From 2ed629380e6ea6a3b9e150e4ad0dfe2949bc6d50 Mon Sep 17 00:00:00 2001 From: Quentin Gliech Date: Thu, 20 Jun 2024 16:00:50 +0200 Subject: [PATCH 1/6] Generate React components for each SVG icon --- build.ts | 5 +- package.json | 37 +- src/utils/generateIconTokens.ts | 141 +++++++- yarn.lock | 574 +++++++++++++++++++++++++++++++- 4 files changed, 734 insertions(+), 23 deletions(-) diff --git a/build.ts b/build.ts index 281a7ae0..07ed9696 100644 --- a/build.ts +++ b/build.ts @@ -16,10 +16,8 @@ limitations under the License. import type { Platform, Theme } from "./src/@types/index"; import * as setupStyleDictionary from "./src/setupStyleDictionary"; -import generateIconTokens from "./src/utils/generateIconTokens"; - -import fs from "fs-extra"; import { generateCssIndex } from "./src/utils/generateCssIndex"; +import generateIconTokens from "./src/utils/generateIconTokens"; const themes: Theme[] = ["light", "light-hc", "dark", "dark-hc"]; const platforms: Platform[] = ["web", "android", "ios"]; @@ -35,5 +33,4 @@ const platforms: Platform[] = ["web", "android", "ios"]; const sb = await setupStyleDictionary.common(platform); sb.buildAllPlatforms(); } - fs.copySync("icons", "assets/web/icons", { overwrite: true }); })(); diff --git a/package.json b/package.json index 6a5e12cb..2b9e1d73 100644 --- a/package.json +++ b/package.json @@ -14,6 +14,22 @@ "files": ["./assets/web/**/*", "./icons/**/*"], "main": "assets/web/js/index.js", "type": "module", + "exports": { + "./*": "./*", + "./assets/web/js": "./assets/web/js/index.js", + "./assets/web/js/*": { + "import": "./assets/web/js/*.js", + "types": "./assets/web/js/*.d.ts" + }, + "./assets/web/icons": { + "import": "./assets/web/icons/index.js", + "types": "./assets/web/icons/index.d.ts" + }, + "./assets/web/icons/*": { + "import": "./assets/web/icons/*.js", + "types": "./assets/web/icons/*.d.ts" + } + }, "author": "", "license": "Apache-2.0", "homepage": "https://github.com/vector-im/compound-design-tokens", @@ -26,7 +42,14 @@ }, "devDependencies": { "@biomejs/biome": "^1.8.3", + "@babel/core": "^7.24.7", + "@babel/generator": "^7.24.7", + "@babel/plugin-transform-react-jsx": "^7.24.7", + "@babel/types": "^7.24.7", + "@svgr/core": "^8.1.0", + "@svgr/plugin-jsx": "^8.1.0", "@tokens-studio/sd-transforms": "^0.12.2", + "@types/babel__core": "^7.20.5", "@types/fs-extra": "^11.0.4", "@types/lodash-es": "^4.17.12", "@types/node": "^20.14.6", @@ -38,5 +61,17 @@ "tsx": "^4.15.6", "typescript": "^5.4.5" }, - "dependencies": {} + "dependencies": {}, + "peerDependencies": { + "@types/react": "*", + "react": "^17 || ^18" + }, + "peerDependenciesMeta": { + "react": { + "optional": true + }, + "@types/react": { + "optional": true + } + } } diff --git a/src/utils/generateIconTokens.ts b/src/utils/generateIconTokens.ts index c9bf0c5a..74d49724 100644 --- a/src/utils/generateIconTokens.ts +++ b/src/utils/generateIconTokens.ts @@ -18,6 +18,14 @@ import fs from "node:fs/promises"; import path from "node:path"; import { fileURLToPath } from "node:url"; +import type { TransformOptions as BabelOptions } from "@babel/core"; +import generate from "@babel/generator"; +import babelTransformReactJsx from "@babel/plugin-transform-react-jsx"; +import t from "@babel/types"; +import { type ConfigPlugin, transform as svgrTransform } from "@svgr/core"; +import svgrPluginJsx from "@svgr/plugin-jsx"; +import { camelCase, startCase } from "lodash-es"; + /** * Generates `icons/$icons.json` off all the SVG icons discovered in the * `icons/` folder @@ -25,32 +33,133 @@ import { fileURLToPath } from "node:url"; export default async function generateIconTokens(): Promise { const outputFileName = "$icons.json"; const folder = "icons/"; - const iconsFolder = path.join( - fileURLToPath(new URL("../../", import.meta.url)), - folder, + const iconsFolder = fileURLToPath(new URL("../../icons/", import.meta.url)); + const webOutput = fileURLToPath( + new URL("../../assets/web/icons/", import.meta.url), ); const files = await fs.readdir(iconsFolder); const icons = files.filter((asset) => asset.endsWith(".svg")); - const iconsManifest = Object.fromEntries( - icons.map((file) => { - const assetPath = path.join(iconsFolder, file); - const parsedPath = path.parse(assetPath); - return [ - parsedPath.name, - { - value: `${folder}${parsedPath.name}.svg`, - type: "icon", + const manifest: Record = {}; + + // List of statements to be added to the assets/web/icons/index.js file + const statements = []; + + for (const icon of icons) { + const assetPath = path.join(iconsFolder, icon); + const parsedPath = path.parse(assetPath); + const svg = await fs.readFile(assetPath, "utf-8"); + + manifest[parsedPath.name] = { + value: `${folder}${parsedPath.base}`, + type: "icon", + }; + + // Compute the component name + // mic-on.svg -> MicOnIcon + const componentName = `${startCase(camelCase(parsedPath.name)).replace(/\s/g, "")}Icon`; + + // This generates a React component for the icon + const result = await svgrTransform( + svg, + { + plugins: [svgrPluginJsx as unknown as ConfigPlugin], + icon: true, + jsxRuntime: "automatic", + jsx: { + babelConfig: { + plugins: [ + { + // For some reason, svgr emits ESM code but without specifying the sourceType, it is treated as CommonJS + // This patches the sourceType so that the JSX transform also emits ESM code + visitor: { + Program(program) { + program.node.sourceType = "module"; + }, + }, + }, + [babelTransformReactJsx, { runtime: "automatic" }], + ], + } satisfies BabelOptions, }, - ]; - }), - ); + // Custom template which uses a function instead of an arrow function and sets the component displayName + template(variables, { tpl }) { + return tpl` + ${variables.imports}; + + function ${variables.componentName}(${variables.props}) { + return ( + ${variables.jsx} + ); + }; + ${variables.componentName}.displayName = '${variables.componentName}' + + ${variables.exports}; + `; + }, + }, + { + componentName, + }, + ); + + // Write the react component to the web output folder + await fs.writeFile( + path.join(webOutput, `${parsedPath.name}.js`), + result, + "utf-8", + ); + + // Generate a .d.ts (typescript declaration) file for the icon + const dTs = `import * as React from "react"; + +/** + * ${parsedPath.base} + */ +declare const ${componentName}: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ${componentName}; +`; + + await fs.writeFile( + path.join(webOutput, `${parsedPath.name}.d.ts`), + dTs, + "utf-8", + ); + + // Add the import statement to the list of statements for the index.js + // import { default as SomeIcon } from "./some-icon.js"; + statements.push( + t.exportNamedDeclaration( + null, + [ + t.exportSpecifier( + t.identifier("default"), + t.identifier(componentName), + ), + ], + t.stringLiteral(`./${parsedPath.name}.js`), + ), + ); + } + + // Generate the index.js file + const program = t.program(statements, [], "module"); + const result = generate.default(program).code; + + await fs.writeFile(path.join(webOutput, "index.js"), result, "utf-8"); + // The index.d.ts is identical to the index as it only re-exports the icons + await fs.writeFile(path.join(webOutput, "index.d.ts"), result, "utf-8"); + + // Write the icons manifest to the icons folder await fs.writeFile( path.join(iconsFolder, outputFileName), - JSON.stringify({ icon: iconsManifest }), + JSON.stringify({ icon: manifest }), "utf-8", ); } diff --git a/yarn.lock b/yarn.lock index 72279b25..bcc0536d 100644 --- a/yarn.lock +++ b/yarn.lock @@ -2,6 +2,227 @@ # yarn lockfile v1 +"@ampproject/remapping@^2.2.0": + version "2.3.0" + resolved "https://registry.yarnpkg.com/@ampproject/remapping/-/remapping-2.3.0.tgz#ed441b6fa600072520ce18b43d2c8cc8caecc7f4" + integrity sha512-30iZtAPgz+LTIYoeivqYo853f02jBYSd5uGnGpkFV0M3xOt9aN73erkgYAmZU43x4VfqcnLxW9Kpg3R5LC4YYw== + dependencies: + "@jridgewell/gen-mapping" "^0.3.5" + "@jridgewell/trace-mapping" "^0.3.24" + +"@babel/code-frame@^7.0.0", "@babel/code-frame@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.24.7.tgz#882fd9e09e8ee324e496bd040401c6f046ef4465" + integrity sha512-BcYH1CVJBO9tvyIZ2jVeXgSIMvGZ2FDRvDdOIVQyuklNKSsx+eppDEBq/g47Ayw+RqNFE+URvOShmf+f/qwAlA== + dependencies: + "@babel/highlight" "^7.24.7" + picocolors "^1.0.0" + +"@babel/compat-data@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/compat-data/-/compat-data-7.24.7.tgz#d23bbea508c3883ba8251fb4164982c36ea577ed" + integrity sha512-qJzAIcv03PyaWqxRgO4mSU3lihncDT296vnyuE2O8uA4w3UHWI4S3hgeZd1L8W1Bft40w9JxJ2b412iDUFFRhw== + +"@babel/core@^7.21.3", "@babel/core@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/core/-/core-7.24.7.tgz#b676450141e0b52a3d43bc91da86aa608f950ac4" + integrity sha512-nykK+LEK86ahTkX/3TgauT0ikKoNCfKHEaZYTUVupJdTLzGNvrblu4u6fa7DhZONAltdf8e662t/abY8idrd/g== + dependencies: + "@ampproject/remapping" "^2.2.0" + "@babel/code-frame" "^7.24.7" + "@babel/generator" "^7.24.7" + "@babel/helper-compilation-targets" "^7.24.7" + "@babel/helper-module-transforms" "^7.24.7" + "@babel/helpers" "^7.24.7" + "@babel/parser" "^7.24.7" + "@babel/template" "^7.24.7" + "@babel/traverse" "^7.24.7" + "@babel/types" "^7.24.7" + convert-source-map "^2.0.0" + debug "^4.1.0" + gensync "^1.0.0-beta.2" + json5 "^2.2.3" + semver "^6.3.1" + +"@babel/generator@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.24.7.tgz#1654d01de20ad66b4b4d99c135471bc654c55e6d" + integrity sha512-oipXieGC3i45Y1A41t4tAqpnEZWgB/lC6Ehh6+rOviR5XWpTtMmLN+fGjz9vOiNRt0p6RtO6DtD0pdU3vpqdSA== + dependencies: + "@babel/types" "^7.24.7" + "@jridgewell/gen-mapping" "^0.3.5" + "@jridgewell/trace-mapping" "^0.3.25" + jsesc "^2.5.1" + +"@babel/helper-annotate-as-pure@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.24.7.tgz#5373c7bc8366b12a033b4be1ac13a206c6656aab" + integrity sha512-BaDeOonYvhdKw+JoMVkAixAAJzG2jVPIwWoKBPdYuY9b452e2rPuI9QPYh3KpofZ3pW2akOmwZLOiOsHMiqRAg== + dependencies: + "@babel/types" "^7.24.7" + +"@babel/helper-compilation-targets@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-compilation-targets/-/helper-compilation-targets-7.24.7.tgz#4eb6c4a80d6ffeac25ab8cd9a21b5dfa48d503a9" + integrity sha512-ctSdRHBi20qWOfy27RUb4Fhp07KSJ3sXcuSvTrXrc4aG8NSYDo1ici3Vhg9bg69y5bj0Mr1lh0aeEgTvc12rMg== + dependencies: + "@babel/compat-data" "^7.24.7" + "@babel/helper-validator-option" "^7.24.7" + browserslist "^4.22.2" + lru-cache "^5.1.1" + semver "^6.3.1" + +"@babel/helper-environment-visitor@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-environment-visitor/-/helper-environment-visitor-7.24.7.tgz#4b31ba9551d1f90781ba83491dd59cf9b269f7d9" + integrity sha512-DoiN84+4Gnd0ncbBOM9AZENV4a5ZiL39HYMyZJGZ/AZEykHYdJw0wW3kdcsh9/Kn+BRXHLkkklZ51ecPKmI1CQ== + dependencies: + "@babel/types" "^7.24.7" + +"@babel/helper-function-name@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-function-name/-/helper-function-name-7.24.7.tgz#75f1e1725742f39ac6584ee0b16d94513da38dd2" + integrity sha512-FyoJTsj/PEUWu1/TYRiXTIHc8lbw+TDYkZuoE43opPS5TrI7MyONBE1oNvfguEXAD9yhQRrVBnXdXzSLQl9XnA== + dependencies: + "@babel/template" "^7.24.7" + "@babel/types" "^7.24.7" + +"@babel/helper-hoist-variables@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-hoist-variables/-/helper-hoist-variables-7.24.7.tgz#b4ede1cde2fd89436397f30dc9376ee06b0f25ee" + integrity sha512-MJJwhkoGy5c4ehfoRyrJ/owKeMl19U54h27YYftT0o2teQ3FJ3nQUf/I3LlJsX4l3qlw7WRXUmiyajvHXoTubQ== + dependencies: + "@babel/types" "^7.24.7" + +"@babel/helper-module-imports@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.24.7.tgz#f2f980392de5b84c3328fc71d38bd81bbb83042b" + integrity sha512-8AyH3C+74cgCVVXow/myrynrAGv+nTVg5vKu2nZph9x7RcRwzmh0VFallJuFTZ9mx6u4eSdXZfcOzSqTUm0HCA== + dependencies: + "@babel/traverse" "^7.24.7" + "@babel/types" "^7.24.7" + +"@babel/helper-module-transforms@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.24.7.tgz#31b6c9a2930679498db65b685b1698bfd6c7daf8" + integrity sha512-1fuJEwIrp+97rM4RWdO+qrRsZlAeL1lQJoPqtCYWv0NL115XM93hIH4CSRln2w52SqvmY5hqdtauB6QFCDiZNQ== + dependencies: + "@babel/helper-environment-visitor" "^7.24.7" + "@babel/helper-module-imports" "^7.24.7" + "@babel/helper-simple-access" "^7.24.7" + "@babel/helper-split-export-declaration" "^7.24.7" + "@babel/helper-validator-identifier" "^7.24.7" + +"@babel/helper-plugin-utils@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.24.7.tgz#98c84fe6fe3d0d3ae7bfc3a5e166a46844feb2a0" + integrity sha512-Rq76wjt7yz9AAc1KnlRKNAi/dMSVWgDRx43FHoJEbcYU6xOWaE2dVPwcdTukJrjxS65GITyfbvEYHvkirZ6uEg== + +"@babel/helper-simple-access@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-simple-access/-/helper-simple-access-7.24.7.tgz#bcade8da3aec8ed16b9c4953b74e506b51b5edb3" + integrity sha512-zBAIvbCMh5Ts+b86r/CjU+4XGYIs+R1j951gxI3KmmxBMhCg4oQMsv6ZXQ64XOm/cvzfU1FmoCyt6+owc5QMYg== + dependencies: + "@babel/traverse" "^7.24.7" + "@babel/types" "^7.24.7" + +"@babel/helper-split-export-declaration@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.24.7.tgz#83949436890e07fa3d6873c61a96e3bbf692d856" + integrity sha512-oy5V7pD+UvfkEATUKvIjvIAH/xCzfsFVw7ygW2SI6NClZzquT+mwdTfgfdbUiceh6iQO0CHtCPsyze/MZ2YbAA== + dependencies: + "@babel/types" "^7.24.7" + +"@babel/helper-string-parser@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-string-parser/-/helper-string-parser-7.24.7.tgz#4d2d0f14820ede3b9807ea5fc36dfc8cd7da07f2" + integrity sha512-7MbVt6xrwFQbunH2DNQsAP5sTGxfqQtErvBIvIMi6EQnbgUOuVYanvREcmFrOPhoXBrTtjhhP+lW+o5UfK+tDg== + +"@babel/helper-validator-identifier@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.24.7.tgz#75b889cfaf9e35c2aaf42cf0d72c8e91719251db" + integrity sha512-rR+PBcQ1SMQDDyF6X0wxtG8QyLCgUB0eRAGguqRLfkCA87l7yAP7ehq8SNj96OOGTO8OBV70KhuFYcIkHXOg0w== + +"@babel/helper-validator-option@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.24.7.tgz#24c3bb77c7a425d1742eec8fb433b5a1b38e62f6" + integrity sha512-yy1/KvjhV/ZCL+SM7hBrvnZJ3ZuT9OuZgIJAGpPEToANvc3iM6iDvBnRjtElWibHU6n8/LPR/EjX9EtIEYO3pw== + +"@babel/helpers@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/helpers/-/helpers-7.24.7.tgz#aa2ccda29f62185acb5d42fb4a3a1b1082107416" + integrity sha512-NlmJJtvcw72yRJRcnCmGvSi+3jDEg8qFu3z0AFoymmzLx5ERVWyzd9kVXr7Th9/8yIJi2Zc6av4Tqz3wFs8QWg== + dependencies: + "@babel/template" "^7.24.7" + "@babel/types" "^7.24.7" + +"@babel/highlight@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/highlight/-/highlight-7.24.7.tgz#a05ab1df134b286558aae0ed41e6c5f731bf409d" + integrity sha512-EStJpq4OuY8xYfhGVXngigBJRWxftKX9ksiGDnmlY3o7B/V7KIAc9X4oiK87uPJSc/vs5L869bem5fhZa8caZw== + dependencies: + "@babel/helper-validator-identifier" "^7.24.7" + chalk "^2.4.2" + js-tokens "^4.0.0" + picocolors "^1.0.0" + +"@babel/parser@^7.1.0", "@babel/parser@^7.20.7", "@babel/parser@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.24.7.tgz#9a5226f92f0c5c8ead550b750f5608e766c8ce85" + integrity sha512-9uUYRm6OqQrCqQdG1iCBwBPZgN8ciDBro2nIOFaiRz1/BCxaI7CNvQbDHvsArAC7Tw9Hda/B3U+6ui9u4HWXPw== + +"@babel/plugin-syntax-jsx@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.24.7.tgz#39a1fa4a7e3d3d7f34e2acc6be585b718d30e02d" + integrity sha512-6ddciUPe/mpMnOKv/U+RSd2vvVy+Yw/JfBB0ZHYjEZt9NLHmCUylNYlsbqCCS1Bffjlb0fCwC9Vqz+sBz6PsiQ== + dependencies: + "@babel/helper-plugin-utils" "^7.24.7" + +"@babel/plugin-transform-react-jsx@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/plugin-transform-react-jsx/-/plugin-transform-react-jsx-7.24.7.tgz#17cd06b75a9f0e2bd076503400e7c4b99beedac4" + integrity sha512-+Dj06GDZEFRYvclU6k4bme55GKBEWUmByM/eoKuqg4zTNQHiApWRhQph5fxQB2wAEFvRzL1tOEj1RJ19wJrhoA== + dependencies: + "@babel/helper-annotate-as-pure" "^7.24.7" + "@babel/helper-module-imports" "^7.24.7" + "@babel/helper-plugin-utils" "^7.24.7" + "@babel/plugin-syntax-jsx" "^7.24.7" + "@babel/types" "^7.24.7" + +"@babel/template@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.24.7.tgz#02efcee317d0609d2c07117cb70ef8fb17ab7315" + integrity sha512-jYqfPrU9JTF0PmPy1tLYHW4Mp4KlgxJD9l2nP9fD6yT/ICi554DmrWBAEYpIelzjHf1msDP3PxJIRt/nFNfBig== + dependencies: + "@babel/code-frame" "^7.24.7" + "@babel/parser" "^7.24.7" + "@babel/types" "^7.24.7" + +"@babel/traverse@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.24.7.tgz#de2b900163fa741721ba382163fe46a936c40cf5" + integrity sha512-yb65Ed5S/QAcewNPh0nZczy9JdYXkkAbIsEo+P7BE7yO3txAY30Y/oPa3QkQ5It3xVG2kpKMg9MsdxZaO31uKA== + dependencies: + "@babel/code-frame" "^7.24.7" + "@babel/generator" "^7.24.7" + "@babel/helper-environment-visitor" "^7.24.7" + "@babel/helper-function-name" "^7.24.7" + "@babel/helper-hoist-variables" "^7.24.7" + "@babel/helper-split-export-declaration" "^7.24.7" + "@babel/parser" "^7.24.7" + "@babel/types" "^7.24.7" + debug "^4.3.1" + globals "^11.1.0" + +"@babel/types@^7.0.0", "@babel/types@^7.20.7", "@babel/types@^7.21.3", "@babel/types@^7.24.7": + version "7.24.7" + resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.24.7.tgz#6027fe12bc1aa724cd32ab113fb7f1988f1f66f2" + integrity sha512-XEFXSlxiG5td2EJRe8vOmRbaXVgfcBlszKujvVmWIK/UpywWljQCfzAv3RQCGujWQ1RD4YYWEAqDXfuJiy8f5Q== + dependencies: + "@babel/helper-string-parser" "^7.24.7" + "@babel/helper-validator-identifier" "^7.24.7" + to-fast-properties "^2.0.0" + "@biomejs/biome@^1.8.3": version "1.8.3" resolved "https://registry.yarnpkg.com/@biomejs/biome/-/biome-1.8.3.tgz#3b5eecea90d973f71618aae3e6e8be4d2ca23e42" @@ -183,6 +404,38 @@ wrap-ansi "^8.1.0" wrap-ansi-cjs "npm:wrap-ansi@^7.0.0" +"@jridgewell/gen-mapping@^0.3.5": + version "0.3.5" + resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz#dcce6aff74bdf6dad1a95802b69b04a2fcb1fb36" + integrity sha512-IzL8ZoEDIBRWEzlCcRhOaCupYyN5gdIK+Q6fbFdPDg6HqX6jpkItn7DFIpW9LQzXG6Df9sA7+OKnq0qlz/GaQg== + dependencies: + "@jridgewell/set-array" "^1.2.1" + "@jridgewell/sourcemap-codec" "^1.4.10" + "@jridgewell/trace-mapping" "^0.3.24" + +"@jridgewell/resolve-uri@^3.1.0": + version "3.1.2" + resolved "https://registry.yarnpkg.com/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz#7a0ee601f60f99a20c7c7c5ff0c80388c1189bd6" + integrity sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw== + +"@jridgewell/set-array@^1.2.1": + version "1.2.1" + resolved "https://registry.yarnpkg.com/@jridgewell/set-array/-/set-array-1.2.1.tgz#558fb6472ed16a4c850b889530e6b36438c49280" + integrity sha512-R8gLRTZeyp03ymzP/6Lil/28tGeGEzhx1q2k703KGWRAI1VdvPIXdG70VJc2pAMw3NA6JKL5hhFu1sJX0Mnn/A== + +"@jridgewell/sourcemap-codec@^1.4.10", "@jridgewell/sourcemap-codec@^1.4.14": + version "1.4.15" + resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz#d7c6e6755c78567a951e04ab52ef0fd26de59f32" + integrity sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg== + +"@jridgewell/trace-mapping@^0.3.24", "@jridgewell/trace-mapping@^0.3.25": + version "0.3.25" + resolved "https://registry.yarnpkg.com/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz#15f190e98895f3fc23276ee14bc76b675c2e50f0" + integrity sha512-vNk6aEwybGtawWmy/PzwnGDOjCkLWSD2wqvjGGAgOAwCGWySYXfYoxt00IJkTF+8Lb57DwOb3Aa0o9CApepiYQ== + dependencies: + "@jridgewell/resolve-uri" "^3.1.0" + "@jridgewell/sourcemap-codec" "^1.4.14" + "@nodelib/fs.scandir@2.1.5": version "2.1.5" resolved "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz" @@ -209,6 +462,89 @@ resolved "https://registry.yarnpkg.com/@pkgjs/parseargs/-/parseargs-0.11.0.tgz#a77ea742fab25775145434eb1d2328cf5013ac33" integrity sha512-+1VkjdD0QBLPodGrJUeqarH8VAIvQODIbwh9XpP5Syisf7YoQgsJKPNFoqqLQlu+VQ/tVSshMR6loPMn8U+dPg== +"@svgr/babel-plugin-add-jsx-attribute@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-add-jsx-attribute/-/babel-plugin-add-jsx-attribute-8.0.0.tgz#4001f5d5dd87fa13303e36ee106e3ff3a7eb8b22" + integrity sha512-b9MIk7yhdS1pMCZM8VeNfUlSKVRhsHZNMl5O9SfaX0l0t5wjdgu4IDzGB8bpnGBBOjGST3rRFVsaaEtI4W6f7g== + +"@svgr/babel-plugin-remove-jsx-attribute@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-remove-jsx-attribute/-/babel-plugin-remove-jsx-attribute-8.0.0.tgz#69177f7937233caca3a1afb051906698f2f59186" + integrity sha512-BcCkm/STipKvbCl6b7QFrMh/vx00vIP63k2eM66MfHJzPr6O2U0jYEViXkHJWqXqQYjdeA9cuCl5KWmlwjDvbA== + +"@svgr/babel-plugin-remove-jsx-empty-expression@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-remove-jsx-empty-expression/-/babel-plugin-remove-jsx-empty-expression-8.0.0.tgz#c2c48104cfd7dcd557f373b70a56e9e3bdae1d44" + integrity sha512-5BcGCBfBxB5+XSDSWnhTThfI9jcO5f0Ai2V24gZpG+wXF14BzwxxdDb4g6trdOux0rhibGs385BeFMSmxtS3uA== + +"@svgr/babel-plugin-replace-jsx-attribute-value@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-replace-jsx-attribute-value/-/babel-plugin-replace-jsx-attribute-value-8.0.0.tgz#8fbb6b2e91fa26ac5d4aa25c6b6e4f20f9c0ae27" + integrity sha512-KVQ+PtIjb1BuYT3ht8M5KbzWBhdAjjUPdlMtpuw/VjT8coTrItWX6Qafl9+ji831JaJcu6PJNKCV0bp01lBNzQ== + +"@svgr/babel-plugin-svg-dynamic-title@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-svg-dynamic-title/-/babel-plugin-svg-dynamic-title-8.0.0.tgz#1d5ba1d281363fc0f2f29a60d6d936f9bbc657b0" + integrity sha512-omNiKqwjNmOQJ2v6ge4SErBbkooV2aAWwaPFs2vUY7p7GhVkzRkJ00kILXQvRhA6miHnNpXv7MRnnSjdRjK8og== + +"@svgr/babel-plugin-svg-em-dimensions@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-svg-em-dimensions/-/babel-plugin-svg-em-dimensions-8.0.0.tgz#35e08df300ea8b1d41cb8f62309c241b0369e501" + integrity sha512-mURHYnu6Iw3UBTbhGwE/vsngtCIbHE43xCRK7kCw4t01xyGqb2Pd+WXekRRoFOBIY29ZoOhUCTEweDMdrjfi9g== + +"@svgr/babel-plugin-transform-react-native-svg@8.1.0": + version "8.1.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-transform-react-native-svg/-/babel-plugin-transform-react-native-svg-8.1.0.tgz#90a8b63998b688b284f255c6a5248abd5b28d754" + integrity sha512-Tx8T58CHo+7nwJ+EhUwx3LfdNSG9R2OKfaIXXs5soiy5HtgoAEkDay9LIimLOcG8dJQH1wPZp/cnAv6S9CrR1Q== + +"@svgr/babel-plugin-transform-svg-component@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-plugin-transform-svg-component/-/babel-plugin-transform-svg-component-8.0.0.tgz#013b4bfca88779711f0ed2739f3f7efcefcf4f7e" + integrity sha512-DFx8xa3cZXTdb/k3kfPeaixecQLgKh5NVBMwD0AQxOzcZawK4oo1Jh9LbrcACUivsCA7TLG8eeWgrDXjTMhRmw== + +"@svgr/babel-preset@8.1.0": + version "8.1.0" + resolved "https://registry.yarnpkg.com/@svgr/babel-preset/-/babel-preset-8.1.0.tgz#0e87119aecdf1c424840b9d4565b7137cabf9ece" + integrity sha512-7EYDbHE7MxHpv4sxvnVPngw5fuR6pw79SkcrILHJ/iMpuKySNCl5W1qcwPEpU+LgyRXOaAFgH0KhwD18wwg6ug== + dependencies: + "@svgr/babel-plugin-add-jsx-attribute" "8.0.0" + "@svgr/babel-plugin-remove-jsx-attribute" "8.0.0" + "@svgr/babel-plugin-remove-jsx-empty-expression" "8.0.0" + "@svgr/babel-plugin-replace-jsx-attribute-value" "8.0.0" + "@svgr/babel-plugin-svg-dynamic-title" "8.0.0" + "@svgr/babel-plugin-svg-em-dimensions" "8.0.0" + "@svgr/babel-plugin-transform-react-native-svg" "8.1.0" + "@svgr/babel-plugin-transform-svg-component" "8.0.0" + +"@svgr/core@^8.1.0": + version "8.1.0" + resolved "https://registry.yarnpkg.com/@svgr/core/-/core-8.1.0.tgz#41146f9b40b1a10beaf5cc4f361a16a3c1885e88" + integrity sha512-8QqtOQT5ACVlmsvKOJNEaWmRPmcojMOzCz4Hs2BGG/toAp/K38LcsMRyLp349glq5AzJbCEeimEoxaX6v/fLrA== + dependencies: + "@babel/core" "^7.21.3" + "@svgr/babel-preset" "8.1.0" + camelcase "^6.2.0" + cosmiconfig "^8.1.3" + snake-case "^3.0.4" + +"@svgr/hast-util-to-babel-ast@8.0.0": + version "8.0.0" + resolved "https://registry.yarnpkg.com/@svgr/hast-util-to-babel-ast/-/hast-util-to-babel-ast-8.0.0.tgz#6952fd9ce0f470e1aded293b792a2705faf4ffd4" + integrity sha512-EbDKwO9GpfWP4jN9sGdYwPBU0kdomaPIL2Eu4YwmgP+sJeXT+L7bMwJUBnhzfH8Q2qMBqZ4fJwpCyYsAN3mt2Q== + dependencies: + "@babel/types" "^7.21.3" + entities "^4.4.0" + +"@svgr/plugin-jsx@^8.1.0": + version "8.1.0" + resolved "https://registry.yarnpkg.com/@svgr/plugin-jsx/-/plugin-jsx-8.1.0.tgz#96969f04a24b58b174ee4cd974c60475acbd6928" + integrity sha512-0xiIyBsLlr8quN+WyuxooNW9RJ0Dpr8uOnH/xrCVO8GLUcwHISwj1AG0k+LFzteTkAA0GbX0kj9q6Dk70PTiPA== + dependencies: + "@babel/core" "^7.21.3" + "@svgr/babel-preset" "8.1.0" + "@svgr/hast-util-to-babel-ast" "8.0.0" + svg-parser "^2.0.4" + "@tokens-studio/sd-transforms@^0.12.2": version "0.12.2" resolved "https://registry.yarnpkg.com/@tokens-studio/sd-transforms/-/sd-transforms-0.12.2.tgz#b0512e163d2a0d46f75426b6c4f431cda6c4f9e2" @@ -233,6 +569,39 @@ resolved "https://registry.yarnpkg.com/@trysound/sax/-/sax-0.2.0.tgz#cccaab758af56761eb7bf37af6f03f326dd798ad" integrity sha512-L7z9BgrNEcYyUYtF+HaEfiS5ebkh9jXqbszz7pC0hRBPaatV0XjSD3+eHrpqFemQfgwiFF0QPIarnIihIDn7OA== +"@types/babel__core@^7.20.5": + version "7.20.5" + resolved "https://registry.yarnpkg.com/@types/babel__core/-/babel__core-7.20.5.tgz#3df15f27ba85319caa07ba08d0721889bb39c017" + integrity sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA== + dependencies: + "@babel/parser" "^7.20.7" + "@babel/types" "^7.20.7" + "@types/babel__generator" "*" + "@types/babel__template" "*" + "@types/babel__traverse" "*" + +"@types/babel__generator@*": + version "7.6.8" + resolved "https://registry.yarnpkg.com/@types/babel__generator/-/babel__generator-7.6.8.tgz#f836c61f48b1346e7d2b0d93c6dacc5b9535d3ab" + integrity sha512-ASsj+tpEDsEiFr1arWrlN6V3mdfjRMZt6LtK/Vp/kreFLnr5QH5+DhvD5nINYZXzwJvXeGq+05iUXcAzVrqWtw== + dependencies: + "@babel/types" "^7.0.0" + +"@types/babel__template@*": + version "7.4.4" + resolved "https://registry.yarnpkg.com/@types/babel__template/-/babel__template-7.4.4.tgz#5672513701c1b2199bc6dad636a9d7491586766f" + integrity sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A== + dependencies: + "@babel/parser" "^7.1.0" + "@babel/types" "^7.0.0" + +"@types/babel__traverse@*": + version "7.20.6" + resolved "https://registry.yarnpkg.com/@types/babel__traverse/-/babel__traverse-7.20.6.tgz#8dc9f0ae0f202c08d8d4dab648912c8d6038e3f7" + integrity sha512-r1bzfrm0tomOI8g1SzvCaQHo6Lcv6zu0EA+W2kHrt8dyrHQxGzBBL4kdkzIS+jBMV+EYcMAEAqXqYaLJq5rOZg== + dependencies: + "@babel/types" "^7.20.7" + "@types/fs-extra@^11.0.4": version "11.0.4" resolved "https://registry.yarnpkg.com/@types/fs-extra/-/fs-extra-11.0.4.tgz#e16a863bb8843fba8c5004362b5a73e17becca45" @@ -311,6 +680,11 @@ ansi-styles@^6.1.0: resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-6.2.1.tgz#0e62320cf99c21afff3b3012192546aacbfb05c5" integrity sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug== +argparse@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/argparse/-/argparse-2.0.1.tgz#246f50f3ca78a3240f6c997e8a9bd1eac49e4b38" + integrity sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q== + async@^2.6.4: version "2.6.4" resolved "https://registry.npmjs.org/async/-/async-2.6.4.tgz" @@ -349,6 +723,16 @@ braces@^3.0.2: dependencies: fill-range "^7.0.1" +browserslist@^4.22.2: + version "4.23.1" + resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-4.23.1.tgz#ce4af0534b3d37db5c1a4ca98b9080f985041e96" + integrity sha512-TUfofFo/KsK/bWZ9TWQ5O26tsWW4Uhmt8IYklbnUa70udB6P2wA7w7o4PY4muaEPBQaAX+CEnmmIA41NVHtPVw== + dependencies: + caniuse-lite "^1.0.30001629" + electron-to-chromium "^1.4.796" + node-releases "^2.0.14" + update-browserslist-db "^1.0.16" + call-bind@^1.0.0: version "1.0.2" resolved "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz" @@ -357,6 +741,11 @@ call-bind@^1.0.0: function-bind "^1.1.1" get-intrinsic "^1.0.2" +callsites@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73" + integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ== + camel-case@^4.1.2: version "4.1.2" resolved "https://registry.npmjs.org/camel-case/-/camel-case-4.1.2.tgz" @@ -365,6 +754,16 @@ camel-case@^4.1.2: pascal-case "^3.1.2" tslib "^2.0.3" +camelcase@^6.2.0: + version "6.3.0" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-6.3.0.tgz#5685b95eb209ac9c0c177467778c9c84df58ba9a" + integrity sha512-Gmy6FhYlCY7uOElZUSbxo2UCDH8owEk996gkbrpsgGtrJLM3J7jGxl9Ic7Qwwj4ivOE5AWZWRMecDdF7hqGjFA== + +caniuse-lite@^1.0.30001629: + version "1.0.30001636" + resolved "https://registry.yarnpkg.com/caniuse-lite/-/caniuse-lite-1.0.30001636.tgz#b15f52d2bdb95fad32c2f53c0b68032b85188a78" + integrity sha512-bMg2vmr8XBsbL6Lr0UHXy/21m84FTxDLWn2FSqMd5PrlbMxwJlQnC2YWYxVgp66PZE+BBNF2jYQUBKCo1FDeZg== + capital-case@^1.0.4: version "1.0.4" resolved "https://registry.npmjs.org/capital-case/-/capital-case-1.0.4.tgz" @@ -374,7 +773,7 @@ capital-case@^1.0.4: tslib "^2.0.3" upper-case-first "^2.0.2" -chalk@^2.4.1: +chalk@^2.4.1, chalk@^2.4.2: version "2.4.2" resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424" integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ== @@ -471,11 +870,26 @@ constant-case@^3.0.4: tslib "^2.0.3" upper-case "^2.0.2" +convert-source-map@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-2.0.0.tgz#4b560f649fc4e918dd0ab75cf4961e8bc882d82a" + integrity sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg== + corser@^2.0.1: version "2.0.1" resolved "https://registry.npmjs.org/corser/-/corser-2.0.1.tgz" integrity sha512-utCYNzRSQIZNPIcGZdQc92UVJYAhtGAteCFg0yRaFm8f0P+CPtyGyHXJcGXnffjCybUCEx3FQ2G7U3/o9eIkVQ== +cosmiconfig@^8.1.3: + version "8.3.6" + resolved "https://registry.yarnpkg.com/cosmiconfig/-/cosmiconfig-8.3.6.tgz#060a2b871d66dba6c8538ea1118ba1ac16f5fae3" + integrity sha512-kcZ6+W5QzcJ3P1Mt+83OUv/oHFqZHIx8DuxG6eZ5RGMERoLqp4BuGjhHLYGK+Kf5XVkQvqBSmAy/nGWN3qDgEA== + dependencies: + import-fresh "^3.3.0" + js-yaml "^4.1.0" + parse-json "^5.2.0" + path-type "^4.0.0" + cross-spawn@^7.0.0: version "7.0.3" resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.3.tgz#f73a85b9d5d41d045551c177e2882d4ac85728a6" @@ -523,6 +937,13 @@ debug@^3.2.7: dependencies: ms "^2.1.1" +debug@^4.1.0, debug@^4.3.1: + version "4.3.5" + resolved "https://registry.yarnpkg.com/debug/-/debug-4.3.5.tgz#e83444eceb9fedd4a1da56d671ae2446a01a6e1e" + integrity sha512-pt0bNEmneDIvdL1Xsd9oDQ/wrQRkXDT4AUWlNZNPKvW5x/jyO9VFXkJUP07vQ2upmw5PlaITaPKc31jK13V+jg== + dependencies: + ms "2.1.2" + deepmerge@^4.3.1: version "4.3.1" resolved "https://registry.yarnpkg.com/deepmerge/-/deepmerge-4.3.1.tgz#44b5f2147cd3b00d4b56137685966f26fd25dd4a" @@ -571,6 +992,11 @@ eastasianwidth@^0.2.0: resolved "https://registry.yarnpkg.com/eastasianwidth/-/eastasianwidth-0.2.0.tgz#696ce2ec0aa0e6ea93a397ffcf24aa7840c827cb" integrity sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA== +electron-to-chromium@^1.4.796: + version "1.4.807" + resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.4.807.tgz#4d6c5ea1516f0164ac5bfd487ccd4ee9507c8f01" + integrity sha512-kSmJl2ZwhNf/bcIuCH/imtNOKlpkLDn2jqT5FJ+/0CXjhnFaOa9cOe9gHKKy71eM49izwuQjZhKk+lWQ1JxB7A== + emoji-regex@^8.0.0: version "8.0.0" resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37" @@ -586,6 +1012,18 @@ entities@^2.0.0: resolved "https://registry.yarnpkg.com/entities/-/entities-2.2.0.tgz#098dc90ebb83d8dffa089d55256b351d34c4da55" integrity sha512-p92if5Nz619I0w+akJrLZH0MX0Pb5DX39XOwQTtXSdQQOaYH03S1uIQp4mhOZtAXrxq4ViO67YTiLBo2638o9A== +entities@^4.4.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/entities/-/entities-4.5.0.tgz#5d268ea5e7113ec74c4d033b79ea5a35a488fb48" + integrity sha512-V0hjH4dGPh9Ao5p0MoRY6BVqtwCjhz6vI5LT8AJ55H+4g9/4vbHx1I54fS0XuclLhDHArPQCiMjDxjaL8fPxhw== + +error-ex@^1.3.1: + version "1.3.2" + resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.2.tgz#b4ac40648107fdcdcfae242f428bea8a14d4f1bf" + integrity sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g== + dependencies: + is-arrayish "^0.2.1" + esbuild@~0.21.4: version "0.21.5" resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.21.5.tgz#9ca301b120922959b766360d8ac830da0d02997d" @@ -615,6 +1053,11 @@ esbuild@~0.21.4: "@esbuild/win32-ia32" "0.21.5" "@esbuild/win32-x64" "0.21.5" +escalade@^3.1.2: + version "3.1.2" + resolved "https://registry.yarnpkg.com/escalade/-/escalade-3.1.2.tgz#54076e9ab29ea5bf3d8f1ed62acffbb88272df27" + integrity sha512-ErCHMCae19vR8vQGe50xIsVomy19rg6gFu3+r3jkEO46suLMWBksvVyoGgQV+jOfl84ZSOSlmv6Gxa89PmTGmA== + escape-string-regexp@^1.0.5: version "1.0.5" resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4" @@ -687,6 +1130,11 @@ function-bind@^1.1.1: resolved "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz" integrity sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A== +gensync@^1.0.0-beta.2: + version "1.0.0-beta.2" + resolved "https://registry.yarnpkg.com/gensync/-/gensync-1.0.0-beta.2.tgz#32a6ee76c3d7f52d46b2b1ae5d93fea8580a25e0" + integrity sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg== + get-intrinsic@^1.0.2: version "1.2.0" resolved "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.0.tgz" @@ -722,6 +1170,11 @@ glob@^10.3.10: package-json-from-dist "^1.0.0" path-scurry "^1.11.1" +globals@^11.1.0: + version "11.12.0" + resolved "https://registry.yarnpkg.com/globals/-/globals-11.12.0.tgz#ab8795338868a0babd8525758018c2a7eb95c42e" + integrity sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA== + graceful-fs@^4.1.6, graceful-fs@^4.2.0: version "4.2.10" resolved "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.10.tgz" @@ -804,6 +1257,19 @@ iconv-lite@0.6.3: dependencies: safer-buffer ">= 2.1.2 < 3.0.0" +import-fresh@^3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.0.tgz#37162c25fcb9ebaa2e6e53d5b4d88ce17d9e0c2b" + integrity sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw== + dependencies: + parent-module "^1.0.0" + resolve-from "^4.0.0" + +is-arrayish@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d" + integrity sha512-zz06S8t0ozoDXMG+ube26zeCTNXcKIPJZJi8hBrF4idCLms4CG9QtK7qBl1boi5ODzFpjswb5JPmHCbMpjaYzg== + is-extglob@^2.1.1: version "2.1.1" resolved "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz" @@ -850,7 +1316,29 @@ jackspeak@^3.1.2: optionalDependencies: "@pkgjs/parseargs" "^0.11.0" -json5@^2.2.2: +js-tokens@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499" + integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ== + +js-yaml@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602" + integrity sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA== + dependencies: + argparse "^2.0.1" + +jsesc@^2.5.1: + version "2.5.2" + resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-2.5.2.tgz#80564d2e483dacf6e8ef209650a67df3f0c283a4" + integrity sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA== + +json-parse-even-better-errors@^2.3.0: + version "2.3.1" + resolved "https://registry.yarnpkg.com/json-parse-even-better-errors/-/json-parse-even-better-errors-2.3.1.tgz#7c47805a94319928e05777405dc12e1f7a4ee02d" + integrity sha512-xyFwyhro/JEof6Ghe2iz2NcXoj2sloNsWr/XsERDK/oiPCfaNhl5ONfp+jQdAZRQQ0IJWNzH9zIZF7li91kh2w== + +json5@^2.2.2, json5@^2.2.3: version "2.2.3" resolved "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz" integrity sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg== @@ -869,6 +1357,11 @@ jsonfile@^6.0.1: optionalDependencies: graceful-fs "^4.1.6" +lines-and-columns@^1.1.6: + version "1.2.4" + resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632" + integrity sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg== + lodash-es@^4.17.21: version "4.17.21" resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.21.tgz#43e626c46e6591b7750beb2b50117390c609e3ee" @@ -891,6 +1384,13 @@ lru-cache@^10.2.0: resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-10.2.2.tgz#48206bc114c1252940c41b25b41af5b545aca878" integrity sha512-9hp3Vp2/hFQUiIwKo8XCeFVnrg8Pk3TYNPIR7tJADKi5YfcF7vEaK7avFHTlSy3kOKYaJQaalfEo6YuXdceBOQ== +lru-cache@^5.1.1: + version "5.1.1" + resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-5.1.1.tgz#1da27e6710271947695daf6848e847f01d84b920" + integrity sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w== + dependencies: + yallist "^3.0.2" + mdn-data@2.0.14: version "2.0.14" resolved "https://registry.yarnpkg.com/mdn-data/-/mdn-data-2.0.14.tgz#7113fc4281917d63ce29b43446f701e68c25ba50" @@ -943,6 +1443,11 @@ mkdirp@^1.0.4: resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-1.0.4.tgz#3eb5ed62622756d79a5f0e2a221dfebad75c2f7e" integrity sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw== +ms@2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009" + integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w== + ms@^2.1.1: version "2.1.3" resolved "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz" @@ -956,6 +1461,11 @@ no-case@^3.0.4: lower-case "^2.0.2" tslib "^2.0.3" +node-releases@^2.0.14: + version "2.0.14" + resolved "https://registry.yarnpkg.com/node-releases/-/node-releases-2.0.14.tgz#2ffb053bceb8b2be8495ece1ab6ce600c4461b0b" + integrity sha512-y10wOWt8yZpqXmOgRo77WaHEmhYQYGNA6y421PKsKYWEK8aW+cqAphborZDhqfyKrbZEN92CN1X2KbafY2s7Yw== + normalize-svg-path@^1.0.0: version "1.1.0" resolved "https://registry.yarnpkg.com/normalize-svg-path/-/normalize-svg-path-1.1.0.tgz#0e614eca23c39f0cffe821d6be6cd17e569a766c" @@ -993,6 +1503,23 @@ param-case@^3.0.4: dot-case "^3.0.4" tslib "^2.0.3" +parent-module@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2" + integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g== + dependencies: + callsites "^3.0.0" + +parse-json@^5.2.