-
Notifications
You must be signed in to change notification settings - Fork 1
/
Reducers-159463380737877584.json
1 lines (1 loc) · 250 KB
/
Reducers-159463380737877584.json
1
{"apiReducers":{"target_id_list":[{"id":2,"title":"NUDT7A","project_id":[2],"protein_set":[15617,15618,15619,15620,15621,15622,15623,15624,15625,15626,15627,15628,15629,15630,15631],"template_protein":"/media/pdbs/NUDT7A-x0140_1_apo_hYaNUGN.pdb","metadata":null,"zip_archive":null},{"id":4,"title":"ATAD","project_id":[2],"protein_set":[13044,13045,13046,13047,13048,13049,13050,13051],"template_protein":"/media/pdbs/ATAD2A-x1712_1_apo_QcCBCZx.pdb","metadata":null,"zip_archive":null},{"id":5,"title":"BRD1A","project_id":[2],"protein_set":[13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065,13066,13067,13068,13069,13070,13071,13072,13073],"template_protein":"/media/pdbs/BRD1A-x0900_1_apo_X36iTCu.pdb","metadata":null,"zip_archive":null},{"id":7,"title":"DCP2B","project_id":[2],"protein_set":[14666,14667,14668,14669,14670,14671,14672,14673,14674,14675,14676,14677,14678,14679,14680,14681,14682,14683,14684,14685,14686,14687,14688,14689,14690,14691,14692,14693,14694,14695,14696,14697,14698,14699,14700,14701,14702,14703,14704,14705,14706,14707,14708,14709,14710,14711,14712,14713,14714,14715,14716,14717,14718,14719,14720,14721,14722,14723,14724,14725,14726,14727,14728,14729,14730,14731,14732,14733,14734,14735,14736,14737,14738],"template_protein":"/media/pdbs/DCP2B-x0020_1_apo_5td9srg.pdb","metadata":null,"zip_archive":null},{"id":8,"title":"FAM83BA","project_id":[2],"protein_set":[13325,13326,13327,13328,13329,13330,13331,13332,13333,13334,13335,13336,13337,13338],"template_protein":"/media/pdbs/FAM83BA-x0131_1_apo_G2blbbF.pdb","metadata":null,"zip_archive":null},{"id":12,"title":"MURD","project_id":[2],"protein_set":[6378,6379,6380,6381],"template_protein":"/media/pdbs/MURD-x0349_apo_0Z35oUA.pdb","metadata":null,"zip_archive":null},{"id":15,"title":"NUDT4A","project_id":[2],"protein_set":[13536,13537,13538,13539,13540,13541,13542,13543],"template_protein":"/media/pdbs/NUDT4A-x0159_1_apo_MptlW5D.pdb","metadata":null,"zip_archive":null},{"id":17,"title":"OXA10OTA","project_id":[2],"protein_set":[13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967,13968,13969,13970],"template_protein":"/media/pdbs/OXA10OTA-x0038_1_apo_b0APxOF.pdb","metadata":null,"zip_archive":null},{"id":18,"title":"PARP14A","project_id":[2],"protein_set":[13971,13972,13973,13974,13975,13976,13977,13978,13979,13980,13981,13982,13983,13984,13985,13986,13987,13988],"template_protein":"/media/pdbs/PARP14A-x0137_1_apo_RiuanPQ.pdb","metadata":null,"zip_archive":null},{"id":19,"title":"PHIPA","project_id":[2],"protein_set":[16673],"template_protein":"/media/pdbs/PHIPA-x9178_1_apo_zdgcIwy.pdb","metadata":null,"zip_archive":null},{"id":20,"title":"PTP1B","project_id":[2],"protein_set":[6480,6481,6482,6483,6484,6485,6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,6614,6615,6616,6617,6618],"template_protein":"/media/pdbs/PTP1B-y0049_apo_N9naW4T.pdb","metadata":null,"zip_archive":null},{"id":22,"title":"SMTGR","project_id":[2],"protein_set":[7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213,7214,7215],"template_protein":"/media/pdbs/smTGR-x2053_apo_zrHDWbw.pdb","metadata":null,"zip_archive":null},{"id":29,"title":"ATAD2A","project_id":[2],"protein_set":[13052,13053,13054],"template_protein":"/media/pdbs/ATAD2A-x1803_1_apo_D4wOsMM.pdb","metadata":null,"zip_archive":null},{"id":30,"title":"CAMK1DA","project_id":[2],"protein_set":[13074,13075,13076,13077,13078,13079,13080,13081,13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092],"template_protein":"/media/pdbs/CAMK1DA-x0049_1_apo_Xd3Xer3.pdb","metadata":null,"zip_archive":null},{"id":31,"title":"DCLRE1AA","project_id":[2],"protein_set":[13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,13228,13229,13230,13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,13241,13242,13243,13244,13245,13246,13247,13248,13249,13250,13251],"template_protein":"/media/pdbs/DCLRE1AA-x0128_1_apo_SgxAg9F.pdb","metadata":null,"zip_archive":null},{"id":32,"title":"FALZA","project_id":[2],"protein_set":[6928,6929,6930,6931,6932,6933,6934,6935],"template_protein":"/media/pdbs/FALZA-x0079_1_apo_pDzqSU5.pdb","metadata":null,"zip_archive":null},{"id":35,"title":"HAO1A","project_id":[2],"protein_set":[6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968,6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983],"template_protein":"/media/pdbs/HAO1A-x0208_1_apo_MQrMrik.pdb","metadata":null,"zip_archive":null},{"id":37,"title":"MUREECA","project_id":[2],"protein_set":[17944,17945,17946,17947,17948,17949,17950,17951,17952,17953,17954,17955,17956,17957,17958,17959,17960,17961,17962,17963,17964,17965],"template_protein":"/media/pdbs/MUREECA-x0114_1_apo_SbbuYzF.pdb","metadata":null,"zip_archive":null},{"id":38,"title":"NUDT21A","project_id":[2],"protein_set":[13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506,13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522,13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535],"template_protein":"/media/pdbs/NUDT21A-x0159_1_apo_VSKfMPI.pdb","metadata":null,"zip_archive":null},{"id":39,"title":"NUDT4","project_id":[2],"protein_set":[7069,7070,7071,7072,7073,7074],"template_protein":"/media/pdbs/NUDT4A-x0159_apo_Z09M2Hp.pdb","metadata":null,"zip_archive":null},{"id":40,"title":"NUDT5A","project_id":[2],"protein_set":[18136,18137,18138,18139,18140,18141,18142,18143,18144,18145,18146,18147,18148,18149,18150,18151,18152,18153,18154,18155,18156,18157,18158,18159,18160,18161,18162,18163,18164,18165,18166,18167,18168,18169,18170,18171,18172,18173,18174,18175,18176,18177,18178,18179,18180,18181,18182,18183,18184,18185,18186,18187,18188,18189,18190,18191,18192,18193,18194,18195,18196,18197,18198,18199,18200,18201,18202,18203,18204,18205,18206,18207,18208,18209,18210,18211,18212,18213,18214,18215,18216,18217,18218,18219,18220,18221,18222,18223,18224,18225,18226,18227,18228,18229,18230,18231,18232,18233,18234,18235,18236,18237,18238,18239,18240,18241,18242,18243,18244,18245,18246,18247,18248,18249,18250,18251,18252,18253,18254,18255,18256,18257,18258,18259,18260,18261,18262,18263,18264,18265,18266,18267,18268,18269,18270,18271,18272,18273,18274,18275,18276,18277,18278,18279,18280,18281,18282,18283,18284,18285,18286,18287,18288,18289,18290,18291,18292,18293,18294,18295,18296,18297,18298,18299,18300,18301,18302,18303,18304],"template_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","metadata":null,"zip_archive":null},{"id":41,"title":"NUDT7A_CRUDE","project_id":[2],"protein_set":[13657,13658,13659,13660,13661,13662,13663,13664,13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680,13681,13682,13683,13684,13685,13686,13687,13688,13689,13690,13691,13692,13693,13694,13695,13696,13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712,13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728,13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744,13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760,13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,13775,13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791,13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807,13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823,13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839,13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855,13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871,13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887,13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903,13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919,13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935,13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951],"template_protein":"/media/pdbs/NUDT7A_Crude-x0005_1_apo_by2s3Tn.pdb","metadata":null,"zip_archive":null},{"id":46,"title":"smTGRNEW","project_id":[2],"protein_set":[7216,7217,7218,7219,7220,7221,7222,7223,7224],"template_protein":"/media/pdbs/smTGR-x20531_apo_ddCGiaP.pdb","metadata":null,"zip_archive":null},{"id":47,"title":"STAG1A","project_id":[2],"protein_set":[14789,14790,14791,14792,14793,14794,14795,14796,14797,14798,14799,14800,14801,14802,14803,14804,14805,14806,14807,14808,14809],"template_protein":"/media/pdbs/STAG1A-x0237_1_apo_T6h9LGK.pdb","metadata":null,"zip_archive":null},{"id":48,"title":"TBXTA","project_id":[2],"protein_set":[14810,14811,14812,14813,14814,14815,14816,14817,14818,14819,14820,14821,14822,14823,14824,14825,14826,14827,14828,14829,14830,14831,14832,14833,14834,14835,14836,14837,14838,14839,14840,14841,14842,14843,14844,14845,14846,14847,14848,14849,14850,14851,14852,14853,14854,14855,14856,14857,14858,14859,14860,14861,14862],"template_protein":"/media/pdbs/TBXTA-x0024_1_apo_kFHAPSk.pdb","metadata":null,"zip_archive":null},{"id":50,"title":"VIM2","project_id":[2],"protein_set":[14410,14411,14412,14413,14414,14415,14416,14417,14418,14419,14420,14421,14422,14423,14424,14425,14426,14427,14428,14429,14430,14431,14432,14433,14434,14435,14436,14437,14438,14439,14440,14441,14442,14443,14444,14445,14446,14447,14448,14449,14450,14451,14452,14453,14454,14455,14456,14457,14458,14459,14460,14461,14462,14463,14464,14465,14466,14467,14468,14469,14470,14471,14472,14473,14474,14475,14476,14477,14478,14479,14480,14481,14482,14483,14484,14485,14486,14487,14488,14489,14490,14491,14492,14493,14494,14495,14496,14497,14498,14499,14500,14501,14502,14503,14504,14505,14506,14507,14508,14509,14510,14511,14512,14513,14514,14515,14516,14517,14518,14519,14520,14521,14522,14523,14524,14525,14526,14527,14528,14529,14530,14531,14532,14533,14534,14535,14536,14537,14538,14539,14540,14541,14542,14543,14544,14545,14546,14547,14548,14549,14550,14551,14552,14553,14554,14555,14556,14557,14558,14559,14560,14561,14562,14563,14564,14565,14566,14567,14568,14569,14570,14571,14572,14573],"template_protein":"/media/pdbs/VIM2-MB-105_1_apo_SBlf6ub.pdb","metadata":null,"zip_archive":null},{"id":51,"title":"XX02KALRNA","project_id":[2],"protein_set":[14902,14903,14904,14905,14906,14907,14908,14909,14910,14911,14912,14913],"template_protein":"/media/pdbs/XX02KALRNA-x1376_1_apo_9VSCvR8.pdb","metadata":null,"zip_archive":null},{"id":52,"title":"TNCA","project_id":[2],"protein_set":[14354,14355,14356,14357,14358,14359,14360,14361,14362,14363,14364,14365,14366,14367,14368,14369,14370],"template_protein":"/media/pdbs/TNCA-x0062_1_apo_Vc9bxy2.pdb","metadata":null,"zip_archive":null},{"id":53,"title":"ALAS2A","project_id":[2],"protein_set":[17966],"template_protein":"NOT AVAILABLE","metadata":null,"zip_archive":null},{"id":54,"title":"EPB41L3A","project_id":[2],"protein_set":[18404,18405,18406,18407,18408,18409,18410,18411,18412,18413,18414,18415,18416,18417,18418,18419,18420,18421,18422,18423,18424,18425,18426,18427,18428,18429,18430,18431,18432,18433,18434,18435,18436,18437,18438,18439,18440,18441,18442,18443,18444,18445,18446,18447,18448,18449,18450,18451,18452,18453,18454,18455,18456,18457,18458,18459,18460,18461,18462,18463,18464,18465,18466,18467,18468,18469,18470,18471,18472,18473,18474,18475,18476,18477,18478],"template_protein":"/media/pdbs/EPB41L3A-x0076_1_apo_vcDam7m.pdb","metadata":null,"zip_archive":null},{"id":61,"title":"mArh","project_id":[2],"protein_set":[27229,27256,27245,27231,27233,27269,27247,27235,27265,27232,27257,27248,27234,27236,27250,27238,27239,27258,27251,27240,27241,27252,27242,27266,27243,27259,27253,27244,27254,27255,27260,27275,27261,27262,27263,27270,27267,27268,27271,27272,27274,27277,27279,27276,27281,27278,27226,27280,27225,27227,27230,27301,27325,27311,27296,27304,27293,27290,27299,27309,27307,27322,27302,27287,27284,27316,27314,27320,27305,27326,27310,27312,27324,27318,27308,27321,27315,27297,27291,27288,27294,27323,27285,27300,27303,27289,27319,27286,27292,27298,27295,27306,27317,27313,27283,27359,27332,27347,27330,27366,27331,27348,27334,27360,27337,27349,27339,27378,27336,27350,27341,27338,27342,27351,27340,27367,27343,27352,27345,27361,27346,27354,27355,27374,27356,27358,27362,27364,27365,27368,27369,27370,27371,27373,27376,27375,27377,27380,27329,27379,27383,27382,27385,27328,27333,27384,27411,27387,27404,27396,27412,27388,27405,27413,27397,27389,27406,27398,27390,27407,27399,27391,27408,27400,27392,27401,27409,27393,27402,27410,27394,27403,27395,27386,27344,27223,27353,27224,27228,27237,27363,27246,27372,27249,27381,27630,27264,27273,27282,27327,27335],"template_protein":"/media/pdbs/mArh-3ew5_A_0_A_apo_E1jNcsT.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/mArh.zip"},{"id":62,"title":"Mpro","project_id":[2],"protein_set":[27437,27414,27428,27415,27444,27416,27429,27417,27438,27418,27430,27419,27455,27420,27431,27421,27439,27422,27432,27423,27445,27424,27433,27425,27440,27426,27434,27427,27449,27435,27441,27436,27446,27442,27452,27447,27443,27450,27448,27454,27451,27453,27456,27457,27458,27459,27460,27461,27496,27511,27476,27509,27502,27464,27484,27471,27489,27468,27465,27472,27490,27470,27486,27473,27497,27480,27485,27491,27475,27467,27477,27474,27492,27481,27514,27462,27498,27479,27493,27469,27501,27510,27487,27499,27495,27507,27505,27503,27500,27506,27512,27463,27516,27508,27513,27482,27488,27523,27548,27553,27518,27533,27543,27549,27551,27536,27552,27532,27574,27537,27534,27547,27517,27538,27524,27519,27522,27539,27559,27528,27540,27529,27530,27558,27541,27531,27555,27560,27542,27572,27525,27550,27556,27521,27545,27544,27573,27571,27557,27569,27563,27567,27561,27565,27570,27566,27564,27527,27546,27595,27598,27611,27593,27576,27580,27606,27599,27581,27577,27594,27625,27575,27628,27578,27596,27622,27587,27617,27597,27604,27585,27627,27588,27589,27624,27590,27615,27591,27607,27602,27592,27613,27623,27609,27600,27583,27603,27612,27614,27610,27620,27618,27616,27621,27626,27619,27586,27605,27584,27582,27478,27515,27520,27535,27526,27579,27504,27494,27568,27562,27608,27601,27483,27554,27466],"template_protein":"/media/pdbs/Mpro-3sn8-2020-04-Zhu_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_zEUROET.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/Mpro.zip"}],"mol_group_list":[{"id":236812,"group_type":"MC","mol_id":[27354,27355,27366,27367,27371,27374,27377,27380,27386,27387,27388,27389,27392,27398,27399,27401,27402,27403,27404,27410,27411,27416,27419,27420,27421,27422,27425,27426,27427,27429,27431,27432,27439,27440,27447,27448,27449,27451,27452,27455],"target_id":61,"x_com":-4.4989012455838715,"y_com":14.114083179731415,"z_com":0.25580480583399456,"description":"A1 - Adenine Site (XChem)"},{"id":236813,"group_type":"MC","mol_id":[27342,27345,27346],"target_id":61,"x_com":-3.8341915817309933,"y_com":13.712565082187156,"z_com":-0.15587148891049324,"description":"A2 - Adenine Site (UCSF)"},{"id":236814,"group_type":"MC","mol_id":[27266,27267,27268,27269,27270,27271,27272,27273,27274,27275,27276,27277,27278,27279,27280,27281,27282,27283,27284,27285,27286,27287,27288,27289,27290,27291,27292,27293,27294,27295,27296,27297,27298,27299,27300,27301,27302,27303,27304,27305,27306,27307,27308,27309,27310,27311,27312,27313,27314,27315,27316,27317,27318,27319,27320,27321,27322,27323,27324,27325,27326,27327,27328,27329,27330,27333,27334,27335,27336,27339,27673,27674,27675,27676,27677,27678,27679,27680],"target_id":61,"x_com":-1.8511471525183878,"y_com":17.267210230159005,"z_com":-5.243608535510113,"description":"A3 - Adenine Site (PDB)"},{"id":236815,"group_type":"MC","mol_id":[27364,27378,27393,27405,27423,27424,27445,27446,27453,27454,27681],"target_id":61,"x_com":-0.017333865222552636,"y_com":10.906212267654093,"z_com":-4.626821873627239,"description":"B1 - Proximal Ribose Site (XChem)"},{"id":236816,"group_type":"MC","mol_id":[27362,27372,27373,27376,27412,27415,27434,27435],"target_id":61,"x_com":-5.445321639158269,"y_com":26.48507876672931,"z_com":-12.632551178123105,"description":"C1 - Catalytic Loop (XChem)"},{"id":236817,"group_type":"MC","mol_id":[27359,27383,27394,27396,27397,27428,27450],"target_id":61,"x_com":1.529875624226074,"y_com":8.826352123573598,"z_com":-9.342696112478631,"description":"D1 - Pyrophosphate loop (XChem)"},{"id":236818,"group_type":"MC","mol_id":[27363,27370,27382,27390,27413,27418,27441],"target_id":61,"x_com":3.703160482033595,"y_com":22.644234697869933,"z_com":14.73997129271892,"description":"K1 - K90 Site (XChem)"},{"id":236819,"group_type":"MC","mol_id":[27343,27344,27347,27349,27350,27351,27352],"target_id":61,"x_com":2.520089218143665,"y_com":26.248473959106587,"z_com":14.956820899478545,"description":"K2 - K90 Site (UCSF)"},{"id":236820,"group_type":"MC","mol_id":[27353,27356,27357,27358,27368,27375,27379,27384,27385,27391,27408,27409,27414,27417,27430,27436,27437,27438,27442,27443,27456],"target_id":61,"x_com":6.255407567135129,"y_com":18.147956402411463,"z_com":7.939211104515316,"description":"S1 - Surface (XChem)"},{"id":236821,"group_type":"MC","mol_id":[27340,27341,27348],"target_id":61,"x_com":7.3207703682032,"y_com":17.828445687157366,"z_com":1.5423113747874648,"description":"S2 - Surface (UCSF)"},{"id":236822,"group_type":"MC","mol_id":[27331,27332,27337,27338],"target_id":61,"x_com":6.777995086418041,"y_com":32.54349142855037,"z_com":2.104151146166346,"description":"S3 - Surface (PDB)"},{"id":236823,"group_type":"MC","mol_id":[27360,27361,27365,27369,27381,27395,27406,27407,27433,27444],"target_id":61,"x_com":12.61463170030533,"y_com":26.078180854021745,"z_com":0.3734862742954836,"description":"X1 - Xtal contact (XChem)"}],"molecule_list":[{"id":27353,"smiles":"Cc1cc(CN(C)C(=O)NC2CC2)no1","cmpd_id":527,"prot_id":27310,"protein_code":"mArh-x0091_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0091_0_B_apo_uPjhLrD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 12.8290 21.1900 13.7390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3540 21.9680 14.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8710 17.0250 15.3150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3430 19.8210 13.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7650 17.7140 14.7640 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1860 20.9630 11.9270 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2460 18.8420 14.3280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1050 22.9540 12.9500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6280 18.9410 14.5660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9640 17.7930 15.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2450 17.2010 15.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7350 21.6690 12.8170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1140 23.5750 12.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5410 23.3540 12.4180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9210 24.6780 12.6600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 1 12 1 0\n 4 7 1 0\n 12 6 2 0\n 12 8 1 0\n 3 5 1 0\n 3 10 1 0\n 5 7 2 0\n 10 9 2 0\n 10 11 1 0\n 7 9 1 0\n 13 8 1 0\n 13 14 1 0\n 13 15 1 0\n 14 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":209.12,"logp":1.29,"tpsa":58.37,"ha":15,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":82},{"id":27356,"smiles":"O=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":3840,"prot_id":27313,"protein_code":"mArh-x0128_1_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0128_1_A_apo_sDgKudh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 10.5560 -2.3180 -2.0240 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7130 -1.9300 -1.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5390 -2.3000 -0.9010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3020 -3.1700 -3.1300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3430 -1.0470 -0.1560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2160 -4.0410 -3.1830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2280 0.9430 2.9360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0670 -4.8960 -4.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9930 -4.8880 -5.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0680 -4.0190 -5.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2260 -3.1590 -4.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8000 -0.2430 0.8830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4960 0.2380 0.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0780 1.0740 1.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9710 1.3980 2.8940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6250 0.1400 1.9430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 2 3 2 0\n 2 5 1 0\n 4 6 2 0\n 4 11 1 0\n 5 12 1 0\n 6 8 1 0\n 11 10 2 0\n 12 13 1 0\n 12 16 2 0\n 8 9 2 0\n 7 15 2 0\n 7 16 1 0\n 15 14 1 0\n 9 10 1 0\n 13 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":2.73,"tpsa":54.02,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80},{"id":27357,"smiles":"COc1ccc(NC(=O)Nc2ccncc2)cc1","cmpd_id":120,"prot_id":27314,"protein_code":"mArh-x0142_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0142_0_A_apo_DRP4ngI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 14.8410 7.1070 12.1650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3630 12.3990 15.