From 2d00a13077676cdf8b0641665fb50e251128b97e Mon Sep 17 00:00:00 2001 From: Guillaume Ballet <3272758+gballet@users.noreply.github.com> Date: Wed, 8 Nov 2023 10:51:02 +0100 Subject: [PATCH] post-genesis transition MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit quell linter issue support Transition post tree in conversion Refactor transition post genesis (#311) * rewrite per-block conversion pointer management * remove unused method * fix: a branch that can verge at genesis or post genesis (#314) * fix: import cycle in conversion refactor (#315) * fix shadowfork panic in OpenStorageTrie fix OpenStorageTrie: return an error instead of panicking if the account tree not a verkle tree (#321) add a switch to force proof in blocks (#322) * add a switch to force proof in blocks * activate switch * fix switch type add switch to override the stride of the overlay conversion (#323) * add switch to override the stride of the overlay conversion * set a default stride of 10k add a few traces for relaunch add missing step in the chain of setting the override for overlay stride fix: save and load transition state for block processing (#324) * fix: save and load transition state for block processing * log whether the tree is verkle in LoadTransitionState * fix: ensure the transition is marked as started in insertChain * dump saved address * fix nil pointer panic * remove stacktrace that is no longer useful * fix a panic * fix build * check: copy current account address BEFORE it's saved * mandatory panic fix * Remove debug fmt.Println * more cleanup + comments fix: ensure StorageProcessed is properly recovered add traces for gas pool overflow cmd/{geth, utils}: add a command to clear verkle costs (#326) * cmd/{geth, utils}: add a command to clear verkle costs fix: boolean issue fix: load finalization state in FinalizeAndAssemble (#340) * Conversion and TransitionTrie fixes (#346) * fixes Signed-off-by: Ignacio Hagopian * remove old comment Signed-off-by: Ignacio Hagopian --------- Signed-off-by: Ignacio Hagopian * trace cleanup --------- Signed-off-by: Ignacio Hagopian Co-authored-by: Ignacio Hagopian fix: check for nil override in NewBlockChain (#357) fix rebase issue fix a few rebase issues add debug traces fix: assume that having to create a new transaction state mean it hasn't happened. This is a workaround, because it will always be false when restarting a node that has started the transition but not necessarily completed it. add logs to debug shadowfork persist conversion state to db and use an LRU cache for active transition states (#375) * persist conversion state to db * fix: don't recreate LRU when writing state * opt: only write state to db if not already present in LRU * fix: rlp can't encode TransitionState * fix: use gob because binary.Write does not support structs 🤦‍♂️ * fix: nil pointer panic * add logs to debug shadowfork * no such thing as not enough traces * ditto * fix stupid bug * add a comment for readability * add more traces * Lock the state transition during conversion (#384) * heavy handed approach: lock the state transition during conversion * also lock transition state loading/unloading * reduce logs verbosity * add conversion test to workflow (#386) * add conversion test to workflow * mandatory -f switch fix in rm * forgot & at the end of the geth command * remove incorrect kill * add debug traces * add an overlay stride * fix typo * Apply suggestions from code review eth: add debug_conversionStatus RPC call (#392) * eth: add debug_conversionStatus RPC call * add debug trace4s * Apply suggestions from code review * export started/ended fields fix post-verge sync (#404) * fix post-verge sync * review: fix truncated comment --- .github/workflows/conversion.yml | 75 ++++++ cmd/geth/config.go | 11 + cmd/geth/main.go | 3 + cmd/utils/flags.go | 16 ++ consensus/beacon/consensus.go | 93 ++++--- core/block_validator.go | 1 + core/blockchain.go | 41 ++- core/chain_makers.go | 11 +- core/genesis.go | 27 +- .../conversion.go} | 210 ++++++++++++++- core/rawdb/accessors_overlay.go | 30 +++ core/rawdb/schema.go | 7 + core/state/database.go | 248 ++++++++++++++---- core/state/statedb.go | 11 +- core/state/trie_prefetcher.go | 2 +- core/state_processor.go | 188 ------------- core/state_transition.go | 4 + eth/api_debug.go | 40 +++ eth/backend.go | 6 + eth/catalyst/api.go | 6 +- eth/ethconfig/config.go | 6 + light/trie.go | 33 ++- miner/worker.go | 7 +- params/config.go | 3 +- trie/transition.go | 8 +- 25 files changed, 757 insertions(+), 330 deletions(-) create mode 100644 .github/workflows/conversion.yml rename core/{overlay_transition.go => overlay/conversion.go} (53%) create mode 100644 core/rawdb/accessors_overlay.go diff --git a/.github/workflows/conversion.yml b/.github/workflows/conversion.yml new file mode 100644 index 000000000000..40d4fed6925d --- /dev/null +++ b/.github/workflows/conversion.yml @@ -0,0 +1,75 @@ +name: Overlay conversion + +on: + push: + branches: [ master, transition-post-genesis, store-transition-state-in-db ] + pull_request: + branches: [ master, kaustinen-with-shapella, transition-post-genesis, store-transition-state-in-db, lock-overlay-transition ] + workflow_dispatch: + +jobs: + build: + runs-on: self-hosted + steps: + - uses: actions/checkout@v2 + - name: Set up Go + uses: actions/setup-go@v2 + with: + go-version: 1.21.1 + + - name: Cleanup from previous runs + run: | + rm -f log.txt + rm -rf .shadowfork + rm -f genesis.json + + - name: Download genesis file + run: wget https://gist.githubusercontent.com/gballet/0b02a025428aa0e7b67941864d54716c/raw/bfb4e158bca5217b356a19b2ec55c4a45a7b2bad/genesis.json + + - name: Init data + run: go run ./cmd/geth --dev --cache.preimages init genesis.json + + - name: Run geth in devmode + run: go run ./cmd/geth --dev --dev.period=5 --cache.preimages --http --datadir=.shadowfork --override.overlay-stride=10 --override.prague=$(($(date +%s) + 45)) > log.txt & + + - name: Wait for the transition to start + run: | + start_time=$(date +%s) + while true; do + sleep 5 + current_time=$(date +%s) + elapsed_time=$((current_time - start_time)) + + # 2 minute timeout + if [ $elapsed_time -ge 120 ]; then + kill -9 $(pgrep -f geth) + exit 1 + fi + + # Check for signs that the conversion has started + if grep -q "Processing verkle conversion starting at" log.txt; then + break + fi + done + + - name: Wait for the transition to end + run: | + start_time=$(date +%s) + while true; do + sleep 5 + current_time=$(date +%s) + elapsed_time=$((current_time - start_time)) + + # 10 minute timeout + if [ $elapsed_time -ge 300 ]; then + cat log.txt + kill -9 $(pgrep -f geth) + exit 1 + fi + + # Check for signs that the conversion has started + if egrep -q "at block.*performing transition\? false" log.txt; then + kill -9 $(pgrep -f geth) + break + fi + done diff --git a/cmd/geth/config.go b/cmd/geth/config.go index bf01c6f91857..4184290e86c6 100644 --- a/cmd/geth/config.go +++ b/cmd/geth/config.go @@ -175,6 +175,17 @@ func makeFullNode(ctx *cli.Context) (*node.Node, ethapi.Backend) { v := ctx.Uint64(utils.OverridePrague.Name) cfg.Eth.OverridePrague = &v } + if ctx.IsSet(utils.OverrideProofInBlock.Name) { + v := ctx.Bool(utils.OverrideProofInBlock.Name) + cfg.Eth.OverrideProofInBlock = &v + } + if ctx.IsSet(utils.OverrideOverlayStride.Name) { + v := ctx.Uint64(utils.OverrideOverlayStride.Name) + cfg.Eth.OverrideOverlayStride = &v + } + if ctx.IsSet(utils.ClearVerkleCosts.Name) { + params.ClearVerkleWitnessCosts() + } backend, eth := utils.RegisterEthService(stack, &cfg.Eth) // Configure log filter RPC API. diff --git a/cmd/geth/main.go b/cmd/geth/main.go index 38fb755b4b5a..5cb1580df3d1 100644 --- a/cmd/geth/main.go +++ b/cmd/geth/main.go @@ -67,8 +67,11 @@ var ( utils.NoUSBFlag, utils.USBFlag, utils.SmartCardDaemonPathFlag, + utils.OverrideOverlayStride, utils.OverrideCancun, utils.OverridePrague, + utils.OverrideProofInBlock, + utils.ClearVerkleCosts, utils.EnablePersonal, utils.TxPoolLocalsFlag, utils.TxPoolNoLocalsFlag, diff --git a/cmd/utils/flags.go b/cmd/utils/flags.go index b927d0f94f83..3395eebca866 100644 --- a/cmd/utils/flags.go +++ b/cmd/utils/flags.go @@ -263,6 +263,12 @@ var ( Value: 2048, Category: flags.EthCategory, } + OverrideOverlayStride = &cli.Uint64Flag{ + Name: "override.overlay-stride", + Usage: "Manually specify the stride of the overlay transition, overriding the bundled setting", + Value: 10000, + Category: flags.EthCategory, + } OverrideCancun = &cli.Uint64Flag{ Name: "override.cancun", Usage: "Manually specify the Cancun fork timestamp, overriding the bundled setting", @@ -273,6 +279,16 @@ var ( Usage: "Manually specify the Verkle fork timestamp, overriding the bundled setting", Category: flags.EthCategory, } + OverrideProofInBlock = &cli.BoolFlag{ + Name: "override.blockproof", + Usage: "Manually specify the proof-in-block setting", + Category: flags.EthCategory, + } + ClearVerkleCosts = &cli.BoolFlag{ + Name: "clear.verkle.costs", + Usage: "Clear verkle costs (for shadow forks)", + Category: flags.EthCategory, + } // Light server and client settings LightServeFlag = &cli.IntFlag{ Name: "light.serve", diff --git a/consensus/beacon/consensus.go b/consensus/beacon/consensus.go index 