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-5.2.0.tgz#c76fc66dee54231c962b22bcc8a72cf2f99753cd" + integrity sha512-ayCKvm/phCGxOkYRSCM82iDwct8/EonSEgCSxWxD7ve6jHggsFl4fZVQBPRNgQoKiuV/odhFrGzQXZwbifC8Rg== + dependencies: + "@babel/code-frame" "^7.0.0" + error-ex "^1.3.1" + json-parse-even-better-errors "^2.3.0" + lines-and-columns "^1.1.6" + parse-svg-path@^0.1.2: version "0.1.2" resolved "https://registry.yarnpkg.com/parse-svg-path/-/parse-svg-path-0.1.2.tgz#7a7ec0d1eb06fa5325c7d3e009b859a09b5d49eb" @@ -1027,11 +1554,21 @@ path-scurry@^1.11.1: lru-cache "^10.2.0" minipass "^5.0.0 || ^6.0.2 || ^7.0.0" +path-type@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-4.0.0.tgz#84ed01c0a7ba380afe09d90a8c180dcd9d03043b" + integrity sha512-gDKb8aZMDeD/tZWs9P6+q0J9Mwkdl6xMV8TjnGP3qJVJ06bdMgkbBlLU8IdfOsIsFz2BW1rNVT3XuNEl8zPAvw== + picocolors@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.0.0.tgz#cb5bdc74ff3f51892236eaf79d68bc44564ab81c" integrity sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ== +picocolors@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.0.1.tgz#a8ad579b571952f0e5d25892de5445bcfe25aaa1" + integrity sha512-anP1Z8qwhkbmu7MFP5iTt+wQKXgwzf7zTyGlcdzabySa9vd0Xt392U0rVmz9poOaBj0uHJKyyo9/upk0HrEQew== + picomatch@^2.3.1: version "2.3.1" resolved "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz" @@ -1080,6 +1617,11 @@ requires-port@^1.0.0: resolved "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz" integrity sha512-KigOCHcocU3XODJxsu8i/j8T9tzT4adHiecwORRQ0ZZFcp7ahwXuRU1m+yuO90C5ZUyGeGfocHDI14M3L3yDAQ== +resolve-from@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6" + integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g== + resolve-pkg-maps@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/resolve-pkg-maps/-/resolve-pkg-maps-1.0.0.tgz#616b3dc2c57056b5588c31cdf4b3d64db133720f" @@ -1112,6 +1654,11 @@ secure-compare@3.0.1: resolved "https://registry.npmjs.org/secure-compare/-/secure-compare-3.0.1.tgz" integrity sha512-AckIIV90rPDcBcglUwXPF3kg0P0qmPsPXAj6BBEENQE1p5yA1xfmDJzfi1Tappj37Pv2mVbKpL3Z1T+Nn7k1Qw== +semver@^6.3.1: + version "6.3.1" + resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.1.tgz#556d2ef8689146e46dcea4bfdd095f3434dffcb4" + integrity sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA== + sentence-case@^3.0.4: version "3.0.4" resolved "https://registry.npmjs.org/sentence-case/-/sentence-case-3.0.4.tgz" @@ -1233,6 +1780,11 @@ svg-arc-to-cubic-bezier@^3.0.0: resolved "https://registry.yarnpkg.com/svg-arc-to-cubic-bezier/-/svg-arc-to-cubic-bezier-3.2.0.tgz#390c450035ae1c4a0104d90650304c3bc814abe6" integrity sha512-djbJ/vZKZO+gPoSDThGNpKDO+o+bAeA4XQKovvkNCqnIS2t+S4qnLAGQhyyrulhCFRl1WWzAp0wUDV8PpTVU3g== +svg-parser@^2.0.4: + version "2.0.4" + resolved "https://registry.yarnpkg.com/svg-parser/-/svg-parser-2.0.4.tgz#fdc2e29e13951736140b76cb122c8ee6630eb6b5" + integrity sha512-e4hG1hRwoOdRb37cIMSgzNsxyzKfayW6VOflrwvR+/bzrkyxY/31WkbgnQpgtrNp1SdpJvpUAGTa/ZoiPNDuRQ== + svg-path-bounds@^1.0.1: version "1.0.2" resolved "https://registry.yarnpkg.com/svg-path-bounds/-/svg-path-bounds-1.0.2.tgz#00312f672b08afc432a66ddfbd06db40cec8d0d0" @@ -1277,6 +1829,11 @@ tinycolor2@^1.4.1: resolved "https://registry.npmjs.org/tinycolor2/-/tinycolor2-1.5.2.tgz" integrity sha512-h80m9GPFGbcLzZByXlNSEhp1gf8Dy+VX/2JCGUZsWLo7lV1mnE/XlxGYgRBoMLJh1lIDXP0EMC4RPTjlRaV+Bg== +to-fast-properties@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-2.0.0.tgz#dc5e698cbd079265bc73e0377681a4e4e83f616e" + integrity sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog== + to-regex-range@^5.0.1: version "5.0.1" resolved "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz" @@ -1321,6 +1878,14 @@ universalify@^2.0.0: resolved "https://registry.npmjs.org/universalify/-/universalify-2.0.0.tgz" integrity sha512-hAZsKq7Yy11Zu1DE0OzWjw7nnLZmJZYTDZZyEFHZdUhV8FkH5MCfoU1XMaxXovpyW5nq5scPqq0ZDP9Zyl04oQ== +update-browserslist-db@^1.0.16: + version "1.0.16" + resolved "https://registry.yarnpkg.com/update-browserslist-db/-/update-browserslist-db-1.0.16.tgz#f6d489ed90fb2f07d67784eb3f53d7891f736356" + integrity sha512-KVbTxlBYlckhF5wgfyZXTWnMn7MMZjMu9XG8bPlliUOP9ThaF4QnhP8qrjrH7DRzHfSk0oQv1wToW+iA5GajEQ== + dependencies: + escalade "^3.1.2" + picocolors "^1.0.1" + upper-case-first@^2.0.2: version "2.0.2" resolved "https://registry.npmjs.org/upper-case-first/-/upper-case-first-2.0.2.tgz" @@ -1371,3 +1936,8 @@ wrap-ansi@^8.1.0: ansi-styles "^6.1.0" string-width "^5.0.1" strip-ansi "^7.0.1" + +yallist@^3.0.2: + version "3.1.1" + resolved "https://registry.yarnpkg.com/yallist/-/yallist-3.1.1.tgz#dbb7daf9bfd8bac9ab45ebf602b8cbad0d5d08fd" + integrity sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g== From 8f7e9aa7aef8ec15dd188165871582e93049a996 Mon Sep 17 00:00:00 2001 From: Quentin Gliech Date: Thu, 20 Jun 2024 16:00:21 +0200 Subject: [PATCH 2/6] Regenerate icons --- assets/web/icons/$icons.json | 1 - assets/web/icons/admin.d.ts | 10 ++ assets/web/icons/admin.js | 19 ++ assets/web/icons/admin.svg | 3 - assets/web/icons/arrow-down.d.ts | 10 ++ assets/web/icons/arrow-down.js | 17 ++ assets/web/icons/arrow-down.svg | 3 - assets/web/icons/arrow-left.d.ts | 10 ++ assets/web/icons/arrow-left.js | 17 ++ assets/web/icons/arrow-left.svg | 3 - assets/web/icons/arrow-right.d.ts | 10 ++ assets/web/icons/arrow-right.js | 17 ++ assets/web/icons/arrow-right.svg | 3 - assets/web/icons/arrow-up-right.d.ts | 10 ++ assets/web/icons/arrow-up-right.js | 17 ++ assets/web/icons/arrow-up-right.svg | 3 - assets/web/icons/arrow-up.d.ts | 10 ++ assets/web/icons/arrow-up.js | 17 ++ assets/web/icons/arrow-up.svg | 3 - assets/web/icons/attachment.d.ts | 10 ++ assets/web/icons/attachment.js | 17 ++ assets/web/icons/attachment.svg | 3 - assets/web/icons/block.d.ts | 10 ++ assets/web/icons/block.js | 17 ++ assets/web/icons/block.svg | 3 - assets/web/icons/bold.d.ts | 10 ++ assets/web/icons/bold.js | 17 ++ assets/web/icons/bold.svg | 3 - assets/web/icons/chart.d.ts | 10 ++ assets/web/icons/chart.js | 17 ++ assets/web/icons/chart.svg | 3 - assets/web/icons/chat-new.d.ts | 10 ++ assets/web/icons/chat-new.js | 19 ++ assets/web/icons/chat-new.svg | 4 - assets/web/icons/chat-problem.d.ts | 10 ++ assets/web/icons/chat-problem.js | 19 ++ assets/web/icons/chat-problem.svg | 4 - assets/web/icons/chat-solid.d.ts | 10 ++ assets/web/icons/chat-solid.js | 17 ++ assets/web/icons/chat-solid.svg | 3 - assets/web/icons/chat.d.ts | 10 ++ assets/web/icons/chat.js | 17 ++ assets/web/icons/chat.svg | 3 - assets/web/icons/check-circle-solid.d.ts | 10 ++ assets/web/icons/check-circle-solid.js | 17 ++ assets/web/icons/check-circle-solid.svg | 3 - assets/web/icons/check-circle.d.ts | 10 ++ assets/web/icons/check-circle.js | 17 ++ assets/web/icons/check-circle.svg | 3 - assets/web/icons/check.d.ts | 10 ++ assets/web/icons/check.js | 17 ++ assets/web/icons/check.svg | 3 - assets/web/icons/chevron-down.d.ts | 10 ++ assets/web/icons/chevron-down.js | 17 ++ assets/web/icons/chevron-down.svg | 3 - assets/web/icons/chevron-left.d.ts | 10 ++ assets/web/icons/chevron-left.js | 17 ++ assets/web/icons/chevron-left.svg | 3 - assets/web/icons/chevron-right.d.ts | 10 ++ assets/web/icons/chevron-right.js | 17 ++ assets/web/icons/chevron-right.svg | 3 - assets/web/icons/chevron-up-down.d.ts | 10 ++ assets/web/icons/chevron-up-down.js | 17 ++ assets/web/icons/chevron-up-down.svg | 3 - assets/web/icons/chevron-up.d.ts | 10 ++ assets/web/icons/chevron-up.js | 17 ++ assets/web/icons/chevron-up.svg | 3 - assets/web/icons/circle.d.ts | 10 ++ assets/web/icons/circle.js | 17 ++ assets/web/icons/circle.svg | 3 - assets/web/icons/close.d.ts | 10 ++ assets/web/icons/close.js | 17 ++ assets/web/icons/close.svg | 3 - assets/web/icons/cloud-solid.d.ts | 10 ++ assets/web/icons/cloud-solid.js | 17 ++ assets/web/icons/cloud-solid.svg | 3 - assets/web/icons/cloud.d.ts | 10 ++ assets/web/icons/cloud.js | 19 ++ assets/web/icons/cloud.svg | 3 - assets/web/icons/code.d.ts | 10 ++ assets/web/icons/code.js | 17 ++ assets/web/icons/code.svg | 3 - assets/web/icons/collapse.d.ts | 10 ++ assets/web/icons/collapse.js | 17 ++ assets/web/icons/collapse.svg | 3 - assets/web/icons/company.d.ts | 10 ++ assets/web/icons/company.js | 17 ++ assets/web/icons/company.svg | 3 - assets/web/icons/compose.d.ts | 10 ++ assets/web/icons/compose.js | 25 +++ assets/web/icons/compose.svg | 5 - assets/web/icons/computer.d.ts | 10 ++ assets/web/icons/computer.js | 17 ++ assets/web/icons/computer.svg | 3 - assets/web/icons/copy.d.ts | 10 ++ assets/web/icons/copy.js | 19 ++ assets/web/icons/copy.svg | 4 - assets/web/icons/dark-mode.d.ts | 10 ++ assets/web/icons/dark-mode.js | 19 ++ assets/web/icons/dark-mode.svg | 3 - assets/web/icons/delete.d.ts | 10 ++ assets/web/icons/delete.js | 17 ++ assets/web/icons/delete.svg | 3 - assets/web/icons/devices.d.ts | 10 ++ assets/web/icons/devices.js | 17 ++ assets/web/icons/devices.svg | 3 - assets/web/icons/document.d.ts | 10 ++ assets/web/icons/document.js | 17 ++ assets/web/icons/document.svg | 3 - assets/web/icons/download.d.ts | 10 ++ assets/web/icons/download.js | 17 ++ assets/web/icons/download.svg | 3 - assets/web/icons/drag-grid.d.ts | 10 ++ assets/web/icons/drag-grid.js | 17 ++ assets/web/icons/drag-grid.svg | 3 - assets/web/icons/drag-list.d.ts | 10 ++ assets/web/icons/drag-list.js | 17 ++ assets/web/icons/drag-list.svg | 3 - assets/web/icons/edit-solid.d.ts | 10 ++ assets/web/icons/edit-solid.js | 29 +++ assets/web/icons/edit-solid.svg | 7 - assets/web/icons/edit.d.ts | 10 ++ assets/web/icons/edit.js | 19 ++ assets/web/icons/edit.svg | 3 - assets/web/icons/email-solid.d.ts | 10 ++ assets/web/icons/email-solid.js | 17 ++ assets/web/icons/email-solid.svg | 3 - assets/web/icons/email.d.ts | 10 ++ assets/web/icons/email.js | 17 ++ assets/web/icons/email.svg | 3 - assets/web/icons/end-call.d.ts | 10 ++ assets/web/icons/end-call.js | 17 ++ assets/web/icons/end-call.svg | 3 - assets/web/icons/error.d.ts | 10 ++ assets/web/icons/error.js | 17 ++ assets/web/icons/error.svg | 3 - assets/web/icons/expand.d.ts | 10 ++ assets/web/icons/expand.js | 17 ++ assets/web/icons/expand.svg | 3 - assets/web/icons/export-archive.d.ts | 10 ++ assets/web/icons/export-archive.js | 17 ++ assets/web/icons/export-archive.svg | 3 - assets/web/icons/extensions-solid.d.ts | 10 ++ assets/web/icons/extensions-solid.js | 17 ++ assets/web/icons/extensions-solid.svg | 3 - assets/web/icons/extensions.d.ts | 10 ++ assets/web/icons/extensions.js | 17 ++ assets/web/icons/extensions.svg | 3 - assets/web/icons/favourite-solid.d.ts | 10 ++ assets/web/icons/favourite-solid.js | 17 ++ assets/web/icons/favourite-solid.svg | 3 - assets/web/icons/favourite.d.ts | 10 ++ assets/web/icons/favourite.js | 17 ++ assets/web/icons/favourite.svg | 3 - assets/web/icons/file-error.d.ts | 10 ++ assets/web/icons/file-error.js | 19 ++ assets/web/icons/file-error.svg | 4 - assets/web/icons/files.d.ts | 10 ++ assets/web/icons/files.js | 17 ++ assets/web/icons/files.svg | 3 - assets/web/icons/filter.d.ts | 10 ++ assets/web/icons/filter.js | 17 ++ assets/web/icons/filter.svg | 3 - assets/web/icons/forward.d.ts | 10 ++ assets/web/icons/forward.js | 17 ++ assets/web/icons/forward.svg | 3 - assets/web/icons/grid.d.ts | 10 ++ assets/web/icons/grid.js | 17 ++ assets/web/icons/grid.svg | 3 - assets/web/icons/help-solid.d.ts | 10 ++ assets/web/icons/help-solid.js | 17 ++ assets/web/icons/help-solid.svg | 3 - assets/web/icons/help.d.ts | 10 ++ assets/web/icons/help.js | 19 ++ assets/web/icons/help.svg | 4 - assets/web/icons/history.d.ts | 10 ++ assets/web/icons/history.js | 19 ++ assets/web/icons/history.svg | 4 - assets/web/icons/home-solid.d.ts | 10 ++ assets/web/icons/home-solid.js | 17 ++ assets/web/icons/home-solid.svg | 3 - assets/web/icons/home.d.ts | 10 ++ assets/web/icons/home.js | 19 ++ assets/web/icons/home.svg | 3 - assets/web/icons/host.d.ts | 10 ++ assets/web/icons/host.js | 21 +++ assets/web/icons/host.svg | 4 - assets/web/icons/image-error.d.ts | 10 ++ assets/web/icons/image-error.js | 19 ++ assets/web/icons/image-error.svg | 4 - assets/web/icons/image.d.ts | 10 ++ assets/web/icons/image.js | 19 ++ assets/web/icons/image.svg | 4 - assets/web/icons/indent-decrease.d.ts | 10 ++ assets/web/icons/indent-decrease.js | 17 ++ assets/web/icons/indent-decrease.svg | 3 - assets/web/icons/indent-increase.d.ts | 10 ++ assets/web/icons/indent-increase.js | 17 ++ assets/web/icons/indent-increase.svg | 3 - assets/web/icons/index.d.ts | 170 ++++++++++++++++++ assets/web/icons/index.js | 170 ++++++++++++++++++ assets/web/icons/info-solid.d.ts | 10 ++ assets/web/icons/info-solid.js | 17 ++ assets/web/icons/info-solid.svg | 3 - assets/web/icons/info.d.ts | 10 ++ assets/web/icons/info.js | 21 +++ assets/web/icons/info.svg | 4 - assets/web/icons/inline-code.d.ts | 10 ++ assets/web/icons/inline-code.js | 17 ++ assets/web/icons/inline-code.svg | 3 - assets/web/icons/italic.d.ts | 10 ++ assets/web/icons/italic.js | 17 ++ assets/web/icons/italic.svg | 3 - assets/web/icons/key-off-solid.d.ts | 10 ++ assets/web/icons/key-off-solid.js | 17 ++ assets/web/icons/key-off-solid.svg | 3 - assets/web/icons/key-off.d.ts | 10 ++ assets/web/icons/key-off.js | 19 ++ assets/web/icons/key-off.svg | 4 - assets/web/icons/key-solid.d.ts | 10 ++ assets/web/icons/key-solid.js | 17 ++ assets/web/icons/key-solid.svg | 3 - assets/web/icons/key.d.ts | 10 ++ assets/web/icons/key.js | 17 ++ assets/web/icons/key.svg | 3 - assets/web/icons/keyboard.d.ts | 10 ++ assets/web/icons/keyboard.js | 21 +++ assets/web/icons/keyboard.svg | 4 - assets/web/icons/labs.d.ts | 10 ++ assets/web/icons/labs.js | 23 +++ assets/web/icons/labs.svg | 5 - assets/web/icons/leave.d.ts | 10 ++ assets/web/icons/leave.js | 19 ++ assets/web/icons/leave.svg | 4 - assets/web/icons/link.d.ts | 10 ++ assets/web/icons/link.js | 17 ++ assets/web/icons/link.svg | 3 - assets/web/icons/list-bulleted.d.ts | 10 ++ assets/web/icons/list-bulleted.js | 17 ++ assets/web/icons/list-bulleted.svg | 3 - assets/web/icons/list-numbered.d.ts | 10 ++ assets/web/icons/list-numbered.js | 17 ++ assets/web/icons/list-numbered.svg | 3 - .../web/icons/location-navigator-centred.d.ts | 10 ++ .../web/icons/location-navigator-centred.js | 17 ++ .../web/icons/location-navigator-centred.svg | 3 - assets/web/icons/location-navigator.d.ts | 10 ++ assets/web/icons/location-navigator.js | 17 ++ assets/web/icons/location-navigator.svg | 3 - assets/web/icons/location-pin-solid.d.ts | 10 ++ assets/web/icons/location-pin-solid.js | 17 ++ assets/web/icons/location-pin-solid.svg | 3 - assets/web/icons/location-pin.d.ts | 10 ++ assets/web/icons/location-pin.js | 17 ++ assets/web/icons/location-pin.svg | 3 - assets/web/icons/lock-off.d.ts | 10 ++ assets/web/icons/lock-off.js | 17 ++ assets/web/icons/lock-off.svg | 3 - assets/web/icons/lock-solid.d.ts | 10 ++ assets/web/icons/lock-solid.js | 17 ++ assets/web/icons/lock-solid.svg | 3 - assets/web/icons/lock.d.ts | 10 ++ assets/web/icons/lock.js | 17 ++ assets/web/icons/lock.svg | 3 - assets/web/icons/mark-as-read.d.ts | 10 ++ assets/web/icons/mark-as-read.js | 17 ++ assets/web/icons/mark-as-read.svg | 3 - assets/web/icons/mark-as-unread.d.ts | 10 ++ assets/web/icons/mark-as-unread.js | 21 +++ assets/web/icons/mark-as-unread.svg | 4 - assets/web/icons/marker-read-receipts.d.ts | 10 ++ assets/web/icons/marker-read-receipts.js | 19 ++ assets/web/icons/marker-read-receipts.svg | 4 - assets/web/icons/mention.d.ts | 10 ++ assets/web/icons/mention.js | 17 ++ assets/web/icons/mention.svg | 3 - assets/web/icons/menu.d.ts | 10 ++ assets/web/icons/menu.js | 17 ++ assets/web/icons/menu.svg | 3 - assets/web/icons/mic-off-solid.d.ts | 10 ++ assets/web/icons/mic-off-solid.js | 17 ++ assets/web/icons/mic-off-solid.svg | 3 - assets/web/icons/mic-off.d.ts | 10 ++ assets/web/icons/mic-off.js | 21 +++ assets/web/icons/mic-off.svg | 4 - assets/web/icons/mic-on-solid.d.ts | 10 ++ assets/web/icons/mic-on-solid.js | 19 ++ assets/web/icons/mic-on-solid.svg | 4 - assets/web/icons/mic-on.d.ts | 10 ++ assets/web/icons/mic-on.js | 21 +++ assets/web/icons/mic-on.svg | 4 - assets/web/icons/minus.d.ts | 10 ++ assets/web/icons/minus.js | 17 ++ assets/web/icons/minus.svg | 3 - assets/web/icons/mobile.d.ts | 10 ++ assets/web/icons/mobile.js | 17 ++ assets/web/icons/mobile.svg | 3 - assets/web/icons/notifications-off-solid.d.ts | 10 ++ assets/web/icons/notifications-off-solid.js | 19 ++ assets/web/icons/notifications-off-solid.svg | 4 - assets/web/icons/notifications-off.d.ts | 10 ++ assets/web/icons/notifications-off.js | 19 ++ assets/web/icons/notifications-off.svg | 4 - assets/web/icons/notifications-solid.d.ts | 10 ++ assets/web/icons/notifications-solid.js | 17 ++ assets/web/icons/notifications-solid.svg | 3 - assets/web/icons/notifications.d.ts | 10 ++ assets/web/icons/notifications.js | 17 ++ assets/web/icons/notifications.svg | 3 - assets/web/icons/offline.d.ts | 10 ++ assets/web/icons/offline.js | 17 ++ assets/web/icons/offline.svg | 3 - assets/web/icons/overflow-horizontal.d.ts | 10 ++ assets/web/icons/overflow-horizontal.js | 17 ++ assets/web/icons/overflow-horizontal.svg | 3 - assets/web/icons/overflow-vertical.d.ts | 10 ++ assets/web/icons/overflow-vertical.js | 17 ++ assets/web/icons/overflow-vertical.svg | 3 - assets/web/icons/pause-solid.d.ts | 10 ++ assets/web/icons/pause-solid.js | 17 ++ assets/web/icons/pause-solid.svg | 3 - assets/web/icons/pause.d.ts | 10 ++ assets/web/icons/pause.js | 17 ++ assets/web/icons/pause.svg | 3 - assets/web/icons/pin-solid.d.ts | 10 ++ assets/web/icons/pin-solid.js | 17 ++ assets/web/icons/pin-solid.svg | 3 - assets/web/icons/pin.d.ts | 10 ++ assets/web/icons/pin.js | 19 ++ assets/web/icons/pin.svg | 3 - assets/web/icons/play-solid.d.ts | 10 ++ assets/web/icons/play-solid.js | 17 ++ assets/web/icons/play-solid.svg | 3 - assets/web/icons/play.d.ts | 10 ++ assets/web/icons/play.js | 17 ++ assets/web/icons/play.svg | 3 - assets/web/icons/plus.d.ts | 10 ++ assets/web/icons/plus.js | 17 ++ assets/web/icons/plus.svg | 3 - assets/web/icons/polls-end.d.ts | 10 ++ assets/web/icons/polls-end.js | 19 ++ assets/web/icons/polls-end.svg | 4 - assets/web/icons/polls.d.ts | 10 ++ assets/web/icons/polls.js | 17 ++ assets/web/icons/polls.svg | 3 - assets/web/icons/pop-out.d.ts | 10 ++ assets/web/icons/pop-out.js | 19 ++ assets/web/icons/pop-out.svg | 4 - assets/web/icons/preferences.d.ts | 10 ++ assets/web/icons/preferences.js | 19 ++ assets/web/icons/preferences.svg | 3 - assets/web/icons/public.d.ts | 10 ++ assets/web/icons/public.js | 17 ++ assets/web/icons/public.svg | 3 - assets/web/icons/qr-code.d.ts | 10 ++ assets/web/icons/qr-code.js | 23 +++ assets/web/icons/qr-code.svg | 5 - assets/web/icons/quote.d.ts | 10 ++ assets/web/icons/quote.js | 17 ++ assets/web/icons/quote.svg | 3 - assets/web/icons/reaction-add.d.ts | 10 ++ assets/web/icons/reaction-add.js | 19 ++ assets/web/icons/reaction-add.svg | 4 - assets/web/icons/reaction.d.ts | 10 ++ assets/web/icons/reaction.js | 19 ++ assets/web/icons/reaction.svg | 4 - assets/web/icons/reply.d.ts | 10 ++ assets/web/icons/reply.js | 17 ++ assets/web/icons/reply.svg | 3 - assets/web/icons/restart.d.ts | 10 ++ assets/web/icons/restart.js | 17 ++ assets/web/icons/restart.svg | 3 - assets/web/icons/search.d.ts | 10 ++ assets/web/icons/search.js | 17 ++ assets/web/icons/search.svg | 3 - assets/web/icons/send-solid.d.ts | 10 ++ assets/web/icons/send-solid.js | 17 ++ assets/web/icons/send-solid.svg | 3 - assets/web/icons/send.d.ts | 10 ++ assets/web/icons/send.js | 19 ++ assets/web/icons/send.svg | 3 - assets/web/icons/settings-solid.d.ts | 10 ++ assets/web/icons/settings-solid.js | 17 ++ assets/web/icons/settings-solid.svg | 3 - assets/web/icons/settings.d.ts | 10 ++ assets/web/icons/settings.js | 19 ++ assets/web/icons/settings.svg | 4 - assets/web/icons/share-android.d.ts | 10 ++ assets/web/icons/share-android.js | 17 ++ assets/web/icons/share-android.svg | 3 - assets/web/icons/share-ios.d.ts | 10 ++ assets/web/icons/share-ios.js | 19 ++ assets/web/icons/share-ios.svg | 4 - assets/web/icons/share-screen-solid.d.ts | 10 ++ assets/web/icons/share-screen-solid.js | 17 ++ assets/web/icons/share-screen-solid.svg | 3 - assets/web/icons/share-screen.d.ts | 10 ++ assets/web/icons/share-screen.js | 19 ++ assets/web/icons/share-screen.svg | 4 - assets/web/icons/share.d.ts | 10 ++ assets/web/icons/share.js | 17 ++ assets/web/icons/share.svg | 3 - assets/web/icons/sidebar.d.ts | 10 ++ assets/web/icons/sidebar.js | 19 ++ assets/web/icons/sidebar.svg | 3 - assets/web/icons/sign-out.d.ts | 10 ++ assets/web/icons/sign-out.js | 17 ++ assets/web/icons/sign-out.svg | 3 - assets/web/icons/spinner.d.ts | 10 ++ assets/web/icons/spinner.js | 19 ++ assets/web/icons/spinner.svg | 3 - assets/web/icons/spotlight.d.ts | 10 ++ assets/web/icons/spotlight.js | 17 ++ assets/web/icons/spotlight.svg | 3 - assets/web/icons/strikethrough.d.ts | 10 ++ assets/web/icons/strikethrough.js | 17 ++ assets/web/icons/strikethrough.svg | 3 - assets/web/icons/switch-camera-solid.d.ts | 10 ++ assets/web/icons/switch-camera-solid.js | 19 ++ assets/web/icons/switch-camera-solid.svg | 4 - assets/web/icons/take-photo-solid.d.ts | 10 ++ assets/web/icons/take-photo-solid.js | 19 ++ assets/web/icons/take-photo-solid.svg | 3 - assets/web/icons/take-photo.d.ts | 10 ++ assets/web/icons/take-photo.js | 17 ++ assets/web/icons/take-photo.svg | 3 - assets/web/icons/text-formatting.d.ts | 10 ++ assets/web/icons/text-formatting.js | 17 ++ assets/web/icons/text-formatting.svg | 3 - assets/web/icons/threads-solid.d.ts | 10 ++ assets/web/icons/threads-solid.js | 17 ++ assets/web/icons/threads-solid.svg | 3 - assets/web/icons/threads.d.ts | 10 ++ assets/web/icons/threads.js | 19 ++ assets/web/icons/threads.svg | 4 - assets/web/icons/time.d.ts | 10 ++ assets/web/icons/time.js | 21 +++ assets/web/icons/time.svg | 4 - assets/web/icons/underline.d.ts | 10 ++ assets/web/icons/underline.js | 17 ++ assets/web/icons/underline.svg | 3 - assets/web/icons/unknown-solid.d.ts | 10 ++ assets/web/icons/unknown-solid.js | 17 ++ assets/web/icons/unknown-solid.svg | 3 - assets/web/icons/unknown.d.ts | 10 ++ assets/web/icons/unknown.js | 19 ++ assets/web/icons/unknown.svg | 4 - assets/web/icons/user-add-solid.d.ts | 10 ++ assets/web/icons/user-add-solid.js | 17 ++ assets/web/icons/user-add-solid.svg | 3 - assets/web/icons/user-add.d.ts | 10 ++ assets/web/icons/user-add.js | 17 ++ assets/web/icons/user-add.svg | 3 - assets/web/icons/user-profile-solid.d.ts | 10 ++ assets/web/icons/user-profile-solid.js | 19 ++ assets/web/icons/user-profile-solid.svg | 4 - assets/web/icons/user-profile.d.ts | 10 ++ assets/web/icons/user-profile.js | 21 +++ assets/web/icons/user-profile.svg | 5 - assets/web/icons/user-solid.d.ts | 10 ++ assets/web/icons/user-solid.js | 17 ++ assets/web/icons/user-solid.svg | 3 - assets/web/icons/user.d.ts | 10 ++ assets/web/icons/user.js | 17 ++ assets/web/icons/user.svg | 3 - assets/web/icons/verified.d.ts | 10 ++ assets/web/icons/verified.js | 17 ++ assets/web/icons/verified.svg | 3 - .../web/icons/video-call-declined-solid.d.ts | 10 ++ assets/web/icons/video-call-declined-solid.js | 17 ++ .../web/icons/video-call-declined-solid.svg | 3 - assets/web/icons/video-call-missed-solid.d.ts | 10 ++ assets/web/icons/video-call-missed-solid.js | 17 ++ assets/web/icons/video-call-missed-solid.svg | 3 - assets/web/icons/video-call-off-solid.d.ts | 10 ++ assets/web/icons/video-call-off-solid.js | 17 ++ assets/web/icons/video-call-off-solid.svg | 3 - assets/web/icons/video-call-off.d.ts | 10 ++ assets/web/icons/video-call-off.js | 17 ++ assets/web/icons/video-call-off.svg | 3 - assets/web/icons/video-call-solid.d.ts | 10 ++ assets/web/icons/video-call-solid.js | 17 ++ assets/web/icons/video-call-solid.svg | 3 - assets/web/icons/video-call.d.ts | 10 ++ assets/web/icons/video-call.js | 17 ++ assets/web/icons/video-call.svg | 3 - assets/web/icons/visibility-off.d.ts | 10 ++ assets/web/icons/visibility-off.js | 17 ++ assets/web/icons/visibility-off.svg | 3 - assets/web/icons/visibility-on.d.ts | 10 ++ assets/web/icons/visibility-on.js | 17 ++ assets/web/icons/visibility-on.svg | 3 - assets/web/icons/voice-call.d.ts | 10 ++ assets/web/icons/voice-call.js | 17 ++ assets/web/icons/voice-call.svg | 3 - assets/web/icons/volume-off-solid.d.ts | 10 ++ assets/web/icons/volume-off-solid.js | 17 ++ assets/web/icons/volume-off-solid.svg | 3 - assets/web/icons/volume-off.d.ts | 10 ++ assets/web/icons/volume-off.js | 17 ++ assets/web/icons/volume-off.svg | 3 - assets/web/icons/volume-on-solid.d.ts | 10 ++ assets/web/icons/volume-on-solid.js | 19 ++ assets/web/icons/volume-on-solid.svg | 4 - assets/web/icons/volume-on.d.ts | 10 ++ assets/web/icons/volume-on.js | 19 ++ assets/web/icons/volume-on.svg | 4 - assets/web/icons/warning.d.ts | 10 ++ assets/web/icons/warning.js | 21 +++ assets/web/icons/warning.svg | 4 - assets/web/icons/web-browser.d.ts | 10 ++ assets/web/icons/web-browser.js | 17 ++ assets/web/icons/web-browser.svg | 3 - 513 files changed, 5074 insertions(+), 558 deletions(-) delete mode 100644 assets/web/icons/$icons.json create mode 100644 assets/web/icons/admin.d.ts create mode 100644 assets/web/icons/admin.js delete mode 100644 assets/web/icons/admin.svg create mode 100644 assets/web/icons/arrow-down.d.ts create mode 100644 assets/web/icons/arrow-down.js delete mode 100644 assets/web/icons/arrow-down.svg create mode 100644 assets/web/icons/arrow-left.d.ts create mode 100644 assets/web/icons/arrow-left.js delete mode 100644 assets/web/icons/arrow-left.svg create mode 100644 assets/web/icons/arrow-right.d.ts create mode 100644 assets/web/icons/arrow-right.js delete mode 100644 assets/web/icons/arrow-right.svg create mode 100644 assets/web/icons/arrow-up-right.d.ts create mode 100644 assets/web/icons/arrow-up-right.js delete mode 100644 assets/web/icons/arrow-up-right.svg create mode 100644 assets/web/icons/arrow-up.d.ts create mode 100644 assets/web/icons/arrow-up.js delete mode 100644 assets/web/icons/arrow-up.svg create mode 100644 assets/web/icons/attachment.d.ts create mode 100644 assets/web/icons/attachment.js delete mode 100644 assets/web/icons/attachment.svg create mode 100644 assets/web/icons/block.d.ts create mode 100644 assets/web/icons/block.js delete mode 100644 assets/web/icons/block.svg create mode 100644 assets/web/icons/bold.d.ts create mode 100644 assets/web/icons/bold.js delete mode 100644 assets/web/icons/bold.svg create mode 100644 assets/web/icons/chart.d.ts create mode 100644 assets/web/icons/chart.js delete mode 100644 assets/web/icons/chart.svg create mode 100644 assets/web/icons/chat-new.d.ts create mode 100644 assets/web/icons/chat-new.js delete mode 100644 assets/web/icons/chat-new.svg create mode 100644 assets/web/icons/chat-problem.d.ts create mode 100644 assets/web/icons/chat-problem.js delete mode 100644 assets/web/icons/chat-problem.svg create mode 100644 assets/web/icons/chat-solid.d.ts create mode 100644 assets/web/icons/chat-solid.js delete mode 100644 assets/web/icons/chat-solid.svg create mode 100644 assets/web/icons/chat.d.ts create mode 100644 assets/web/icons/chat.js delete mode 100644 assets/web/icons/chat.svg create mode 100644 assets/web/icons/check-circle-solid.d.ts create mode 100644 assets/web/icons/check-circle-solid.js delete mode 100644 assets/web/icons/check-circle-solid.svg create mode 100644 assets/web/icons/check-circle.d.ts create mode 100644 assets/web/icons/check-circle.js delete mode 100644 assets/web/icons/check-circle.svg create mode 100644 assets/web/icons/check.d.ts create mode 100644 assets/web/icons/check.js delete mode 100644 assets/web/icons/check.svg create mode 100644 assets/web/icons/chevron-down.d.ts create mode 100644 assets/web/icons/chevron-down.js delete mode 100644 assets/web/icons/chevron-down.svg create mode 100644 assets/web/icons/chevron-left.d.ts create mode 100644 assets/web/icons/chevron-left.js delete mode 100644 assets/web/icons/chevron-left.svg create mode 100644 assets/web/icons/chevron-right.d.ts create mode 100644 assets/web/icons/chevron-right.js delete mode 100644 assets/web/icons/chevron-right.svg create mode 100644 assets/web/icons/chevron-up-down.d.ts create mode 100644 assets/web/icons/chevron-up-down.js delete mode 100644 assets/web/icons/chevron-up-down.svg create mode 100644 assets/web/icons/chevron-up.d.ts create mode 100644 assets/web/icons/chevron-up.js delete mode 100644 assets/web/icons/chevron-up.svg create mode 100644 assets/web/icons/circle.d.ts create mode 100644 assets/web/icons/circle.js delete mode 100644 assets/web/icons/circle.svg create mode 100644 assets/web/icons/close.d.ts create mode 100644 assets/web/icons/close.js delete mode 100644 assets/web/icons/close.svg create mode 100644 assets/web/icons/cloud-solid.d.ts create mode 100644 assets/web/icons/cloud-solid.js delete mode 100644 assets/web/icons/cloud-solid.svg create mode 100644 assets/web/icons/cloud.d.ts create mode 100644 assets/web/icons/cloud.js delete mode 100644 assets/web/icons/cloud.svg create mode 100644 assets/web/icons/code.d.ts create mode 100644 assets/web/icons/code.js delete mode 100644 assets/web/icons/code.svg create mode 100644 assets/web/icons/collapse.d.ts create mode 100644 assets/web/icons/collapse.js delete mode 100644 assets/web/icons/collapse.svg create mode 100644 assets/web/icons/company.d.ts create mode 100644 assets/web/icons/company.js delete mode 100644 assets/web/icons/company.svg create mode 100644 assets/web/icons/compose.d.ts create mode 100644 assets/web/icons/compose.js delete mode 100644 assets/web/icons/compose.svg create mode 100644 assets/web/icons/computer.d.ts create mode 100644 assets/web/icons/computer.js delete mode 100644 assets/web/icons/computer.svg create mode 100644 assets/web/icons/copy.d.ts create mode 100644 assets/web/icons/copy.js delete mode 100644 assets/web/icons/copy.svg create mode 100644 assets/web/icons/dark-mode.d.ts create mode 100644 assets/web/icons/dark-mode.js delete mode 100644 assets/web/icons/dark-mode.svg create mode 100644 assets/web/icons/delete.d.ts create mode 100644 assets/web/icons/delete.js delete mode 100644 assets/web/icons/delete.svg create mode 100644 assets/web/icons/devices.d.ts create mode 100644 assets/web/icons/devices.js delete mode 100644 assets/web/icons/devices.svg create mode 100644 assets/web/icons/document.d.ts create mode 100644 assets/web/icons/document.js delete mode 100644 assets/web/icons/document.svg create mode 100644 assets/web/icons/download.d.ts create mode 100644 assets/web/icons/download.js delete mode 100644 assets/web/icons/download.svg create mode 100644 assets/web/icons/drag-grid.d.ts create mode 100644 assets/web/icons/drag-grid.js delete mode 100644 assets/web/icons/drag-grid.svg create mode 100644 assets/web/icons/drag-list.d.ts create mode 100644 assets/web/icons/drag-list.js delete mode 100644 assets/web/icons/drag-list.svg create mode 100644 assets/web/icons/edit-solid.d.ts create mode 100644 assets/web/icons/edit-solid.js delete mode 100644 assets/web/icons/edit-solid.svg create mode 100644 assets/web/icons/edit.d.ts create mode 100644 assets/web/icons/edit.js delete mode 100644 assets/web/icons/edit.svg create mode 100644 assets/web/icons/email-solid.d.ts create mode 100644 assets/web/icons/email-solid.js delete mode 100644 assets/web/icons/email-solid.svg create mode 100644 assets/web/icons/email.d.ts create mode 100644 assets/web/icons/email.js delete mode 100644 assets/web/icons/email.svg create mode 100644 assets/web/icons/end-call.d.ts create mode 100644 assets/web/icons/end-call.js delete mode 100644 assets/web/icons/end-call.svg create mode 100644 assets/web/icons/error.d.ts create mode 100644 assets/web/icons/error.js delete mode 100644 assets/web/icons/error.svg create mode 100644 assets/web/icons/expand.d.ts create mode 100644 assets/web/icons/expand.js delete mode 100644 assets/web/icons/expand.svg create mode 