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6420 12.1610 14.3150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3460 10.9280 13.7910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9810 5.2910 10.8380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8730 7.3760 9.8820 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7410 10.7080 12.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9450 2.7510 7.5210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5740 9.4560 11.9130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9920 8.4260 12.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8780 6.6530 10.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0120 4.4670 9.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7760 3.1130 9.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7480 2.3060 8.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1990 4.0560 7.3760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2430 4.9500 8.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5850 8.6600 13.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7630 9.9050 14.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 10 1 0\n 1 11 1 0\n 10 9 2 0\n 10 17 1 0\n 11 5 1 0\n 11 6 2 0\n 2 3 1 0\n 3 4 1 0\n 4 7 2 0\n 4 18 1 0\n 7 9 1 0\n 18 17 2 0\n 5 12 1 0\n 12 13 2 0\n 12 16 1 0\n 8 14 2 0\n 8 15 1 0\n 14 13 1 0\n 15 16 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92},{"id":27358,"smiles":"CCOC(=O)CN1CCS(=O)(=O)CC1","cmpd_id":629,"prot_id":27315,"protein_code":"mArh-x0158_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0158_0_B_apo_bVPi3uc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 14.4090 13.2890 13.1450 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3930 17.9390 11.2500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9330 16.1680 11.7670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1970 17.5830 11.9990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9380 15.7610 13.9810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7990 15.3890 12.8450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0280 11.2790 14.8150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4720 13.9770 12.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8850 12.0100 12.4700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1930 14.0990 13.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1400 13.5530 14.1680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1800 11.1250 13.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0830 12.0150 12.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6430 11.9270 13.6890 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 10 1 0\n 1 13 1 0\n 8 6 1 0\n 10 11 1 0\n 13 12 1 0\n 2 4 1 0\n 4 3 1 0\n 3 6 1 0\n 6 5 2 0\n 7 14 2 0\n 14 9 2 0\n 14 11 1 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":221.07,"logp":-0.72,"tpsa":63.68,"ha":14,"hacc":5,"hdon":0,"rots":3,"rings":1,"velec":82},{"id":27368,"smiles":"CCCC(=O)NCc1nc2ccccc2[nH]1","cmpd_id":588,"prot_id":27325,"protein_code":"mArh-x0299_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0299_0_A_apo_e2D9gkx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 13.9780 8.3580 12.4330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8620 8.7620 16.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0590 8.7330 13.2050 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1940 7.7660 15.7610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5320 5.9180 11.2320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3060 8.4530 14.8120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7680 6.7540 9.1790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8680 8.5110 13.4130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3700 8.4060 11.0400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 7.0110 10.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7650 4.8750 10.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8900 3.5090 10.5640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1510 2.6860 9.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2750 3.2080 8.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1470 4.5680 7.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9040 5.3860 9.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 3 2 0\n 8 6 1 0\n 9 10 1 0\n 2 4 1 0\n 4 6 1 0\n 5 10 2 0\n 5 11 1 0\n 10 7 1 0\n 11 12 2 0\n 11 16 1 0\n 7 16 1 0\n 16 15 2 0\n 12 13 1 0\n 13 14 2 0\n 14 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.98,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":4,"rings":2,"velec":84},{"id":27375,"smiles":"CN[C@@H]1CCCN(c2cccnn2)C1","cmpd_id":725,"prot_id":27332,"protein_code":"mArh-x0423_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0423_0_B_apo_jAk3TyY.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 14.1240 26.4360 14.7030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0300 26.9770 15.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4500 25.0310 15.0080 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.9440 23.1630 13.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8300 24.6440 14.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6070 19.8100 12.3370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8560 24.6200 12.9480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0430 21.0780 12.4920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7050 23.8010 12.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3710 24.1190 14.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4310 21.8880 13.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3390 21.4700 14.1280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9080 20.1690 13.9560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5740 19.3780 13.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 3 1 1 6\n 3 5 1 0\n 3 10 1 0\n 5 7 1 0\n 10 4 1 0\n 4 9 1 0\n 4 11 1 0\n 9 7 1 0\n 11 8 1 0\n 11 12 2 0\n 6 8 2 0\n 6 14 1 0\n 14 13 2 0\n 12 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":192.14,"logp":0.66,"tpsa":41.05,"ha":14,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":76},{"id":27379,"smiles":"COc1cc(CN)cc(OC)c1OC","cmpd_id":726,"prot_id":27336,"protein_code":"mArh-x0469_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0469_0_B_apo_iWgpEu4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -5.5510 40.4310 6.1110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3320 38.8420 4.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0270 37.6020 4.9910 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7700 37.4430 5.5040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3530 35.1600 7.9370 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6970 38.2790 5.2330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7370 35.6650 6.7980 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4990 38.1360 5.9210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3310 39.0620 5.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3740 37.1210 6.8630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4210 36.2470 7.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0870 34.8420 8.5190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6380 36.4210 6.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8460 34.3830 6.1860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 9 1 0\n 9 8 1 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 13 1 0\n 6 8 1 0\n 13 7 1 0\n 13 11 2 0\n 5 11 1 0\n 5 12 1 0\n 11 10 1 0\n 8 10 2 0\n 7 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":197.11,"logp":1.17,"tpsa":53.71,"ha":14,"hacc":4,"hdon":1,"rots":4,"rings":1,"velec":78},{"id":27384,"smiles":"COc1ccc2[nH]cc(CN(C)C)c2c1","cmpd_id":65,"prot_id":27341,"protein_code":"mArh-x0548_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0548_0_A_apo_qaj2LA3.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -8.6930 41.5000 -7.9690 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5060 46.9740 -4.9230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3840 45.8690 -5.1530 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9590 44.8470 -5.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9420 44.1210 -7.8970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8320 43.7690 -5.9580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5030 42.5990 -6.6190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2880 42.5350 -7.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4680 41.9130 -8.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2570 43.2200 -8.0910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1990 44.1400 -8.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1170 43.0130 -8.3400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2250 45.3690 -8.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4040 43.6280 -7.3260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7550 44.8000 -6.6610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.13,"logp":2.24,"tpsa":28.26,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":80},{"id":27385,"smiles":"COc1ccc2[nH]cc(CN(C)C)c2c1","cmpd_id":65,"prot_id":27342,"protein_code":"mArh-x0548_1_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0548_1_B_apo_Qo13dJt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -9.9290 37.7490 4.5770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9960 34.7940 8.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3440 34.5150 8.1420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9620 35.3720 7.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2280 39.7080 6.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2280 34.9370 6.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9680 35.6700 5.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4180 36.8360 5.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0190 38.7540 4.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9040 38.5210 5.1500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6560 39.3590 5.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2860 40.4160 7.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0220 40.5290 6.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1420 37.2890 5.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4080 36.5420 6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.13,"logp":2.24,"tpsa":28.26,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":80},{"id":27391,"smiles":"CC(=O)c1ccc(OCC(=O)O)cc1","cmpd_id":3956,"prot_id":27348,"protein_code":"mArh-x0600_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0600_0_A_apo_mneCGqA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -12.5120 25.7190 16.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4190 26.7840 16.9770 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2960 26.4280 16.2020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8240 27.6550 10.7060 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1650 26.7030 14.7440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8510 30.6380 10.2890 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0320 27.3740 14.2770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9130 30.2750 11.0330 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8920 27.6760 12.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8890 27.3140 12.0390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7100 28.4040 10.1990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7720 29.8790 10.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -12.0160 26.6280 12.4830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -12.1530 26.3290 13.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 3 1 0\n 3 2 2 0\n 3 5 1 0\n 5 7 2 0\n 5 14 1 0\n 4 10 1 0\n 4 11 1 0\n 10 9 2 0\n 10 13 1 0\n 11 12 1 0\n 7 9 1 0\n 14 13 2 0\n 6 12 2 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":194.06,"logp":1.35,"tpsa":63.6,"ha":14,"hacc":3,"hdon":1,"rots":4,"rings":1,"velec":74},{"id":27408,"smiles":"C[C@@H]1[C@H](C#N)CCCN1S(C)(=O)=O","cmpd_id":3961,"prot_id":27365,"protein_code":"mArh-x0729_2_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0729_2_B_apo_I07m1be.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -15.9420 24.9190 2.5930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.7820 24.5310 1.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3010 25.8490 4.8310 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1470 23.9720 1.7640 C 0 0 2 0 0 0 0 0 0 0 0 0\n -14.4990 21.8660 -0.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.7910 23.9320 4.5180 O 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3410 23.5130 4.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1030 25.5870 1.9350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.7970 25.9140 0.4760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4770 24.6640 -0.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9320 23.5200 0.5170 C 0 0 1 0 0 0 0 0 0 0 0 0\n -15.1170 22.6070 -0.2860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0020 24.6120 4.1830 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 8 1 0\n 1 13 1 0\n 4 2 1 6\n 4 11 1 0\n 8 9 1 0\n 13 3 2 0\n 13 6 2 0\n 13 7 1 0\n 11 10 1 0\n 11 12 1 6\n 5 12 3 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.08,"logp":0.57,"tpsa":61.17,"ha":13,"hacc":3,"hdon":0,"rots":1,"rings":1,"velec":74},{"id":27409,"smiles":"CNC(=O)[C@H]1CCCN(S(C)(=O)=O)[C@H]1C","cmpd_id":3962,"prot_id":27366,"protein_code":"mArh-x0737_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0737_0_B_apo_ge7tsCT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 15.6620 16.1250 11.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6350 17.1760 11.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1750 14.4590 11.6230 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0080 14.8440 11.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0230 12.6900 12.5920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3620 14.1960 13.5840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8620 13.8630 11.4620 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.7750 11.9830 14.5840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3610 12.4980 10.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2260 11.4830 10.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4420 11.3510 12.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0900 13.6960 12.7860 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9870 13.3620 13.9680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4080 12.1020 12.3950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6350 12.8030 13.4190 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 4 3 2 0\n 7 4 1 1\n 7 9 1 0\n 7 12 1 0\n 5 11 1 0\n 5 12 1 0\n 5 15 1 0\n 11 10 1 0\n 12 13 1 1\n 15 6 2 0\n 15 8 2 0\n 15 14 1 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":234.1,"logp":-0.21,"tpsa":66.48,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":88},{"id":27414,"smiles":"O=C1Nc2ccccc2C[C@]12CCCN2","cmpd_id":3966,"prot_id":27371,"protein_code":"mArh-x0796_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0796_0_B_apo_HiGpcfV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n 12.7410 10.9960 11.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9650 11.6530 12.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7460 11.6940 12.2500 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1360 11.0200 11.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7940 13.3240 14.1920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7910 11.9350 12.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1760 11.8500 12.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8870 10.8710 11.7850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2350 9.9700 10.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8610 10.0420 10.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9680 12.9680 13.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6470 12.3330 13.5220 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.8020 13.0040 15.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9020 11.4990 15.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8800 11.2140 14.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 2 3 2 0\n 2 12 1 0\n 4 6 2 0\n 4 10 1 0\n 12 5 1 0\n 12 11 1 6\n 12 15 1 0\n 6 7 1 0\n 6 11 1 0\n 10 9 2 0\n 5 13 1 0\n 13 14 1 0\n 7 8 2 0\n 8 9 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.11,"logp":1.3,"tpsa":41.13,"ha":15,"hacc":2,"hdon":2,"rots":0,"rings":3,"velec":78},{"id":27417,"smiles":"C[C@H]1[C@@H](C(N)=O)CCCN1S(C)(=O)=O","cmpd_id":3969,"prot_id":27374,"protein_code":"mArh-x0814_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0814_0_B_apo_AYzhIGD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 13.0270 12.6020 12.5560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0510 13.2450 13.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4440 14.1700 13.5750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1250 13.5940 12.7180 C 0 0 1 0 0 0 0 0 0 0 0 0\n 17.2160 14.3160 11.3540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6370 12.0770 12.5600 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8700 13.7150 11.3750 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.7090 15.9060 11.8530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3240 12.3330 10.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1630 11.3440 10.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4220 11.2500 12.0940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7780 11.9650 14.8830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9750 14.7390 11.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6150 12.7710 13.3330 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 11 1 0\n 1 14 1 0\n 4 2 1 1\n 4 7 1 0\n 11 10 1 0\n 14 3 2 0\n 14 6 2 0\n 14 12 1 0\n 7 9 1 0\n 7 13 1 1\n 5 13 1 0\n 13 8 2 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.09,"logp":-0.47,"tpsa":80.47,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":82},{"id":27430,"smiles":"Oc1ccccn1","cmpd_id":1605,"prot_id":27387,"protein_code":"mArh-x0905_1_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0905_1_B_apo_pED10WT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 12.4440 19.6240 13.3840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4250 20.2680 12.6710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0180 19.5990 11.7000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8330 21.5770 12.9400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2150 22.2430 13.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2390 21.6100 14.7340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8880 20.3130 14.3960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0\n 1 7 1 0\n 2 3 1 0\n 2 4 1 0\n 7 6 2 0\n 4 5 2 0\n 5 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":95.04,"logp":0.79,"tpsa":33.12,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27436,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":27393,"protein_code":"mArh-x0918_2_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0918_2_A_apo_zpdsnpJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 14.8660 5.5250 11.0340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9110 4.7000 9.9300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8010 3.3200 10.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9190 3.0240 7.6790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8130 2.5310 8.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 4.3570 7.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0340 5.2190 8.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 7 1 0\n 3 5 1 0\n 7 6 2 0\n 5 4 2 0\n 4 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27437,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":27394,"protein_code":"mArh-x0918_3_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0918_3_A_apo_F0NjoWZ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 15.2250 6.4090 8.5820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0920 5.1300 9.0850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1870 4.8750 10.4540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9520 2.5150 10.0950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1170 3.5710 10.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8390 2.7670 8.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9040 4.0390 8.2410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 7 1 0\n 3 5 1 0\n 7 6 2 0\n 5 4 2 0\n 4 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27438,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":27395,"protein_code":"mArh-x0918_4_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0918_4_B_apo_mnXF94Y.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 13.8400 23.3110 13.7410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4580 22.0180 13.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2380 21.2400 12.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7780 19.3530 12.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8710 19.9280 12.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0220 20.1080 13.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3220 21.4230 13.9510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 7 1 0\n 3 5 1 0\n 7 6 2 0\n 5 4 2 0\n 4 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27442,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":27399,"protein_code":"mArh-x0933_2_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0933_2_A_apo_bVOZlCL.