mac1-DLS-EU0569_0A_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/Mac1.zip"}],"mol_group_list":[{"id":220881,"group_type":"MC","mol_id":[18220,18224,18228,18232,18236,18271,18275,18278,18283,18287,18291],"target_id":40,"x_com":-10.4955049680239,"y_com":-9.68024546470901,"z_com":-8.32242130242049,"description":"c_of_m"},{"id":220882,"group_type":"MC","mol_id":[18123,18132,18135,18138,18148,18153,18157,18158,18162,18167,18170,18172,18174,18180,18181,18186,18189,18191,18196,18198,18200,18204,18206,18207,18211,18214,18240,18244,18247,18251,18255,18259,18263,18267],"target_id":40,"x_com":-2.81713538840293,"y_com":3.04881164113424,"z_com":3.68988223433862,"description":"c_of_m"},{"id":220883,"group_type":"MC","mol_id":[18124,18131,18134,18139,18145,18146,18150,18154,18160,18166,18168,18177,18182,18184,18193,18201,18202,18208,18212,18239,18243,18246,18250,18254,18258,18262,18266],"target_id":40,"x_com":-22.4835233187594,"y_com":28.4053233460983,"z_com":-57.027099634933,"description":"c_of_m"},{"id":220884,"group_type":"MC","mol_id":[18125,18133,18137,18141,18144,18149,18152,18156,18163,18164,18171,18175,18179,18183,18188,18195,18205,18209,18215,18237,18241,18248,18252,18256,18260,18264],"target_id":40,"x_com":-29.077335188903,"y_com":6.01824404431039,"z_com":-63.9042831677937,"description":"c_of_m"},{"id":220885,"group_type":"MC","mol_id":[18126,18129,18130,18136,18140,18142,18143,18147,18151,18155,18159,18161,18165,18169,18173,18176,18178,18185,18190,18192,18194,18197,18199,18203,18210,18213,18216,18238,18242,18245,18249,18253,18257,18261,18265],"target_id":40,"x_com":-17.0403378328045,"y_com":-14.5791312624094,"z_com":-4.79678133325591,"description":"c_of_m"},{"id":220886,"group_type":"MC","mol_id":[18127],"target_id":40,"x_com":-52.3928823529412,"y_com":9.81782352941177,"z_com":-44.0535294117647,"description":"c_of_m"},{"id":220887,"group_type":"MC","mol_id":[18128],"target_id":40,"x_com":-6.39705882352941,"y_com":15.7078235294118,"z_com":-24.2612352941176,"description":"c_of_m"},{"id":220888,"group_type":"MC","mol_id":[18187],"target_id":40,"x_com":12.4376428571429,"y_com":5.258,"z_com":-4.62571428571429,"description":"c_of_m"},{"id":220889,"group_type":"MC","mol_id":[18217,18221,18225,18229,18233,18268,18272,18276,18279,18280,18284,18288],"target_id":40,"x_com":-25.3682771564328,"y_com":21.5258951736469,"z_com":-52.7491056544548,"description":"c_of_m"},{"id":220890,"group_type":"MC","mol_id":[18218,18222,18226,18230,18234,18269,18273,18277,18281,18285,18289],"target_id":40,"x_com":-8.16724968062983,"y_com":2.81894853371173,"z_com":-2.84670969915877,"description":"c_of_m"},{"id":220891,"group_type":"MC","mol_id":[18219,18223,18227,18231,18235,18270,18274,18282,18286,18290],"target_id":40,"x_com":-33.276049496474,"y_com":12.3248778435673,"z_com":-59.8326882142243,"description":"c_of_m"}],"molecule_list":[],"cached_mol_lists":{},"all_mol_lists":{},"duck_yank_data":{},"pandda_event_list":[],"pandda_site_list":[],"target_on":40,"target_on_name":"NUDT5A","isFetching":false,"app_on":"PREVIEW","group_type":"MC","hotspot_list":[],"savingState":"UNSET","seshListSaving":false,"targetUnrecognised":false,"uuid":"UNSET","sessionIdList":[],"direct_access":{},"direct_access_processed":false},"nglReducers":{"objectsInView":{"PROTEIN_40":{"name":"PROTEIN_40","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"summary_view","representations":[{"lastKnownID":"E68C9B71-2F81-4D6A-873E-D79C1A94324A","uuid":"E68C9B71-2F81-4D6A-873E-D79C1A94324A","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"PROTEIN_40_MAIN":{"name":"PROTEIN_40_MAIN","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"major_view","representations":[{"lastKnownID":"3C0398B1-6773-4B86-A150-8B16078CABC1","uuid":"3C0398B1-6773-4B86-A150-8B16078CABC1","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220881":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220881","radius":6,"colour":[0,0,1],"coords":[-10.4955049680239,-9.68024546470901,-8.32242130