35a7ed2b56d0..62d9f48feb2a 100644 --- a/consensus/beacon/consensus.go +++ b/consensus/beacon/consensus.go @@ -25,8 +25,10 @@ import ( "github.com/ethereum/go-ethereum/consensus" "github.com/ethereum/go-ethereum/consensus/misc/eip1559" "github.com/ethereum/go-ethereum/consensus/misc/eip4844" + "github.com/ethereum/go-ethereum/core/overlay" "github.com/ethereum/go-ethereum/core/state" "github.com/ethereum/go-ethereum/core/types" + "github.com/ethereum/go-ethereum/log" "github.com/ethereum/go-ethereum/params" "github.com/ethereum/go-ethereum/rpc" "github.com/ethereum/go-ethereum/trie" @@ -363,6 +365,14 @@ func (beacon *Beacon) Finalize(chain consensus.ChainHeaderReader, header *types. state.Witness().TouchAddressOnWriteAndComputeGas(w.Address[:], uint256.Int{}, utils.CodeKeccakLeafKey) state.Witness().TouchAddressOnWriteAndComputeGas(w.Address[:], uint256.Int{}, utils.CodeSizeLeafKey) } + + if chain.Config().IsPrague(header.Number, header.Time) { + fmt.Println("at block", header.Number, "performing transition?", state.Database().InTransition()) + parent := chain.GetHeaderByHash(header.ParentHash) + if err := overlay.OverlayVerkleTransition(state, parent.Root, chain.Config().OverlayStride); err != nil { + log.Error("error performing the transition", "err", err) + } + } } // FinalizeAndAssemble implements consensus.Engine, setting the final state and @@ -387,51 +397,70 @@ func (beacon *Beacon) FinalizeAndAssemble(chain consensus.ChainHeaderReader, hea // Assign the final state root to header. header.Root = state.IntermediateRoot(true) + state.Database().SaveTransitionState(header.Root) var ( p *verkle.VerkleProof k verkle.StateDiff keys = state.Witness().Keys() ) - if chain.Config().IsPrague(header.Number, header.Time) && chain.Config().ProofInBlocks { + if chain.Config().IsPrague(header.Number, header.Time) { // Open the pre-tree to prove the pre-state against parent := chain.GetHeaderByNumber(header.Number.Uint64() - 1) if parent == nil { return nil, fmt.Errorf("nil parent header for block %d", header.Number) } - preTrie, err := state.Database().OpenTrie(parent.Root) - if err != nil { - return nil, fmt.Errorf("error opening pre-state tree root: %w", err) - } + // Load transition state at beginning of block, because + // OpenTrie needs to know what the conversion status is. + state.Database().LoadTransitionState(parent.Root) - var okpre, okpost bool - var vtrpre, vtrpost *trie.VerkleTrie - switch pre := preTrie.(type) { - case *trie.VerkleTrie: - vtrpre, okpre = preTrie.(*trie.VerkleTrie) - vtrpost, okpost = state.GetTrie().(*trie.VerkleTrie) - case *trie.TransitionTrie: - vtrpre = pre.Overlay() - okpre = true - post, _ := state.GetTrie().(*trie.TransitionTrie) - vtrpost = post.Overlay() - okpost = true - default: - // This should only happen for the first block of the - // conversion, when the previous tree is a merkle tree. - // Logically, the "previous" verkle tree is an empty tree. - okpre = true - vtrpre = trie.NewVerkleTrie(verkle.New(), state.Database().TrieDB(), utils.NewPointCache(), false) - post := state.GetTrie().(*trie.TransitionTrie) - vtrpost = post.Overlay() - okpost = true - } - if okpre && okpost { - if len(keys) > 0 { - p, k, err = trie.ProveAndSerialize(vtrpre, vtrpost, keys, vtrpre.FlatdbNodeResolver) - if err != nil { - return nil, fmt.Errorf("error generating verkle proof for block %d: %w", header.Number, err) + if chain.Config().ProofInBlocks { + preTrie, err := state.Database().OpenTrie(parent.Root) + if err != nil { + return nil, fmt.Errorf("error opening pre-state tree root: %w", err) + } + + var okpre, okpost bool + var vtrpre, vtrpost *trie.VerkleTrie + switch pre := preTrie.(type) { + case *trie.VerkleTrie: + vtrpre, okpre = preTrie.(*trie.VerkleTrie) + switch tr := state.GetTrie().(type) { + case *trie.VerkleTrie: + vtrpost = tr + okpost = true + // This is to handle a situation right at the start of the conversion: + // the post trie is a transition tree when the pre tree is an empty + // verkle tree. + case *trie.TransitionTrie: + vtrpost = tr.Overlay() + okpost = true + default: + okpost = false + } + case *trie.TransitionTrie: + vtrpre = pre.Overlay() + okpre = true + post, _ := state.GetTrie().(*trie.TransitionTrie) + vtrpost = post.Overlay() + okpost = true + default: + // This should only happen for the first block of the + // conversion, when the previous tree is a merkle tree. + // Logically, the "previous" verkle tree is an empty tree. + okpre = true + vtrpre = trie.NewVerkleTrie(verkle.New(), state.Database().TrieDB(), utils.NewPointCache(), false) + post := state.GetTrie().(*trie.TransitionTrie) + vtrpost = post.Overlay() + okpost = true + } + if okpre && okpost { + if len(keys) > 0 { + p, k, err = trie.ProveAndSerialize(vtrpre, vtrpost, keys, vtrpre.FlatdbNodeResolver) + if err != nil { + return nil, fmt.Errorf("error generating verkle proof for block %d: %w", header.Number, err) + } } } } diff --git a/core/block_validator.go b/core/block_validator.go index b1ceab9d5c6c..d977c1d63d96 100644 --- a/core/block_validator.go +++ b/core/block_validator.go @@ -131,6 +131,7 @@ func (v *BlockValidator) ValidateState(block *types.Block, statedb *state.StateD if root := statedb.IntermediateRoot(v.config.IsEIP158(header.Number)); header.Root != root { return fmt.Errorf("invalid merkle root (remote: %x local: %x) dberr: %w", header.Root, root, statedb.Error()) } + statedb.Database().SaveTransitionState(header.Root) return nil } diff --git a/core/blockchain.go b/core/blockchain.go index a97bfb20c1aa..9143fd6c699d 100644 --- a/core/blockchain.go +++ b/core/blockchain.go @@ -103,7 +103,7 @@ const ( txLookupCacheLimit = 1024 maxFutureBlocks = 256 maxTimeFutureBlocks = 30 - TriesInMemory = 128 + TriesInMemory = 8192 // BlockChainVersion ensures that an incompatible database forces a resync from scratch. // @@ -251,6 +251,14 @@ func NewBlockChain(db ethdb.Database, cacheConfig *CacheConfig, genesis *Genesis if _, ok := genesisErr.(*params.ConfigCompatError); genesisErr != nil && !ok { return nil, genesisErr } + if overrides != nil { + if overrides.OverrideProofInBlock != nil { + chainConfig.ProofInBlocks = *overrides.OverrideProofInBlock + } + if overrides.OverrideOverlayStride != nil { + chainConfig.OverlayStride = *overrides.OverrideOverlayStride + } + } log.Info("") log.Info(strings.Repeat("-", 153)) for _, line := range strings.Split(chainConfig.Description(), "\n") { @@ -313,6 +321,12 @@ func NewBlockChain(db ethdb.Database, cacheConfig *CacheConfig, genesis *Genesis // Declare the end of the verkle transition if need be if bc.chainConfig.Rules(head.Number, false /* XXX */, head.Time).IsPrague { + // TODO this only works when resuming a chain that has already gone + // through the conversion. All pointers should be saved to the DB + // for it to be able to recover if interrupted during the transition + // but that's left out to a later PR since there's not really a need + // right now. + bc.stateCache.InitTransitionStatus(true, true) bc.stateCache.EndVerkleTransition() } @@ -1746,8 +1760,22 @@ func (bc *BlockChain) insertChain(chain types.Blocks, setHead bool) (int, error) parent = bc.GetHeader(block.ParentHash(), block.NumberU64()-1) } + if bc.Config().IsPrague(block.Number(), block.Time()) { + bc.stateCache.LoadTransitionState(parent.Root) + + // pragueTime has been reached. If the transition isn't active, it means this + // is the fork block and that the conversion needs to be marked at started. + if !bc.stateCache.InTransition() && !bc.stateCache.Transitioned() { + bc.stateCache.StartVerkleTransition(parent.Root, emptyVerkleRoot, bc.Config(), bc.Config().PragueTime, parent.Root) + } + } else { + // If the verkle activation time hasn't started, declare it as "not started". + // This is so that if the miner activates the conversion, the insertion happens + // in the correct mode. + bc.stateCache.InitTransitionStatus(false, false) + } if parent.Number.Uint64() == conversionBlock { - bc.StartVerkleTransition(parent.Root, emptyVerkleRoot, bc.Config(), &parent.Time) + bc.StartVerkleTransition(parent.Root, emptyVerkleRoot, bc.Config(), &parent.Time, parent.Root) bc.stateCache.SetLastMerkleRoot(parent.Root) } statedb, err := state.New(parent.Root, bc.stateCache, bc.snaps) @@ -1989,7 +2017,7 @@ func (bc *BlockChain) insertSideChain(block *types.Block, it *insertIterator) (i parent = bc.GetHeader(parent.ParentHash, parent.Number.Uint64()-1) } if parent == nil { - return it.index, errors.New("missing parent") + return it.index, fmt.Errorf("missing parent: hash=%x, number=%d", current.Hash(), current.Number) } // Import all the pruned blocks to make the state available var ( @@ -2050,7 +2078,7 @@ func (bc *BlockChain) recoverAncestors(block *types.Block) (common.Hash, error) } } if parent == nil { - return common.Hash{}, errors.New("missing parent") + return common.Hash{}, fmt.Errorf("missing parent during ancestor recovery: hash=%x, number=%d", block.ParentHash(), block.Number()) } // Import all the pruned blocks to make the state available for i := len(hashes) - 1; i >= 0; i-- { @@ -2288,6 +2316,7 @@ func (bc *BlockChain) SetCanonical(head *types.Block) (common.Hash, error) { defer bc.chainmu.Unlock() // Re-execute the reorged chain in case the head