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 19.8860 12.5370 -5.3330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4730 12.8550 -4.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1550 12.0410 -1.9710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4750 11.9250 -3.2620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4130 13.5030 -1.6270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1100 14.0190 -4.0180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8340 14.3830 -2.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 1 0\n 2 6 1 0\n 4 3 1 0\n 6 7 1 0\n 3 5 1 0\n 5 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42},{"id":27443,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":27400,"protein_code":"mArh-x0933_3_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0933_3_B_apo_ZGCDuME.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 0.2690 33.5930 10.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3580 34.4850 9.5400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4390 36.7010 8.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4130 35.5820 9.6790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0200 36.2380 7.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1530 34.4080 8.4530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2790 35.4130 7.4000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 1 0\n 2 6 1 0\n 4 3 1 0\n 6 7 1 0\n 3 5 1 0\n 5 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42},{"id":27456,"smiles":"Cn1c2c(c3ccccc31)C[C@@H]1C[C@H]2[C@@H](O)CN1","cmpd_id":3990,"prot_id":27413,"protein_code":"mArh-x1092_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x1092_0_B_apo_hCklf8v.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 21 0 0 0 0 0 0 0 0999 V2000\n -9.1220 35.4240 6.6850 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1060 34.3590 6.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2720 34.2200 10.6560 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0210 35.4300 7.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5890 36.6630 10.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8550 34.5450 8.7270 C 0 0 1 0 0 0 0 0 0 0 0 0\n -6.3480 34.4750 9.0230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8160 35.9050 9.1790 C 0 0 1 0 0 0 0 0 0 0 0 0\n -5.8360 36.6120 7.8250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1790 36.4420 7.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7990 37.1620 6.1140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4520 38.2910 5.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3280 38.7770 4.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5350 38.1460 4.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8920 37.0080 4.8860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0140 36.5250 5.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6760 35.9390 10.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6060 35.2180 9.8870 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 1 16 1 0\n 6 4 1 6\n 4 10 2 0\n 16 11 2 0\n 16 15 1 0\n 18 3 1 1\n 18 6 1 0\n 18 17 1 0\n 6 7 1 0\n 10 9 1 0\n 10 11 1 0\n 5 8 1 0\n 5 17 1 0\n 8 7 1 0\n 8 9 1 6\n 11 12 1 0\n 12 13 2 0\n 13 14 1 0\n 14 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":242.14,"logp":1.54,"tpsa":37.19,"ha":18,"hacc":3,"hdon":2,"rots":0,"rings":4,"velec":94}],"cached_mol_lists":{"236812":[{"id":27354,"smiles":"COc1ccc(NC(=O)Nc2cccs2)cn1","cmpd_id":718,"prot_id":27311,"protein_code":"mArh-x0104_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0104_0_A_apo_bzGLDCt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -6.6160 14.9830 2.8280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4520 14.9620 -2.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8450 14.9010 -2.3280 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2120 14.8760 -1.0330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0690 15.0160 4.6450 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8880 15.1640 2.4960 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5880 14.7820 -0.8390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3170 14.9360 -0.0560 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0430 14.7260 0.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1450 14.8240 1.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9190 15.0620 3.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2710 15.0400 5.3620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.3570 15.1490 6.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.7390 15.1020 7.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -11.6200 14.9740 6.1480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7900 14.9110 1.1940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8490 14.8970 4.6170 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 10 1 0\n 1 11 1 0\n 10 9 2 0\n 10 16 1 0\n 11 5 1 0\n 11 6 2 0\n 2 3 1 0\n 3 4 1 0\n 4 7 2 0\n 4 8 1 0\n 7 9 1 0\n 8 16 2 0\n 5 12 1 0\n 12 13 2 0\n 12 17 1 0\n 13 14 1 0\n 17 15 1 0\n 14 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":249.06,"logp":2.8,"tpsa":63.25,"ha":17,"hacc":4,"hdon":2,"rots":3,"rings":2,"velec":88},{"id":27355,"smiles":"O=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":3840,"prot_id":27312,"protein_code":"mArh-x0128_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0128_0_A_apo_r6Fak5i.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -6.4560 14.9100 2.6680 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6860 15.2830 3.1250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6200 15.5810 2.3870 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9960 14.9220 1.3410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7360 15.3090 4.4960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8660 14.7770 0.2690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9020 18.0750 5.6900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3890 14.8770 -1.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0440 15.0850 -1.2510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1770 15.2230 -0.1940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6430 15.1500 1.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5550 16.1060 5.3350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7740 15.7140 6.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5530 16.5100 7.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0930 17.6770 6.9570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.1370 17.3020 4.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 2 3 2 0\n 2 5 1 0\n 4 6 2 0\n 4 11 1 0\n 5 12 1 0\n 6 8 1 0\n 11 10 2 0\n 12 13 1 0\n 12 16 2 0\n 8 9 2 0\n 7 15 2 0\n 7 16 1 0\n 15 14 1 0\n 9 10 1 0\n 13 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":2.73,"tpsa":54.02,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80},{"id":27366,"smiles":"OCC1CCN(c2ncccn2)CC1","cmpd_id":131,"prot_id":27323,"protein_code":"mArh-x0282_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0282_0_A_apo_qwhImku.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -3.3330 14.6200 0.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4400 13.9600 0.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4980 14.5530 0.2080 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2010 14.8250 0.9250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4890 14.6290 -0.8030 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5030 15.1800 -0.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2500 14.5630 1.5990 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2260 14.3890 -0.5430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9750 14.2880 1.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2580 15.0840 2.0890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9770 14.6550 0.4620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1560 14.5040 -0.9030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6780 14.4510 0.1850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0720 14.4650 1.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 1 11 1 0\n 8 6 1 0\n 9 10 1 0\n 11 5 2 0\n 11 7 1 0\n 2 3 1 0\n 4 2 1 0\n 4 6 1 0\n 4 10 1 0\n 5 12 1 0\n 12 13 2 0\n 7 14 2 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":193.12,"logp":0.69,"tpsa":49.25,"ha":14,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":76},{"id":27367,"smiles":"CNCC(=O)Nc1cc(C)ccn1","cmpd_id":3949,"prot_id":27324,"protein_code":"mArh-x0290_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0290_0_A_apo_QqRuUj2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -7.5740 13.8500 1.2960 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5100 14.8540 0.7790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3610 14.2170 -0.2110 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3970 14.4590 1.9260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0190 14.7680 1.5460 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2110 14.4680 0.9800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6800 14.6310 1.7660 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7490 14.7360 0.9510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6430 14.7810 -0.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3850 14.7100 -1.0250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2330 14.6590 -2.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2810 14.6360 -0.1850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4720 14.5900 1.1840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 4 6 1 0\n 3 6 2 0\n 6 5 1 0\n 5 8 1 0\n 8 7 2 0\n 8 9 1 0\n 7 13 1 0\n 13 12 2 0\n 9 10 2 0\n 10 11 1 0\n 10 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":179.11,"logp":0.55,"tpsa":54.02,"ha":13,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":70},{"id":27371,"smiles":"O=C(NCc1nc2ccccc2[nH]1)c1ccco1","cmpd_id":419,"prot_id":27328,"protein_code":"mArh-x0371_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0371_0_A_apo_mQbd6BF.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n -8.2380 14.3970 2.9860 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8300 15.4210 3.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5090 16.2550 3.0040 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3420 14.2240 1.5520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8970 14.6840 1.5180 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9020 14.5350 5.6650 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0580 14.5850 0.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9680 14.8210 -0.4290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9830 14.9980 0.5200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6040 15.1660 0.5810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9170 15.3830 -0.6030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5860 15.4520 -1.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9630 15.3130 -1.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.6410 15.0790 -0.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6550 15.4950 5.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.1210 16.3600 5.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6490 15.9110 7.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9290 14.8230 6.9940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 2 3 2 0\n 2 15 1 0\n 4 7 1 0\n 15 6 1 0\n 15 16 2 0\n 7 5 2 0\n 7 8 1 0\n 5 9 1 0\n 9 10 2 0\n 9 14 1 0\n 6 18 1 0\n 18 17 2 0\n 8 14 1 0\n 14 13 2 0\n 10 11 1 0\n 11 12 2 0\n 12 13 1 0\n 16 17 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":241.09,"logp":2.09,"tpsa":70.92,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":3,"velec":90},{"id":27374,"smiles":"NC(=O)c1c[nH]c(C2CC2)n1","cmpd_id":512,"prot_id":27331,"protein_code":"mArh-x0421_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0421_0_A_apo_dMLiW3x.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n -3.6920 15.0970 -2.9190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8930 14.9160 -1.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6620 14.8230 -1.9810 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5340 14.9330 -0.5330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8900 14.9700 1.6370 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9230 14.9710 0.6870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9130 14.9030 -0.3540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0600 14.9240 0.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3250 14.8580 1.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6430 14.9110 1.0050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2000 13.6420 1.6130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 4 1 0\n 4 6 2 0\n 4 7 1 0\n 6 5 1 0\n 7 8 2 0\n 5 8 1 0\n 9 8 1 0\n 9 10 1 0\n 9 11 1 0\n 10 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":151.07,"logp":0.39,"tpsa":71.77,"ha":11,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":58},{"id":27377,"smiles":"CS(=O)(=O)Cc1nc2ccccc2[nH]1","cmpd_id":3854,"prot_id":27334,"protein_code":"mArh-x0438_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0438_0_A_apo_MqTExsW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -7.1260 14.7730 -0.3130 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2650 15.6530 3.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5970 14.8140 3.0700 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5800 14.0960 1.5700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0970 14.4220 1.6320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4690 16.5540 1.7480 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2690 14.4350 0.9550 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7630 15.0000 -0.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0270 15.3570 -1.5920 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6490 15.4590 -1.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0140 15.2410 -0.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7420 14.9040 0.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1110 14.7780 0.7420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.3730 15.3620 2.5470 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 7 2 0\n 1 8 1 0\n 7 4 1 0\n 7 5 1 0\n 8 9 2 0\n 8 13 1 0\n 14 2 1 0\n 14 3 2 0\n 14 4 1 0\n 14 6 2 0\n 5 13 1 0\n 13 12 2 0\n 9 10 1 0\n 10 11 2 0\n 11 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.05,"logp":1.11,"tpsa":62.82,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":74},{"id":27380,"smiles":"CC(C)C(=O)NCc1nc2ccccc2[nH]1","cmpd_id":3953,"prot_id":27337,"protein_code":"mArh-x0471_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0471_0_A_apo_FbSQ50e.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n -8.7410 14.0170 2.8240 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1390 13.6730 5.6360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.1850 16.1060 3.5260 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8540 14.4090 5.2380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1920 14.8550 -0.4140 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5690 15.5650 6.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3290 14.6650 1.6340 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9370 14.9280 3.7820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8210 14.3570 1.4180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4420 14.6280 0.8620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8120 15.0480 -0.4800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9820 15.3130 -1.5650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6250 15.4850 -1.3350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0980 15.3890 -0.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9120 15.1140 1.0380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2670 14.9420 0.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 3 2 0\n 8 4 1 0\n 9 10 1 0\n 4 2 1 0\n 4 6 1 0\n 5 10 2 0\n 5 11 1 0\n 10 7 1 0\n 11 12 2 0\n 11 16 1 0\n 7 16 1 0\n 16 15 2 0\n 12 13 1 0\n 13 14 2 0\n 14 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.84,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":84},{"id":27386,"smiles":"COc1ccc2sc(N)nc2c1","cmpd_id":195,"prot_id":27343,"protein_code":"mArh-x0574_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0574_0_A_apo_3jCGkak.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 0.5170 13.9780 1.7620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8380 14.7650 2.5260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5090 14.9180 1.1420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1900 14.8510 0.7750 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7550 14.3440 2.0300 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9210 15.0430 -0.5710 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6160 15.0750 -1.0230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5930 14.8650 -0.1100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6680 14.3450 1.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8640 14.6310 1.2440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1780 14.6380 1.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8830 14.7370 -0.3950 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 9 1 0\n 9 5 2 0\n 9 12 1 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 11 1 0\n 6 7 1 0\n 11 10 2 0\n 5 10 1 0\n 10 8 1 0\n 7 8 2 0\n 8 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":180.04,"logp":1.89,"tpsa":48.14,"ha":12,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":62},{"id":27387,"smiles":"NC(=O)c1cnc(C(F)(F)F)nc1","cmpd_id":198,"prot_id":27344,"protein_code":"mArh-x0587_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0587_0_A_apo_OBYDT5Y.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -7.8050 15.0810 4.0540 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2710 15.0410 2.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4700 15.1940 2.5370 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2830 14.8450 1.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9970 14.8590 0.9430 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9140 14.9210 1.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7990 14.6070 -0.6440 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5150 14.7050 -0.2800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6670 14.6760 0.3720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5570 14.6390 -1.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3260 14.9870 -1.1170 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4610 13.4220 -1.9410 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9360 15.4360 -2.4390 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 4 1 0\n 4 6 2 0\n 4 9 1 0\n 6 5 1 0\n 9 7 2 0\n 5 8 2 0\n 8 7 1 0\n 8 10 1 0\n 10 11 1 0\n 10 12 1 0\n 10 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":191.03,"logp":0.59,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":70},{"id":27388,"smiles":"CNC(=O)c1ccc(S(N)(=O)=O)cc1","cmpd_id":250,"prot_id":27345,"protein_code":"mArh-x0591_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0591_0_A_apo_CpaFEeh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -5.8050 14.6040 0.8520 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7050 14.6090 1.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4380 14.8600 -0.6610 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2440 14.7550 -0.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1250 15.6450 -4.7510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8240 13.3040 -5.0430 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2140 14.8040 -1.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0730 15.1310 -6.1520 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5470 15.4040 -2.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6720 15.3710 -3.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4510 14.7310 -3.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0930 14.1450 -2.4080 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9750 14.1930 -1.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3590 14.6390 -5.0040 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 4 3 2 0\n 4 7 1 0\n 7 9 2 0\n 7 13 1 0\n 14 5 1 0\n 14 6 2 0\n 14 8 2 0\n 14 11 1 0\n 9 10 1 0\n 13 12 2 0\n 10 11 2 0\n 11 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":214.04,"logp":-0.31,"tpsa":89.26,"ha":14,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":76},{"id":27389,"smiles":"NC(=O)c1cnn(CCO)c1","cmpd_id":3954,"prot_id":27346,"protein_code":"mArh-x0592_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0592_0_A_apo_Pe9bcIa.