100644 assets/web/icons/export-archive.d.ts create mode 100644 assets/web/icons/export-archive.js delete mode 100644 assets/web/icons/export-archive.svg create mode 100644 assets/web/icons/extensions-solid.d.ts create mode 100644 assets/web/icons/extensions-solid.js delete mode 100644 assets/web/icons/extensions-solid.svg create mode 100644 assets/web/icons/extensions.d.ts create mode 100644 assets/web/icons/extensions.js delete mode 100644 assets/web/icons/extensions.svg create mode 100644 assets/web/icons/favourite-solid.d.ts create mode 100644 assets/web/icons/favourite-solid.js delete mode 100644 assets/web/icons/favourite-solid.svg create mode 100644 assets/web/icons/favourite.d.ts create mode 100644 assets/web/icons/favourite.js delete mode 100644 assets/web/icons/favourite.svg create mode 100644 assets/web/icons/file-error.d.ts create mode 100644 assets/web/icons/file-error.js delete mode 100644 assets/web/icons/file-error.svg create mode 100644 assets/web/icons/files.d.ts create mode 100644 assets/web/icons/files.js delete mode 100644 assets/web/icons/files.svg create mode 100644 assets/web/icons/filter.d.ts create mode 100644 assets/web/icons/filter.js delete mode 100644 assets/web/icons/filter.svg create mode 100644 assets/web/icons/forward.d.ts create mode 100644 assets/web/icons/forward.js delete mode 100644 assets/web/icons/forward.svg create mode 100644 assets/web/icons/grid.d.ts create mode 100644 assets/web/icons/grid.js delete mode 100644 assets/web/icons/grid.svg create mode 100644 assets/web/icons/help-solid.d.ts create mode 100644 assets/web/icons/help-solid.js delete mode 100644 assets/web/icons/help-solid.svg create mode 100644 assets/web/icons/help.d.ts create mode 100644 assets/web/icons/help.js delete mode 100644 assets/web/icons/help.svg create mode 100644 assets/web/icons/history.d.ts create mode 100644 assets/web/icons/history.js delete mode 100644 assets/web/icons/history.svg create mode 100644 assets/web/icons/home-solid.d.ts create mode 100644 assets/web/icons/home-solid.js delete mode 100644 assets/web/icons/home-solid.svg create mode 100644 assets/web/icons/home.d.ts create mode 100644 assets/web/icons/home.js delete mode 100644 assets/web/icons/home.svg create mode 100644 assets/web/icons/host.d.ts create mode 100644 assets/web/icons/host.js delete mode 100644 assets/web/icons/host.svg create mode 100644 assets/web/icons/image-error.d.ts create mode 100644 assets/web/icons/image-error.js delete mode 100644 assets/web/icons/image-error.svg create mode 100644 assets/web/icons/image.d.ts create mode 100644 assets/web/icons/image.js delete mode 100644 assets/web/icons/image.svg create mode 100644 assets/web/icons/indent-decrease.d.ts create mode 100644 assets/web/icons/indent-decrease.js delete mode 100644 assets/web/icons/indent-decrease.svg create mode 100644 assets/web/icons/indent-increase.d.ts create mode 100644 assets/web/icons/indent-increase.js delete mode 100644 assets/web/icons/indent-increase.svg create mode 100644 assets/web/icons/index.d.ts create mode 100644 assets/web/icons/index.js create mode 100644 assets/web/icons/info-solid.d.ts create mode 100644 assets/web/icons/info-solid.js delete mode 100644 assets/web/icons/info-solid.svg create mode 100644 assets/web/icons/info.d.ts create mode 100644 assets/web/icons/info.js delete mode 100644 assets/web/icons/info.svg create mode 100644 assets/web/icons/inline-code.d.ts create mode 100644 assets/web/icons/inline-code.js delete mode 100644 assets/web/icons/inline-code.svg create mode 100644 assets/web/icons/italic.d.ts create mode 100644 assets/web/icons/italic.js delete mode 100644 assets/web/icons/italic.svg create mode 100644 assets/web/icons/key-off-solid.d.ts create mode 100644 assets/web/icons/key-off-solid.js delete mode 100644 assets/web/icons/key-off-solid.svg create mode 100644 assets/web/icons/key-off.d.ts create mode 100644 assets/web/icons/key-off.js delete mode 100644 assets/web/icons/key-off.svg create mode 100644 assets/web/icons/key-solid.d.ts create mode 100644 assets/web/icons/key-solid.js delete mode 100644 assets/web/icons/key-solid.svg create mode 100644 assets/web/icons/key.d.ts create mode 100644 assets/web/icons/key.js delete mode 100644 assets/web/icons/key.svg create mode 100644 assets/web/icons/keyboard.d.ts create mode 100644 assets/web/icons/keyboard.js delete mode 100644 assets/web/icons/keyboard.svg create mode 100644 assets/web/icons/labs.d.ts create mode 100644 assets/web/icons/labs.js delete mode 100644 assets/web/icons/labs.svg create mode 100644 assets/web/icons/leave.d.ts create mode 100644 assets/web/icons/leave.js delete mode 100644 assets/web/icons/leave.svg create mode 100644 assets/web/icons/link.d.ts create mode 100644 assets/web/icons/link.js delete mode 100644 assets/web/icons/link.svg create mode 100644 assets/web/icons/list-bulleted.d.ts create mode 100644 assets/web/icons/list-bulleted.js delete mode 100644 assets/web/icons/list-bulleted.svg create mode 100644 assets/web/icons/list-numbered.d.ts create mode 100644 assets/web/icons/list-numbered.js delete mode 100644 assets/web/icons/list-numbered.svg create mode 100644 assets/web/icons/location-navigator-centred.d.ts create mode 100644 assets/web/icons/location-navigator-centred.js delete mode 100644 assets/web/icons/location-navigator-centred.svg create mode 100644 assets/web/icons/location-navigator.d.ts create mode 100644 assets/web/icons/location-navigator.js delete mode 100644 assets/web/icons/location-navigator.svg create mode 100644 assets/web/icons/location-pin-solid.d.ts create mode 100644 assets/web/icons/location-pin-solid.js delete mode 100644 assets/web/icons/location-pin-solid.svg create mode 100644 assets/web/icons/location-pin.d.ts create mode 100644 assets/web/icons/location-pin.js delete mode 100644 assets/web/icons/location-pin.svg create mode 100644 assets/web/icons/lock-off.d.ts create mode 100644 assets/web/icons/lock-off.js delete mode 100644 assets/web/icons/lock-off.svg create mode 100644 assets/web/icons/lock-solid.d.ts create mode 100644 assets/web/icons/lock-solid.js delete mode 100644 assets/web/icons/lock-solid.svg create mode 100644 assets/web/icons/lock.d.ts create mode 100644 assets/web/icons/lock.js delete mode 100644 assets/web/icons/lock.svg create mode 100644 assets/web/icons/mark-as-read.d.ts create mode 100644 assets/web/icons/mark-as-read.js delete mode 100644 assets/web/icons/mark-as-read.svg create mode 100644 assets/web/icons/mark-as-unread.d.ts create mode 100644 assets/web/icons/mark-as-unread.js delete mode 100644 assets/web/icons/mark-as-unread.svg create mode 100644 assets/web/icons/marker-read-receipts.d.ts create mode 100644 assets/web/icons/marker-read-receipts.js delete mode 100644 assets/web/icons/marker-read-receipts.svg create mode 100644 assets/web/icons/mention.d.ts create mode 100644 assets/web/icons/mention.js delete mode 100644 assets/web/icons/mention.svg create mode 100644 assets/web/icons/menu.d.ts create mode 100644 assets/web/icons/menu.js delete mode 100644 assets/web/icons/menu.svg create mode 100644 assets/web/icons/mic-off-solid.d.ts create mode 100644 assets/web/icons/mic-off-solid.js delete mode 100644 assets/web/icons/mic-off-solid.svg create mode 100644 assets/web/icons/mic-off.d.ts create mode 100644 assets/web/icons/mic-off.js delete mode 100644 assets/web/icons/mic-off.svg create mode 100644 assets/web/icons/mic-on-solid.d.ts create mode 100644 assets/web/icons/mic-on-solid.js delete mode 100644 assets/web/icons/mic-on-solid.svg create mode 100644 assets/web/icons/mic-on.d.ts create mode 100644 assets/web/icons/mic-on.js delete mode 100644 assets/web/icons/mic-on.svg create mode 100644 assets/web/icons/minus.d.ts create mode 100644 assets/web/icons/minus.js delete mode 100644 assets/web/icons/minus.svg create mode 100644 assets/web/icons/mobile.d.ts create mode 100644 assets/web/icons/mobile.js delete mode 100644 assets/web/icons/mobile.svg create mode 100644 assets/web/icons/notifications-off-solid.d.ts create mode 100644 assets/web/icons/notifications-off-solid.js delete mode 100644 assets/web/icons/notifications-off-solid.svg create mode 100644 assets/web/icons/notifications-off.d.ts create mode 100644 assets/web/icons/notifications-off.js delete mode 100644 assets/web/icons/notifications-off.svg create mode 100644 assets/web/icons/notifications-solid.d.ts create mode 100644 assets/web/icons/notifications-solid.js delete mode 100644 assets/web/icons/notifications-solid.svg create mode 100644 assets/web/icons/notifications.d.ts create mode 100644 assets/web/icons/notifications.js delete mode 100644 assets/web/icons/notifications.svg create mode 100644 assets/web/icons/offline.d.ts create mode 100644 assets/web/icons/offline.js delete mode 100644 assets/web/icons/offline.svg create mode 100644 assets/web/icons/overflow-horizontal.d.ts create mode 100644 assets/web/icons/overflow-horizontal.js delete mode 100644 assets/web/icons/overflow-horizontal.svg create mode 100644 assets/web/icons/overflow-vertical.d.ts create mode 100644 assets/web/icons/overflow-vertical.js delete mode 100644 assets/web/icons/overflow-vertical.svg create mode 100644 assets/web/icons/pause-solid.d.ts create mode 100644 assets/web/icons/pause-solid.js delete mode 100644 assets/web/icons/pause-solid.svg create mode 100644 assets/web/icons/pause.d.ts create mode 100644 assets/web/icons/pause.js delete mode 100644 assets/web/icons/pause.svg create mode 100644 assets/web/icons/pin-solid.d.ts create mode 100644 assets/web/icons/pin-solid.js delete mode 100644 assets/web/icons/pin-solid.svg create mode 100644 assets/web/icons/pin.d.ts create mode 100644 assets/web/icons/pin.js delete mode 100644 assets/web/icons/pin.svg create mode 100644 assets/web/icons/play-solid.d.ts create mode 100644 assets/web/icons/play-solid.js delete mode 100644 assets/web/icons/play-solid.svg create mode 100644 assets/web/icons/play.d.ts create mode 100644 assets/web/icons/play.js delete mode 100644 assets/web/icons/play.svg create mode 100644 assets/web/icons/plus.d.ts create mode 100644 assets/web/icons/plus.js delete mode 100644 assets/web/icons/plus.svg create mode 100644 assets/web/icons/polls-end.d.ts create mode 100644 assets/web/icons/polls-end.js delete mode 100644 assets/web/icons/polls-end.svg create mode 100644 assets/web/icons/polls.d.ts create mode 100644 assets/web/icons/polls.js delete mode 100644 assets/web/icons/polls.svg create mode 100644 assets/web/icons/pop-out.d.ts create mode 100644 assets/web/icons/pop-out.js delete mode 100644 assets/web/icons/pop-out.svg create mode 100644 assets/web/icons/preferences.d.ts create mode 100644 assets/web/icons/preferences.js delete mode 100644 assets/web/icons/preferences.svg create mode 100644 assets/web/icons/public.d.ts create mode 100644 assets/web/icons/public.js delete mode 100644 assets/web/icons/public.svg create mode 100644 assets/web/icons/qr-code.d.ts create mode 100644 assets/web/icons/qr-code.js delete mode 100644 assets/web/icons/qr-code.svg create mode 100644 assets/web/icons/quote.d.ts create mode 100644 assets/web/icons/quote.js delete mode 100644 assets/web/icons/quote.svg create mode 100644 assets/web/icons/reaction-add.d.ts create mode 100644 assets/web/icons/reaction-add.js delete mode 100644 assets/web/icons/reaction-add.svg create mode 100644 assets/web/icons/reaction.d.ts create mode 100644 assets/web/icons/reaction.js delete mode 100644 assets/web/icons/reaction.svg create mode 100644 assets/web/icons/reply.d.ts create mode 100644 assets/web/icons/reply.js delete mode 100644 assets/web/icons/reply.svg create mode 100644 assets/web/icons/restart.d.ts create mode 100644 assets/web/icons/restart.js delete mode 100644 assets/web/icons/restart.svg create mode 100644 assets/web/icons/search.d.ts create mode 100644 assets/web/icons/search.js delete mode 100644 assets/web/icons/search.svg create mode 100644 assets/web/icons/send-solid.d.ts create mode 100644 assets/web/icons/send-solid.js delete mode 100644 assets/web/icons/send-solid.svg create mode 100644 assets/web/icons/send.d.ts create mode 100644 assets/web/icons/send.js delete mode 100644 assets/web/icons/send.svg create mode 100644 assets/web/icons/settings-solid.d.ts create mode 100644 assets/web/icons/settings-solid.js delete mode 100644 assets/web/icons/settings-solid.svg create mode 100644 assets/web/icons/settings.d.ts create mode 100644 assets/web/icons/settings.js delete mode 100644 assets/web/icons/settings.svg create mode 100644 assets/web/icons/share-android.d.ts create mode 100644 assets/web/icons/share-android.js delete mode 100644 assets/web/icons/share-android.svg create mode 100644 assets/web/icons/share-ios.d.ts create mode 100644 assets/web/icons/share-ios.js delete mode 100644 assets/web/icons/share-ios.svg create mode 100644 assets/web/icons/share-screen-solid.d.ts create mode 100644 assets/web/icons/share-screen-solid.js delete mode 100644 assets/web/icons/share-screen-solid.svg create mode 100644 assets/web/icons/share-screen.d.ts create mode 100644 assets/web/icons/share-screen.js delete mode 100644 assets/web/icons/share-screen.svg create mode 100644 assets/web/icons/share.d.ts create mode 100644 assets/web/icons/share.js delete mode 100644 assets/web/icons/share.svg create mode 100644 assets/web/icons/sidebar.d.ts create mode 100644 assets/web/icons/sidebar.js delete mode 100644 assets/web/icons/sidebar.svg create mode 100644 assets/web/icons/sign-out.d.ts create mode 100644 assets/web/icons/sign-out.js delete mode 100644 assets/web/icons/sign-out.svg create mode 100644 assets/web/icons/spinner.d.ts create mode 100644 assets/web/icons/spinner.js delete mode 100644 assets/web/icons/spinner.svg create mode 100644 assets/web/icons/spotlight.d.ts create mode 100644 assets/web/icons/spotlight.js delete mode 100644 assets/web/icons/spotlight.svg create mode 100644 assets/web/icons/strikethrough.d.ts create mode 100644 assets/web/icons/strikethrough.js delete mode 100644 assets/web/icons/strikethrough.svg create mode 100644 assets/web/icons/switch-camera-solid.d.ts create mode 100644 assets/web/icons/switch-camera-solid.js delete mode 100644 assets/web/icons/switch-camera-solid.svg create mode 100644 assets/web/icons/take-photo-solid.d.ts create mode 100644 assets/web/icons/take-photo-solid.js delete mode 100644 assets/web/icons/take-photo-solid.svg create mode 100644 assets/web/icons/take-photo.d.ts create mode 100644 assets/web/icons/take-photo.js delete mode 100644 assets/web/icons/take-photo.svg create mode 100644 assets/web/icons/text-formatting.d.ts create mode 100644 assets/web/icons/text-formatting.js delete mode 100644 assets/web/icons/text-formatting.svg create mode 100644 assets/web/icons/threads-solid.d.ts create mode 100644 assets/web/icons/threads-solid.js delete mode 100644 assets/web/icons/threads-solid.svg create mode 100644 assets/web/icons/threads.d.ts create mode 100644 assets/web/icons/threads.js delete mode 100644 assets/web/icons/threads.svg create mode 100644 assets/web/icons/time.d.ts create mode 100644 assets/web/icons/time.js delete mode 100644 assets/web/icons/time.svg create mode 100644 assets/web/icons/underline.d.ts create mode 100644 assets/web/icons/underline.js delete mode 100644 assets/web/icons/underline.svg create mode 100644 assets/web/icons/unknown-solid.d.ts create mode 100644 assets/web/icons/unknown-solid.js delete mode 100644 assets/web/icons/unknown-solid.svg create mode 100644 assets/web/icons/unknown.d.ts create mode 100644 assets/web/icons/unknown.js delete mode 100644 assets/web/icons/unknown.svg create mode 100644 assets/web/icons/user-add-solid.d.ts create mode 100644 assets/web/icons/user-add-solid.js delete mode 100644 assets/web/icons/user-add-solid.svg create mode 100644 assets/web/icons/user-add.d.ts create mode 100644 assets/web/icons/user-add.js delete mode 100644 assets/web/icons/user-add.svg create mode 100644 assets/web/icons/user-profile-solid.d.ts create mode 100644 assets/web/icons/user-profile-solid.js delete mode 100644 assets/web/icons/user-profile-solid.svg create mode 100644 assets/web/icons/user-profile.d.ts create mode 100644 assets/web/icons/user-profile.js delete mode 100644 assets/web/icons/user-profile.svg create mode 100644 assets/web/icons/user-solid.d.ts create mode 100644 assets/web/icons/user-solid.js delete mode 100644 assets/web/icons/user-solid.svg create mode 100644 assets/web/icons/user.d.ts create mode 100644 assets/web/icons/user.js delete mode 100644 assets/web/icons/user.svg create mode 100644 assets/web/icons/verified.d.ts create mode 100644 assets/web/icons/verified.js delete mode 100644 assets/web/icons/verified.svg create mode 100644 assets/web/icons/video-call-declined-solid.d.ts create mode 100644 assets/web/icons/video-call-declined-solid.js delete mode 100644 assets/web/icons/video-call-declined-solid.svg create mode 100644 assets/web/icons/video-call-missed-solid.d.ts create mode 100644 assets/web/icons/video-call-missed-solid.js delete mode 100644 assets/web/icons/video-call-missed-solid.svg create mode 100644 assets/web/icons/video-call-off-solid.d.ts create mode 100644 