state is missing. + log.Trace("looking for state", "root", head.Root(), "has state", bc.HasState(head.Root())) if !bc.HasState(head.Root()) { if latestValidHash, err := bc.recoverAncestors(head); err != nil { return latestValidHash, err @@ -2533,8 +2562,8 @@ func (bc *BlockChain) GetTrieFlushInterval() time.Duration { return time.Duration(bc.flushInterval.Load()) } -func (bc *BlockChain) StartVerkleTransition(originalRoot, translatedRoot common.Hash, chainConfig *params.ChainConfig, pragueTime *uint64) { - bc.stateCache.StartVerkleTransition(originalRoot, translatedRoot, chainConfig, pragueTime) +func (bc *BlockChain) StartVerkleTransition(originalRoot, translatedRoot common.Hash, chainConfig *params.ChainConfig, pragueTime *uint64, root common.Hash) { + bc.stateCache.StartVerkleTransition(originalRoot, translatedRoot, chainConfig, pragueTime, root) } func (bc *BlockChain) ReorgThroughVerkleTransition() { bc.stateCache.ReorgThroughVerkleTransition() diff --git a/core/chain_makers.go b/core/chain_makers.go index 5b9dc0c6ff08..1c232e6b6d92 100644 --- a/core/chain_makers.go +++ b/core/chain_makers.go @@ -365,7 +365,7 @@ func GenerateChainWithGenesis(genesis *Genesis, engine consensus.Engine, n int, return db, blocks, receipts } -func GenerateVerkleChain(config *params.ChainConfig, parent *types.Block, engine consensus.Engine, db ethdb.Database, n int, gen func(int, *BlockGen)) ([]*types.Block, []types.Receipts, []*verkle.VerkleProof, []verkle.StateDiff) { +func GenerateVerkleChain(config *params.ChainConfig, parent *types.Block, engine consensus.Engine, diskdb ethdb.Database, n int, gen func(int, *BlockGen)) ([]*types.Block, []types.Receipts, []*verkle.VerkleProof, []verkle.StateDiff) { if config == nil { config = params.TestChainConfig } @@ -434,13 +434,16 @@ func GenerateVerkleChain(config *params.ChainConfig, parent *types.Block, engine return nil, nil } var snaps *snapshot.Tree - triedb := state.NewDatabaseWithConfig(db, nil) - triedb.EndVerkleTransition() + db := state.NewDatabaseWithConfig(diskdb, nil) + db.StartVerkleTransition(common.Hash{}, common.Hash{}, config, config.PragueTime, common.Hash{}) + db.EndVerkleTransition() + db.SaveTransitionState(parent.Root()) for i := 0; i < n; i++ { - statedb, err := state.New(parent.Root(), triedb, snaps) + statedb, err := state.New(parent.Root(), db, snaps) if err != nil { panic(fmt.Sprintf("could not find state for block %d: err=%v, parent root=%x", i, err, parent.Root())) } + statedb.NewAccessWitness() block, receipt := genblock(i, parent, statedb) blocks[i] = block receipts[i] = receipt diff --git a/core/genesis.go b/core/genesis.go index c8a4bc5952d9..a2a331d1fe33 100644 --- a/core/genesis.go +++ b/core/genesis.go @@ -126,6 +126,7 @@ func (ga *GenesisAlloc) deriveHash(cfg *params.ChainConfig, timestamp uint64) (c // all the derived states will be discarded to not pollute disk. db := state.NewDatabase(rawdb.NewMemoryDatabase()) if cfg.IsPrague(big.NewInt(int64(0)), timestamp) { + db.StartVerkleTransition(common.Hash{}, common.Hash{}, cfg, ×tamp, common.Hash{}) db.EndVerkleTransition() } statedb, err := state.New(types.EmptyRootHash, db, nil) @@ -146,15 +147,17 @@ func (ga *GenesisAlloc) deriveHash(cfg *params.ChainConfig, timestamp uint64) (c // flush is very similar with deriveHash, but the main difference is // all the generated states will be persisted into the given database. // Also, the genesis state specification will be flushed as well. -func (ga *GenesisAlloc) flush(db ethdb.Database, triedb *trie.Database, blockhash common.Hash, cfg *params.ChainConfig) error { - statedb, err := state.New(types.EmptyRootHash, state.NewDatabaseWithNodeDB(db, triedb), nil) - if err != nil { - return err +func (ga *GenesisAlloc) flush(db ethdb.Database, triedb *trie.Database, blockhash common.Hash, cfg *params.ChainConfig, timestamp *uint64) error { + database := state.NewDatabaseWithNodeDB(db, triedb) + // End the verkle conversion at genesis if the fork block is 0 + if timestamp != nil && cfg.IsPrague(big.NewInt(int64(0)), *timestamp) { + database.StartVerkleTransition(common.Hash{}, common.Hash{}, cfg, timestamp, common.Hash{}) + database.EndVerkleTransition() } - // End the verkle conversion at genesis if the fork block is 0 - if triedb.IsVerkle() { - statedb.Database().EndVerkleTransition() + statedb, err := state.New(types.EmptyRootHash, database, nil) + if err != nil { + return err } for addr, account := range *ga { @@ -221,7 +224,7 @@ func CommitGenesisState(db ethdb.Database, triedb *trie.Database, blockhash comm return errors.New("not found") } } - return alloc.flush(db, triedb, blockhash, config) + return alloc.flush(db, triedb, blockhash, config, nil) } // GenesisAccount is an account in the state of the genesis block. @@ -288,8 +291,10 @@ func (e *GenesisMismatchError) Error() string { // ChainOverrides contains the changes to chain config. type ChainOverrides struct { - OverrideCancun *uint64 - OverridePrague *uint64 + OverrideCancun *uint64 + OverridePrague *uint64 + OverrideProofInBlock *bool + OverrideOverlayStride *uint64 } // SetupGenesisBlock writes or updates the genesis block in db. @@ -536,7 +541,7 @@ func (g *Genesis) Commit(db ethdb.Database, triedb *trie.Database) (*types.Block // All the checks has passed, flush the states derived from the genesis // specification as well as the specification itself into the provided // database. - if err := g.Alloc.flush(db, triedb, block.Hash(), g.Config); err != nil { + if err := g.Alloc.flush(db, triedb, block.Hash(), g.Config, &g.Timestamp); err != nil { return nil, err } rawdb.WriteTd(db, block.Hash(), block.NumberU64(), block.Difficulty()) diff --git a/core/overlay_transition.go b/core/overlay/conversion.go similarity index 53% rename from core/overlay_transition.go rename to core/overlay/conversion.go index 35c09d22d938..bf77ff0033f1 100644 --- a/core/overlay_transition.go +++ b/core/overlay/conversion.go @@ -14,14 +14,17 @@ // You should have received a copy of the GNU Lesser General Public License // along with the go-ethereum library. If not, see . -package core +package overlay import ( "bufio" "bytes" + "encoding/binary" "fmt" "io" "os" + "runtime" + "sync" "time" "github.com/ethereum/go-ethereum/common" @@ -32,15 +35,199 @@ import ( "github.com/ethereum/go-ethereum/log" "github.com/ethereum/go-ethereum/rlp" "github.com/ethereum/go-ethereum/trie" + "github.com/ethereum/go-ethereum/trie/utils" + "github.com/ethereum/go-verkle" + "github.com/holiman/uint256" ) +var zeroTreeIndex uint256.Int + +// keyValueMigrator is a helper module that collects key-values from the overlay-tree migration for Verkle Trees. +// It assumes that the walk of the base tree is done in address-order, so it exploit that fact to +// collect the key-values in a way that is efficient. +type keyValueMigrator struct { + // leafData contains the values for the future leaf for a particular VKT branch. + leafData map[branchKey]*migratedKeyValue + + // When prepare() is called, it will start a background routine that will process the leafData + // saving the result in newLeaves to be used by migrateCollectedKeyValues(). The background + // routine signals that it is done by closing processingReady. + processingReady chan struct{} + newLeaves []verkle.LeafNode + prepareErr error +} + +func newKeyValueMigrator() *keyValueMigrator { + // We do initialize the VKT config since prepare() might indirectly make multiple GetConfig() calls + // in different goroutines when we never called GetConfig() before, causing a race considering the way + // that `config` is designed in go-verkle. + // TODO: jsign as a fix for this in the PR where we move to a file-less precomp, since it allows safe + // concurrent calls to GetConfig(). When that gets merged, we can remove this line. + _ = verkle.GetConfig() + return &keyValueMigrator{ + processingReady: make(chan struct{}), + leafData: make(map[branchKey]*migratedKeyValue, 10_000), + } +} + +type migratedKeyValue struct { + branchKey branchKey + leafNodeData verkle.BatchNewLeafNodeData +} +type branchKey struct { + addr common.Address + treeIndex uint256.Int +} + +func newBranchKey(addr []byte, treeIndex *uint256.Int) branchKey { + var sk branchKey + copy(sk.addr[:], addr) + sk.treeIndex = *treeIndex + return sk +} + +func (kvm *keyValueMigrator) addStorageSlot(addr []byte, slotNumber []byte, slotValue []byte) { + treeIndex, subIndex := utils.GetTreeKeyStorageSlotTreeIndexes(slotNumber) + leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, treeIndex)) + leafNodeData.Values[subIndex] = slotValue +} + +func (kvm *keyValueMigrator) addAccount(addr []byte, acc *types.StateAccount) { + leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, &zeroTreeIndex)) + + var version [verkle.LeafValueSize]byte + leafNodeData.Values[utils.VersionLeafKey] = version[:] + + var balance [verkle.LeafValueSize]byte + for i, b := range acc.Balance.Bytes() { + balance[len(acc.Balance.Bytes())-1-i] = b + } + leafNodeData.Values[utils.BalanceLeafKey] = balance[:] + + var nonce [verkle.LeafValueSize]byte + binary.LittleEndian.PutUint64(nonce[:8], acc.Nonce) + leafNodeData.Values[utils.NonceLeafKey] = nonce[:] + + leafNodeData.Values[utils.CodeKeccakLeafKey] = acc.CodeHash[:] +} + +func (kvm *keyValueMigrator) addAccountCode(addr []byte, codeSize uint64, chunks []byte) { + leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, &zeroTreeIndex)) + + // Save the code size. + var codeSizeBytes [verkle.LeafValueSize]byte + binary.LittleEndian.PutUint64(codeSizeBytes[:8], codeSize) + leafNodeData.Values[utils.CodeSizeLeafKey] = codeSizeBytes[:] + + // The first 128 chunks are stored in the account header leaf. + for i := 0; i < 128 && i < len(chunks)/32; i++ { + leafNodeData.Values[byte(128+i)] = chunks[32*i : 32*(i+1)] + } + + // Potential further chunks, have their own leaf nodes. + for i := 128; i < len(chunks)/32; { + treeIndex, _ := utils.GetTreeKeyCodeChunkIndices(uint256.NewInt(uint64(i))) + leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, treeIndex)) + + j := i + for ; (j-i) < 256 && j < len(chunks)/32; j++ { + leafNodeData.Values[byte((j-128)%256)] = chunks[32*j : 32*(j+1)] + } + i = j + } +} + +func (kvm *keyValueMigrator) getOrInitLeafNodeData(bk branchKey) *verkle.BatchNewLeafNodeData { + if ld, ok := kvm.leafData[bk]; ok { + return &ld.leafNodeData + } + kvm.leafData[bk] = &migratedKeyValue{ + branchKey: bk, + leafNodeData: verkle.BatchNewLeafNodeData{ + Stem: nil, // It will be calculated in the prepare() phase, since it's CPU heavy. + Values: make(map[byte][]byte, 256), + }, + } + return &kvm.leafData[bk].leafNodeData +} + +func (kvm *keyValueMigrator) prepare() { + // We fire a background routine to process the leafData and save the result in newLeaves. + // The background routine signals that it is done by closing processingReady. + go func() { + // Step 1: We split kvm.leafData in numBatches batches, and we process each batch in a separate goroutine. + // This fills each leafNodeData.Stem with the correct value. + leafData := make([]migratedKeyValue, 0, len(kvm.leafData)) + for _, v := range kvm.leafData { + leafData = append(leafData, *v) + } + var wg sync.WaitGroup + batchNum := runtime.NumCPU() + batchSize := (len(kvm.leafData) + batchNum - 1) / batchNum + for i := 0; i < len(kvm.leafData); i += batchSize { + start := i + end := i + batchSize + if end > len(kvm.leafData) { + end = len(kvm.leafData) + } + wg.Add(1) + + batch := leafData[start:end] + go func() { + defer wg.Done() + var currAddr common.Address + var currPoint *verkle.Point + for i := range batch { + if batch[i].branchKey.addr != currAddr || currAddr == (common.Address{}) { + currAddr = batch[i].branchKey.addr + currPoint = utils.EvaluateAddressPoint(currAddr[:]) + } + stem := utils.GetTreeKeyWithEvaluatedAddess(currPoint, &batch[i].branchKey.treeIndex, 0) + stem = stem[:verkle.StemSize] + batch[i].leafNodeData.Stem = stem + } + }() + } + wg.Wait() + + // Step 2: Now that we have all stems (i.e: tree keys) calculated, we can create the new leaves. + nodeValues := make([]verkle.BatchNewLeafNodeData, len(kvm.leafData)) + for i := range leafData { + nodeValues[i] = leafData[i].leafNodeData + } + + // Create all leaves in batch mode so we can optimize cryptography operations. + kvm.newLeaves, kvm.prepareErr = verkle.BatchNewLeafNode(nodeValues) + close(kvm.processingReady) + }() +} + +func (kvm *keyValueMigrator) migrateCollectedKeyValues(tree *trie.VerkleTrie) error { + now := time.Now() + <-kvm.processingReady + if kvm.prepareErr != nil { + return fmt.Errorf("failed to prepare key values: %w", kvm.prepareErr) + } + log.Info("Prepared key values from base tree", "duration", time.Since(now)) + + // Insert into the tree. + if err := tree.InsertMigratedLeaves(kvm.newLeaves); err != nil { + return fmt.Errorf("failed to insert migrated leaves: %w", err) + } + + return nil +} + // OverlayVerkleTransition contains the overlay conversion logic -func OverlayVerkleTransition(statedb *state.StateDB) error { +func OverlayVerkleTransition(statedb *state.StateDB, root common.Hash, maxMovedCount uint64) error { migrdb := statedb.Database() + migrdb.LockCurrentTransitionState() + defer migrdb.UnLockCurrentTransitionState() // verkle transition: if the conversion process is in progress, move // N values from the MPT into the verkle tree. if migrdb.InTransition() { + fmt.Printf("Processing verkle conversion starting at %x %x, building on top of %x\n", migrdb.GetCurrentAccountHash(), migrdb.GetCurrentSlotHash(), root) var ( now = time.Now() tt = statedb.GetTrie().(*trie.TransitionTrie) @@ -92,20 +279,19 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { preimageSeek += int64(len(addr)) } - const maxMovedCount = 10000 // mkv will be assiting in the collection of up to maxMovedCount key values to be migrated to the VKT. // It has internal caches to do efficient MPT->VKT key calculations, which will be discarded after // this function. mkv := newKeyValueMigrator() // move maxCount accounts into the verkle tree, starting with the // slots from the previous account. - count := 0 + count := uint64(0) // if less than maxCount slots were moved, move to the next account for count < maxMovedCount { acc, err := types.FullAccount(accIt.Account()) if err != nil { - log.Error("Invalid account encountered during traversal", "error", err) + fmt.Println("Invalid account encountered during traversal", "error", err) return err } vkt.SetStorageRootConversion(*migrdb.GetCurrentAccountAddress(), acc.Root) @@ -124,7 +310,12 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { if err != nil { return err } - stIt.Next() + processed := stIt.Next() + if processed { + log.Debug("account has storage and a next item") + } else { + log.Debug("account has storage and NO next item") + } // fdb.StorageProcessed will be initialized to `true` if the // entire storage for an account was not entirely processed @@ -133,6 +324,7 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { // If the entire storage was processed, then the iterator was // created in vain, but it's ok as this will not happen often. for ; !migrdb.GetStorageProcessed() && count < maxMovedCount; count++ { + log.Trace("Processing storage", "count", count, "slot", stIt.Slot(), "storage processed", migrdb.GetStorageProcessed(), "current account", migrdb.GetCurrentAccountAddress(), "current account hash", migrdb.GetCurrentAccountHash()) var ( value []byte // slot value after RLP decoding safeValue [32]byte // 32-byte aligned value @@ -155,6 +347,7 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { return fmt.Errorf("slotnr len is zero is not 32: %d", len(slotnr)) } } + log.Trace("found slot number", "number", slotnr) if crypto.Keccak256Hash(slotnr[:]) != stIt.Hash() { return fmt.Errorf("preimage file does not match storage hash: %s!=%s", crypto.Keccak256Hash(slotnr), stIt.Hash()) } @@ -196,6 +389,7 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { // Move to the next account, if available - or end // the transition otherwise. if accIt.Next() { + log.Trace("Found another account to convert", "hash", accIt.Hash()) var addr common.Address if hasPreimagesBin { if _, err := io.ReadFull(fpreimages, addr[:]); err != nil { @@ -207,10 +401,10 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { return fmt.Errorf("account address len is zero is not 20: %d", len(addr)) } } - // fmt.Printf("account switch: %s != %s\n", crypto.Keccak256Hash(addr[:]), accIt.Hash()) if crypto.Keccak256Hash(addr[:]) != accIt.Hash() { return fmt.Errorf("preimage file does not match account hash: %s != %s", crypto.Keccak256Hash(addr[:]), accIt.Hash()) } + log.Trace("Converting account address", "hash", accIt.Hash(), "addr", addr) preimageSeek += int64(len(addr)) migrdb.SetCurrentAccountAddress(addr) } else { @@ -223,7 +417,7 @@ func OverlayVerkleTransition(statedb *state.StateDB) error { } migrdb.SetCurrentPreimageOffset(preimageSeek) - log.Info("Collected key values from base tree", "count", count, "duration", time.Since(now), "last account", statedb.Database().GetCurrentAccountHash()) + log.Info("Collected key values from base tree", "count", count, "duration", time.Since(now), "last account hash", statedb.Database().GetCurrentAccountHash(), "last account address", statedb.Database().GetCurrentAccountAddress(), "storage processed", statedb.Database().GetStorageProcessed(), "last storage", statedb.Database().GetCurrentSlotHash()) // Take all the collected key-values and prepare the new leaf values. // This fires a background routine that will start doing the work that diff --git a/core/rawdb/accessors_overlay.go b/core/rawdb/accessors_overlay.go new file mode 100644 index 000000000000..5a371b9d307f --- /dev/null +++ b/core/rawdb/accessors_overlay.go @@ -0,0 +1,30 @@ +// Copyright 2024 The go-ethereum Authors +// This file is part of the go-ethereum library. +// +// The go-ethereum library is free software: you can redistribute it and/or modify +// it under the terms of the GNU Lesser General Public License as published by +// the Free Software Foundation, either version 3 of the License, or +// (at your option) any later version. +// +// The go-ethereum library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public License +// along with the go-ethereum library. If not, see . + +package rawdb + +import ( + "github.com/ethereum/go-ethereum/common" + "github.com/ethereum/go-ethereum/ethdb" +) + +func ReadVerkleTransitionState(db ethdb.KeyValueReader, hash