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -2.7770 14.9470 1.1200 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2620 14.8590 -0.1130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5690 14.8200 -1.1330 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7290 14.8190 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8050 14.9890 -1.1470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3510 15.1340 3.0650 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5120 15.0060 -1.4180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.8670 14.7530 0.1860 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1680 14.6330 0.8370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0280 14.1650 2.2650 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.6510 14.6520 0.7470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 4 1 0\n 4 7 1 0\n 4 11 2 0\n 7 5 2 0\n 11 8 1 0\n 5 8 1 0\n 8 9 1 0\n 6 10 1 0\n 10 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":155.07,"logp":-1.03,"tpsa":81.14,"ha":11,"hacc":4,"hdon":2,"rots":3,"rings":1,"velec":60},{"id":27392,"smiles":"CCC(=O)Nc1nc(C)cs1","cmpd_id":282,"prot_id":27349,"protein_code":"mArh-x0626_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0626_0_A_apo_e0UDyzI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -4.9510 14.6980 1.3220 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5960 14.5780 0.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2320 14.8670 -0.5560 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3160 14.4860 1.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6250 14.7040 1.4260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1350 14.7030 0.6560 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7210 14.7520 0.7120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5130 14.7860 0.6020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1500 14.6830 1.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7960 14.9010 -0.7180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4980 14.8900 -0.9980 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 6 1 0\n 1 7 1 0\n 6 3 2 0\n 6 4 1 0\n 7 5 2 0\n 7 11 1 0\n 2 4 1 0\n 5 8 1 0\n 8 9 1 0\n 8 10 2 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.05,"logp":1.8,"tpsa":41.99,"ha":11,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":60},{"id":27398,"smiles":"NC(=O)[C@H]1CCCn2ccnc21","cmpd_id":3958,"prot_id":27355,"protein_code":"mArh-x0681_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0681_0_A_apo_xULW3TJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n -4.4900 15.4830 -2.1370 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4260 14.8110 -1.7410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5010 14.4910 -2.4920 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4860 14.3650 -0.2970 C 0 0 1 0 0 0 0 0 0 0 0 0\n -5.5030 13.3560 0.7460 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8580 15.5530 0.6210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9170 12.5980 -1.2430 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2570 15.0690 2.0070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4860 14.1770 1.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4600 12.4550 0.3790 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0990 12.0130 -0.8460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6070 13.4190 -0.2610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 4 2 1 6\n 4 6 1 0\n 4 12 1 0\n 6 8 1 0\n 12 5 1 0\n 12 7 2 0\n 5 9 1 0\n 5 10 1 0\n 9 8 1 0\n 10 11 2 0\n 7 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":165.09,"logp":0.25,"tpsa":60.91,"ha":12,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":64},{"id":27399,"smiles":"CCNc1ccc(C#N)cn1","cmpd_id":3834,"prot_id":27356,"protein_code":"mArh-x0685_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0685_0_A_apo_weBV2kt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n -5.9380 15.0150 2.7660 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8560 13.5040 3.0690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3790 14.9350 2.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1810 15.1770 -3.2900 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3350 14.9450 1.5500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1260 14.8920 0.4670 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9390 15.0150 1.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3600 15.0460 0.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1660 15.0150 -0.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5980 15.1030 -2.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5460 14.9280 -0.7360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 3 1 0\n 1 5 1 0\n 3 2 1 0\n 5 6 2 0\n 5 7 1 0\n 4 10 3 0\n 10 9 1 0\n 6 11 1 0\n 7 8 2 0\n 11 9 2 0\n 8 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":147.08,"logp":1.39,"tpsa":48.71,"ha":11,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":56},{"id":27401,"smiles":"CNc1ncccn1","cmpd_id":298,"prot_id":27358,"protein_code":"mArh-x0689_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0689_0_A_apo_owjQoCr.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n -3.4140 15.0340 1.6910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6990 15.2420 1.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2600 14.8250 1.0430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1630 14.6480 1.8110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0040 14.5360 1.1430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2960 14.8510 -0.3080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0880 14.5630 -0.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1070 14.7110 -0.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 3 1 0\n 3 4 2 0\n 3 6 1 0\n 4 5 1 0\n 6 8 2 0\n 5 7 2 0\n 7 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":109.06,"logp":0.52,"tpsa":37.81,"ha":8,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":42},{"id":27402,"smiles":"CS(=O)(=O)Nc1ccc(C(N)=O)cc1","cmpd_id":98,"prot_id":27359,"protein_code":"mArh-x0711_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0711_0_A_apo_syqjlfn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -1.5830 15.2550 -2.5570 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5610 12.9780 -4.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2720 14.8090 -4.0930 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7910 14.9770 -1.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3780 14.5730 1.6610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0400 13.4820 -2.0260 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7650 14.6990 -0.5020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5210 14.7210 -0.2650 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9450 14.5910 0.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1700 14.7550 -0.4210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1920 15.0190 -1.7840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0140 15.1220 -2.5020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4510 14.6750 0.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5640 14.1380 -3.1460 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 14 1 0\n 4 7 2 0\n 4 12 1 0\n 14 2 1 0\n 14 3 2 0\n 14 6 2 0\n 7 9 1 0\n 12 11 2 0\n 5 13 1 0\n 13 8 2 0\n 13 10 1 0\n 9 10 2 0\n 10 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":214.04,"logp":0.16,"tpsa":89.26,"ha":14,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":76},{"id":27403,"smiles":"Cc1nn(C)c(C)c1CC(N)=O","cmpd_id":3959,"prot_id":27360,"protein_code":"mArh-x0722_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0722_0_A_apo_lfQMA4L.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n -2.4670 14.9210 2.0320 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7810 15.6180 2.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0580 15.2810 -0.9660 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6420 15.1890 1.4850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6350 14.7030 0.9850 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2250 14.4430 1.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9340 13.5440 -0.0730 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2720 14.7990 -0.1970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6520 14.5660 -1.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5900 15.1200 0.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6860 15.4410 -0.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9970 14.7410 -0.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 2 0\n 1 5 1 0\n 4 2 1 0\n 4 10 1 0\n 5 6 1 0\n 5 8 1 0\n 3 12 2 0\n 12 7 1 0\n 12 11 1 0\n 10 8 2 0\n 10 11 1 0\n 8 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":167.11,"logp":0.06,"tpsa":60.91,"ha":12,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":66},{"id":27404,"smiles":"CNCc1cnn(-c2ccccc2)c1","cmpd_id":99,"prot_id":27361,"protein_code":"mArh-x0724_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0724_0_A_apo_162TAln.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n -8.2620 13.8360 4.4030 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9890 13.9630 5.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2170 15.1070 3.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3980 14.6580 0.0800 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6260 14.9150 2.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1770 14.7520 0.6840 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2630 14.7550 1.0760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2860 14.9000 2.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9870 14.7120 -0.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7560 14.7370 0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6080 14.8350 -0.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6910 14.8900 -1.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9200 14.8680 -2.2410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0720 14.7670 -1.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 3 1 0\n 3 5 1 0\n 5 7 1 0\n 5 8 2 0\n 4 6 1 0\n 4 7 2 0\n 6 8 1 0\n 6 9 1 0\n 9 10 2 0\n 9 14 1 0\n 10 11 1 0\n 14 13 2 0\n 11 12 2 0\n 12 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":187.11,"logp":1.59,"tpsa":29.85,"ha":14,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":72},{"id":27410,"smiles":"CC(=O)N1[C@H]2CC[C@@H]1Cc1ncccc12","cmpd_id":3963,"prot_id":27367,"protein_code":"mArh-x0742_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0742_0_A_apo_WjOkwFr.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n -4.5820 13.5560 -0.1510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2500 12.4300 -0.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9160 11.7990 -1.5040 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7050 14.3920 1.0500 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.0550 14.1900 1.8080 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4910 14.1460 1.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2170 14.1970 1.1330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2940 14.2150 -0.2860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0950 14.2220 -0.9920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1040 14.2210 -0.3030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0740 14.2140 1.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6150 14.2070 -1.0370 C 0 0 2 0 0 0 0 0 0 0 0 0\n -4.1040 15.6570 -0.9820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6840 15.8040 0.4510 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3660 11.9840 0.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 1 12 1 0\n 2 3 2 0\n 2 15 1 0\n 4 6 1 1\n 4 14 1 0\n 12 8 1 0\n 12 13 1 1\n 6 7 1 0\n 14 13 1 0\n 5 7 2 0\n 5 11 1 0\n 7 8 1 0\n 11 10 2 0\n 8 9 2 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.11,"logp":1.69,"tpsa":33.2,"ha":15,"hacc":2,"hdon":0,"rots":0,"rings":3,"velec":78},{"id":27411,"smiles":"O=C(O)[C@@H]1CCC[C@@H]1c1ccsc1","cmpd_id":3964,"prot_id":27368,"protein_code":"mArh-x0766_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0766_0_A_apo_OLBSO7k.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 0.4640 12.2860 -2.7380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2600 12.8290 -1.8660 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1850 13.1400 -3.9440 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.0120 11.1840 -2.6330 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4650 13.4630 -4.7320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7770 14.9150 -4.4150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6970 15.4350 -3.4820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5040 14.5120 -3.6980 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.5000 14.5630 -2.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8540 14.4650 -2.7200 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2710 15.0410 -0.4000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1710 14.8750 -1.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6950 14.7970 -1.2730 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0\n 3 1 1 1\n 1 4 1 0\n 3 5 1 0\n 3 8 1 0\n 5 6 1 0\n 8 7 1 0\n 8 9 1 1\n 6 7 1 0\n 9 10 2 0\n 9 12 1 0\n 10 13 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.06,"logp":2.72,"tpsa":37.3,"ha":13,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":70},{"id":27416,"smiles":"COc1cccc([C@H]2CCOC[C@H]2C(=O)O)c1","cmpd_id":3968,"prot_id":27373,"protein_code":"mArh-x0805_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0805_0_A_apo_FJaK9m7.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n -4.3290 15.5300 0.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1680 15.5550 -0.2470 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0980 14.7030 -1.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4660 14.1750 -4.2000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9270 14.8340 -2.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2930 10.9340 -2.7740 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6990 14.0240 -3.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0010 12.7700 -1.7980 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6510 13.0780 -3.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8170 12.9460 -2.7800 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0550 13.7670 -1.6840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4320 14.1800 -3.9900 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.4540 15.3310 -3.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7350 15.4040 -4.2830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7010 13.0890 -4.7780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3570 12.8490 -4.1040 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.5840 12.1890 -2.7690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 5 2 0\n 3 11 1 0\n 5 7 1 0\n 11 10 2 0\n 4 14 1 0\n 4 15 1 0\n 14 13 1 0\n 15 16 1 0\n 7 9 2 0\n 12 7 1 1\n 6 17 1 0\n 17 8 2 0\n 16 17 1 1\n 9 10 1 0\n 12 13 1 0\n 12 16 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":236.1,"logp":1.9,"tpsa":55.76,"ha":17,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":92},{"id":27419,"smiles":"O=c1cc(I)cc[nH]1","cmpd_id":3971,"prot_id":27376,"protein_code":"mArh-x0837_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0837_0_A_apo_jqjJI2p.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n -5.6560 15.0130 1.3870 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2990 14.9140 0.1740 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5320 14.7950 0.1540 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4570 14.9100 -0.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1370 14.9520 -0.8300 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5080 15.0390 0.4470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3130 15.0740 1.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9700 14.8040 -2.5590 I 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 7 1 0\n 2 3 2 0\n 2 4 1 0\n 7 6 2 0\n 4 5 2 0\n 5 6 1 0\n 5 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.93,"logp":0.98,"tpsa":32.86,"ha":8,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":42},{"id":27420,"smiles":"O=c1cc(Br)cc[nH]1","cmpd_id":3972,"prot_id":27377,"protein_code":"mArh-x0844_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0844_0_A_apo_3RtIIxo.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n -5.7550 14.9110 1.1710 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3710 14.9320 -0.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6070 14.9070 -0.1080 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5140 15.0150 -1.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1750 15.0430 -1.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5810 15.0490 0.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4110 14.9850 1.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0620 14.9580 -2.5190 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 7 1 0\n 2 3 2 0\n 2 4 1 0\n 7 6 2 0\n 4 5 2 0\n 5 6 1 0\n 5 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":172.95,"logp":1.14,"tpsa":32.86,"ha":8,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":42},{"id":27421,"smiles":"Brc1ccnc2ncccc12","cmpd_id":3973,"prot_id":27378,"protein_code":"mArh-x0849_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0849_0_A_apo_GLtFDQE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n -3.2360 15.1170 1.9810 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3660 15.2950 -0.7680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4930 15.4520 -0.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9690 14.7150 1.9350 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3660 15.3620 1.3440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1120 14.9380 1.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1610 14.6200 1.2540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2580 14.7150 -0.1230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8750 14.9010 -0.8440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1190 15.0200 -0.1840 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4670 15.5350 -2.6290 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 2 0\n 1 6 1 0\n 5 3 1 0\n 6 4 2 0\n 6 10 1 0\n 2 3 2 0\n 2 10 1 0\n 2 11 1 0\n 10 9 2 0\n 4 7 1 0\n 7 8 2 0\n 8 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":207.96,"logp":2.39,"tpsa":25.78,"ha":11,"hacc":2,"hdon":0,"rots":0,"rings":2,"velec":54},{"id":27422,"smiles":"N#Cc1cc(Br)ccc1O","cmpd_id":3974,"prot_id":27379,"protein_code":"mArh-x0852_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0852_0_B_apo_aSy79Ei.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n -9.4780 17.7120 7.2460 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3560 15.3330 4.9160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6880 14.8810 6.0070 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.1180 16.5110 4.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2970 17.1700 6.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7800 16.9900 3.8680 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7080 16.2690 2.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9850 15.0970 2.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3010 14.6360 3.7110 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5900 16.9390 1.1530 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 3 0\n 5 4 1 0\n 2 3 1 0\n 2 4 2 0\n 2 9 1 0\n 4 6 1 0\n 9 8 2 0\n 6 7 2 0\n 7 8 1 0\n 7 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.95,"logp":2.03,"tpsa":44.02,"ha":10,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":50},{"id":27425,"smiles":"O=C1CNC(=O)N1","cmpd_id":3977,"prot_id":27382,"protein_code":"mArh-x0895_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0895_0_A_apo_xPmJFMj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -4.4900 15.3300 0.6370 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3550 14.7230 1.2570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3160 14.4140 1.8400 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6970 15.1600 1.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5170 14.7200 -0.0980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2070 15.1960 -1.6200 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7920 15.0830 -0.4750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 7 1 0\n 4 2 1 0\n 7 5 1 0\n 7 6 2 0\n 2 3 2 0\n 2 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":100.03,"logp":-1.17,"tpsa":58.2,"ha":7,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":38},{"id":27426,"smiles":"O=C1CNC(=O)N1","cmpd_id":3977,"prot_id":27383,"protein_code":"mArh-x0895_1_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0895_1_A_apo_yNNY327.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -4.4430 14.9010 -0.5950 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6110 14.8500 0.8030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4930 14.7590 1.3070 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0000 14.9750 -0.6690 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7830 14.7830 1.4930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0570 14.7590 1.0160 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8830 14.8070 0.6650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 7 1 0\n 4 2 1 0\n 7 5 1 0\n 7 6 2 0\n 2 3 2 0\n 2 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":100.03,"logp":-1.17,"tpsa":58.2,"ha":7,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":38},{"id":27427,"smiles":"O=C1CCCN1","cmpd_id":3978,"prot_id":27384,"protein_code":"mArh-x0900_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0900_0_A_apo_hlYYP2i.