assets/web/icons/video-call-off-solid.js delete mode 100644 assets/web/icons/video-call-off-solid.svg create mode 100644 assets/web/icons/video-call-off.d.ts create mode 100644 assets/web/icons/video-call-off.js delete mode 100644 assets/web/icons/video-call-off.svg create mode 100644 assets/web/icons/video-call-solid.d.ts create mode 100644 assets/web/icons/video-call-solid.js delete mode 100644 assets/web/icons/video-call-solid.svg create mode 100644 assets/web/icons/video-call.d.ts create mode 100644 assets/web/icons/video-call.js delete mode 100644 assets/web/icons/video-call.svg create mode 100644 assets/web/icons/visibility-off.d.ts create mode 100644 assets/web/icons/visibility-off.js delete mode 100644 assets/web/icons/visibility-off.svg create mode 100644 assets/web/icons/visibility-on.d.ts create mode 100644 assets/web/icons/visibility-on.js delete mode 100644 assets/web/icons/visibility-on.svg create mode 100644 assets/web/icons/voice-call.d.ts create mode 100644 assets/web/icons/voice-call.js delete mode 100644 assets/web/icons/voice-call.svg create mode 100644 assets/web/icons/volume-off-solid.d.ts create mode 100644 assets/web/icons/volume-off-solid.js delete mode 100644 assets/web/icons/volume-off-solid.svg create mode 100644 assets/web/icons/volume-off.d.ts create mode 100644 assets/web/icons/volume-off.js delete mode 100644 assets/web/icons/volume-off.svg create mode 100644 assets/web/icons/volume-on-solid.d.ts create mode 100644 assets/web/icons/volume-on-solid.js delete mode 100644 assets/web/icons/volume-on-solid.svg create mode 100644 assets/web/icons/volume-on.d.ts create mode 100644 assets/web/icons/volume-on.js delete mode 100644 assets/web/icons/volume-on.svg create mode 100644 assets/web/icons/warning.d.ts create mode 100644 assets/web/icons/warning.js delete mode 100644 assets/web/icons/warning.svg create mode 100644 assets/web/icons/web-browser.d.ts create mode 100644 assets/web/icons/web-browser.js delete mode 100644 assets/web/icons/web-browser.svg diff --git a/assets/web/icons/$icons.json b/assets/web/icons/$icons.json deleted file mode 100644 index 4dc8f83d..00000000 --- a/assets/web/icons/$icons.json +++ /dev/null @@ -1 +0,0 @@ -{"icon":{"admin":{"value":"icons/admin.svg","type":"icon"},"arrow-down":{"value":"icons/arrow-down.svg","type":"icon"},"arrow-left":{"value":"icons/arrow-left.svg","type":"icon"},"arrow-right":{"value":"icons/arrow-right.svg","type":"icon"},"arrow-up-right":{"value":"icons/arrow-up-right.svg","type":"icon"},"arrow-up":{"value":"icons/arrow-up.svg","type":"icon"},"attachment":{"value":"icons/attachment.svg","type":"icon"},"block":{"value":"icons/block.svg","type":"icon"},"bold":{"value":"icons/bold.svg","type":"icon"},"chart":{"value":"icons/chart.svg","type":"icon"},"chat-new":{"value":"icons/chat-new.svg","type":"icon"},"chat-problem":{"value":"icons/chat-problem.svg","type":"icon"},"chat-solid":{"value":"icons/chat-solid.svg","type":"icon"},"chat":{"value":"icons/chat.svg","type":"icon"},"check-circle-solid":{"value":"icons/check-circle-solid.svg","type":"icon"},"check-circle":{"value":"icons/check-circle.svg","type":"icon"},"check":{"value":"icons/check.svg","type":"icon"},"chevron-down":{"value":"icons/chevron-down.svg","type":"icon"},"chevron-left":{"value":"icons/chevron-left.svg","type":"icon"},"chevron-right":{"value":"icons/chevron-right.svg","type":"icon"},"chevron-up-down":{"value":"icons/chevron-up-down.svg","type":"icon"},"chevron-up":{"value":"icons/chevron-up.svg","type":"icon"},"circle":{"value":"icons/circle.svg","type":"icon"},"close":{"value":"icons/close.svg","type":"icon"},"cloud-solid":{"value":"icons/cloud-solid.svg","type":"icon"},"cloud":{"value":"icons/cloud.svg","type":"icon"},"code":{"value":"icons/code.svg","type":"icon"},"collapse":{"value":"icons/collapse.svg","type":"icon"},"company":{"value":"icons/company.svg","type":"icon"},"compose":{"value":"icons/compose.svg","type":"icon"},"computer":{"value":"icons/computer.svg","type":"icon"},"copy":{"value":"icons/copy.svg","type":"icon"},"dark-mode":{"value":"icons/dark-mode.svg","type":"icon"},"delete":{"value":"icons/delete.svg","type":"icon"},"devices":{"value":"icons/devices.svg","type":"icon"},"document":{"value":"icons/document.svg","type":"icon"},"download":{"value":"icons/download.svg","type":"icon"},"drag-grid":{"value":"icons/drag-grid.svg","type":"icon"},"drag-list":{"value":"icons/drag-list.svg","type":"icon"},"edit-solid":{"value":"icons/edit-solid.svg","type":"icon"},"edit":{"value":"icons/edit.svg","type":"icon"},"email-solid":{"value":"icons/email-solid.svg","type":"icon"},"email":{"value":"icons/email.svg","type":"icon"},"end-call":{"value":"icons/end-call.svg","type":"icon"},"error":{"value":"icons/error.svg","type":"icon"},"expand":{"value":"icons/expand.svg","type":"icon"},"export-archive":{"value":"icons/export-archive.svg","type":"icon"},"extensions-solid":{"value":"icons/extensions-solid.svg","type":"icon"},"extensions":{"value":"icons/extensions.svg","type":"icon"},"favourite-solid":{"value":"icons/favourite-solid.svg","type":"icon"},"favourite":{"value":"icons/favourite.svg","type":"icon"},"file-error":{"value":"icons/file-error.svg","type":"icon"},"files":{"value":"icons/files.svg","type":"icon"},"filter":{"value":"icons/filter.svg","type":"icon"},"forward":{"value":"icons/forward.svg","type":"icon"},"grid":{"value":"icons/grid.svg","type":"icon"},"help-solid":{"value":"icons/help-solid.svg","type":"icon"},"help":{"value":"icons/help.svg","type":"icon"},"history":{"value":"icons/history.svg","type":"icon"},"home-solid":{"value":"icons/home-solid.svg","type":"icon"},"home":{"value":"icons/home.svg","type":"icon"},"host":{"value":"icons/host.svg","type":"icon"},"image-error":{"value":"icons/image-error.svg","type":"icon"},"image":{"value":"icons/image.svg","type":"icon"},"indent-decrease":{"value":"icons/indent-decrease.svg","type":"icon"},"indent-increase":{"value":"icons/indent-increase.svg","type":"icon"},"info-solid":{"value":"icons/info-solid.svg","type":"icon"},"info":{"value":"icons/info.svg","type":"icon"},"inline-code":{"value":"icons/inline-code.svg","type":"icon"},"italic":{"value":"icons/italic.svg","type":"icon"},"key-off-solid":{"value":"icons/key-off-solid.svg","type":"icon"},"key-off":{"value":"icons/key-off.svg","type":"icon"},"key-solid":{"value":"icons/key-solid.svg","type":"icon"},"key":{"value":"icons/key.svg","type":"icon"},"keyboard":{"value":"icons/keyboard.svg","type":"icon"},"labs":{"value":"icons/labs.svg","type":"icon"},"leave":{"value":"icons/leave.svg","type":"icon"},"link":{"value":"icons/link.svg","type":"icon"},"list-bulleted":{"value":"icons/list-bulleted.svg","type":"icon"},"list-numbered":{"value":"icons/list-numbered.svg","type":"icon"},"location-navigator-centred":{"value":"icons/location-navigator-centred.svg","type":"icon"},"location-navigator":{"value":"icons/location-navigator.svg","type":"icon"},"location-pin-solid":{"value":"icons/location-pin-solid.svg","type":"icon"},"location-pin":{"value":"icons/location-pin.svg","type":"icon"},"lock-off":{"value":"icons/lock-off.svg","type":"icon"},"lock-solid":{"value":"icons/lock-solid.svg","type":"icon"},"lock":{"value":"icons/lock.svg","type":"icon"},"mark-as-read":{"value":"icons/mark-as-read.svg","type":"icon"},"mark-as-unread":{"value":"icons/mark-as-unread.svg","type":"icon"},"marker-read-receipts":{"value":"icons/marker-read-receipts.svg","type":"icon"},"mention":{"value":"icons/mention.svg","type":"icon"},"menu":{"value":"icons/menu.svg","type":"icon"},"mic-off-solid":{"value":"icons/mic-off-solid.svg","type":"icon"},"mic-off":{"value":"icons/mic-off.svg","type":"icon"},"mic-on-solid":{"value":"icons/mic-on-solid.svg","type":"icon"},"mic-on":{"value":"icons/mic-on.svg","type":"icon"},"minus":{"value":"icons/minus.svg","type":"icon"},"mobile":{"value":"icons/mobile.svg","type":"icon"},"notifications-off-solid":{"value":"icons/notifications-off-solid.svg","type":"icon"},"notifications-off":{"value":"icons/notifications-off.svg","type":"icon"},"notifications-solid":{"value":"icons/notifications-solid.svg","type":"icon"},"notifications":{"value":"icons/notifications.svg","type":"icon"},"offline":{"value":"icons/offline.svg","type":"icon"},"overflow-horizontal":{"value":"icons/overflow-horizontal.svg","type":"icon"},"overflow-vertical":{"value":"icons/overflow-vertical.svg","type":"icon"},"pause-solid":{"value":"icons/pause-solid.svg","type":"icon"},"pause":{"value":"icons/pause.svg","type":"icon"},"pin-solid":{"value":"icons/pin-solid.svg","type":"icon"},"pin":{"value":"icons/pin.svg","type":"icon"},"play-solid":{"value":"icons/play-solid.svg","type":"icon"},"play":{"value":"icons/play.svg","type":"icon"},"plus":{"value":"icons/plus.svg","type":"icon"},"polls-end":{"value":"icons/polls-end.svg","type":"icon"},"polls":{"value":"icons/polls.svg","type":"icon"},"pop-out":{"value":"icons/pop-out.svg","type":"icon"},"preferences":{"value":"icons/preferences.svg","type":"icon"},"public":{"value":"icons/public.svg","type":"icon"},"qr-code":{"value":"icons/qr-code.svg","type":"icon"},"quote":{"value":"icons/quote.svg","type":"icon"},"reaction-add":{"value":"icons/reaction-add.svg","type":"icon"},"reaction":{"value":"icons/reaction.svg","type":"icon"},"reply":{"value":"icons/reply.svg","type":"icon"},"restart":{"value":"icons/restart.svg","type":"icon"},"search":{"value":"icons/search.svg","type":"icon"},"send-solid":{"value":"icons/send-solid.svg","type":"icon"},"send":{"value":"icons/send.svg","type":"icon"},"settings-solid":{"value":"icons/settings-solid.svg","type":"icon"},"settings":{"value":"icons/settings.svg","type":"icon"},"share-android":{"value":"icons/share-android.svg","type":"icon"},"share-ios":{"value":"icons/share-ios.svg","type":"icon"},"share-screen-solid":{"value":"icons/share-screen-solid.svg","type":"icon"},"share-screen":{"value":"icons/share-screen.svg","type":"icon"},"share":{"value":"icons/share.svg","type":"icon"},"sidebar":{"value":"icons/sidebar.svg","type":"icon"},"sign-out":{"value":"icons/sign-out.svg","type":"icon"},"spinner":{"value":"icons/spinner.svg","type":"icon"},"spotlight":{"value":"icons/spotlight.svg","type":"icon"},"strikethrough":{"value":"icons/strikethrough.svg","type":"icon"},"switch-camera-solid":{"value":"icons/switch-camera-solid.svg","type":"icon"},"take-photo-solid":{"value":"icons/take-photo-solid.svg","type":"icon"},"take-photo":{"value":"icons/take-photo.svg","type":"icon"},"text-formatting":{"value":"icons/text-formatting.svg","type":"icon"},"threads-solid":{"value":"icons/threads-solid.svg","type":"icon"},"threads":{"value":"icons/threads.svg","type":"icon"},"time":{"value":"icons/time.svg","type":"icon"},"underline":{"value":"icons/underline.svg","type":"icon"},"unknown-solid":{"value":"icons/unknown-solid.svg","type":"icon"},"unknown":{"value":"icons/unknown.svg","type":"icon"},"user-add-solid":{"value":"icons/user-add-solid.svg","type":"icon"},"user-add":{"value":"icons/user-add.svg","type":"icon"},"user-profile-solid":{"value":"icons/user-profile-solid.svg","type":"icon"},"user-profile":{"value":"icons/user-profile.svg","type":"icon"},"user-solid":{"value":"icons/user-solid.svg","type":"icon"},"user":{"value":"icons/user.svg","type":"icon"},"verified":{"value":"icons/verified.svg","type":"icon"},"video-call-declined-solid":{"value":"icons/video-call-declined-solid.svg","type":"icon"},"video-call-missed-solid":{"value":"icons/video-call-missed-solid.svg","type":"icon"},"video-call-off-solid":{"value":"icons/video-call-off-solid.svg","type":"icon"},"video-call-off":{"value":"icons/video-call-off.svg","type":"icon"},"video-call-solid":{"value":"icons/video-call-solid.svg","type":"icon"},"video-call":{"value":"icons/video-call.svg","type":"icon"},"visibility-off":{"value":"icons/visibility-off.svg","type":"icon"},"visibility-on":{"value":"icons/visibility-on.svg","type":"icon"},"voice-call":{"value":"icons/voice-call.svg","type":"icon"},"volume-off-solid":{"value":"icons/volume-off-solid.svg","type":"icon"},"volume-off":{"value":"icons/volume-off.svg","type":"icon"},"volume-on-solid":{"value":"icons/volume-on-solid.svg","type":"icon"},"volume-on":{"value":"icons/volume-on.svg","type":"icon"},"warning":{"value":"icons/warning.svg","type":"icon"},"web-browser":{"value":"icons/web-browser.svg","type":"icon"}}} \ No newline at end of file diff --git a/assets/web/icons/admin.d.ts b/assets/web/icons/admin.d.ts new file mode 100644 index 00000000..2e16f0f9 --- /dev/null +++ b/assets/web/icons/admin.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * admin.svg + */ +declare const AdminIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default AdminIcon; diff --git a/assets/web/icons/admin.js b/assets/web/icons/admin.js new file mode 100644 index 00000000..e3173421 --- /dev/null +++ b/assets/web/icons/admin.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function AdminIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "m12 4.236-6 3V12c0 5.156 4.239 7.254 6 7.898 1.761-.644 6-2.742 6-7.898V7.236l-6-3Zm-.894-1.789a2 2 0 0 1 1.788 0l6 3A2 2 0 0 1 20 7.236V12c0 6.742-5.773 9.246-7.51 9.846-.32.111-.66.111-.98 0C9.774 21.246 4 18.742 4 12V7.236a2 2 0 0 1 1.106-1.789l6-3Z", + clipRule: "evenodd" + }) + }); +} +; +AdminIcon.displayName = "AdminIcon"; +export default AdminIcon; \ No newline at end of file diff --git a/assets/web/icons/admin.svg b/assets/web/icons/admin.svg deleted file mode 100644 index 5e798212..00000000 --- a/assets/web/icons/admin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/arrow-down.d.ts b/assets/web/icons/arrow-down.d.ts new file mode 100644 index 00000000..f1afcd3a --- /dev/null +++ b/assets/web/icons/arrow-down.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * arrow-down.svg + */ +declare const ArrowDownIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ArrowDownIcon; diff --git a/assets/web/icons/arrow-down.js b/assets/web/icons/arrow-down.js new file mode 100644 index 00000000..dc0ea7b6 --- /dev/null +++ b/assets/web/icons/arrow-down.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ArrowDownIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 4.5a1 1 0 0 1 1 1v10.586l4.293-4.293a1 1 0 0 1 1.414 1.414l-6 6a1 1 0 0 1-1.414 0l-6-6a1 1 0 1 1 1.414-1.414L11 16.086V5.5a1 1 0 0 1 1-1Z" + }) + }); +} +; +ArrowDownIcon.displayName = "ArrowDownIcon"; +export default ArrowDownIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-down.svg b/assets/web/icons/arrow-down.svg deleted file mode 100644 index cb4335c4..00000000 --- a/assets/web/icons/arrow-down.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/arrow-left.d.ts b/assets/web/icons/arrow-left.d.ts new file mode 100644 index 00000000..df219fba --- /dev/null +++ b/assets/web/icons/arrow-left.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * arrow-left.svg + */ +declare const ArrowLeftIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ArrowLeftIcon; diff --git a/assets/web/icons/arrow-left.js b/assets/web/icons/arrow-left.js new file mode 100644 index 00000000..05808df0 --- /dev/null +++ b/assets/web/icons/arrow-left.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ArrowLeftIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12.207 5.293a1 1 0 0 1 0 1.414L7.914 11H18.5a1 1 0 1 1 0 2H7.914l4.293 4.293a1 1 0 0 1-1.414 1.414l-6-6a1 1 0 0 1 0-1.414l6-6a1 1 0 0 1 1.414 0Z" + }) + }); +} +; +ArrowLeftIcon.displayName = "ArrowLeftIcon"; +export default ArrowLeftIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-left.svg b/assets/web/icons/arrow-left.svg deleted file mode 100644 index 22ad431c..00000000 --- a/assets/web/icons/arrow-left.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/arrow-right.d.ts b/assets/web/icons/arrow-right.d.ts new file mode 100644 index 00000000..7b8bee88 --- /dev/null +++ b/assets/web/icons/arrow-right.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * arrow-right.svg + */ +declare const ArrowRightIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ArrowRightIcon; diff --git a/assets/web/icons/arrow-right.js b/assets/web/icons/arrow-right.js new file mode 100644 index 00000000..947a2091 --- /dev/null +++ b/assets/web/icons/arrow-right.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ArrowRightIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M11.793 5.293a1 1 0 0 1 1.414 0l6 6a1 1 0 0 1 0 1.414l-6 6a1 1 0 0 1-1.414-1.414L16.086 13H5.5a1 1 0 1 1 0-2h10.586l-4.293-4.293a1 1 0 0 1 0-1.414Z" + }) + }); +} +; +ArrowRightIcon.displayName = "ArrowRightIcon"; +export default ArrowRightIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-right.svg b/assets/web/icons/arrow-right.svg deleted file mode 100644 index 3ea91f10..00000000 --- a/assets/web/icons/arrow-right.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/arrow-up-right.d.ts b/assets/web/icons/arrow-up-right.d.ts new file mode 100644 index 00000000..b46522d2 --- /dev/null +++ b/assets/web/icons/arrow-up-right.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * arrow-up-right.svg + */ +declare const ArrowUpRightIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ArrowUpRightIcon; diff --git a/assets/web/icons/arrow-up-right.js b/assets/web/icons/arrow-up-right.js new file mode 100644 index 00000000..5e178c7a --- /dev/null +++ b/assets/web/icons/arrow-up-right.