common.Hash) ([]byte, error) { + return db.Get(transitionStateKey(hash)) +} + +func WriteVerkleTransitionState(db ethdb.KeyValueWriter, hash common.Hash, state []byte) error { + return db.Put(transitionStateKey(hash), state) +} diff --git a/core/rawdb/schema.go b/core/rawdb/schema.go index 18722ed5d4cb..f7a3515715ae 100644 --- a/core/rawdb/schema.go +++ b/core/rawdb/schema.go @@ -122,6 +122,8 @@ var ( CliqueSnapshotPrefix = []byte("clique-") + VerkleTransitionStatePrefix = []byte("verkle-transition-state-") + preimageCounter = metrics.NewRegisteredCounter("db/preimage/total", nil) preimageHitCounter = metrics.NewRegisteredCounter("db/preimage/hits", nil) ) @@ -250,6 +252,11 @@ func storageTrieNodeKey(accountHash common.Hash, path []byte) []byte { return append(append(trieNodeStoragePrefix, accountHash.Bytes()...), path...) } +// transitionStateKey = transitionStatusKey + hash +func transitionStateKey(hash common.Hash) []byte { + return append(VerkleTransitionStatePrefix, hash.Bytes()...) +} + // IsLegacyTrieNode reports whether a provided database entry is a legacy trie // node. The characteristics of legacy trie node are: // - the key length is 32 bytes diff --git a/core/state/database.go b/core/state/database.go index 5707e2c88b60..5fa7738fb525 100644 --- a/core/state/database.go +++ b/core/state/database.go @@ -17,8 +17,12 @@ package state import ( + "bytes" + "encoding/gob" "errors" "fmt" + "runtime/debug" + "sync" "github.com/ethereum/go-ethereum/common" "github.com/ethereum/go-ethereum/common/lru" @@ -26,6 +30,7 @@ import ( "github.com/ethereum/go-ethereum/core/types" "github.com/ethereum/go-ethereum/crypto" "github.com/ethereum/go-ethereum/ethdb" + "github.com/ethereum/go-ethereum/log" "github.com/ethereum/go-ethereum/params" "github.com/ethereum/go-ethereum/trie" "github.com/ethereum/go-ethereum/trie/trienode" @@ -64,7 +69,7 @@ type Database interface { // TrieDB retrieves the low level trie database used for data storage. TrieDB() *trie.Database - StartVerkleTransition(originalRoot, translatedRoot common.Hash, chainConfig *params.ChainConfig, cancunTime *uint64) + StartVerkleTransition(originalRoot, translatedRoot common.Hash, chainConfig *params.ChainConfig, cancunTime *uint64, root common.Hash) ReorgThroughVerkleTransition() @@ -74,7 +79,9 @@ type Database interface { Transitioned() bool - SetCurrentSlotHash(hash common.Hash) + InitTransitionStatus(bool, bool) + + SetCurrentSlotHash(common.Hash) GetCurrentAccountAddress() *common.Address @@ -94,7 +101,15 @@ type Database interface { AddRootTranslation(originalRoot, translatedRoot common.Hash) - SetLastMerkleRoot(root common.Hash) + SetLastMerkleRoot(common.Hash) + + SaveTransitionState(common.Hash) + + LoadTransitionState(common.Hash) + + LockCurrentTransitionState() + + UnLockCurrentTransitionState() } // Trie is a Ethereum Merkle Patricia trie. @@ -182,36 +197,37 @@ func NewDatabase(db ethdb.Database) Database { // large memory cache. func NewDatabaseWithConfig(db ethdb.Database, config *trie.Config) Database { return &cachingDB{ - disk: db, - codeSizeCache: lru.NewCache[common.Hash, int](codeSizeCacheSize), - codeCache: lru.NewSizeConstrainedCache[common.Hash, []byte](codeCacheSize), - triedb: trie.NewDatabaseWithConfig(db, config), - addrToPoint: utils.NewPointCache(), + disk: db, + codeSizeCache: lru.NewCache[common.Hash, int](codeSizeCacheSize), + codeCache: lru.NewSizeConstrainedCache[common.Hash, []byte](codeCacheSize), + triedb: trie.NewDatabaseWithConfig(db, config), + addrToPoint: utils.NewPointCache(), + TransitionStatePerRoot: lru.NewBasicLRU[common.Hash, *TransitionState](100), } } // NewDatabaseWithNodeDB creates a state database with an already initialized node database. func NewDatabaseWithNodeDB(db ethdb.Database, triedb *trie.Database) Database { return &cachingDB{ - disk: db, - codeSizeCache: lru.NewCache[common.Hash, int](codeSizeCacheSize), - codeCache: lru.NewSizeConstrainedCache[common.Hash, []byte](codeCacheSize), - triedb: triedb, - addrToPoint: utils.NewPointCache(), - ended: triedb.IsVerkle(), + disk: db, + codeSizeCache: lru.NewCache[common.Hash, int](codeSizeCacheSize), + codeCache: lru.NewSizeConstrainedCache[common.Hash, []byte](codeCacheSize), + triedb: triedb, + addrToPoint: utils.NewPointCache(), + TransitionStatePerRoot: lru.NewBasicLRU[common.Hash, *TransitionState](100), } } func (db *cachingDB) InTransition() bool { - return db.started && !db.ended + return db.CurrentTransitionState != nil && db.CurrentTransitionState.Started && !db.CurrentTransitionState.Ended } func (db *cachingDB) Transitioned() bool { - return db.ended + return db.CurrentTransitionState != nil && db.CurrentTransitionState.Ended } // Fork implements the fork -func (db *cachingDB) StartVerkleTransition(originalRoot, translatedRoot common.Hash, chainConfig *params.ChainConfig, pragueTime *uint64) { +func (db *cachingDB) StartVerkleTransition(originalRoot, translatedRoot common.Hash, chainConfig *params.ChainConfig, pragueTime *uint64, root common.Hash) { fmt.Println(` __________.__ .__ .__ __ .__ .__ ____ \__ ___| |__ ____ ____ | | ____ ______ | |__ _____ _____/ |_ | |__ _____ ______ __ _ _|__| ____ / ___\ ______ @@ -219,24 +235,35 @@ func (db *cachingDB) StartVerkleTransition(originalRoot, translatedRoot common.H | | | Y \ ___/ \ ___/| |_\ ___/| |_> | Y \/ __ \| | | | | Y \/ __ \_\___ \ \ /| | | \\___ /\___ \ |____| |___| /\___ \___ |____/\___ | __/|___| (____ |___| |__| |___| (____ /_____/ \/\_/ |__|___| /_____//_____/ |__|`) - db.started = true - db.ended = false + db.CurrentTransitionState = &TransitionState{ + Started: true, + // initialize so that the first storage-less accounts are processed + StorageProcessed: true, + } // db.AddTranslation(originalRoot, translatedRoot) db.baseRoot = originalRoot - // initialize so that the first storage-less accounts are processed - db.StorageProcessed = true + + // Reinitialize values in case of a reorg if pragueTime != nil { chainConfig.PragueTime = pragueTime } } func (db *cachingDB) ReorgThroughVerkleTransition() { - db.ended, db.started = false, false + log.Warn("trying to reorg through the transition, which makes no sense at this point") +} + +func (db *cachingDB) InitTransitionStatus(started, ended bool) { + db.CurrentTransitionState = &TransitionState{ + Ended: ended, + Started: started, + // TODO add other fields when we handle mid-transition interrupts + } } func (db *cachingDB) EndVerkleTransition() { - if !db.started { - db.started = true + if !db.CurrentTransitionState.Started { + db.CurrentTransitionState.Started = true } fmt.Println(` @@ -246,7 +273,36 @@ func (db *cachingDB) EndVerkleTransition() { | | | Y \ ___/ \ ___/| |_\ ___/| |_> | Y \/ __ \| | | | | Y \/ __ \_\___ \ | |__/ __ \| | / /_/ \ ___// /_/ | |____| |___| /\___ \___ |____/\___ | __/|___| (____ |___| |__| |___| (____ /_____/ |____(____ |___| \____ |\___ \____ | |__|`) - db.ended = true + db.CurrentTransitionState.Ended = true +} + +type TransitionState struct { + CurrentAccountAddress *common.Address // addresss of the last translated account + CurrentSlotHash common.Hash // hash of the last translated storage slot + CurrentPreimageOffset int64 // next byte to read from the preimage file + Started, Ended bool + + // Mark whether the storage for an account has been processed. This is useful if the + // maximum number of leaves of the conversion is reached before the whole storage is + // processed. + StorageProcessed bool +} + +func (ts *TransitionState) Copy() *TransitionState { + ret := &TransitionState{ + Started: ts.Started, + Ended: ts.Ended, + CurrentSlotHash: ts.CurrentSlotHash, + CurrentPreimageOffset: ts.CurrentPreimageOffset, + StorageProcessed: ts.StorageProcessed, + } + + if ts.CurrentAccountAddress != nil { + ret.CurrentAccountAddress = &common.Address{} + copy(ret.CurrentAccountAddress[:], ts.CurrentAccountAddress[:]) + } + + return ret } type cachingDB struct { @@ -255,22 +311,16 @@ type cachingDB struct { codeCache *lru.SizeConstrainedCache[common.Hash, []byte] triedb *trie.Database - // Verkle specific fields + // Transition-specific fields // TODO ensure that this info is in the DB - started, ended bool - LastMerkleRoot common.Hash // root hash of the read-only base tree + LastMerkleRoot common.Hash // root hash of the read-only base tree + CurrentTransitionState *TransitionState + TransitionStatePerRoot lru.BasicLRU[common.Hash, *TransitionState] + transitionStateLock sync.Mutex addrToPoint *utils.PointCache - baseRoot common.Hash // hash of the read-only base tree - CurrentAccountAddress *common.Address // addresss of the last translated account - CurrentSlotHash common.Hash // hash of the last translated storage slot - CurrentPreimageOffset int64 // next byte to read from the preimage file - - // Mark whether the storage for an account has been processed. This is useful if the - // maximum number of leaves of the conversion is reached before the whole storage is - // processed. - StorageProcessed bool + baseRoot common.Hash // hash of the read-only base tree } func (db *cachingDB) openMPTTrie(root common.Hash) (Trie, error) { @@ -284,14 +334,14 @@ func (db *cachingDB) openMPTTrie(root common.Hash) (Trie, error) { func (db *cachingDB) openVKTrie(root