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n -4.7440 15.1110 -1.0260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8670 14.9820 -0.3350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0030 15.0300 -0.8110 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5250 14.7800 1.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0970 15.2830 1.2060 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5460 15.1950 -0.2030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 6 1 0\n 2 3 2 0\n 2 4 1 0\n 6 5 1 0\n 4 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":85.05,"logp":-0.1,"tpsa":29.1,"ha":6,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":34},{"id":27429,"smiles":"Oc1ccccn1","cmpd_id":1605,"prot_id":27386,"protein_code":"mArh-x0905_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0905_0_A_apo_vJ4r0zk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -5.3300 15.1190 0.7390 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7650 15.1340 -0.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.0740 15.0290 -0.7540 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9150 15.2210 -1.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5510 15.2690 -1.3980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0800 15.2300 -0.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9990 15.1610 0.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0\n 1 7 1 0\n 2 3 1 0\n 2 4 1 0\n 7 6 2 0\n 4 5 2 0\n 5 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":95.04,"logp":0.79,"tpsa":33.12,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27431,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":27388,"protein_code":"mArh-x0910_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0910_0_A_apo_Zhc5m42.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n -7.7200 14.0420 1.2910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7440 14.6960 0.6360 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8520 15.7340 0.2980 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7550 15.0670 -0.6510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5590 15.7360 -0.9030 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5780 15.0970 1.2390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 2 0\n 2 6 1 0\n 4 5 1 0\n 6 3 1 0\n 3 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32},{"id":27432,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":27389,"protein_code":"mArh-x0910_1_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0910_1_A_apo_GeZuJBp.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n -2.5700 14.8290 -1.6290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7470 14.8990 -0.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1040 14.8320 0.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0910 15.0820 0.6940 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9200 15.0400 1.4470 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3970 14.7440 -0.6920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 2 0\n 2 6 1 0\n 4 5 1 0\n 6 3 1 0\n 3 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32},{"id":27439,"smiles":"O=c1cccn[nH]1","cmpd_id":3981,"prot_id":27396,"protein_code":"mArh-x0926_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0926_0_A_apo_3bwStHc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -3.3150 15.2830 -1.4000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5330 15.2040 -0.4150 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7390 14.9750 -0.5930 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9070 15.4010 0.8580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6740 15.1750 -1.4640 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5640 15.5160 0.9630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7990 15.4350 -0.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 1 0\n 1 7 2 0\n 5 2 1 0\n 7 6 1 0\n 2 3 2 0\n 2 4 1 0\n 4 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":96.03,"logp":-0.23,"tpsa":45.75,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27440,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":27397,"protein_code":"mArh-x0933_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0933_0_A_apo_4XsCzuW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -6.0640 14.6550 2.0400 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1630 14.8050 1.1270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8070 15.4800 0.7040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9450 15.1690 1.5750 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9430 14.7820 -0.6250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3430 14.6890 -0.2030 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3140 14.9800 -1.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 1 0\n 2 6 1 0\n 4 3 1 0\n 6 7 1 0\n 3 5 1 0\n 5 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42},{"id":27447,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":27404,"protein_code":"mArh-x0962_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0962_0_A_apo_H2siHrT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -2.3490 14.9230 -2.2180 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0320 14.9640 -1.3050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8470 15.0390 -0.1250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3640 15.1130 1.0630 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5670 15.1820 1.9250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7650 15.1040 1.0260 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2480 15.0410 -0.1710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 3 0\n 2 3 1 0\n 3 4 1 0\n 3 7 2 0\n 4 5 2 0\n 7 6 1 0\n 5 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34},{"id":27448,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":27405,"protein_code":"mArh-x0962_1_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0962_1_A_apo_sgJNb2S.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -3.5060 15.2120 -1.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3210 15.1000 -0.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3830 14.9400 0.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2690 15.0370 1.4250 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6540 14.7780 1.9260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5030 14.5500 0.7190 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6880 14.6520 -0.2780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 3 0\n 2 3 1 0\n 3 4 1 0\n 3 7 2 0\n 4 5 2 0\n 7 6 1 0\n 5 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34},{"id":27449,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":27406,"protein_code":"mArh-x0962_2_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0962_2_B_apo_GtB4JQC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n -10.6510 16.3920 1.0620 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9760 16.0160 1.9010 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.1040 15.6010 2.9620 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7830 16.3870 3.9270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8430 15.6140 4.7520 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7240 14.2820 4.1160 N 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4900 14.3480 3.0610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 3 0\n 2 3 1 0\n 3 4 1 0\n 3 7 2 0\n 4 5 2 0\n 7 6 1 0\n 5 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34},{"id":27451,"smiles":"c1cnc2ncccc2c1","cmpd_id":3985,"prot_id":27408,"protein_code":"mArh-x0967_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0967_0_A_apo_rwF3DqH.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -7.0630 14.7590 -0.6880 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3220 14.6360 1.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8120 14.6490 0.3960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9820 14.9590 -1.6480 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7180 14.8700 -0.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6700 15.0590 -1.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0080 15.0850 -0.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7330 15.0000 0.8480 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1290 14.8810 0.7760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9830 14.7570 1.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 3 2 0\n 1 5 1 0\n 3 2 1 0\n 5 4 2 0\n 5 9 1 0\n 2 10 2 0\n 10 9 1 0\n 4 6 1 0\n 6 7 2 0\n 9 8 2 0\n 7 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":130.05,"logp":1.63,"tpsa":25.78,"ha":10,"hacc":2,"hdon":0,"rots":0,"rings":2,"velec":48},{"id":27452,"smiles":"Nc1nnc2ccccn12","cmpd_id":3986,"prot_id":27409,"protein_code":"mArh-x0969_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0969_0_A_apo_SDeGcso.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -6.5210 14.9770 2.6180 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4370 14.9200 1.2760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5920 14.9910 -0.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4420 14.7980 0.4280 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5660 15.0700 -1.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.9090 14.8570 -0.8660 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2730 15.2240 -1.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2390 15.0540 0.6040 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9560 15.3100 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9330 15.2260 1.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 2 0\n 2 8 1 0\n 4 6 1 0\n 8 3 1 0\n 8 10 1 0\n 3 5 1 0\n 3 6 2 0\n 5 7 2 0\n 7 9 1 0\n 9 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":134.06,"logp":0.31,"tpsa":56.21,"ha":10,"hacc":4,"hdon":1,"rots":0,"rings":2,"velec":50},{"id":27455,"smiles":"Clc1ccc2nnnn2n1","cmpd_id":3989,"prot_id":27412,"protein_code":"mArh-x1018_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x1018_0_A_apo_T8tpjpe.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n -2.9700 14.7860 -0.8290 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6530 14.7280 0.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3230 14.7040 0.9740 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -5.6830 14.6360 1.5720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3410 14.8890 -2.1270 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3890 14.6540 1.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6320 14.9160 -2.2510 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0950 14.7430 -0.1430 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1030 14.8240 -0.9970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4250 14.8360 -0.7330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 1 0\n 1 8 2 0\n 5 7 2 0\n 8 6 1 0\n 8 9 1 0\n 2 3 1 0\n 2 4 1 0\n 2 10 2 0\n 4 6 2 0\n 10 9 1 0\n 7 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":155,"logp":0.17,"tpsa":55.97,"ha":10,"hacc":5,"hdon":0,"rots":0,"rings":2,"velec":50}],"236820":[{"id":27353,"smiles":"Cc1cc(CN(C)C(=O)NC2CC2)no1","cmpd_id":527,"prot_id":27310,"protein_code":"mArh-x0091_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0091_0_B_apo_uPjhLrD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 12.8290 21.1900 13.7390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3540 21.9680 14.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8710 17.0250 15.3150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3430 19.8210 13.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7650 17.7140 14.7640 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1860 20.9630 11.9270 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2460 18.8420 14.3280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1050 22.9540 12.9500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6280 18.9410 14.5660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9640 17.7930 15.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2450 17.2010 15.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7350 21.6690 12.8170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1140 23.5750 12.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5410 23.3540 12.4180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9210 24.6780 12.6600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 1 12 1 0\n 4 7 1 0\n 12 6 2 0\n 12 8 1 0\n 3 5 1 0\n 3 10 1 0\n 5 7 2 0\n 10 9 2 0\n 10 11 1 0\n 7 9 1 0\n 13 8 1 0\n 13 14 1 0\n 13 15 1 0\n 14 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":209.12,"logp":1.29,"tpsa":58.37,"ha":15,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":82},{"id":27356,"smiles":"O=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":3840,"prot_id":27313,"protein_code":"mArh-x0128_1_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0128_1_A_apo_sDgKudh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 10.5560 -2.3180 -2.0240 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7130 -1.9300 -1.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5390 -2.3000 -0.9010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3020 -3.1700 -3.1300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3430 -1.0470 -0.1560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2160 -4.0410 -3.1830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2280 0.9430 2.9360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0670 -4.8960 -4.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9930 -4.8880 -5.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0680 -4.0190 -5.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2260 -3.1590 -4.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8000 -0.2430 0.8830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4960 0.2380 0.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0780 1.0740 1.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9710 1.3980 2.8940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6250 0.1400 1.9430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 2 3 2 0\n 2 5 1 0\n 4 6 2 0\n 4 11 1 0\n 5 12 1 0\n 6 8 1 0\n 11 10 2 0\n 12 13 1 0\n 12 16 2 0\n 8 9 2 0\n 7 15 2 0\n 7 16 1 0\n 15 14 1 0\n 9 10 1 0\n 13 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":2.73,"tpsa":54.02,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80},{"id":27357,"smiles":"COc1ccc(NC(=O)Nc2ccncc2)cc1","cmpd_id":120,"prot_id":27314,"protein_code":"mArh-x0142_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0142_0_A_apo_DRP4ngI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 14.8410 7.1070 12.1650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3630 12.3990 15.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6420 12.1610 14.3150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3460 10.9280 13.7910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9810 5.2910 10.8380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8730 7.3760 9.8820 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7410 10.7080 12.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9450 2.7510 7.5210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5740 9.4560 11.9130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9920 8.4260 12.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8780 6.6530 10.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0120 4.4670 9.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7760 3.1130 9.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7480 2.3060 8.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1990 4.0560 7.3760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2430 4.9500 8.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5850 8.6600 13.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7630 9.9050 14.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 10 1 0\n 1 11 1 0\n 10 9 2 0\n 10 17 1 0\n 11 5 1 0\n 11 6 2 0\n 2 3 1 0\n 3 4 1 0\n 4 7 2 0\n 4 18 1 0\n 7 9 1 0\n 18 17 2 0\n 5 12 1 0\n 12 13 2 0\n 12 16 1 0\n 8 14 2 0\n 8 15 1 0\n 14 13 1 0\n 15 16 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92},{"id":27358,"smiles":"CCOC(=O)CN1CCS(=O)(=O)CC1","cmpd_id":629,"prot_id":27315,"protein_code":"mArh-x0158_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0158_0_B_apo_bVPi3uc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 14.4090 13.2890 13.1450 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3930 17.9390 11.2500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9330 16.1680 11.7670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1970 17.5830 11.9990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9380 15.7610 13.9810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7990 15.3890 12.8450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0280 11.2790 14.8150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4720 13.9770 12.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8850 12.0100 12.4700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1930 14.0990 13.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1400 13.5530 14.1680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1800 11.1250 13.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0830 12.0150 12.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6430 11.9270 13.6890 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 10 1 0\n 1 13 1 0\n 8 6 1 0\n 10 11 1 0\n 13 12 1 0\n 2 4 1 0\n 4 3 1 0\n 3 6 1 0\n 6 5 2 0\n 7 14 2 0\n 14 9 2 0\n 14 11 1 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":221.07,"logp":-0.72,"tpsa":63.68,"ha":14,"hacc":5,"hdon":0,"rots":3,"rings":1,"velec":82},{"id":27368,"smiles":"CCCC(=O)NCc1nc2ccccc2[nH]1","cmpd_id":588,"prot_id":27325,"protein_code":"mArh-x0299_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0299_0_A_apo_e2D9gkx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 13.9780 8.3580 12.4330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8620 8.7620 16.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0590 8.7330 13.2050 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1940 7.7660 15.7610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5320 5.9180 11.2320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3060 8.4530 14.8120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7680 6.7540 9.1790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8680 8.5110 13.4130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3700 8.4060 11.0400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 7.0110 10.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7650 4.8750 10.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8900 3.5090 10.5640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1510 2.6860 9.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2750 3.2080 8.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1470 4.5680 7.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9040 5.3860 9.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 3 2 0\n 8 6 1 0\n 9 10 1 0\n 2 4 1 0\n 4 6 1 0\n 5 10 2 0\n 5 11 1 0\n 10 7 1 0\n 11 12 2 0\n 11 16 1 0\n 7 16 1 0\n 16 15 2 0\n 12 13 1 0\n 13 14 2 0\n 14 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.98,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":4,"rings":2,"velec":84},{"id":27375,"smiles":"CN[C@@H]1CCCN(c2cccnn2)C1","cmpd_id":725,"prot_id":27332,"protein_code":"mArh-x0423_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0423_0_B_apo_jAk3TyY.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 14.1240 26.4360 14.7030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0300 26.9770 15.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4500 25.0310 15.0080 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.9440 23.1630 13.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8300 24.6440 14.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6070 19.8100 12.3370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8560 24.6200 12.9480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0430 21.0780 12.4920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7050 23.8010 12.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3710 24.1190 14.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4310 21.8880 13.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3390 21.4700 14.1280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9080 20.1690 13.9560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5740 19.3780 13.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 3 1 1 6\n 3 5 1 0\n 3 10 1 0\n 5 7 1 0\n 10 4 1 0\n 4 9 1 0\n 4 11 1 0\n 9 7 1 0\n 11 8 1 0\n 11 12 2 0\n 6 8 2 0\n 6 14 1 0\n 14 13 2 0\n 12 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":192.14,"logp":0.66,"tpsa":41.05,"ha":14,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":76},{"id":27379,"smiles":"COc1cc(CN)cc(OC)c1OC","cmpd_id":726,"prot_id":27336,"protein_code":"mArh-x0469_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0469_0_B_apo_iWgpEu4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -5.5510 40.4310 6.1110 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3320 38.8420 4.