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ArrowUpRightIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M17.924 6.617a.996.996 0 0 1 .076.38V15a1 1 0 1 1-2 0V9.414l-8.293 8.293a1 1 0 0 1-1.414-1.414L14.586 8H9a1 1 0 0 1 0-2h8a.997.997 0 0 1 .924.617Z" + }) + }); +} +; +ArrowUpRightIcon.displayName = "ArrowUpRightIcon"; +export default ArrowUpRightIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-up-right.svg b/assets/web/icons/arrow-up-right.svg deleted file mode 100644 index 05927870..00000000 --- a/assets/web/icons/arrow-up-right.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/arrow-up.d.ts b/assets/web/icons/arrow-up.d.ts new file mode 100644 index 00000000..dbc9942c --- /dev/null +++ b/assets/web/icons/arrow-up.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * arrow-up.svg + */ +declare const ArrowUpIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ArrowUpIcon; diff --git a/assets/web/icons/arrow-up.js b/assets/web/icons/arrow-up.js new file mode 100644 index 00000000..77c06ac6 --- /dev/null +++ b/assets/web/icons/arrow-up.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ArrowUpIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 19.5a1 1 0 0 0 1-1V7.914l4.293 4.293a1 1 0 0 0 1.414-1.414l-6-6a1 1 0 0 0-1.414 0l-6 6a1 1 0 1 0 1.414 1.414L11 7.914V18.5a1 1 0 0 0 1 1Z" + }) + }); +} +; +ArrowUpIcon.displayName = "ArrowUpIcon"; +export default ArrowUpIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-up.svg b/assets/web/icons/arrow-up.svg deleted file mode 100644 index 32c19a24..00000000 --- a/assets/web/icons/arrow-up.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/attachment.d.ts b/assets/web/icons/attachment.d.ts new file mode 100644 index 00000000..30956766 --- /dev/null +++ b/assets/web/icons/attachment.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * attachment.svg + */ +declare const AttachmentIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default AttachmentIcon; diff --git a/assets/web/icons/attachment.js b/assets/web/icons/attachment.js new file mode 100644 index 00000000..65eb3706 --- /dev/null +++ b/assets/web/icons/attachment.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function AttachmentIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M11.5 22c-1.533 0-2.833-.533-3.9-1.6C6.533 19.333 6 18.033 6 16.5V6c0-1.1.392-2.042 1.175-2.825C7.958 2.392 8.9 2 10 2s2.042.392 2.825 1.175C13.608 3.958 14 4.9 14 6v9.5c0 .7-.242 1.292-.725 1.775-.483.483-1.075.725-1.775.725s-1.292-.242-1.775-.725C9.242 16.792 9 16.2 9 15.5V6.75A.728.728 0 0 1 9.75 6a.729.729 0 0 1 .75.75v8.75c0 .283.096.52.287.712.192.192.43.288.713.288s.52-.096.713-.288a.968.968 0 0 0 .287-.712V6c0-.7-.242-1.292-.725-1.775C11.292 3.742 10.7 3.5 10 3.5s-1.292.242-1.775.725C7.742 4.708 7.5 5.3 7.5 6v10.5c0 1.1.392 2.042 1.175 2.825.783.783 1.725 1.175 2.825 1.175s2.042-.392 2.825-1.175c.783-.783 1.175-1.725 1.175-2.825V6.75a.728.728 0 0 1 .75-.75.728.728 0 0 1 .75.75v9.75c0 1.533-.533 2.833-1.6 3.9-1.067 1.067-2.367 1.6-3.9 1.6Z" + }) + }); +} +; +AttachmentIcon.displayName = "AttachmentIcon"; +export default AttachmentIcon; \ No newline at end of file diff --git a/assets/web/icons/attachment.svg b/assets/web/icons/attachment.svg deleted file mode 100644 index d1a5dc17..00000000 --- a/assets/web/icons/attachment.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/block.d.ts b/assets/web/icons/block.d.ts new file mode 100644 index 00000000..62b10e71 --- /dev/null +++ b/assets/web/icons/block.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * block.svg + */ +declare const BlockIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default BlockIcon; diff --git a/assets/web/icons/block.js b/assets/web/icons/block.js new file mode 100644 index 00000000..4d2b3e0c --- /dev/null +++ b/assets/web/icons/block.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function BlockIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm0-2c2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-.9-.146-1.767-.438-2.6A7.951 7.951 0 0 0 18.3 7.1L7.1 18.3c.7.55 1.467.97 2.3 1.262.833.292 1.7.438 2.6.438Zm-6.3-3.1L16.9 5.7a7.95 7.95 0 0 0-2.3-1.263A7.813 7.813 0 0 0 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 .9.146 1.767.438 2.6A7.95 7.95 0 0 0 5.7 16.9Z" + }) + }); +} +; +BlockIcon.displayName = "BlockIcon"; +export default BlockIcon; \ No newline at end of file diff --git a/assets/web/icons/block.svg b/assets/web/icons/block.svg deleted file mode 100644 index bb0b6cdf..00000000 --- a/assets/web/icons/block.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/bold.d.ts b/assets/web/icons/bold.d.ts new file mode 100644 index 00000000..cfeb8b45 --- /dev/null +++ b/assets/web/icons/bold.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * bold.svg + */ +declare const BoldIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default BoldIcon; diff --git a/assets/web/icons/bold.js b/assets/web/icons/bold.js new file mode 100644 index 00000000..59d97928 --- /dev/null +++ b/assets/web/icons/bold.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function BoldIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8.8 19c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 6.8 17V7c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 8.8 5h3.525c1.083 0 2.083.333 3 1 .917.667 1.375 1.592 1.375 2.775 0 .85-.192 1.504-.575 1.963-.383.458-.742.787-1.075.987.417.183.88.525 1.387 1.025.509.5.763 1.25.763 2.25 0 1.483-.542 2.52-1.625 3.113-1.083.591-2.1.887-3.05.887H8.8Zm1.025-2.8h2.6c.8 0 1.287-.204 1.462-.612.175-.409.263-.705.263-.888 0-.183-.088-.48-.263-.887-.175-.409-.687-.613-1.537-.613H9.825v3Zm0-5.7h2.325c.55 0 .95-.142 1.2-.425a1.4 1.4 0 0 0 .375-.95c0-.4-.142-.725-.425-.975-.283-.25-.65-.375-1.1-.375H9.825V10.5Z" + }) + }); +} +; +BoldIcon.displayName = "BoldIcon"; +export default BoldIcon; \ No newline at end of file diff --git a/assets/web/icons/bold.svg b/assets/web/icons/bold.svg deleted file mode 100644 index bc165486..00000000 --- a/assets/web/icons/bold.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chart.d.ts b/assets/web/icons/chart.d.ts new file mode 100644 index 00000000..1b2fbd97 --- /dev/null +++ b/assets/web/icons/chart.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chart.svg + */ +declare const ChartIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChartIcon; diff --git a/assets/web/icons/chart.js b/assets/web/icons/chart.js new file mode 100644 index 00000000..76489df7 --- /dev/null +++ b/assets/web/icons/chart.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChartIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8 17a.97.97 0 0 0 .713-.288A.968.968 0 0 0 9 16v-5a.968.968 0 0 0-.287-.713A.967.967 0 0 0 8 10a.967.967 0 0 0-.713.287A.968.968 0 0 0 7 11v5c0 .283.096.52.287.712.192.192.43.288.713.288Zm4 0a.97.97 0 0 0 .713-.288A.968.968 0 0 0 13 16V8a.967.967 0 0 0-.287-.713A.968.968 0 0 0 12 7a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 8v8c0 .283.096.52.287.712.192.192.43.288.713.288Zm4 0c.283 0 .52-.096.712-.288A.968.968 0 0 0 17 16v-2a.968.968 0 0 0-.288-.713A.968.968 0 0 0 16 13a.968.968 0 0 0-.713.287A.968.968 0 0 0 15 14v2c0 .283.096.52.287.712.192.192.43.288.713.288ZM5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }) + }); +} +; +ChartIcon.displayName = "ChartIcon"; +export default ChartIcon; \ No newline at end of file diff --git a/assets/web/icons/chart.svg b/assets/web/icons/chart.svg deleted file mode 100644 index 44e6fe64..00000000 --- a/assets/web/icons/chart.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chat-new.d.ts b/assets/web/icons/chat-new.d.ts new file mode 100644 index 00000000..a0ba7f7e --- /dev/null +++ b/assets/web/icons/chat-new.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chat-new.svg + */ +declare const ChatNewIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChatNewIcon; diff --git a/assets/web/icons/chat-new.js b/assets/web/icons/chat-new.js new file mode 100644 index 00000000..a2bf0b14 --- /dev/null +++ b/assets/web/icons/chat-new.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ChatNewIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M19 6h-2a.968.968 0 0 1-.712-.287A.967.967 0 0 1 16 5a.97.97 0 0 1 .288-.713A.968.968 0 0 1 17 4h2V2c0-.283.096-.52.288-.712A.968.968 0 0 1 20 1c.283 0 .52.096.712.288A.965.965 0 0 1 21 2v2h2a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 23 6h-2v2a.97.97 0 0 1-.288.713A.968.968 0 0 1 20 9a.968.968 0 0 1-.712-.287A.967.967 0 0 1 19 8V6Z" + }), /*#__PURE__*/_jsx("path", { + d: "M22 17v-6.341A5.99 5.99 0 0 1 20 11v6H6a2 2 0 0 0-1.414.586L4 18.172V5h10c0-.701.12-1.374.341-2H4a2 2 0 0 0-2 2v15.586c0 .89 1.077 1.337 1.707.707L6 19h14a2 2 0 0 0 2-2Z" + })] + }); +} +; +ChatNewIcon.displayName = "ChatNewIcon"; +export default ChatNewIcon; \ No newline at end of file diff --git a/assets/web/icons/chat-new.svg b/assets/web/icons/chat-new.svg deleted file mode 100644 index 2cc7c9fa..00000000 --- a/assets/web/icons/chat-new.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/chat-problem.d.ts b/assets/web/icons/chat-problem.d.ts new file mode 100644 index 00000000..a2728b8c --- /dev/null +++ b/assets/web/icons/chat-problem.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chat-problem.svg + */ +declare const ChatProblemIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChatProblemIcon; diff --git a/assets/web/icons/chat-problem.js b/assets/web/icons/chat-problem.js new file mode 100644 index 00000000..d1ab1a1a --- /dev/null +++ b/assets/web/icons/chat-problem.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ChatProblemIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M12.712 16.712A.968.968 0 0 1 12 17a.967.967 0 0 1-.713-.288A.968.968 0 0 1 11 16c0-.283.096-.52.287-.713A.967.967 0 0 1 12 15a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.712Zm0-3.999A.968.968 0 0 1 12 13a.967.967 0 0 1-.713-.287A.968.968 0 0 1 11 12V8c0-.283.096-.52.287-.713A.967.967 0 0 1 12 7a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v4a.97.97 0 0 1-.288.713Z" + }), /*#__PURE__*/_jsx("path", { + d: "M2.95 16.3a10.233 10.233 0 0 1-.713-2.1A10.168 10.168 0 0 1 2 12a9.74 9.74 0 0 1 .787-3.9 10.099 10.099 0 0 1 2.138-3.175c.9-.9 1.958-1.612 3.175-2.137A9.737 9.737 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.1 10.1 0 0 1 3.175 2.137c.9.9 1.612 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175 10.1 10.1 0 0 1-3.175 2.137A9.738 9.738 0 0 1 12 22c-.75 0-1.484-.08-2.2-.238a10.23 10.23 0 0 1-2.1-.712L2.75 22.5a.936.936 0 0 1-1-.25.936.936 0 0 1-.25-1l1.45-4.95Zm4.2 2.8a.949.949 0 0 1 .275-.063c.1-.008.191-.012.275-.012.15 0 .296.013.437.038.142.024.28.07.413.137a7.434 7.434 0 0 0 1.675.6c.583.133 1.175.2 1.775.2 2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.234 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 .6.066 1.192.2 1.775.133.583.333 1.142.6 1.675.116.217.179.446.187.688.009.241-.02.479-.087.712l-.95 3.2 3.2-.95Z" + })] + }); +} +; +ChatProblemIcon.displayName = "ChatProblemIcon"; +export default ChatProblemIcon; \ No newline at end of file diff --git a/assets/web/icons/chat-problem.svg b/assets/web/icons/chat-problem.svg deleted file mode 100644 index d32a3092..00000000 --- a/assets/web/icons/chat-problem.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/chat-solid.d.ts b/assets/web/icons/chat-solid.d.ts new file mode 100644 index 00000000..5c273892 --- /dev/null +++ b/assets/web/icons/chat-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chat-solid.svg + */ +declare const ChatSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChatSolidIcon; diff --git a/assets/web/icons/chat-solid.js b/assets/web/icons/chat-solid.js new file mode 100644 index 00000000..e6e0c268 --- /dev/null +++ b/assets/web/icons/chat-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChatSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2.95 16.3 1.5 21.25a.936.936 0 0 0 .25 1 .936.936 0 0 0 1 .25l4.95-1.45a10.23 10.23 0 0 0 2.1.712c.717.159 1.45.238 2.2.238a9.738 9.738 0 0 0 3.9-.788 10.098 10.098 0 0 0 3.175-2.137c.9-.9 1.613-1.958 2.137-3.175A9.738 9.738 0 0 0 22 12a9.738 9.738 0 0 0-.788-3.9 10.099 10.099 0 0 0-2.137-3.175c-.9-.9-1.958-1.612-3.175-2.137A9.738 9.738 0 0 0 12 2a9.738 9.738 0 0 0-3.9.788 10.099 10.099 0 0 0-3.175 2.137c-.9.9-1.612 1.958-2.137 3.175A9.738 9.738 0 0 0 2 12a10.179 10.179 0 0 0 .95 4.3Z" + }) + }); +} +; +ChatSolidIcon.displayName = "ChatSolidIcon"; +export default ChatSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/chat-solid.svg b/assets/web/icons/chat-solid.svg deleted file mode 100644 index ad0a8c9d..00000000 --- a/assets/web/icons/chat-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chat.d.ts b/assets/web/icons/chat.d.ts new file mode 100644 index 00000000..f9075f82 --- /dev/null +++ b/assets/web/icons/chat.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chat.svg + */ +declare const ChatIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChatIcon; diff --git a/assets/web/icons/chat.js b/assets/web/icons/chat.js new file mode 100644 index 00000000..9109250e --- /dev/null +++ b/assets/web/icons/chat.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChatIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m1.5 21.25 1.45-4.95a10.232 10.232 0 0 1-.712-2.1A10.167 10.167 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.737 9.737 0 0 1 12 22c-.75 0-1.483-.08-2.2-.238a10.23 10.23 0 0 1-2.1-.712L2.75 22.5a.936.936 0 0 1-1-.25.936.936 0 0 1-.25-1Zm2.45-1.2 3.2-.95a.949.949 0 0 1 .275-.063c.1-.008.192-.012.275-.012.15 0 .296.013.438.038.141.024.279.07.412.137a7.434 7.434 0 0 0 1.675.6c.583.133 1.175.2 1.775.2 2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 .6.067 1.192.2 1.775s.333 1.142.6 1.675c.117.217.18.446.188.688a2.29 2.29 0 0 1-.088.712l-.95 3.2Z" + }) + }); +} +; +ChatIcon.displayName = "ChatIcon"; +export default ChatIcon; \ No newline at end of file diff --git a/assets/web/icons/chat.svg b/assets/web/icons/chat.svg deleted file mode 100644 index bafbafea..00000000 --- a/assets/web/icons/chat.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/check-circle-solid.d.ts b/assets/web/icons/check-circle-solid.d.ts new file mode 100644 index 00000000..402c6d99 --- /dev/null +++ b/assets/web/icons/check-circle-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * check-circle-solid.svg + */ +declare const CheckCircleSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CheckCircleSolidIcon; diff --git a/assets/web/icons/check-circle-solid.js b/assets/web/icons/check-circle-solid.js new file mode 100644 index 00000000..61a1272b --- /dev/null +++ b/assets/web/icons/check-circle-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CheckCircleSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m10.6 13.8-2.15-2.15a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7L9.9 15.9c.2.2.433.3.7.3.267 0 .5-.1.7-.3l5.65-5.65a.948.948 0 0 0 .275-.7.948.948 0 0 0-.275-.7.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275L10.6 13.8ZM12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Z" + }) + }); +} +; +CheckCircleSolidIcon.displayName = "CheckCircleSolidIcon"; +export default CheckCircleSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/check-circle-solid.svg b/assets/web/icons/check-circle-solid.svg deleted file mode 100644 index 22ad4426..00000000 --- a/assets/web/icons/check-circle-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/check-circle.d.ts b/assets/web/icons/check-circle.d.ts new file mode 100644 index 00000000..964b2d29 --- /dev/null +++ b/assets/web/icons/check-circle.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * check-circle.svg + */ +declare const CheckCircleIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CheckCircleIcon; diff --git a/assets/web/icons/check-circle.js b/assets/web/icons/check-circle.js new file mode 100644 index 00000000..a7fc25b8 --- /dev/null +++ b/assets/web/icons/check-circle.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CheckCircleIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m10.6 13.8-2.15-2.15a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7L9.9 15.9c.2.2.433.3.7.3.267 0 .5-.1.7-.3l5.65-5.65a.948.948 0 0 0 .275-.7.948.948 0 0 0-.275-.7.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275L10.6 13.8ZM12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm0-2c2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 2.233.775 4.125 2.325 5.675C7.875 19.225 9.767 20 12 20Z" + }) + }); +} +; +CheckCircleIcon.displayName = "CheckCircleIcon"; +export default CheckCircleIcon; \ No newline at end of file diff --git a/assets/web/icons/check-circle.svg b/assets/web/icons/check-circle.svg deleted file mode 100644 index 89ed5ee5..00000000 --- a/assets/web/icons/check-circle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/check.d.ts b/assets/web/icons/check.d.ts new file mode 100644 index 00000000..f435ad2f --- /dev/null +++ b/assets/web/icons/check.