242049],"representations":[{"lastKnownID":"91DF4B9B-C9FF-411E-BFF2-C98C0E5AD9F5","uuid":"91DF4B9B-C9FF-411E-BFF2-C98C0E5AD9F5","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220882":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220882","radius":6,"colour":[0,0,1],"coords":[-2.81713538840293,3.04881164113424,3.68988223433862],"representations":[{"lastKnownID":"7D229A8D-9BF4-4BCB-AA29-A8C2D81F74AE","uuid":"7D229A8D-9BF4-4BCB-AA29-A8C2D81F74AE","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220883":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220883","radius":6,"colour":[0,0,1],"coords":[-22.4835233187594,28.4053233460983,-57.027099634933],"representations":[{"lastKnownID":"4C8717FB-79E7-47FD-8EAE-3848E2FDD41C","uuid":"4C8717FB-79E7-47FD-8EAE-3848E2FDD41C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220884":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220884","radius":6,"colour":[0,0,1],"coords":[-29.077335188903,6.01824404431039,-63.9042831677937],"representations":[{"lastKnownID":"9A1D3568-5108-4068-ADC7-627797D9BEFD","uuid":"9A1D3568-5108-4068-ADC7-627797D9BEFD","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220885":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220885","radius":6,"colour":[0,0,1],"coords":[-17.0403378328045,-14.5791312624094,-4.79678133325591],"representations":[{"lastKnownID":"1E898E28-DE37-446B-AD9F-B51D72B944DD","uuid":"1E898E28-DE37-446B-AD9F-B51D72B944DD","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220886":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220886","radius":2,"colour":[0,0,1],"coords":[-52.3928823529412,9.81782352941177,-44.0535294117647],"representations":[{"lastKnownID":"E70390EC-FB25-4CE4-B266-383B2FF8A2BD","uuid":"E70390EC-FB25-4CE4-B266-383B2FF8A2BD","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220887":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220887","radius":2,"colour":[0,0,1],"coords":[-6.39705882352941,15.7078235294118,-24.2612352941176],"representations":[{"lastKnownID":"DA748419-76FC-4CE8-9186-8B024FDE0E7B","uuid":"DA748419-76FC-4CE8-9186-8B024FDE0E7B","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220888":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220888","radius":2,"colour":[0,0,1],"coords":[12.4376428571429,5.258,-4.62571428571429],"representations":[{"lastKnownID":"8999BFA5-8D27-458B-BA4E-55D612F4F42C","uuid":"8999BFA5-8D27-458B-BA4E-55D612F4F42C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220889":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220889","radius":6,"colour":[0,0,1],"coords":[-25.3682771564328,21.5258951736469,-52.7491056544548],"representations":[{"lastKnownID":"97A2DA89-38F2-4E56-96D3-B4F8497D807C","uuid":"97A2DA89-38F2-4E56-96D3-B4F8497D807C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220890":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220890","radius":6,"colour":[0,0,1],"coords":[-8.16724968062983,2.81894853371173,-2.84670969915877],"representations":[{"lastKnownID":"5733F57C-346E-453B-806E-6FE1DCCE96A4","uuid":"5733F57C-346E-453B-806E-6FE1DCCE96A4","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_220891":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_220891","radius":4,"colour":[0,0,1],"coords":[-33.276049496474,12.3248778435673,-59.8326882142243],"representations":[{"lastKnownID":"7002A955-846A-40C9-B376-BA0CE9E2E347","uuid":"7002A955-846A-40C9-B376-BA0CE9E2E347","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]}},"nglOrientations":{"summary_view":{"elements":[151.57246581831345,0,0,0,0,151.57246581831345,0,0,0,0,151.57246581831345,0,20.63599967956543,-9.788999557495117,30.652498722076416,1]},"major_view":{"elements":[151.57246581831345,0,0,0,0,151.57246581831345,0,0,0,0,151.57246581831345,0,20.63599967956543,-9.788999557495117,30.652498722076416,1]}},"viewParams":{"backgroundColor":"black","clipNear":42,"clipFar":100,"clipDist":10,"fogNear":50,"fogFar":62},"countOfRemainingMoleculeGroups":1,"proteinsHasLoaded":true,"countOfPendingNglObjects":{"major_view":0,"summary_view":0},"moleculeOrientations":{}},"selectionReducers":{"to_buy_list":[],"vector_list":[],"fragmentDisplayList":[],"proteinList":[],"complexList":[],"surfaceList":[],"densityList":[],"vectorOnList":[],"countOfPendingVectorLoadRequests":0,"mol_group_selection":[],"compoundsOfVectors":null,"bondColorMapOfVectors":null,"currentVector":null},"previewReducers":{"summary":{"oldUrl":"","compoundImage":"<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" width=\"150px\" height=\"150px\"/>","width":150,"height":150,"countOfPicked":0,"countOfExploredVectors":0,"countOfExploredSeries":0,"estimatedCost":0},"compounds":{"currentPage":-1,"compoundsPerPage":20,"currentCompounds":[],"currentCompoundClass":"blue","selectedCompoundsClass":{"blue":[],"red":[],"green":[],"purple":[],"apricot":[]},"highlightedCompoundId":null,"showedCompoundList":[],"configuration":{}},"molecule":{"sortDialogOpen":false}},"datasetsReducers":{"datasets":[],"moleculeLists":{},"isLoadingMoleculeList":false,"scoreDatasetMap":{},"scoreCompoundMap":{},"filterDatasetMap":{},"filterPropertiesDatasetMap":{},"filterDialogOpen":false,"filteredScoreProperties":{},"filterWithInspirations":false,"ligandLists":{},"proteinLists":{},"complexLists":{},"surfaceLists":{},"inspirationLists":{},"searchString":null,"isOpenInspirationDialog":false,"inspirationFragmentList":[],"isLoadingInspirationListOfMolecules":false,"inspirationMoleculeDataList":[],"isOpenCrossReferenceDialog":false,"crossReferenceCompoundName":null,"isLoadingCrossReferenceScores":false,"crossReferenceCompoundsDataList":[],"compoundsToBuyDatasetMap":{}}}},"isProjectModalOpen":false,"isProjectModalLoading":false,"listOfProjects":[],"isLoadingListOfProjects":false,"isLoadingTree":false,"currentSnapshotTree":null,"currentSnapshotList":null,"forceCreateProject":false,"isForceProjectCreated":false},"issueReducers":{"name":"Ryota Ashizawa","email":"[email protected]","title":"Download structures failed for NUDT5A","description":"Hello. I got an error message, \"The target was note recognised and there are no other available targets\", when trying to download structures by clicking \"DOWNLOAD STRUCTURES\". Could you please check it? Thank you.","response":"","imageSource":{},"isOpenForm":true},"datasetsReducers":{"datasets":[],"moleculeLists":{},"isLoadingMoleculeList":false,"scoreDatasetMap":{},"scoreCompoundMap":{},"filterDatasetMap":{},"filterPropertiesDatasetMap":{},"filterDialogOpen":false,"filteredScoreProperties":{},"filterWithInspirations":false,"ligandLists":{},"proteinLists":{},"complexLists":{},"surfaceLists":{},"inspirationLists":{},"searchString":null,"isOpenInspirationDialog":false,"inspirationFragmentList":[],"isLoadingInspirationListOfMolecules":false,"inspirationMoleculeDataList":[],"isOpenCrossReferenceDialog":false,"crossReferenceCompoundName":null,"isLoadingCrossReferenceScores":false,"crossReferenceCompoundsDataList":[],"compoundsToBuyDatasetMap":{}},"trackingReducers":{"truck_actions_list":[{"type":"TARGET_LOADED","timestamp":1605110368216,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"NUDT5A","object_id":40,"text":"Target NUDT5A was loaded"},{"type":"SITE_TURNED_ON","timestamp":1605110370608,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"c_of_m","object_id":220881,"text":"Site c_of_m was turned on"},{"type":"SIDECHAINS_TURNED_ON","timestamp":1605110371462,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"NUDT5A-x1004_4","object_id":18220,"text":"Sidechain was turned on MOLECULE NUDT5A-x1004_4"},{"type":"LIGAND_TURNED_ON","timestamp":1605110371463,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"NUDT5A-x1004_4","object_id":18220,"text":"Ligand was turned on MOLECULE NUDT5A-x1004_4"},{"type":"SITE_TURNED_ON","timestamp":1605110374769,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"c_of_m","object_id":220882,"text":"Site c_of_m was turned on"}],"current_actions_list":[]}}