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0270 37.6020 4.9910 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7700 37.4430 5.5040 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3530 35.1600 7.9370 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6970 38.2790 5.2330 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7370 35.6650 6.7980 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4990 38.1360 5.9210 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3310 39.0620 5.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3740 37.1210 6.8630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4210 36.2470 7.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0870 34.8420 8.5190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6380 36.4210 6.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8460 34.3830 6.1860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 9 1 0\n 9 8 1 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 13 1 0\n 6 8 1 0\n 13 7 1 0\n 13 11 2 0\n 5 11 1 0\n 5 12 1 0\n 11 10 1 0\n 8 10 2 0\n 7 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":197.11,"logp":1.17,"tpsa":53.71,"ha":14,"hacc":4,"hdon":1,"rots":4,"rings":1,"velec":78},{"id":27384,"smiles":"COc1ccc2[nH]cc(CN(C)C)c2c1","cmpd_id":65,"prot_id":27341,"protein_code":"mArh-x0548_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0548_0_A_apo_qaj2LA3.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -8.6930 41.5000 -7.9690 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5060 46.9740 -4.9230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.3840 45.8690 -5.1530 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9590 44.8470 -5.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9420 44.1210 -7.8970 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8320 43.7690 -5.9580 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.5030 42.5990 -6.6190 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2880 42.5350 -7.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4680 41.9130 -8.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2570 43.2200 -8.0910 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1990 44.1400 -8.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1170 43.0130 -8.3400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2250 45.3690 -8.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.4040 43.6280 -7.3260 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7550 44.8000 -6.6610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.13,"logp":2.24,"tpsa":28.26,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":80},{"id":27385,"smiles":"COc1ccc2[nH]cc(CN(C)C)c2c1","cmpd_id":65,"prot_id":27342,"protein_code":"mArh-x0548_1_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0548_1_B_apo_Qo13dJt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -9.9290 37.7490 4.5770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9960 34.7940 8.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3440 34.5150 8.1420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9620 35.3720 7.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2280 39.7080 6.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2280 34.9370 6.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9680 35.6700 5.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4180 36.8360 5.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0190 38.7540 4.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9040 38.5210 5.1500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6560 39.3590 5.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2860 40.4160 7.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0220 40.5290 6.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1420 37.2890 5.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4080 36.5420 6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.13,"logp":2.24,"tpsa":28.26,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":80},{"id":27391,"smiles":"CC(=O)c1ccc(OCC(=O)O)cc1","cmpd_id":3956,"prot_id":27348,"protein_code":"mArh-x0600_0_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0600_0_A_apo_mneCGqA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n -12.5120 25.7190 16.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.4190 26.7840 16.9770 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.2960 26.4280 16.2020 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8240 27.6550 10.7060 O 0 0 0 0 0 0 0 0 0 0 0 0\n -11.1650 26.7030 14.7440 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.8510 30.6380 10.2890 O 0 0 0 0 0 0 0 0 0 0 0 0\n -10.0320 27.3740 14.2770 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.9130 30.2750 11.0330 O 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8920 27.6760 12.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n -10.8890 27.3140 12.0390 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7100 28.4040 10.1990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.7720 29.8790 10.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -12.0160 26.6280 12.4830 C 0 0 0 0 0 0 0 0 0 0 0 0\n -12.1530 26.3290 13.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 3 1 0\n 3 2 2 0\n 3 5 1 0\n 5 7 2 0\n 5 14 1 0\n 4 10 1 0\n 4 11 1 0\n 10 9 2 0\n 10 13 1 0\n 11 12 1 0\n 7 9 1 0\n 14 13 2 0\n 6 12 2 0\n 12 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":194.06,"logp":1.35,"tpsa":63.6,"ha":14,"hacc":3,"hdon":1,"rots":4,"rings":1,"velec":74},{"id":27408,"smiles":"C[C@@H]1[C@H](C#N)CCCN1S(C)(=O)=O","cmpd_id":3961,"prot_id":27365,"protein_code":"mArh-x0729_2_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0729_2_B_apo_I07m1be.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n -15.9420 24.9190 2.5930 N 0 0 0 0 0 0 0 0 0 0 0 0\n -13.7820 24.5310 1.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.3010 25.8490 4.8310 O 0 0 0 0 0 0 0 0 0 0 0 0\n -15.1470 23.9720 1.7640 C 0 0 2 0 0 0 0 0 0 0 0 0\n -14.4990 21.8660 -0.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n -14.7910 23.9320 4.5180 O 0 0 0 0 0 0 0 0 0 0 0 0\n -17.3410 23.5130 4.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n -17.1030 25.5870 1.9350 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.7970 25.9140 0.4760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.4770 24.6640 -0.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -15.9320 23.5200 0.5170 C 0 0 1 0 0 0 0 0 0 0 0 0\n -15.1170 22.6070 -0.2860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -16.0020 24.6120 4.1830 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 8 1 0\n 1 13 1 0\n 4 2 1 6\n 4 11 1 0\n 8 9 1 0\n 13 3 2 0\n 13 6 2 0\n 13 7 1 0\n 11 10 1 0\n 11 12 1 6\n 5 12 3 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.08,"logp":0.57,"tpsa":61.17,"ha":13,"hacc":3,"hdon":0,"rots":1,"rings":1,"velec":74},{"id":27409,"smiles":"CNC(=O)[C@H]1CCCN(S(C)(=O)=O)[C@H]1C","cmpd_id":3962,"prot_id":27366,"protein_code":"mArh-x0737_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0737_0_B_apo_ge7tsCT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 15.6620 16.1250 11.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6350 17.1760 11.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1750 14.4590 11.6230 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0080 14.8440 11.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0230 12.6900 12.5920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3620 14.1960 13.5840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8620 13.8630 11.4620 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.7750 11.9830 14.5840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3610 12.4980 10.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2260 11.4830 10.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4420 11.3510 12.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0900 13.6960 12.7860 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9870 13.3620 13.9680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4080 12.1020 12.3950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6350 12.8030 13.4190 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 4 3 2 0\n 7 4 1 1\n 7 9 1 0\n 7 12 1 0\n 5 11 1 0\n 5 12 1 0\n 5 15 1 0\n 11 10 1 0\n 12 13 1 1\n 15 6 2 0\n 15 8 2 0\n 15 14 1 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":234.1,"logp":-0.21,"tpsa":66.48,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":88},{"id":27414,"smiles":"O=C1Nc2ccccc2C[C@]12CCCN2","cmpd_id":3966,"prot_id":27371,"protein_code":"mArh-x0796_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0796_0_B_apo_HiGpcfV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n 12.7410 10.9960 11.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9650 11.6530 12.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7460 11.6940 12.2500 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1360 11.0200 11.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7940 13.3240 14.1920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7910 11.9350 12.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1760 11.8500 12.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8870 10.8710 11.7850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2350 9.9700 10.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8610 10.0420 10.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9680 12.9680 13.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6470 12.3330 13.5220 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.8020 13.0040 15.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9020 11.4990 15.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8800 11.2140 14.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 2 3 2 0\n 2 12 1 0\n 4 6 2 0\n 4 10 1 0\n 12 5 1 0\n 12 11 1 6\n 12 15 1 0\n 6 7 1 0\n 6 11 1 0\n 10 9 2 0\n 5 13 1 0\n 13 14 1 0\n 7 8 2 0\n 8 9 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.11,"logp":1.3,"tpsa":41.13,"ha":15,"hacc":2,"hdon":2,"rots":0,"rings":3,"velec":78},{"id":27417,"smiles":"C[C@H]1[C@@H](C(N)=O)CCCN1S(C)(=O)=O","cmpd_id":3969,"prot_id":27374,"protein_code":"mArh-x0814_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0814_0_B_apo_AYzhIGD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 13.0270 12.6020 12.5560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0510 13.2450 13.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4440 14.1700 13.5750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1250 13.5940 12.7180 C 0 0 1 0 0 0 0 0 0 0 0 0\n 17.2160 14.3160 11.3540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6370 12.0770 12.5600 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8700 13.7150 11.3750 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.7090 15.9060 11.8530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3240 12.3330 10.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1630 11.3440 10.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4220 11.2500 12.0940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7780 11.9650 14.8830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9750 14.7390 11.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6150 12.7710 13.3330 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0\n 1 11 1 0\n 1 14 1 0\n 4 2 1 1\n 4 7 1 0\n 11 10 1 0\n 14 3 2 0\n 14 6 2 0\n 14 12 1 0\n 7 9 1 0\n 7 13 1 1\n 5 13 1 0\n 13 8 2 0\n 9 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.09,"logp":-0.47,"tpsa":80.47,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":82},{"id":27430,"smiles":"Oc1ccccn1","cmpd_id":1605,"prot_id":27387,"protein_code":"mArh-x0905_1_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0905_1_B_apo_pED10WT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 12.4440 19.6240 13.3840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4250 20.2680 12.6710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0180 19.5990 11.7000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8330 21.5770 12.9400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2150 22.2430 13.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2390 21.6100 14.7340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8880 20.3130 14.3960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0\n 1 7 1 0\n 2 3 1 0\n 2 4 1 0\n 7 6 2 0\n 4 5 2 0\n 5 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":95.04,"logp":0.79,"tpsa":33.12,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27436,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":27393,"protein_code":"mArh-x0918_2_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0918_2_A_apo_zpdsnpJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 14.8660 5.5250 11.0340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9110 4.7000 9.9300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8010 3.3200 10.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9190 3.0240 7.6790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8130 2.5310 8.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 4.3570 7.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0340 5.2190 8.6420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 7 1 0\n 3 5 1 0\n 7 6 2 0\n 5 4 2 0\n 4 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27437,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":27394,"protein_code":"mArh-x0918_3_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0918_3_A_apo_F0NjoWZ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 15.2250 6.4090 8.5820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0920 5.1300 9.0850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1870 4.8750 10.4540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9520 2.5150 10.0950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1170 3.5710 10.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8390 2.7670 8.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9040 4.0390 8.2410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 7 1 0\n 3 5 1 0\n 7 6 2 0\n 5 4 2 0\n 4 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27438,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":27395,"protein_code":"mArh-x0918_4_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0918_4_B_apo_mnXF94Y.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 13.8400 23.3110 13.7410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4580 22.0180 13.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2380 21.2400 12.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7780 19.3530 12.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8710 19.9280 12.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0220 20.1080 13.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3220 21.4230 13.9510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 2 0\n 2 7 1 0\n 3 5 1 0\n 7 6 2 0\n 5 4 2 0\n 4 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36},{"id":27442,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":27399,"protein_code":"mArh-x0933_2_A","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0933_2_A_apo_bVOZlCL.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 19.8860 12.5370 -5.3330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4730 12.8550 -4.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1550 12.0410 -1.9710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4750 11.9250 -3.2620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4130 13.5030 -1.6270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1100 14.0190 -4.0180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8340 14.3830 -2.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 1 0\n 2 6 1 0\n 4 3 1 0\n 6 7 1 0\n 3 5 1 0\n 5 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42},{"id":27443,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":27400,"protein_code":"mArh-x0933_3_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x0933_3_B_apo_ZGCDuME.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 0.2690 33.5930 10.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3580 34.4850 9.5400 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4390 36.7010 8.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4130 35.5820 9.6790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0200 36.2380 7.3290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1530 34.4080 8.4530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2790 35.4130 7.4000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 4 1 0\n 2 6 1 0\n 4 3 1 0\n 6 7 1 0\n 3 5 1 0\n 5 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42},{"id":27456,"smiles":"Cn1c2c(c3ccccc31)C[C@@H]1C[C@H]2[C@@H](O)CN1","cmpd_id":3990,"prot_id":27413,"protein_code":"mArh-x1092_0_B","mol_type":"PR","molecule_protein":"/media/pdbs/mArh-x1092_0_B_apo_hCklf8v.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 21 0 0 0 0 0 0 0 0999 V2000\n -9.1220 35.4240 6.6850 N 0 0 0 0 0 0 0 0 0 0 0 0\n -10.1060 34.3590 6.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2720 34.2200 10.6560 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.0210 35.4300 7.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5890 36.6630 10.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8550 34.5450 8.7270 C 0 0 1 0 0 0 0 0 0 0 0 0\n -6.3480 34.4750 9.0230 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8160 35.9050 9.1790 C 0 0 1 0 0 0 0 0 0 0 0 0\n -5.8360 36.6120 7.8250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1790 36.4420 7.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.7990 37.1620 6.1140 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4520 38.2910 5.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.3280 38.7770 4.4240 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5350 38.1460 4.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.8920 37.0080 4.8860 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0140 36.5250 5.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.6760 35.9390 10.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.6060 35.2180 9.8870 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 1 4 1 0\n 1 16 1 0\n 6 4 1 6\n 4 10 2 0\n 16 11 2 0\n 16 15 1 0\n 18 3 1 1\n 18 6 1 0\n 18 17 1 0\n 6 7 1 0\n 10 9 1 0\n 10 11 1 0\n 5 8 1 0\n 5 17 1 0\n 8 7 1 0\n 8 9 1 6\n 11 12 1 0\n 12 13 2 0\n 13 14 1 0\n 14 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":242.14,"logp":1.54,"tpsa":37.19,"ha":18,"hacc":3,"hdon":2,"rots":0,"rings":4,"velec":94}]},"duck_yank_data":{},"pandda_event_list":[],"pandda_site_list":[],"mol_group_on":236820,"target_on":61,"target_on_name":"mArh","isFetching":false,"app_on":"PREVIEW","group_type":"MC","hotspot_list":[],"savingState":"UNSET","seshListSaving":false,"targetUnrecognised":false,"uuid":"UNSET","sessionIdList":[]},"nglReducers":{"objectsInView":{"PROTEIN_61":{"name":"PROTEIN_61","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/mArh-3ew5_A_0_A_apo_E1jNcsT.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"summary_view","representations":[{"lastKnownID":"CC3AC09D-69A2-44E2-B01F-BAD59354572F","uuid":"CC3AC09D-69A2-44E2-B01F-BAD59354572F","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"PROTEIN_61_MAIN":{"name":"PROTEIN_61_MAIN","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/mArh-3ew5_A_0_A_apo_E1jNcsT.