common.Hash) (Trie, error) { payload, err := db.DiskDB().Get(trie.FlatDBVerkleNodeKeyPrefix) if err != nil { - return trie.NewVerkleTrie(verkle.New(), db.triedb, db.addrToPoint, db.ended), nil + return trie.NewVerkleTrie(verkle.New(), db.triedb, db.addrToPoint, db.CurrentTransitionState.Ended), nil } r, err := verkle.ParseNode(payload, 0) if err != nil { panic(err) } - return trie.NewVerkleTrie(r, db.triedb, db.addrToPoint, db.ended), err + return trie.NewVerkleTrie(r, db.triedb, db.addrToPoint, db.CurrentTransitionState.Ended), err } // OpenTrie opens the main account trie at a specific root hash. @@ -300,19 +350,22 @@ func (db *cachingDB) OpenTrie(root common.Hash) (Trie, error) { mpt Trie err error ) + fmt.Printf("opening trie with root %x, %v %v\n", root, db.InTransition(), db.Transitioned()) // TODO separate both cases when I can be certain that it won't // find a Verkle trie where is expects a Transitoion trie. - if db.started || db.ended { + if db.InTransition() || db.Transitioned() { // NOTE this is a kaustinen-only change, it will break replay vkt, err := db.openVKTrie(root) if err != nil { + log.Error("failed to open the vkt", "err", err) return nil, err } // If the verkle conversion has ended, return a single // verkle trie. - if db.ended { + if db.CurrentTransitionState.Ended { + log.Debug("transition ended, returning a simple verkle tree") return vkt, nil } @@ -320,6 +373,7 @@ func (db *cachingDB) OpenTrie(root common.Hash) (Trie, error) { // trie and an overlay, verkle trie. mpt, err = db.openMPTTrie(db.baseRoot) if err != nil { + log.Error("failed to open the mpt", "err", err, "root", db.baseRoot) return nil, err } @@ -345,7 +399,7 @@ func (db *cachingDB) openStorageMPTrie(stateRoot common.Hash, address common.Add // OpenStorageTrie opens the storage trie of an account func (db *cachingDB) OpenStorageTrie(stateRoot common.Hash, address common.Address, root common.Hash, self Trie) (Trie, error) { // TODO this should only return a verkle tree - if db.ended { + if db.Transitioned() { mpt, err := db.openStorageMPTrie(types.EmptyRootHash, address, common.Hash{}, self) if err != nil { return nil, err @@ -361,7 +415,8 @@ func (db *cachingDB) OpenStorageTrie(stateRoot common.Hash, address common.Addre panic("unexpected trie type") } } - if db.started { + if db.InTransition() { + fmt.Printf("OpenStorageTrie during transition, state root=%x root=%x\n", stateRoot, root) mpt, err := db.openStorageMPTrie(db.LastMerkleRoot, address, root, nil) if err != nil { return nil, err @@ -374,7 +429,7 @@ func (db *cachingDB) OpenStorageTrie(stateRoot common.Hash, address common.Addre case *trie.TransitionTrie: return trie.NewTransitionTree(mpt.(*trie.SecureTrie), self.Overlay(), true), nil default: - panic("unexpected trie type") + return nil, errors.New("expected a verkle account tree, and found another type") } } mpt, err := db.openStorageMPTrie(stateRoot, address, root, nil) @@ -451,48 +506,129 @@ func (db *cachingDB) GetTreeKeyHeader(addr []byte) *verkle.Point { } func (db *cachingDB) SetCurrentAccountAddress(addr common.Address) { - db.CurrentAccountAddress = &addr + db.CurrentTransitionState.CurrentAccountAddress = &addr } func (db *cachingDB) GetCurrentAccountHash() common.Hash { var addrHash common.Hash - if db.CurrentAccountAddress != nil { - addrHash = crypto.Keccak256Hash(db.CurrentAccountAddress[:]) + if db.CurrentTransitionState.CurrentAccountAddress != nil { + addrHash = crypto.Keccak256Hash(db.CurrentTransitionState.CurrentAccountAddress[:]) } return addrHash } func (db *cachingDB) GetCurrentAccountAddress() *common.Address { - return db.CurrentAccountAddress + return db.CurrentTransitionState.CurrentAccountAddress } func (db *cachingDB) GetCurrentPreimageOffset() int64 { - return db.CurrentPreimageOffset + return db.CurrentTransitionState.CurrentPreimageOffset } func (db *cachingDB) SetCurrentPreimageOffset(offset int64) { - db.CurrentPreimageOffset = offset + db.CurrentTransitionState.CurrentPreimageOffset = offset } func (db *cachingDB) SetCurrentSlotHash(hash common.Hash) { - db.CurrentSlotHash = hash + db.CurrentTransitionState.CurrentSlotHash = hash } func (db *cachingDB) GetCurrentSlotHash() common.Hash { - return db.CurrentSlotHash + return db.CurrentTransitionState.CurrentSlotHash } func (db *cachingDB) SetStorageProcessed(processed bool) { - db.StorageProcessed = processed + db.CurrentTransitionState.StorageProcessed = processed } func (db *cachingDB) GetStorageProcessed() bool { - return db.StorageProcessed + return db.CurrentTransitionState.StorageProcessed } func (db *cachingDB) AddRootTranslation(originalRoot, translatedRoot common.Hash) { } -func (db *cachingDB) SetLastMerkleRoot(root common.Hash) { - db.LastMerkleRoot = root +func (db *cachingDB) SetLastMerkleRoot(merkleRoot common.Hash) { + db.LastMerkleRoot = merkleRoot +} + +func (db *cachingDB) SaveTransitionState(root common.Hash) { + db.transitionStateLock.Lock() + defer db.transitionStateLock.Unlock() + if db.CurrentTransitionState != nil { + var buf bytes.Buffer + enc := gob.NewEncoder(&buf) + err := enc.Encode(db.CurrentTransitionState) + if err != nil { + log.Error("failed to encode transition state", "err", err) + return + } + + if !db.TransitionStatePerRoot.Contains(root) { + // Copy so that the address pointer isn't updated after + // it has been saved. + db.TransitionStatePerRoot.Add(root, db.CurrentTransitionState.Copy()) + + rawdb.WriteVerkleTransitionState(db.DiskDB(), root, buf.Bytes()) + } + + log.Debug("saving transition state", "storage processed", db.CurrentTransitionState.StorageProcessed, "addr", db.CurrentTransitionState.CurrentAccountAddress, "slot hash", db.CurrentTransitionState.CurrentSlotHash, "root", root, "ended", db.CurrentTransitionState.Ended, "started", db.CurrentTransitionState.Started) + } +} + +func (db *cachingDB) LoadTransitionState(root common.Hash) { + db.transitionStateLock.Lock() + defer db.transitionStateLock.Unlock() + // Try to get the transition state from the cache and + // the DB if it's not there. + ts, ok := db.TransitionStatePerRoot.Get(root) + if !ok { + // Not in the cache, try getting it from the DB + data, err := rawdb.ReadVerkleTransitionState(db.DiskDB(), root) + if err != nil { + log.Error("failed to read transition state", "err", err) + return + } + + // if a state could be read from the db, attempt to decode it + if len(data) > 0 { + var ( + newts TransitionState + buf = bytes.NewBuffer(data[:]) + dec = gob.NewDecoder(buf) + ) + // Decode transition state + err = dec.Decode(&newts) + if err != nil { + log.Error("failed to decode transition state", "err", err) + return + } + ts = &newts + } + + // Fallback that should only happen before the transition + if ts == nil { + // Initialize the first transition state, with the "ended" + // field set to true if the database was created + // as a verkle database. + log.Debug("no transition state found, starting fresh", "is verkle", db.triedb.IsVerkle()) + // Start with a fresh state + ts = &TransitionState{Ended: db.triedb.IsVerkle()} + } + } + + // Copy so that the CurrentAddress pointer in the map + // doesn't get overwritten. + db.CurrentTransitionState = ts.Copy() + + log.Debug("loaded transition state", "storage processed", db.CurrentTransitionState.StorageProcessed, "addr", db.CurrentTransitionState.CurrentAccountAddress, "slot hash", db.CurrentTransitionState.CurrentSlotHash, "root", root, "ended", db.CurrentTransitionState.Ended, "started", db.CurrentTransitionState.Started) + debug.PrintStack() +} + +func (db *cachingDB) LockCurrentTransitionState() { + db.transitionStateLock.Lock() +} + +func (db *cachingDB) UnLockCurrentTransitionState() { + db.transitionStateLock.Unlock() } diff --git a/core/state/statedb.go b/core/state/statedb.go index 1b47746458b5..6ce3b9b2b9b2 100644 --- a/core/state/statedb.go +++ b/core/state/statedb.go @@ -176,10 +176,11 @@ func New(root common.Hash, db Database, snaps *snapshot.Tree) (*StateDB, error) if tr.IsVerkle() { sdb.witness = sdb.NewAccessWitness() } - // if sdb.snaps != nil { - // if sdb.snap = sdb.snaps.Snapshot(root); sdb.snap == nil { - // } - // } + if sdb.snaps != nil { + // if sdb.snap = sdb.snaps.Snapshot(root); sdb.snap == nil { + // } + sdb.snap = sdb.snaps.Snapshot(root) + } return sdb, nil } @@ -1317,7 +1318,7 @@ func (s *StateDB) Commit(block uint64, deleteEmptyObjects bool) (common.Hash, er // - head layer is paired with HEAD state // - head-1 layer is paired with HEAD-1 state // - head-127 layer(bottom-most diff layer) is paired with HEAD-127 state - if err := s.snaps.Cap(root, 128); err != nil { + if err := s.snaps.Cap(root, 8192); err != nil { log.Warn("Failed to cap snapshot tree", "root", root, "layers", 128, "err", err) } } diff --git a/core/state/trie_prefetcher.go b/core/state/trie_prefetcher.go index 6c5c158cc239..4521736c7beb 100644 --- a/core/state/trie_prefetcher.go +++ b/core/state/trie_prefetcher.go @@ -302,7 +302,7 @@ func (sf *subfetcher) loop() { } sf.trie = trie } else { - trie, err := sf.db.OpenStorageTrie(sf.state, sf.addr, sf.root, nil /* safe to set to nil for now, as there is no prefetcher for verkle */) + trie, err := sf.db.OpenStorageTrie(sf.state, sf.addr, sf.root, sf.trie) if err != nil { log.Warn("Trie