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"major_view","representations":[{"lastKnownID":"8C772F67-2E9D-421B-AC58-AC73EBE5295D","uuid":"8C772F67-2E9D-421B-AC58-AC73EBE5295D","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236813":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236813","radius":2,"colour":[0,0,1],"coords":[-3.8341915817309933,13.712565082187156,-0.15587148891049324],"representations":[{"lastKnownID":"A16E3A83-8881-45C1-A614-B88737B5E09E","uuid":"A16E3A83-8881-45C1-A614-B88737B5E09E","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236814":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236814","radius":6,"colour":[0,0,1],"coords":[-1.8511471525183878,17.267210230159005,-5.243608535510113],"representations":[{"lastKnownID":"ECDEEA37-552A-4560-B9FF-B3DFF8461EBB","uuid":"ECDEEA37-552A-4560-B9FF-B3DFF8461EBB","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236815":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236815","radius":6,"colour":[0,0,1],"coords":[-0.017333865222552636,10.906212267654093,-4.626821873627239],"representations":[{"lastKnownID":"45DBA216-C367-4C59-BD02-4C5E3F68DFD3","uuid":"45DBA216-C367-4C59-BD02-4C5E3F68DFD3","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236816":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236816","radius":4,"colour":[0,0,1],"coords":[-5.445321639158269,26.48507876672931,-12.632551178123105],"representations":[{"lastKnownID":"E4B45023-789C-491F-B445-D8DB10F62B35","uuid":"E4B45023-789C-491F-B445-D8DB10F62B35","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236817":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236817","radius":4,"colour":[0,0,1],"coords":[1.529875624226074,8.826352123573598,-9.342696112478631],"representations":[{"lastKnownID":"88A3D5B4-4819-430F-9C3D-400876522D6E","uuid":"88A3D5B4-4819-430F-9C3D-400876522D6E","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236818":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236818","radius":4,"colour":[0,0,1],"coords":[3.703160482033595,22.644234697869933,14.73997129271892],"representations":[{"lastKnownID":"0D5FEB9C-EEBD-4CDA-9447-5D693B1FC190","uuid":"0D5FEB9C-EEBD-4CDA-9447-5D693B1FC190","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236819":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236819","radius":4,"colour":[0,0,1],"coords":[2.520089218143665,26.248473959106587,14.956820899478545],"representations":[{"lastKnownID":"98571C2A-26DA-4582-86C9-4F8BEA1FE104","uuid":"98571C2A-26DA-4582-86C9-4F8BEA1FE104","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236821":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236821","radius":2,"colour":[0,0,1],"coords":[7.3207703682032,17.828445687157366,1.5423113747874648],"representations":[{"lastKnownID":"E642C13F-8E5C-4981-AD48-2242DB4D9A5C","uuid":"E642C13F-8E5C-4981-AD48-2242DB4D9A5C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236822":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236822","radius":2,"colour":[0,0,1],"coords":[6.777995086418041,32.54349142855037,2.104151146166346],"representations":[{"lastKnownID":"BA802ECF-54C0-485E-B1E3-EEA928F36FD7","uuid":"BA802ECF-54C0-485E-B1E3-EEA928F36FD7","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236823":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236823","radius":4,"colour":[0,0,1],"coords":[12.61463170030533,26.078180854021745,0.3734862742954836],"representations":[{"lastKnownID":"AC7E3697-CD7E-4253-B7A7-1DAFFEB1943D","uuid":"AC7E3697-CD7E-4253-B7A7-1DAFFEB1943D","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236812":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236812","radius":6,"colour":[0,0,1],"coords":[-4.4989012455838715,14.114083179731415,0.25580480583399456],"representations":[{"lastKnownID":"D90CFD4A-CA4E-47AB-A1BE-B5925FF20961","uuid":"D90CFD4A-CA4E-47AB-A1BE-B5925FF20961","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236820":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236820","radius":6,"colour":[0,1,0],"coords":[6.255407567135129,18.147956402411463,7.939211104515316],"representations":[{"lastKnownID":"9387322C-EA9E-480C-9CB3-6CA8F42DD44F","uuid":"9387322C-EA9E-480C-9CB3-6CA8F42DD44F","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"mArh-x0548_1_B_LIGAND":{"display_div":"major_view","name":"mArh-x0548_1_B_LIGAND","OBJECT_TYPE":"LIGAND","colour":"#CC6666","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -9.9290 37.7490 4.5770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9960 34.7940 8.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3440 34.5150 8.1420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9620 35.3720 7.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2280 39.7080 6.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2280 34.9370 6.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9680 35.6700 5.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4180 36.8360 5.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0190 38.7540 4.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9040 38.5210 5.1500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6560 39.3590 5.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2860 40.4160 7.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0220 40.5290 6.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1420 37.2890 5.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4080 36.5420 6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","moleculeId":27385,"selectionType":"LIGAND","representations":[{"lastKnownID":"A917ED8B-4DFC-4D01-82A9-D493D3FF9ED3","uuid":"A917ED8B-4DFC-4D01-82A9-D493D3FF9ED3","type":"ball+stick","params":{"lazy":false,"visible":true,"quality":"medium","sphereDetail":1,"radialSegments":10,"openEnded":true,"disableImpostor":false,"aspectRatio":2,"lineOnly":false,"cylinderOnly":false,"multipleBond":true,"bondScale":0.4,"bondSpacing":1,"linewidth":2,"radiusType":"size","radiusData":{},"radiusSize":0.15,"radiusScale":1,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"element","colorScale":"","colorReverse":false,"colorValue":"#CC6666","colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"sphereDetail":{"type":"integer","max":3,"min":0,"rebuild":"impostor"},"radialSegments":{"type":"integer","max":25,"min":5,"rebuild":"impostor"},"openEnded":{"type":"boolean","rebuild":"impostor","buffer":true},"disableImpostor":{"type":"boolean","rebuild":true},"aspectRatio":{"type":"number","precision":1,"max":10,"min":1},"lineOnly":{"type":"boolean","rebuild":true},"cylinderOnly":{"type":"boolean","rebuild":true},"multipleBond":{"type":"select","rebuild":true,"options":{"off":"off","symmetric":"symmetric","offset":"offset"}},"bondScale":{"type":"number","precision":2,"max":1,"min":0.01},"bondSpacing":{"type":"number","precision":2,"max":2,"min":0.5},"linewidth":{"type":"integer","max":50,"min":1,"buffer":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"mArh-x0548_1_B_HIT_PROTEIN":{"display_div":"major_view","name":"mArh-x0548_1_B_HIT_PROTEIN","OBJECT_TYPE":"HIT_PROTEIN","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -9.9290 37.7490 4.5770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9960 34.7940 8.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3440 34.5150 8.1420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9620 35.3720 7.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2280 39.7080 6.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2280 34.9370 6.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9680 35.6700 5.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4180 36.8360 5.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0190 38.7540 4.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9040 38.5210 5.1500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6560 39.3590 5.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2860 40.4160 7.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0220 40.5290 6.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1420 37.2890 5.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4080 36.5420 6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","colour":"#CC6666","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/mArh-x0548_1_B_apo_Qo13dJt.pdb","moleculeId":27385,"selectionType":"PROTEIN","representations":[{"lastKnownID":"A1B96F17-290C-4B67-8DAB-B7D1FED3C6CC","uuid":"A1B96F17-290C-4B67-8DAB-B7D1FED3C6CC","type":"line","params":{"lazy":false,"visible":true,"quality":"medium","multipleBond":"off","bondSpacing":1,"linewidth":4,"lines":true,"crosses":"lone","crossSize":0.4,"radiusType":"vdw","radiusData":{},"radiusSize":1,"radiusScale":1,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"opacity":1,"depthWrite":true,"colorScheme":"element","colorScale":"","colorReverse":false,"colorValue":"#CC6666","colorMode":"hcl","diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":"/0"},"templateParams":{"multipleBond":{"type":"select","rebuild":true,"options":{"off":"off","symmetric":"symmetric","offset":"offset"}},"bondSpacing":{"type":"number","precision":2,"max":2,"min":0.5},"linewidth":{"type":"integer","max":50,"min":1,"buffer":true},"lines":{"type":"boolean","rebuild":true},"crosses":{"type":"select","rebuild":true,"options":{"off":"off","lone":"lone","all":"all"}},"crossSize":{"type":"number","precision":2,"max":2,"min":0.1},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":null,"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":null,"wireframe":null,"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":null,"metalness":null,"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"mArh-x0548_1_B_COMPLEX":{"display_div":"major_view","name":"mArh-x0548_1_B_COMPLEX","OBJECT_TYPE":"COMPLEX","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n -9.9290 37.7490 4.5770 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9960 34.7940 8.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3440 34.5150 8.1420 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9620 35.3720 7.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2280 39.7080 6.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n -9.2280 34.9370 6.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.9680 35.6700 5.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.4180 36.8360 5.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.0190 38.7540 4.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.9040 38.5210 5.1500 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.6560 39.3590 5.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.2860 40.4160 7.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0220 40.5290 6.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1420 37.2890 5.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.4080 36.5420 6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 8 1 0\n 1 9 1 0\n 8 7 2 0\n 8 14 1 0\n 9 10 2 0\n 2 3 1 0\n 3 4 1 0\n 4 6 2 0\n 4 15 1 0\n 6 7 1 0\n 15 14 2 0\n 5 11 1 0\n 5 12 1 0\n 5 13 1 0\n 11 10 1 0\n 14 10 1 0\nM END\n","colour":"#CC6666","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/mArh-x0548_1_B_apo_Qo13dJt.pdb","moleculeId":27385,"selectionType":"COMPLEX","representations":[{"lastKnownID":"4C97FA90-71CF-48BA-9540-B76DEB891334","uuid":"4C97FA90-71CF-48BA-9540-B76DEB891334","type":"contact","params":{"lazy":false,"visible":true,"quality":"medium","hydrogenBond":true,"weakHydrogenBond":true,"waterHydrogenBond":false,"backboneHydrogenBond":false,"hydrophobic":false,"halogenBond":true,"ionicInteraction":true,"metalCoordination":true,"cationPi":true,"piStacking":true,"filterSele":"","labelVisible":false,"labelFixedSize":false,"labelSize":2,"labelUnit":"","maxHydrophobicDist":4,"maxHbondDist":3.5,"maxHbondSulfurDist":4.1,"maxHbondAccAngle":45,"maxHbondDonAngle":45,"maxHbondAccPlaneAngle":90,"maxHbondDonPlaneAngle":35,"maxPiStackingDist":5.5,"maxPiStackingOffset":2,"maxPiStackingAngle":30,"maxCationPiDist":6,"maxCationPiOffset":2,"maxIonicDist":5,"maxHalogenBondDist":3.5,"maxHalogenBondAngle":30,"maxMetalDist":3,"refineSaltBridges":true,"masterModelIndex":0,"lineOfSightDistFactor":1,"radialSegments":10,"disableImpostor":false,"radiusType":"vdw","radiusData":{},"radiusSize":0.05,"radiusScale":1,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"element","colorScale":"","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":"/0 or /1"},"templateParams":{"hydrogenBond":{"type":"boolean","rebuild":true},"weakHydrogenBond":{"type":"boolean","rebuild":true},"waterHydrogenBond":{"type":"boolean","rebuild":true},"backboneHydrogenBond":{"type":"boolean","rebuild":true},"hydrophobic":{"type":"boolean","rebuild":true},"halogenBond":{"type":"boolean","rebuild":true},"ionicInteraction":{"type":"boolean","rebuild":true},"metalCoordination":{"type":"boolean","rebuild":true},"cationPi":{"type":"boolean","rebuild":true},"piStacking":{"type":"boolean","rebuild":true},"filterSele":{"type":"text","rebuild":true},"labelVisible":{"type":"boolean","rebuild":true},"labelFixedSize":{"type":"boolean","buffer":"fixedSize"},"labelSize":{"type":"number","precision":3,"max":10,"min":0.001,"rebuild":true},"labelUnit":{"type":"select","rebuild":true,"options":{"":"","angstrom":"angstrom","nm":"nm"}},"maxHydrophobicDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxHbondDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxHbondSulfurDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxHbondAccAngle":{"type":"integer","max":180,"min":0,"rebuild":true},"maxHbondDonAngle":{"type":"integer","max":180,"min":0,"rebuild":true},"maxHbondAccPlaneAngle":{"type":"integer","max":90,"min":0,"rebuild":true},"maxHbondDonPlaneAngle":{"type":"integer","max":90,"min":0,"rebuild":true},"maxPiStackingDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxPiStackingOffset":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxPiStackingAngle":{"type":"integer","max":180,"min":0,"rebuild":true},"maxCationPiDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxCationPiOffset":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxIonicDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxHalogenBondDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"maxHalogenBondAngle":{"type":"integer","max":180,"min":0,"rebuild":true},"maxMetalDist":{"type":"number","precision":1,"max":10,"min":0.1,"rebuild":true},"refineSaltBridges":{"type":"boolean","rebuild":true},"masterModelIndex":{"type":"integer","max":1000,"min":-1,"rebuild":true},"lineOfSightDistFactor":{"type":"number","precision":1,"max":10,"min":0,"rebuild":true},"radialSegments":{"type":"integer","max":25,"min":5,"rebuild":"impostor"},"disableImpostor":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]}},"nglOrientations":{"summary_view":{"elements":[85.94182315444736,0,0,0,0,85.94182315444736,0,0,0,0,85.94182315444736,0,-3.8655004501342773,-21.819500863552094,-1.2425003051757812,1]},"major_view":{"elements":[20.285935205357198,-7.295343406106384,-13.25001253736082,0,9.342045024149822,23.47624737297404,1.3769672686301102,0,11.89584223247756,-5.995649145764028,21.51383656417637,0,7.535999894142151,-14.944999694824219,-2.2675000429153442,1]}},"viewParams":{"backgroundColor":"black","clipNear":42,"clipFar":100,"clipDist":10,"fogNear":50,"fogFar":62},"countOfRemainingMoleculeGroups":0,"proteinsHasLoaded":true,"countOfPendingNglObjects":{"major_view":0,"summary_view":0},"moleculeOrientations":{"27385":{"elements":[21.76026417255528,0,0,0,0,21.76026417255528,0,0,0,0,21.76026417255528,0,7.495000123977661,-37.52199935913086,-6.457499980926514,1]}}},"selectionReducers":{"to_buy_list":[],"vector_list":[],"fragmentDisplayList":[27385],"proteinList":[27385],"complexList":[27385],"surfaceList":[],"densityList":[],"vectorOnList":[],"countOfPendingVectorLoadRequests":0,"mol_group_selection":[236820],"filter":{"active":false,"predefined":"none","filter":{"site":{"priority":0,"order":1,"minValue":0,"maxValue":0,"isFloat":false},"id":{"priority":0,"order":1,"minValue":27353,"maxValue":27456,"isFloat":false},"MW":{"priority":0,"order":1,"minValue":94.05,"maxValue":243.1,"isFloat":true},"logP":{"priority":0,"order":1,"minValue":-1.19,"maxValue":2.73,"isFloat":true},"TPSA":{"priority":0,"order":1,"minValue":28.26,"maxValue":80.47,"isFloat":true},"HA":{"priority":0,"order":1,"minValue":7,"maxValue":18,"isFloat":false},"Hacc":{"priority":0,"order":1,"minValue":2,"maxValue":5,"isFloat":false},"Hdon":{"priority":0,"order":1,"minValue":0,"maxValue":3,"isFloat":false},"Rots":{"priority":0,"order":1,"minValue":0,"maxValue":4,"isFloat":false},"Rings":{"priority":0,"order":1,"minValue":1,"maxValue":4,"isFloat":false},"Velec":{"priority":0,"order":1,"minValue":36,"maxValue":94,"isFloat":false},"#cpd":{"priority":0,"order":1,"minValue":0,"maxValue":0,"isFloat":false}},"priorityOrder":["site","id","MW","logP","TPSA","HA","Hacc","Hdon","Rots","Rings","Velec","#cpd"]},"compoundsOfVectors":null,"bondColorMapOfVectors":null,"currentVector":null},"targetReducers":{"oldUrl":"https://fragalysis.diamond.ac.uk/api/targets/","isTargetLoading":false},"snapshotReducers":{"saveType":"","nextUuid":"","newSessionFlag":0,"openSavingDialog":false,"dialogCurrentStep":0,"isLoadingSnapshotDialog":false,"listOfSnapshots":[],"isLoadingListOfSnapshots":false,"sharedSnapshotURL":null,"sharedSnapshot":{"url":null,"title":null,"description":null,"disableRedirect":false},"isOpenModalSaveSnapshotBeforeExit":false,"selectedSnapshotToSwitch":null,"disableRedirect":false},"previewReducers":{"summary":{"oldUrl":"","compoundImage":"<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" width=\"150px\" height=\"150px\"/>","width":150,"height":150,"countOfPicked":0,"countOfExploredVectors":0,"countOfExploredSeries":0,"estimatedCost":0},"compounds":{"currentPage":-1,"compoundsPerPage":20,"currentCompounds":[],"currentCompoundClass":"blue","selectedCompoundsClass":{"blue":[],"red":[],"green":[],"purple":[],"apricot":[]},"highlightedCompoundId":null,"showedCompoundList":[],"configuration":{}},"molecule":{"sortDialogOpen":false}},"projectReducers":{"currentProject":{"projectID":null,"authorID":null,"title":null,"description":null,"targetID":null,"tags":[],"type":null},"isLoadingCurrentSnapshot":false,"currentSnapshot":{"id":null,"type":"INIT","title":"Initial Snapshot","author":null,"description":"Auto generated initial snapshot","created":"2020-07-13T09:45:54.708Z","parent":null,"children":[],"data":{"apiReducers":{"target_id_list":[{"id":2,"title":"NUDT7A","project_id":[2],"protein_set":[15617,15618,15619,15620,15621,15622,15623,15624,15625,15626,15627,15628,15629,15630,15631],"template_protein":"/media/pdbs/NUDT7A-x0140_1_apo_hYaNUGN.pdb","metadata":null,"zip_archive":null},{"id":4,"title":"ATAD","project_id":[2],"protein_set":[13044,13045,13046,13047,13048,13049,13050,13051],"template_protein":"/media/pdbs/ATAD2A-x1712_1_apo_QcCBCZx.pdb","metadata":null,"zip_archive":null},{"id":5,"title":"BRD1A","project_id":[2],"protein_set":[13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065,13066,13067,13068,13069,13070,13071,13072,13073],"template_protein":"/media/pdbs/BRD1A-x0900_1_apo_X36iTCu.pdb","metadata":null,"zip_archive":null},{"id":7,"title":"DCP2B","project_id":[2],"protein_set":[14666,14667,14668,14669,14670,14671,14672,14673,14674,14675,14676,14677,14678,14679,14680,14681,14682,14683,14684,14685,14686,14687,14688,14689,14690,14691,14692,14693,14694,14695,14696,14697,14698,14699,14700,14701,14702,14703,14704,14705,14706,14707,14708,14709,14710,14711,14712,14713,14714,14715,14716,14717,14718,14719,14720,14721,14722,14723,14724,14725,14726,14727,14728,14729,14730,14731,14732,14733,14734,14735,14736,14737,14738],"template_protein":"/media/pdbs/DCP2B-x0020_1_apo_5td9srg.pdb","metadata":null,"zip_archive":null},{"id":8,"title":"FAM83BA","project_id":[2],"protein_set":[13325,13326,13327,13328,13329,13330,13331,13332,13333,13334,13335,13336,13337,13338],"template_protein":"/media/pdbs/FAM83BA-x0131_1_apo_G2blbbF.pdb","metadata":null,"zip_archive":null},{"id":12,"title":"MURD","project_id":[2],"protein_set":[6378,6379,6380,6381],"template_protein":"/media/pdbs/MURD-x0349_apo_0Z35oUA.pdb","metadata":null,"zip_archive":null},{"id":15,"title":"NUDT4A","project_id":[2],"protein_set":[13536,13537,13538,13539,13540,13541,13542,13543],"template_protein":"/media/pdbs/NUDT4A-x0159_1_apo_MptlW5D.pdb","metadata":null,"zip_archive":null},{"id":17,"title":"OXA10OTA","project_id":[2],"protein_set":[13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967,13968,13969,13970],"template_protein":"/media/pdbs/OXA10OTA-x0038_1_apo_b0APxOF.pdb","metadata":null,"zip_archive":null},{"id":18,"title":"PARP14A","project_id":[2],"protein_set":[13971,13972,13973,13974,13975,13976,13977,13978,13979,13980,13981,13982,13983,13984,13985,13986,13987,13988],"template_protein":"/media/pdbs/PARP14A-x0137_1_apo_RiuanPQ.pdb","metadata":null,"zip_archive":null},{"id":19,"title":"PHIPA","project_id":[2],"protein_set":[16673],"template_protein":"/media/pdbs/PHIPA-x9178_1_apo_zdgcIwy.pdb","metadata":null,"zip_archive":null},{"id":20,"title":"PTP1B","project_id":[2],"protein_set":[6480,6481,6482,6483,6484,6485,6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,6614,6615,6616,6617,6618],"template_protein":"/media/pdbs/PTP1B-y0049_apo_N9naW4T.pdb","metadata":null,"zip_archive":null},{"id":22,"title":"SMTGR","project_id":[2],"protein_set":[7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213,7214,7215],"template_protein":"/media/pdbs/smTGR-x2053_apo_zrHDWbw.pdb","metadata":null,"zip_archive":null},{"id":29,"title":"ATAD2A","project_id":[2],"protein_set":[13052,13053,13054],"template_protein":"/media/pdbs/ATAD2A-x1803_1_apo_D4wOsMM.pdb","metadata":null,"zip_archive":null},{"id":30,"title":"CAMK1DA","project_id":[2],"protein_set":[13074,13075,13076,13077,13078,13079,13080,13081,13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092],"template_protein":"/media/pdbs/CAMK1DA-x0049_1_apo_Xd3Xer3.pdb","metadata":null,"zip_archive":null},{"id":31,"title":"DCLRE1AA","project_id":[2],"protein_set":[13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,13228,13229,13230,13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,13241,13242,13243,13244,13245,13246,13247,13248,13249,13250,13251],"template_protein":"/media/pdbs/DCLRE1AA-x0128_1_apo_SgxAg9F.pdb","metadata":null,"zip_archive":null},{"id":32,"title":"FALZA","project_id":[2],"protein_set":[6928,6929,6930,6931,6932,6933,6934,6935],"template_protein":"/media/pdbs/FALZA-x0079_1_apo_pDzqSU5.pdb","metadata":null,"zip_archive":null},{"id":35,"title":"HAO1A","project_id":[2],"protein_set":[6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968,6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983],"template_protein":"/media/pdbs/HAO1A-x0208_1_apo_MQrMrik.pdb","metadata":null,"zip_archive":null},{"id":37,"title":"MUREECA","project_id":[2],"protein_set":[17944,17945,17946,17947,17948,17949,17950,17951,17952,17953,17954,17955,17956,17957,17958,17959,17960,17961,17962,17963,17964,17965],"template_protein":"/media/pdbs/MUREECA-x0114_1_apo_SbbuYzF.pdb","metadata":null,"zip_archive":null},{"id":38,"title":"NUDT21A","project_id":[2],"protein_set":[13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506,13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522,13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535],"template_protein":"/media/pdbs/NUDT21A-x0159_1_apo_VSKfMPI.pdb","metadata":null,"zip_archive":null},{"id":39,"title":"NUDT4","project_id":[2],"protein_set":[7069,7070,7071,7072,7073,7074],"template_protein":"/media/pdbs/NUDT4A-x0159_apo_Z09M2Hp.pdb","metadata":null,"zip_archive":null},{"id":40,"title":"NUDT5A","project_id":[2],"protein_set":[18136,18137,18138,18139,18140,18141,18142,18143,18144,18145,18146,18147,18148,18149,18150,18151,18152,18153,18154,18155,18156,18157,18158,18159,18160,18161,18162,18163,18164,18165,18166,18167,18168,18169,18170,18171,18172,18173,18174,18175,18176,18177,18178,18179,18180,18181,18182,18183,18184,18185,18186,18187,18188,18189,18190,18191,18192,18193,18194,18195,18196,18197,18198,18199,18200,18201,18202,18203,18204,18205,18206,18207,18208,18209,18210,18211,18212,18213,18214,18215,18216,18217,18218,18219,18220,18221,18222,18223,18224,18225,18226,18227,18228,18229,18230,18231,18232,18233,18234,18235,18236,18237,18238,18239,18240,18241,18242,18243,18244,18245,18246,18247,18248,18249,18250,18251,18252,18253,18254,18255,18256,18257,18258,18259,18260,18261,18262,18263,18264,18265,18266,18267,18268,18269,18270,18271,18272,18273,18274,18275,18276,18277,18278,18279,18280,18281,18282,18283,18284,18285,18286,18287,18288,18289,18290,18291,18292,18293,18294,18295,18296,18297,18298,18299,18300,18301,18302,18303,18304],"template_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","metadata":null,"zip_archive":null},{"id":41,"title":"NUDT7A_CRUDE","project_id":[2],"protein_set":[13657,13658,13659,13660,13661,13662,13663,13664,13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680,13681,13682,13683,13684,13685,13686,13687,13688,13689,13690,13691,13692,13693,13694,13695,13696,13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712,13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728,13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744,13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760,13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,13775,13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791,13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807,13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823,13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839,13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855,13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871,13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887,13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903,13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919,13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935,13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951],"template_protein":"/media/pdbs/NUDT7A_Crude-x0005_1_apo_by2s3Tn.pdb","metadata":null,"zip_archive":null},{"id":46,"title":"smTGRNEW","project_id":[2],"protein_set":[7216,7217,7218,7219,7220,7221,7222,7223,7224],"template_protein":"/media/pdbs/smTGR-x20531_apo_ddCGiaP.pdb","metadata":null,"zip_archive":null},{"id":47,"title":"STAG1A","project_id":[2],"protein_set":[14789,14790,14791,14792,14793,14794,14795,14796,14797,14798,14799,14800,14801,14802,14803,14804,14805,14806,14807,14808,14809],"template_protein":"/media/pdbs/STAG1A-x0237_1_apo_T6h9LGK.pdb","metadata":null,"zip_archive":null},{"id":48,"title":"TBXTA","project_id":[2],"protein_set":[14810,14811,14812,14813,14814,14815,14816,14817,14818,14819,14820,14821,14822,14823,14824,14825,14826,14827,14828,14829,14830,14831,14832,14833,14834,14835,14836,14837,14838,14839,14840,14841,14842,14843,14844,14845,14846,14847,14848,14849,14850,14851,14852,14853,14854,14855,14856,14857,14858,14859,14860,14861,14862],"template_protein":"/media/pdbs/TBXTA-x0024_1_apo_kFHAPSk.pdb","metadata":null,"zip_archive":null},{"id":50,"title":"VIM2","project_id":[2],"protein_set":[14410,14411,14412,14413,14414,14415,14416,14417,14418,14419,14420,14421,14422,14423,14424,14425,14426,14427,14428,14429,14430,14431,14432,14433,14434,14435,14436,14437,14438,14439,14440,14441,14442,14443,14444,14445,14446,14447,14448,14449,14450,14451,14452,14453,14454,14455,14456,14457,14458,14459,14460,14461,14462,14463,14464,14465,14466,14467,14468,14469,14470,14471,14472,14473,14474,14475,14476,14477,14478,14479,14480,14481,14482,14483,14484,14485,14486,14487,14488,14489,14490,14491,14492,14493,14494,14495,14496,14497,14498,14499,14500,14501,14502,14503,14504,14505,14506,14507,14508,14509,14510,14511,14512,14513,14514,14515,14516,14517,14518,14519,14520,14521,14522,14523,14524,14525,14526,14527,14528,14529,14530,14531,14532,14533,14534,14535,14536,14537,14538,14539,14540,14541,14542,14543,14544,14545,14546,14547,14548,14549,14550,14551,14552,14553,14554,14555,14556,14557,14558,14559,14560,14561,14562,14563,14564,14565,14566,14567,14568,14569,14570,14571,14572,14573],"template_protein":"/media/pdbs/VIM2-MB-105_1_apo_SBlf6ub.pdb","metadata":null,"zip_archive":null},{"id":51,"title":"XX02KALRNA","project_id":[2],"protein_set":[14902,14903,14904,14905,14906,14907,14908,14909,14910,14911,14912,14913],"template_protein":"/media/pdbs/XX02KALRNA-x1376_1_apo_9VSCvR8.pdb","metadata":null,"zip_archive":null},{"id":52,"title":"TNCA","project_id":[2],"protein_set":[14354,14355,14356,14357,14358,14359,14360,14361,14362,14363,14364,14365,14366,14367,14368,14369,14370],"template_protein":"/media/pdbs/TNCA-x0062_1_apo_Vc9bxy2.pdb","metadata":null,"zip_archive":null},{"id":53,"title":"ALAS2A","project_id":[2],"protein_set":[17966],"template_protein":"NOT AVAILABLE","metadata":null,"zip_archive":null},{"id":54,"title":"EPB41L3A","project_id":[2],"protein_set":[18404,18405,18406,18407,18408,18409,18410,18411,18412,18413,18414,18415,18416,18417,18418,18419,18420,18421,18422,18423,18424,18425,18426,18427,18428,18429,18430,18431,18432,18433,18434,18435,18436,18437,18438,18439,18440,18441,18442,18443,18444,18445,18446,18447,18448,18449,18450,18451,18452,18453,18454,18455,18456,18457,18458,18459,18460,18461,18462,18463,18464,18465,18466,18467,18468,18469,18470,18471,18472,18473,18474,18475,18476,18477,18478],"template_protein":"/media/pdbs/EPB41L3A-x0076_1_apo_vcDam7m.pdb","metadata":null,"zip_archive":null},{"id":61,"title":"mArh","project_id":[2],"protein_set":[27229,27256,27245,27231,27233,27269,27247,27235,27265,27232,27257,27248,27234,27236,27250,27238,27239,27258,27251,27240,27241,27252,27242,27266,27243,27259,27253,27244,27254,27255,27260,27275,27261,27262,27263,27270,27267,27268,27271,27272,27274,27277,27279,27276,27281,27278,27226,27280,27225,27227,27230,27301,27325,27311,27296,27304,27293,27290,27299,27309,27307,27322,27302,27287,27284,27316,27314,27320,27305,27326,27310,27312,27324,27318,27308,27321,27315,27297,27291,27288,27294,27323,27285,27300,27303,27289,27319,27286,27292,27298,27295,27306,27317,27313,27283,27359,27332,27347,27330,27366,27331,27348,27334,27360,27337,27349,27339,27378,27336,27350,27341,27338,27342,27351,27340,27367,27343,27352,27345,27361,27346,27354,27355,27374,27356,27358,27362,27364,27365,27368,27369,27370,27371,27373,27376,27375,27377,27380,27329,27379,27383,27382,27385,27328,27333,27384,27411,27387,27404,27396,27412,27388,27405,27413,27397,27389,27406,27398,27390,27407,27399,27391,27408,27400,27392,27401,27409,27393,27402,27410,27394,27403,27395,27386,27344,27223,27353,27224,27228,27237,27363,27246,27372,27249,27381,27630,27264,27273,27282,27327,27335],"template_protein":"/media/pdbs/mArh-3ew5_A_0_A_apo_E1jNcsT.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/mArh.zip"},{"id":62,"title":"Mpro","project_id":[2],"protein_set":[27437,27414,27428,27415,27444,27416,27429,27417,27438,27418,27430,27419,27455,27420,27431,27421,27439,27422,27432,27423,27445,27424,27433,27425,27440,27426,27434,27427,27449,27435,27441,27436,27446,27442,27452,27447,27443,27450,27448,27454,27451,27453,27456,27457,27458,27459,27460,27461,27496,27511,27476,27509,27502,27464,27484,27471,27489,27468,27465,27472,27490,27470,27486,27473,27497,27480,27485,27491,27475,27467,27477,27474,27492,27481,27514,27462,27498,27479,27493,27469,27501,27510,27487,27499,27495,27507,27505,27503,27500,27506,27512,27463,27516,27508,27513,27482,27488,27523,27548,27553,27518,27533,27543,27549,27551,27536,27552,27532,27574,27537,27534,27547,27517,27538,27524,27519,27522,27539,27559,27528,27540,27529,27530,27558,27541,27531,27555,27560,27542,27572,27525,27550,27556,27521,27545,27544,27573,27571,27557,27569,27563,27567,27561,27565,27570,27566,27564,27527,27546,27595,27598,27611,27593,27576,27580,27606,27599,27581,27577,27594,27625,27575,27628,27578,27596,27622,27587,27617,27597,27604,27585,27627,27588,27589,27624,27590,27615,27591,27607,27602,27592,27613,27623,27609,27600,27583,27603,27612,27614,27610,27620,27618,27616,27621,27626,27619,27586,27605,27584,27582,27478,27515,27520,27535,27526,27579,27504,27494,27568,27562,27608,27601,27483,27554,27466],"template_protein":"/media/pdbs/Mpro-3sn8-2020-04-Zhu_0_apo.pdb","metadata":"http://fragalysis.diamond.ac.uk/media/metadata/metadata_zEUROET.csv","zip_archive":"http://fragalysis.diamond.ac.uk/media/targets/Mpro.zip"}],"mol_group_list":[{"id":236812,"group_type":"MC","mol_id":[27354,27355,27366,27367,27371,27374,27377,27380,27386,27387,27388,27389,27392,27398,27399,27401,27402,27403,27404,27410,27411,27416,27419,27420,27421,27422,27425,27426,27427,27429,27431,27432,27439,27440,27447,27448,27449,27451,27452,27455],"target_id":61,"x_com":-4.4989012455838715,"y_com":14.114083179731415,"z_com":0.25580480583399456,"description":"A1 - Adenine Site (XChem)"},{"id":236813,"group_type":"MC","mol_id":[27342,27345,27346],"target_id":61,"x_com":-3.8341915817309933,"y_com":13.712565082187156,"z_com":-0.15587148891049324,"description":"A2 - Adenine Site (UCSF)"},{"id":236814,"group_type":"MC","mol_id":[27266,27267,27268,27269,27270,27271,27272,27273,27274,27275,27276,27277,27278,27279,27280,27281,27282,27283,27284,27285,27286,27287,27288,27289,27290,27291,27292,27293,27294,27295,27296,27297,27298,27299,27300,27301,27302,27303,27304,27305,27306,27307,27308,27309,27310,27311,27312,27313,27314,27315,27316,27317,27318,27319,27320,27321,27322,27323,27324,27325,27326,27327,27328,27329,27330,27333,27334,27335,27336,27339,27673,27674,27675,27676,27677,27678,27679,27680],"target_id":61,"x_com":-1.8511471525183878,"y_com":17.267210230159005,"z_com":-5.243608535510113,"description":"A3 - Adenine Site (PDB)"},{"id":236815,"group_type":"MC","mol_id":[27364,27378,27393,27405,27423,27424,27445,27446,27453,27454,27681],"target_id":61,"x_com":-0.017333865222552636,"y_com":10.906212267654093,"z_com":-4.626821873627239,"description":"B1 - Proximal Ribose Site (XChem)"},{"id":236816,"group_type":"MC","mol_id":[27362,27372,27373,27376,27412,27415,27434,27435],"target_id":61,"x_com":-5.445321639158269,"y_com":26.48507876672931,"z_com":-12.632551178123105,"description":"C1 - Catalytic Loop (XChem)"},{"id":236817,"group_type":"MC","mol_id":[27359,27383,27394,27396,27397,27428,27450],"target_id":61,"x_com":1.529875624226074,"y_com":8.826352123573598,"z_com":-9.342696112478631,"description":"D1 - Pyrophosphate loop (XChem)"},{"id":236818,"group_type":"MC","mol_id":[27363,27370,27382,27390,27413,27418,27441],"target_id":61,"x_com":3.703160482033595,"y_com":22.644234697869933,"z_com":14.73997129271892,"description":"K1 - K90 Site (XChem)"},{"id":236819,"group_type":"MC","mol_id":[27343,27344,27347,27349,27350,27351,27352],"target_id":61,"x_com":2.520089218143665,"y_com":26.248473959106587,"z_com":14.956820899478545,"description":"K2 - K90 Site (UCSF)"},{"id":236820,"group_type":"MC","mol_id":[27353,27356,27357,27358,27368,27375,27379,27384,27385,27391,27408,27409,27414,27417,27430,27436,27437,27438,27442,27443,27456],"target_id":61,"x_com":6.255407567135129,"y_com":18.147956402411463,"z_com":7.939211104515316,"description":"S1 - Surface (XChem)"},{"id":236821,"group_type":"MC","mol_id":[27340,27341,27348],"target_id":61,"x_com":7.3207703682032,"y_com":17.828445687157366,"z_com":1.5423113747874648,"description":"S2 - Surface (UCSF)"},{"id":236822,"group_type":"MC","mol_id":[27331,27332,27337,27338],"target_id":61,"x_com":6.777995086418041,"y_com":32.54349142855037,"z_com":2.104151146166346,"description":"S3 - Surface (PDB)"},{"id":236823,"group_type":"MC","mol_id":[27360,27361,27365,27369,27381,27395,27406,27407,27433,27444],"target_id":61,"x_com":12.61463170030533,"y_com":26.078180854021745,"z_com":0.3734862742954836,"description":"X1 - Xtal contact (XChem)"}],"cached_mol_lists":{},"duck_yank_data":{},"pandda_event_list":[],"pandda_site_list":[],"target_on":61,"target_on_name":"mArh","isFetching":false,"app_on":"PREVIEW","group_type":"MC","hotspot_list":[],"savingState":"UNSET","seshListSaving":false,"targetUnrecognised":false,"uuid":"UNSET","sessionIdList":[]},"nglReducers":{"objectsInView":{"PROTEIN_61":{"name":"PROTEIN_61","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/mArh-3ew5_A_0_A_apo_E1jNcsT.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"summary_view","representations":[{"lastKnownID":"CC3AC09D-69A2-44E2-B01F-BAD59354572F","uuid":"CC3AC09D-69A2-44E2-B01F-BAD59354572F","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"PROTEIN_61_MAIN":{"name":"PROTEIN_61_MAIN","prot_url":"https://fragalysis.diamond.ac.uk/media/pdbs/mArh-3ew5_A_0_A_apo_E1jNcsT.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"major_view","representations":[{"lastKnownID":"8C772F67-2E9D-421B-AC58-AC73EBE5295D","uuid":"8C772F67-2E9D-421B-AC58-AC73EBE5295D","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236812":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236812","radius":6,"colour":[0,0,1],"coords":[-4.4989012455838715,14.114083179731415,0.25580480583399456],"representations":[{"lastKnownID":"95B45C67-AF9F-4539-B990-D9555F547719","uuid":"95B45C67-AF9F-4539-B990-D9555F547719","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236813":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236813","radius":2,"colour":[0,0,1],"coords":[-3.8341915817309933,13.712565082187156,-0.15587148891049324],"representations":[{"lastKnownID":"A16E3A83-8881-45C1-A614-B88737B5E09E","uuid":"A16E3A83-8881-45C1-A614-B88737B5E09E","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236814":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236814","radius":6,"colour":[0,0,1],"coords":[-1.8511471525183878,17.267210230159005,-5.243608535510113],"representations":[{"lastKnownID":"ECDEEA37-552A-4560-B9FF-B3DFF8461EBB","uuid":"ECDEEA37-552A-4560-B9FF-B3DFF8461EBB","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236815":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236815","radius":6,"colour":[0,0,1],"coords":[-0.017333865222552636,10.906212267654093,-4.626821873627239],"representations":[{"lastKnownID":"45DBA216-C367-4C59-BD02-4C5E3F68DFD3","uuid":"45DBA216-C367-4C59-BD02-4C5E3F68DFD3","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236816":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236816","radius":4,"colour":[0,0,1],"coords":[-5.445321639158269,26.48507876672931,-12.632551178123105],"representations":[{"lastKnownID":"E4B45023-789C-491F-B445-D8DB10F62B35","uuid":"E4B45023-789C-491F-B445-D8DB10F62B35","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236817":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236817","radius":4,"colour":[0,0,1],"coords":[1.529875624226074,8.826352123573598,-9.342696112478631],"representations":[{"lastKnownID":"88A3D5B4-4819-430F-9C3D-400876522D6E","uuid":"88A3D5B4-4819-430F-9C3D-400876522D6E","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236818":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236818","radius":4,"colour":[0,0,1],"coords":[3.703160482033595,22.644234697869933,14.73997129271892],"representations":[{"lastKnownID":"0D5FEB9C-EEBD-4CDA-9447-5D693B1FC190","uuid":"0D5FEB9C-EEBD-4CDA-9447-5D693B1FC190","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236819":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236819","radius":4,"colour":[0,0,1],"coords":[2.520089218143665,26.248473959106587,14.956820899478545],"representations":[{"lastKnownID":"98571C2A-26DA-4582-86C9-4F8BEA1FE104","uuid":"98571C2A-26DA-4582-86C9-4F8BEA1FE104","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236820":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236820","radius":6,"colour":[0,0,1],"coords":[6.255407567135129,18.147956402411463,7.939211104515316],"representations":[{"lastKnownID":"952887C4-9580-4954-91E6-18EAFAEF3E58","uuid":"952887C4-9580-4954-91E6-18EAFAEF3E58","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236821":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236821","radius":2,"colour":[0,0,1],"coords":[7.3207703682032,17.828445687157366,1.5423113747874648],"representations":[{"lastKnownID":"E642C13F-8E5C-4981-AD48-2242DB4D9A5C","uuid":"E642C13F-8E5C-4981-AD48-2242DB4D9A5C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236822":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236822","radius":2,"colour":[0,0,1],"coords":[6.777995086418041,32.54349142855037,2.104151146166346],"representations":[{"lastKnownID":"BA802ECF-54C0-485E-B1E3-EEA928F36FD7","uuid":"BA802ECF-54C0-485E-B1E3-EEA928F36FD7","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_236823":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_236823","radius":4,"colour":[0,0,1],"coords":[12.61463170030533,26.078180854021745,0.3734862742954836],"representations":[{"lastKnownID":"AC7E3697-CD7E-4253-B7A7-1DAFFEB1943D","uuid":"AC7E3697-CD7E-4253-B7A7-1DAFFEB1943D","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]}},"nglOrientations":{"summary_view":{"elements":[85.94182315444736,0,0,0,0,85.94182315444736,0,0,0,0,85.94182315444736,0,-3.8655004501342773,-21.819500863552094,-1.2425003051757812,1]},"major_view":{"elements":[85.94182315444736,0,0,0,0,85.94182315444736,0,0,0,0,85.94182315444736,0,-3.8655004501342773,-21.819500863552094,-1.2425003051757812,1]}},"viewParams":{"backgroundColor":"black","clipNear":42,"clipFar":100,"clipDist":10,"fogNear":50,"fogFar":62},"countOfRemainingMoleculeGroups":1,"proteinsHasLoaded":true,"countOfPendingNglObjects":{"major_view":0,"summary_view":0},"moleculeOrientations":{}},"selectionReducers":{"to_buy_list":[],"vector_list":[],"fragmentDisplayList":[],"proteinList":[],"complexList":[],"surfaceList":[],"densityList":[],"vectorOnList":[],"countOfPendingVectorLoadRequests":0,"mol_group_selection":[],"filter":{"active":false,"predefined":"none","filter":{"site":{"priority":0,"order":1,"minValue":0,"maxValue":0,"isFloat":false},"id":{"priority":0,"order":1,"minValue":27353,"maxValue":27456,"isFloat":false},"MW":{"priority":0,"order":1,"minValue":94.05,"maxValue":243.1,"isFloat":true},"logP":{"priority":0,"order":1,"minValue":-1.19,"maxValue":2.73,"isFloat":true},"TPSA":{"priority":0,"order":1,"minValue":28.26,"maxValue":80.47,"isFloat":true},"HA":{"priority":0,"order":1,"minValue":7,"maxValue":18,"isFloat":false},"Hacc":{"priority":0,"order":1,"minValue":2,"maxValue":5,"isFloat":false},"Hdon":{"priority":0,"order":1,"minValue":0,"maxValue":3,"isFloat":false},"Rots":{"priority":0,"order":1,"minValue":0,"maxValue":4,"isFloat":false},"Rings":{"priority":0,"order":1,"minValue":1,"maxValue":4,"isFloat":false},"Velec":{"priority":0,"order":1,"minValue":36,"maxValue":94,"isFloat":false},"#cpd":{"priority":0,"order":1,"minValue":0,"maxValue":0,"isFloat":false}},"priorityOrder":["site","id","MW","logP","TPSA","HA","Hacc","Hdon","Rots","Rings","Velec","#cpd"]},"compoundsOfVectors":null,"bondColorMapOfVectors":null,"currentVector":null},"previewReducers":{"summary":{"oldUrl":"","compoundImage":"<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" width=\"150px\" height=\"150px\"/>","width":150,"height":150,"countOfPicked":0,"countOfExploredVectors":0,"countOfExploredSeries":0,"estimatedCost":0},"compounds":{"currentPage":-1,"compoundsPerPage":20,"currentCompounds":[],"currentCompoundClass":"blue","selectedCompoundsClass":{"blue":[],"red":[],"green":[],"purple":[],"apricot":[]},"highlightedCompoundId":null,"showedCompoundList":[],"configuration":{}},"molecule":{"sortDialogOpen":false}}}},"isProjectModalOpen":false,"isProjectModalLoading":false,"listOfProjects":[],"isLoadingListOfProjects":false,"isLoadingTree":false,"currentSnapshotTree":null,"currentSnapshotList":null,"forceCreateProject":false,"isForceProjectCreated":false},"issueReducers":{"name":"Anthony Aimon","email":"[email protected]","title":"Report issue button is now a submit idea button?","description":"Says it all above","response":"","imageSource":{},"isOpenForm":true},"datasetsReducers":{"datasets":[],"moleculeLists":{},"isLoadingMoleculeList":false,"scoreDatasetMap":{},"scoreCompoundMap":{},"filterDatasetMap":{},"filterPropertiesDatasetMap":{},"filterDialogOpen":false,"filteredScoreProperties":{},"filterWithInspirations":false,"ligandLists":{},"proteinLists":{},"complexLists":{},"surfaceLists":{},"inspirationLists":{},"searchString":null,"isOpenInspirationDialog":false,"inspirationFragmentList":[],"isLoadingInspirationListOfMolecules":false,"inspirationMoleculeDataList":[],"isOpenCrossReferenceDialog":false,"crossReferenceCompoundName":null,"isLoadingCrossReferenceScores":false,"crossReferenceCompoundsDataList":[],"compoundsToBuyDatasetMap":{}}}