prefetcher failed opening trie", "root", sf.root, "err", err) return diff --git a/core/state_processor.go b/core/state_processor.go index 6961a873602e..32a989ed9330 100644 --- a/core/state_processor.go +++ b/core/state_processor.go @@ -21,9 +21,6 @@ import ( "errors" "fmt" "math/big" - "runtime" - "sync" - "time" "github.com/ethereum/go-ethereum/common" "github.com/ethereum/go-ethereum/consensus" @@ -34,11 +31,7 @@ import ( "github.com/ethereum/go-ethereum/crypto" "github.com/ethereum/go-ethereum/log" "github.com/ethereum/go-ethereum/params" - "github.com/ethereum/go-ethereum/trie" "github.com/ethereum/go-ethereum/trie/utils" - tutils "github.com/ethereum/go-ethereum/trie/utils" - "github.com/ethereum/go-verkle" - "github.com/holiman/uint256" ) // StateProcessor is a basic Processor, which takes care of transitioning @@ -114,11 +107,6 @@ func (p *StateProcessor) Process(block *types.Block, statedb *state.StateDB, cfg return nil, nil, 0, errors.New("withdrawals before shanghai") } - // Perform the overlay transition, if relevant - if err := OverlayVerkleTransition(statedb); err != nil { - return nil, nil, 0, fmt.Errorf("error performing verkle overlay transition: %w", err) - } - // Finalize the block, applying any consensus engine specific extras (e.g. block rewards) p.engine.Finalize(p.bc, header, statedb, block.Transactions(), block.Uncles(), withdrawals) @@ -193,182 +181,6 @@ func ApplyTransaction(config *params.ChainConfig, bc ChainContext, author *commo return applyTransaction(msg, config, gp, statedb, header.Number, header.Hash(), tx, usedGas, vmenv) } -var zeroTreeIndex uint256.Int - -// keyValueMigrator is a helper module that collects key-values from the overlay-tree migration for Verkle Trees. -// It assumes that the walk of the base tree is done in address-order, so it exploit that fact to -// collect the key-values in a way that is efficient. -type keyValueMigrator struct { - // leafData contains the values for the future leaf for a particular VKT branch. - leafData []migratedKeyValue - - // When prepare() is called, it will start a background routine that will process the leafData - // saving the result in newLeaves to be used by migrateCollectedKeyValues(). The background - // routine signals that it is done by closing processingReady. - processingReady chan struct{} - newLeaves []verkle.LeafNode - prepareErr error -} - -func newKeyValueMigrator() *keyValueMigrator { - // We do initialize the VKT config since prepare() might indirectly make multiple GetConfig() calls - // in different goroutines when we never called GetConfig() before, causing a race considering the way - // that `config` is designed in go-verkle. - // TODO: jsign as a fix for this in the PR where we move to a file-less precomp, since it allows safe - // concurrent calls to GetConfig(). When that gets merged, we can remove this line. - _ = verkle.GetConfig() - return &keyValueMigrator{ - processingReady: make(chan struct{}), - leafData: make([]migratedKeyValue, 0, 10_000), - } -} - -type migratedKeyValue struct { - branchKey branchKey - leafNodeData verkle.BatchNewLeafNodeData -} -type branchKey struct { - addr common.Address - treeIndex uint256.Int -} - -func newBranchKey(addr []byte, treeIndex *uint256.Int) branchKey { - var sk branchKey - copy(sk.addr[:], addr) - sk.treeIndex = *treeIndex - return sk -} - -func (kvm *keyValueMigrator) addStorageSlot(addr []byte, slotNumber []byte, slotValue []byte) { - treeIndex, subIndex := tutils.GetTreeKeyStorageSlotTreeIndexes(slotNumber) - leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, treeIndex)) - leafNodeData.Values[subIndex] = slotValue -} - -func (kvm *keyValueMigrator) addAccount(addr []byte, acc *types.StateAccount) { - leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, &zeroTreeIndex)) - - var version [verkle.LeafValueSize]byte - leafNodeData.Values[tutils.VersionLeafKey] = version[:] - - var balance [verkle.LeafValueSize]byte - for i, b := range acc.Balance.Bytes() { - balance[len(acc.Balance.Bytes())-1-i] = b - } - leafNodeData.Values[tutils.BalanceLeafKey] = balance[:] - - var nonce [verkle.LeafValueSize]byte - binary.LittleEndian.PutUint64(nonce[:8], acc.Nonce) - leafNodeData.Values[tutils.NonceLeafKey] = nonce[:] - - leafNodeData.Values[tutils.CodeKeccakLeafKey] = acc.CodeHash[:] -} - -func (kvm *keyValueMigrator) addAccountCode(addr []byte, codeSize uint64, chunks []byte) { - leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, &zeroTreeIndex)) - - // Save the code size. - var codeSizeBytes [verkle.LeafValueSize]byte - binary.LittleEndian.PutUint64(codeSizeBytes[:8], codeSize) - leafNodeData.Values[tutils.CodeSizeLeafKey] = codeSizeBytes[:] - - // The first 128 chunks are stored in the account header leaf. - for i := 0; i < 128 && i < len(chunks)/32; i++ { - leafNodeData.Values[byte(128+i)] = chunks[32*i : 32*(i+1)] - } - - // Potential further chunks, have their own leaf nodes. - for i := 128; i < len(chunks)/32; { - treeIndex, _ := tutils.GetTreeKeyCodeChunkIndices(uint256.NewInt(uint64(i))) - leafNodeData := kvm.getOrInitLeafNodeData(newBranchKey(addr, treeIndex)) - - j := i - for ; (j-i) < 256 && j < len(chunks)/32; j++ { - leafNodeData.Values[byte((j-128)%256)] = chunks[32*j : 32*(j+1)] - } - i = j - } -} - -func (kvm *keyValueMigrator) getOrInitLeafNodeData(bk branchKey) *verkle.BatchNewLeafNodeData { - // Remember that keyValueMigration receives actions ordered by (address, subtreeIndex). - // This means that we can assume that the last element of leafData is the one that we - // are looking for, or that we need to create a new one. - if len(kvm.leafData) == 0 || kvm.leafData[len(kvm.leafData)-1].branchKey != bk { - kvm.leafData = append(kvm.leafData, migratedKeyValue{ - branchKey: bk, - leafNodeData: verkle.BatchNewLeafNodeData{ - Stem: nil, // It will be calculated in the prepare() phase, since it's CPU heavy. - Values: make(map[byte][]byte), - }, - }) - } - return &kvm.leafData[len(kvm.leafData)-1].leafNodeData -} - -func (kvm *keyValueMigrator) prepare() { - // We fire a background routine to process the leafData and save the result in newLeaves. - // The background routine signals that it is done by closing processingReady. - go func() { - // Step 1: We split kvm.leafData in numBatches batches, and we process each batch in a separate goroutine. - // This fills each leafNodeData.Stem with the correct value. - var wg sync.WaitGroup - batchNum := runtime.NumCPU() - batchSize := (len(kvm.leafData) + batchNum - 1) / batchNum - for i := 0; i < len(kvm.leafData); i += batchSize { - start := i - end := i + batchSize - if end > len(kvm.leafData) { - end = len(kvm.leafData) - } - wg.Add(1) - - batch := kvm.leafData[start:end] - go func() { - defer wg.Done() - var currAddr common.Address - var currPoint *verkle.Point - for i := range batch { - if batch[i].branchKey.addr != currAddr { - currAddr = batch[i].branchKey.addr - currPoint = tutils.EvaluateAddressPoint(currAddr[:]) - } - stem := tutils.GetTreeKeyWithEvaluatedAddess(currPoint, &batch[i].branchKey.treeIndex, 0) - stem = stem[:verkle.StemSize] - batch[i].leafNodeData.Stem = stem - } - }() - } - wg.Wait() - - // Step 2: Now that we have all stems (i.e: tree keys) calculated, we can create the new leaves. - nodeValues := make([]verkle.BatchNewLeafNodeData, len(kvm.leafData)) - for i := range kvm.leafData { - nodeValues[i] = kvm.leafData[i].leafNodeData - } - - // Create all leaves in batch mode so we can optimize cryptography operations. - kvm.newLeaves, kvm.prepareErr = verkle.BatchNewLeafNode(nodeValues) - close(kvm.processingReady) - }() -} - -func (kvm *keyValueMigrator) migrateCollectedKeyValues(tree *trie.VerkleTrie) error { - now := time.Now() - <-kvm.processingReady - if kvm.prepareErr != nil { - return fmt.Errorf("failed to prepare key values: %w", kvm.prepareErr) - } - log.Info("Prepared key values from base tree", "duration", time.Since(now)) - - // Insert into the tree. - if err := tree.InsertMigratedLeaves(kvm.newLeaves); err != nil { - return fmt.Errorf("failed to insert migrated leaves: %w", err) - } - - return nil -} - func InsertBlockHashHistoryAtEip2935Fork(statedb *state.StateDB, prevNumber uint64, prevHash common.Hash, chain consensus.ChainHeaderReader) { ancestor := chain.GetHeader(prevHash, prevNumber) for i := prevNumber; i > 0 && i >= prevNumber-params.Eip2935BlockHashHistorySize; i-- { diff --git a/core/state_transition.go b/core/state_transition.go index 969e7a75fb9b..5b89b89c4f29 100644 --- a/core/state_transition.go +++ b/core/state_transition.go @@ -508,6 +508,10 @@ func (st *StateTransition) refundGas(refundQuotient uint64) { remaining := new(big.Int).Mul(new(big.Int).SetUint64(st.gasRemaining), st.msg.GasPrice) st.state.AddBalance(st.msg.From, remaining) + if st.gp.Gas() > math.MaxUint64-st.gasRemaining { + fmt.Println(st.gp.Gas(), refund, refundQuotient, st.gasUsed(), st.initialGas, st.gasUsed(), st.evm.Accesses, st.msg) + } + // Also return remaining gas to the block gas counter so it is // available for the next transaction. st.gp.AddGas(st.gasRemaining) diff --git a/eth/api_debug.go b/eth/api_debug.go index 9cfa9103fb58..3e0daac1b5b0 100644 --- a/eth/api_debug.go +++ b/eth/api_debug.go @@ -17,7 +17,9 @@ package eth import ( + "bytes" "context" + "encoding/gob" "errors" "fmt" "time" @@ -432,3 +434,41 @@ func (api *DebugAPI) SetTrieFlushInterval(interval string) error { func (api *DebugAPI) GetTrieFlushInterval() string { return api.eth.blockchain.GetTrieFlushInterval().String() } + +type ConversionStatusResult struct { + Started bool `json:"started"` + Ended bool `json:"ended"` +} + +func (api *DebugAPI) ConversionStatus(ctx context.Context, blockNrOrHash rpc.BlockNumberOrHash) (*ConversionStatusResult, error) { + block, err := api.eth.APIBackend.BlockByNumberOrHash(ctx, blockNrOrHash) + if err != nil { + return nil, err + } + data, err := rawdb.ReadVerkleTransitionState(api.eth.ChainDb(), block.Root()) + if err != nil { + if err.Error() == "pebble: not found" { + return &ConversionStatusResult{}, nil + } + return nil, err + } + log.Info("found entry", "data", data) + if len(data) == 0 { + log.Info("found no data") + // started and ended will be false as no conversion has started + return &ConversionStatusResult{}, nil + } + + var ( + ts state.TransitionState + buf = bytes.NewBuffer(data[:]) + dec = gob.NewDecoder(buf) + ) + // Decode transition state + err = dec.Decode(&ts) + if err != nil { + return nil, fmt.Errorf("failed to decode transition state, err=%v", err) + } + + return &ConversionStatusResult{Started: ts.Started, Ended: ts.Ended}, nil +} diff --git a/eth/backend.go b/eth/backend.go index a6c80159077d..c47bc6b5bb35 100644 --- a/eth/backend.go +++ b/eth/backend.go @@ -201,6 +201,12 @@ func New(stack *node.Node, config *ethconfig.Config) (*Ethereum, error) { if config.OverridePrague != nil { overrides.OverridePrague = config.OverridePrague } + if config.OverrideProofInBlock != nil { + overrides.OverrideProofInBlock = config.OverrideProofInBlock + } + if config.OverrideOverlayStride != nil { + overrides.OverrideOverlayStride = config.OverrideOverlayStride + } eth.blockchain, err = core.NewBlockChain(chainDb, cacheConfig, config.Genesis, &overrides, eth.engine, vmConfig, eth.shouldPreserve, &config.TxLookupLimit) if err != nil { return nil, err diff --git a/eth/catalyst/api.go b/eth/catalyst/api.go index 63079415fc14..925494a74d5f 100644 --- a/eth/catalyst/api.go +++ b/eth/catalyst/api.go @@ -532,13 +532,9 @@ func (api *ConsensusAPI) newPayload(params engine.ExecutableData, versionedHashe if api.eth.BlockChain().Config().IsPrague(block.Number(), block.Time()) && !api.eth.BlockChain().Config().IsPrague(parent.Number(), parent.Time()) { parent := api.eth.BlockChain().GetHeaderByNumber(block.NumberU64() - 1) if !api.eth.BlockChain().Config().IsPrague(parent.Number, parent.Time) { - api.eth.BlockChain().StartVerkleTransition(parent.Root, common.Hash{}, api.eth.BlockChain().Config(), nil) + api.eth.BlockChain().StartVerkleTransition(parent.Root, common.Hash{}, api.eth.BlockChain().Config(), nil, parent.Root) } } - // Reset db merge state in case of a reorg - if !api.eth.BlockChain().Config().IsPrague(block.Number(), block.Time()) { - api.eth.BlockChain().ReorgThroughVerkleTransition() - } // Another cornercase: if the node is in snap sync mode, but the CL client // tries to make it import a block. That should be denied as pushing something // into the database directly will conflict with the assumptions of snap sync diff --git a/eth/ethconfig/config.go b/eth/ethconfig/config.go index 4606b60408dd..fc9550147bcc 100644 --- a/eth/ethconfig/config.go +++ b/eth/ethconfig/config.go @@ -158,6 +158,12 @@ type Config struct { // OverrideVerkle (TODO: remove after the fork) OverridePrague *uint64 `toml:",omitempty"` + + // OverrideProofInBlock + OverrideProofInBlock *bool `toml:",omitempty"` + + // OverrideOverlayStride + OverrideOverlayStride *uint64 `toml:",omitempty"` } // CreateConsensusEngine creates a consensus engine for the given chain config. diff --git a/light/trie.go b/light/trie.go index 53d54615d909..7e7c03bc16c1 100644 --- a/light/trie.go +++ b/light/trie.go @@ -101,7 +101,7 @@ func (db *odrDatabase) DiskDB() ethdb.KeyValueStore { panic("not implemented") } -func (db *odrDatabase) StartVerkleTransition(originalRoot common.Hash, translatedRoot common.Hash, chainConfig *params.ChainConfig, _ *uint64) { +func (db *odrDatabase) StartVerkleTransition(originalRoot common.Hash, translatedRoot common.Hash, chainConfig *params.ChainConfig, _ *uint64, _ common.Hash) { panic("not implemented") // TODO: Implement } @@ -121,7 +121,11 @@ func (db *odrDatabase) Transitioned() bool { panic("not implemented") // TODO: Implement } -func (db *odrDatabase) SetCurrentSlotHash(hash common.Hash) { +func (db *odrDatabase) InitTransitionStatus(bool, bool) { + panic("not implemented") // TODO: Implement +} + +func (db *odrDatabase) SetCurrentSlotHash(common.Hash) { panic("not implemented") // TODO: Implement } @@ -129,7 +133,7 @@ func (db *odrDatabase) GetCurrentAccountAddress() *common.Address { panic("not implemented") // TODO: Implement } -func (db *odrDatabase) SetCurrentAccountAddress(_ common.Address) { +func (db *odrDatabase) SetCurrentAccountAddress(common.Address) { panic("not implemented") // TODO: Implement } @@ -141,7 +145,7 @@ func (db *odrDatabase) GetCurrentSlotHash() common.Hash { panic("not implemented") // TODO: Implement } -func (db *odrDatabase) SetStorageProcessed(_ bool) { +func (db *odrDatabase) SetStorageProcessed(bool) { panic("not implemented") // TODO: Implement } @@ -153,15 +157,30 @@ func (db *odrDatabase) GetCurrentPreimageOffset() int64 { panic("not implemented") // TODO: Implement } -func (db *odrDatabase) SetCurrentPreimageOffset(_ int64) { +func (db *odrDatabase) SetCurrentPreimageOffset(int64) { + panic("not implemented") // TODO: Implement +} + +func (db *odrDatabase) AddRootTranslation(common.Hash, common.Hash) { + panic("not implemented") // TODO: Implement +} + +func (db *odrDatabase) SetLastMerkleRoot(common.Hash) { panic("not implemented") // TODO: Implement } -func (db *odrDatabase) AddRootTranslation(originalRoot common.Hash, translatedRoot common.Hash) { +func (db *odrDatabase) SaveTransitionState(common.Hash) { panic("not implemented") // TODO: Implement } -func (db *odrDatabase) SetLastMerkleRoot(root common.Hash) { +func (db *odrDatabase) LoadTransitionState(common.Hash) { + panic("not implemented") // TODO: Implement +} + +func (db *odrDatabase) LockCurrentTransitionState() { + panic("not implemented") // TODO: Implement +} +func (db *odrDatabase) UnLockCurrentTransitionState() { panic("not implemented") // TODO: Implement } diff --git a/miner/worker.go b/miner/worker.go index aae4fe8b6454..3fb4a3fa43e5 100644 --- a/miner/worker.go +++ b/miner/worker.go @@ -852,7 +852,7 @@ func (w *worker) prepareWork(genParams *generateParams) (*environment, error) { if genParams.parentHash != (common.Hash{}) { block := w.chain.GetBlockByHash(genParams.parentHash) if block == nil { - return nil, fmt.Errorf("missing parent") + return nil, fmt.Errorf("missing parent: %x", genParams.parentHash) } parent = block.Header() } @@ -894,7 +894,7 @@ func (w *worker) prepareWork(genParams *generateParams) (*environment, error) { if w.chain.Config().IsPrague(header.Number, header.Time) { parent := w.chain.GetHeaderByNumber(header.Number.Uint64() - 1) if !w.chain.Config().IsPrague(parent.Number, parent.Time) { - w.chain.StartVerkleTransition(parent.Root, common.Hash{}, w.chain.Config(), nil) + w.chain.StartVerkleTransition(parent.Root, common.Hash{}, w.chain.Config(), w.chain.Config().PragueTime, parent.Root) } } @@ -904,9 +904,6 @@ func (w *worker) prepareWork(genParams *generateParams) (*environment, error) { if err != nil { return nil, err } - if w.chain.Config().IsPrague(header.Number, header.Time) { - core.OverlayVerkleTransition(state) - } // Run the consensus preparation with the default or customized consensus engine. if err := w.engine.Prepare(w.chain, header); err != nil { log.Error("Failed to prepare header for sealing", "err", err) diff --git a/params/config.go b/params/config.go index 19e633a71def..a2df06893a22 100644 --- a/params/config.go +++ b/params/config.go @@ -301,7 +301,8 @@ type ChainConfig struct { IsDevMode bool `json:"isDev,omitempty"` // Proof in block - ProofInBlocks bool `json:"proofInBlocks,omitempty"` + ProofInBlocks bool `json:"proofInBlocks,omitempty"` + OverlayStride uint64 `json:"overlayStride,omitempty"` } // EthashConfig is the consensus engine configs for proof-of-work based sealing. diff --git a/trie/transition.go b/trie/transition.go index 24daf436ed8a..0fe197336524 100644 --- a/trie/transition.go +++ b/trie/transition.go @@ -17,6 +17,8 @@ package trie import ( + "fmt" + "github.com/ethereum/go-ethereum/common" "github.com/ethereum/go-ethereum/core/types" "github.com/ethereum/go-ethereum/ethdb" @@ -62,7 +64,11 @@ func (t *TransitionTrie) GetKey(key []byte) []byte { // not be modified by the caller. If a node was not found in the database, a // trie.MissingNodeError is returned. func (t *TransitionTrie) GetStorage(addr common.Address, key []byte) ([]byte, error) { - if val, err := t.overlay.GetStorage(addr, key); len(val) != 0 || err != nil { + val, err := t.overlay.GetStorage(addr, key) + if err != nil { + return nil, fmt.Errorf("get storage from overlay: %s", err) + } + if len(val) != 0 { return val, nil } // TODO also insert value into overlay