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * check.svg + */ +declare const CheckIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CheckIcon; diff --git a/assets/web/icons/check.js b/assets/web/icons/check.js new file mode 100644 index 00000000..e88588e4 --- /dev/null +++ b/assets/web/icons/check.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CheckIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M9.55 17.575c-.133 0-.258-.02-.375-.063a.878.878 0 0 1-.325-.212L4.55 13c-.183-.183-.27-.42-.263-.713.009-.291.105-.529.288-.712a.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275L9.55 15.15l8.475-8.475c.183-.183.42-.275.712-.275s.53.092.713.275c.183.183.275.42.275.712s-.092.53-.275.713l-9.2 9.2c-.1.1-.208.17-.325.212a1.106 1.106 0 0 1-.375.063Z" + }) + }); +} +; +CheckIcon.displayName = "CheckIcon"; +export default CheckIcon; \ No newline at end of file diff --git a/assets/web/icons/check.svg b/assets/web/icons/check.svg deleted file mode 100644 index eb8b65d6..00000000 --- a/assets/web/icons/check.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chevron-down.d.ts b/assets/web/icons/chevron-down.d.ts new file mode 100644 index 00000000..cc281353 --- /dev/null +++ b/assets/web/icons/chevron-down.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chevron-down.svg + */ +declare const ChevronDownIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChevronDownIcon; diff --git a/assets/web/icons/chevron-down.js b/assets/web/icons/chevron-down.js new file mode 100644 index 00000000..33b29e55 --- /dev/null +++ b/assets/web/icons/chevron-down.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChevronDownIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 14.95c-.133 0-.258-.02-.375-.063a.878.878 0 0 1-.325-.212l-4.6-4.6a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275l3.9 3.9 3.9-3.9a.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7l-4.6 4.6c-.1.1-.208.17-.325.212a1.105 1.105 0 0 1-.375.063Z" + }) + }); +} +; +ChevronDownIcon.displayName = "ChevronDownIcon"; +export default ChevronDownIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-down.svg b/assets/web/icons/chevron-down.svg deleted file mode 100644 index 9d07f262..00000000 --- a/assets/web/icons/chevron-down.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chevron-left.d.ts b/assets/web/icons/chevron-left.d.ts new file mode 100644 index 00000000..3c7ed1c4 --- /dev/null +++ b/assets/web/icons/chevron-left.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chevron-left.svg + */ +declare const ChevronLeftIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChevronLeftIcon; diff --git a/assets/web/icons/chevron-left.js b/assets/web/icons/chevron-left.js new file mode 100644 index 00000000..b3b10dc1 --- /dev/null +++ b/assets/web/icons/chevron-left.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChevronLeftIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m13.3 17.3-4.6-4.6a.877.877 0 0 1-.212-.325A1.107 1.107 0 0 1 8.425 12c0-.133.02-.258.063-.375A.877.877 0 0 1 8.7 11.3l4.6-4.6a.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7L10.8 12l3.9 3.9a.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7.948.948 0 0 1-.7.275.949.949 0 0 1-.7-.275Z" + }) + }); +} +; +ChevronLeftIcon.displayName = "ChevronLeftIcon"; +export default ChevronLeftIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-left.svg b/assets/web/icons/chevron-left.svg deleted file mode 100644 index 85b409d4..00000000 --- a/assets/web/icons/chevron-left.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chevron-right.d.ts b/assets/web/icons/chevron-right.d.ts new file mode 100644 index 00000000..aa28b3a3 --- /dev/null +++ b/assets/web/icons/chevron-right.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chevron-right.svg + */ +declare const ChevronRightIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChevronRightIcon; diff --git a/assets/web/icons/chevron-right.js b/assets/web/icons/chevron-right.js new file mode 100644 index 00000000..894ad7fd --- /dev/null +++ b/assets/web/icons/chevron-right.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChevronRightIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8.7 17.3a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7l3.9-3.9-3.9-3.9a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275l4.6 4.6c.1.1.17.208.213.325.041.117.062.242.062.375s-.02.258-.063.375a.876.876 0 0 1-.212.325l-4.6 4.6a.948.948 0 0 1-.7.275.948.948 0 0 1-.7-.275Z" + }) + }); +} +; +ChevronRightIcon.displayName = "ChevronRightIcon"; +export default ChevronRightIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-right.svg b/assets/web/icons/chevron-right.svg deleted file mode 100644 index c06bba53..00000000 --- a/assets/web/icons/chevron-right.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chevron-up-down.d.ts b/assets/web/icons/chevron-up-down.d.ts new file mode 100644 index 00000000..462eb68c --- /dev/null +++ b/assets/web/icons/chevron-up-down.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chevron-up-down.svg + */ +declare const ChevronUpDownIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChevronUpDownIcon; diff --git a/assets/web/icons/chevron-up-down.js b/assets/web/icons/chevron-up-down.js new file mode 100644 index 00000000..849e4bae --- /dev/null +++ b/assets/web/icons/chevron-up-down.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChevronUpDownIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8.225 8.325C8.042 8.142 7.95 7.9 7.95 7.6s.092-.542.275-.725L11.3 3.8c.1-.1.208-.17.325-.213a1.218 1.218 0 0 1 .762 0 .68.68 0 0 1 .313.213l3.1 3.1c.183.183.27.42.262.712-.008.292-.104.53-.287.713-.183.183-.425.275-.725.275s-.542-.092-.725-.275L12 6 9.65 8.35c-.183.183-.42.27-.713.262a1.007 1.007 0 0 1-.712-.287ZM12 20.575a.941.941 0 0 1-.375-.075 1.315 1.315 0 0 1-.325-.2l-3.075-3.075c-.183-.183-.275-.425-.275-.725s.092-.542.275-.725c.183-.183.425-.275.725-.275s.542.092.725.275L12 18.1l2.35-2.35c.183-.183.42-.27.713-.262.291.008.529.104.712.287.183.183.275.425.275.725s-.092.542-.275.725L12.7 20.3a1.034 1.034 0 0 1-.7.275Z" + }) + }); +} +; +ChevronUpDownIcon.displayName = "ChevronUpDownIcon"; +export default ChevronUpDownIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-up-down.svg b/assets/web/icons/chevron-up-down.svg deleted file mode 100644 index 5d7521a3..00000000 --- a/assets/web/icons/chevron-up-down.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/chevron-up.d.ts b/assets/web/icons/chevron-up.d.ts new file mode 100644 index 00000000..67c22aa0 --- /dev/null +++ b/assets/web/icons/chevron-up.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * chevron-up.svg + */ +declare const ChevronUpIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ChevronUpIcon; diff --git a/assets/web/icons/chevron-up.js b/assets/web/icons/chevron-up.js new file mode 100644 index 00000000..f66f5a2b --- /dev/null +++ b/assets/web/icons/chevron-up.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ChevronUpIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m12 10.775-3.9 3.9a.948.948 0 0 1-.7.275.948.948 0 0 1-.7-.275.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7l4.6-4.6c.1-.1.208-.17.325-.213.117-.041.242-.062.375-.062s.258.02.375.062a.878.878 0 0 1 .325.213l4.6 4.6a.948.948 0 0 1 .275.7.949.949 0 0 1-.275.7.949.949 0 0 1-.7.275.948.948 0 0 1-.7-.275l-3.9-3.9Z" + }) + }); +} +; +ChevronUpIcon.displayName = "ChevronUpIcon"; +export default ChevronUpIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-up.svg b/assets/web/icons/chevron-up.svg deleted file mode 100644 index 5a27c7ff..00000000 --- a/assets/web/icons/chevron-up.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/circle.d.ts b/assets/web/icons/circle.d.ts new file mode 100644 index 00000000..53841b45 --- /dev/null +++ b/assets/web/icons/circle.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * circle.svg + */ +declare const CircleIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CircleIcon; diff --git a/assets/web/icons/circle.js b/assets/web/icons/circle.js new file mode 100644 index 00000000..5f21d863 --- /dev/null +++ b/assets/web/icons/circle.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CircleIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137A10.1 10.1 0 0 1 2.788 15.9 9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.613 3.175-2.138A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.787 10.098 10.098 0 0 1 3.175 2.138c.9.9 1.613 1.958 2.137 3.175A9.737 9.737 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.1 10.1 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm0-2c2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 2.233.775 4.125 2.325 5.675C7.875 19.225 9.767 20 12 20Z" + }) + }); +} +; +CircleIcon.displayName = "CircleIcon"; +export default CircleIcon; \ No newline at end of file diff --git a/assets/web/icons/circle.svg b/assets/web/icons/circle.svg deleted file mode 100644 index 09fa3aa0..00000000 --- a/assets/web/icons/circle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/close.d.ts b/assets/web/icons/close.d.ts new file mode 100644 index 00000000..5c14613c --- /dev/null +++ b/assets/web/icons/close.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * close.svg + */ +declare const CloseIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CloseIcon; diff --git a/assets/web/icons/close.js b/assets/web/icons/close.js new file mode 100644 index 00000000..6c09443d --- /dev/null +++ b/assets/web/icons/close.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CloseIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6.293 6.293a1 1 0 0 1 1.414 0L12 10.586l4.293-4.293a1 1 0 1 1 1.414 1.414L13.414 12l4.293 4.293a1 1 0 0 1-1.414 1.414L12 13.414l-4.293 4.293a1 1 0 0 1-1.414-1.414L10.586 12 6.293 7.707a1 1 0 0 1 0-1.414Z" + }) + }); +} +; +CloseIcon.displayName = "CloseIcon"; +export default CloseIcon; \ No newline at end of file diff --git a/assets/web/icons/close.svg b/assets/web/icons/close.svg deleted file mode 100644 index 65b143b3..00000000 --- a/assets/web/icons/close.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/cloud-solid.d.ts b/assets/web/icons/cloud-solid.d.ts new file mode 100644 index 00000000..6777e327 --- /dev/null +++ b/assets/web/icons/cloud-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * cloud-solid.svg + */ +declare const CloudSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CloudSolidIcon; diff --git a/assets/web/icons/cloud-solid.js b/assets/web/icons/cloud-solid.js new file mode 100644 index 00000000..74b420cb --- /dev/null +++ b/assets/web/icons/cloud-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CloudSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M7 20a5 5 0 0 1-.985-9.903 5.5 5.5 0 0 1 9.734-3.09 4 4 0 0 1 4.187 4.708A4.5 4.5 0 0 1 18 19.973V20H7Z" + }) + }); +} +; +CloudSolidIcon.displayName = "CloudSolidIcon"; +export default CloudSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/cloud-solid.svg b/assets/web/icons/cloud-solid.svg deleted file mode 100644 index 0ec0064f..00000000 --- a/assets/web/icons/cloud-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/cloud.d.ts b/assets/web/icons/cloud.d.ts new file mode 100644 index 00000000..c0e5f60a --- /dev/null +++ b/assets/web/icons/cloud.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * cloud.svg + */ +declare const CloudIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CloudIcon; diff --git a/assets/web/icons/cloud.js b/assets/web/icons/cloud.js new file mode 100644 index 00000000..d6df6bee --- /dev/null +++ b/assets/web/icons/cloud.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CloudIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "m7.9 11.76-1.493.298A3.002 3.002 0 0 0 7 18h10.641l.14-.015a2.5 2.5 0 0 0 1.071-4.588l-1.121-.724.237-1.313a2 2 0 0 0-2.095-2.356l-1.02.063-.648-.789a3.5 3.5 0 0 0-6.195 1.963L7.9 11.76ZM18 19.973V20H7a5 5 0 0 1-.985-9.903 5.5 5.5 0 0 1 9.734-3.09 4 4 0 0 1 4.187 4.708A4.5 4.5 0 0 1 18 19.973Z", + clipRule: "evenodd" + }) + }); +} +; +CloudIcon.displayName = "CloudIcon"; +export default CloudIcon; \ No newline at end of file diff --git a/assets/web/icons/cloud.svg b/assets/web/icons/cloud.svg deleted file mode 100644 index 7224a261..00000000 --- a/assets/web/icons/cloud.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/code.d.ts b/assets/web/icons/code.d.ts new file mode 100644 index 00000000..ae451a51 --- /dev/null +++ b/assets/web/icons/code.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * code.svg + */ +declare const CodeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CodeIcon; diff --git a/assets/web/icons/code.js b/assets/web/icons/code.js new file mode 100644 index 00000000..92b8f75a --- /dev/null +++ b/assets/web/icons/code.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CodeIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m8.825 12 1.475-1.475c.2-.2.3-.433.3-.7 0-.267-.1-.5-.3-.7-.2-.2-.438-.3-.713-.3-.274 0-.512.1-.712.3L6.7 11.3c-.1.1-.17.208-.213.325a1.107 1.107 0 0 0-.062.375c0 .133.02.258.063.375a.877.877 0 0 0 .212.325l2.175 2.175c.2.2.438.3.713.3.275 0 .512-.1.712-.3.2-.2.3-.433.3-.7 0-.267-.1-.5-.3-.7L8.825 12Zm6.35 0L13.7 13.475c-.2.2-.3.433-.3.7 0 .267.1.5.3.7.2.2.438.3.713.3.274 0 .512-.1.712-.3L17.3 12.7c.1-.1.17-.208.212-.325.042-.117.063-.242.063-.375s-.02-.258-.063-.375a.877.877 0 0 0-.212-.325l-2.175-2.175a.999.999 0 0 0-1.425 0c-.2.2-.3.433-.3.7 0 .267.1.5.3.7L15.175 12ZM5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }) + }); +} +; +CodeIcon.displayName = "CodeIcon"; +export default CodeIcon; \ No newline at end of file diff --git a/assets/web/icons/code.svg b/assets/web/icons/code.svg deleted file mode 100644 index b72b5e43..00000000 --- a/assets/web/icons/code.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/collapse.d.ts b/assets/web/icons/collapse.d.ts new file mode 100644 index 00000000..c86e144d --- /dev/null +++ b/assets/web/icons/collapse.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * collapse.svg + */ +declare const CollapseIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CollapseIcon; diff --git a/assets/web/icons/collapse.js b/assets/web/icons/collapse.js new file mode 100644 index 00000000..8c3df7fe --- /dev/null +++ b/assets/web/icons/collapse.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CollapseIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 11.034a.996.996 0 0 0 .29.702l.005.005c.18.18.43.29.705.29h8a1 1 0 0 0 0-2h-5.586L22 3.445a1 1 0 0 0-1.414-1.414L14 8.617V3.031a1 1 0 1 0-2 0v8.003Zm0 1.963a.997.997 0 0 0-.29-.702l-.005-.004A.997.997 0 0 0 11 12H3a1 1 0 1 0 0 2h5.586L2 20.586A1 1 0 1 0 3.414 22L10 15.414V21a1 1 0 0 0 2 0v-8.003Z" + }) + }); +} +; +CollapseIcon.displayName = "CollapseIcon"; +export default CollapseIcon; \ No newline at end of file diff --git a/assets/web/icons/collapse.svg b/assets/web/icons/collapse.svg deleted file mode 100644 index c66c4a5d..00000000 --- a/assets/web/icons/collapse.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/company.d.ts b/assets/web/icons/company.d.ts new file mode 100644 index 00000000..a07b14c7 --- /dev/null +++ b/assets/web/icons/company.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * company.svg + */ +declare const CompanyIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CompanyIcon; diff --git a/assets/web/icons/company.js b/assets/web/icons/company.js new file mode 100644 index 00000000..7692256a --- /dev/null +++ b/assets/web/icons/company.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function CompanyIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M14 7h5a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h7a2 2 0 0 1 2 2v2Zm-2-2H5v2h3a1 1 0 0 1 0 2H5v2h3a1 1 0 1 1 0 2H5v2h3a1 1 0 1 1 0 2H5v2h7V5Zm2 4v2h2a1 1 0 1 1 0 2h-2v2h2a1 1 0 1 1 0 2h-2v2h5V9h-5Z" + }) + }); +} +; +CompanyIcon.displayName = "CompanyIcon"; +export default CompanyIcon; \ No newline at end of file diff --git a/assets/web/icons/company.svg b/assets/web/icons/company.svg deleted file mode 100644 index 7d26bca2..00000000 --- a/assets/web/icons/company.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/compose.d.ts b/assets/web/icons/compose.d.ts new file mode 100644 index 00000000..7b17c7d8 --- /dev/null +++ b/assets/web/icons/compose.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * compose.svg + */ +declare const ComposeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ComposeIcon; diff --git a/assets/web/icons/compose.js b/assets/web/icons/compose.js new file mode 100644 index 00000000..58c479d8 --- /dev/null +++ b/assets/web/icons/compose.js @@ -0,0 +1,25 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ComposeIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M3 5a2 2 0 0 1 2-2h6a1 1 0 1 1 0 2H5v14h14v-6a1 1 0 1 1 2 0v6a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5Z", + clipRule: "evenodd" + }), /*#__PURE__*/_jsx("path", { + d: "m8.023 14.711 1.331-3.992a1 1 0 0 1 1.656-.391l2.662 2.662a1 1 0 0 1-.391 1.655l-3.993 1.331a1 1 0 0 1-1.265-1.265Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M19.765 2.82a2 2 0 0 0-2.828 0L9.866 9.89c-.195.195-.341.42-.439.66a1.024 1.024 0 0 0-.073.168l-1.33 3.992a1 1 0 0 0 1.264 1.265l3.993-1.33c.059-.02.115-.045.167-.074.24-.097.466-.243.66-.438l7.072-7.071a2 2 0 0 0 0-2.829L19.765 2.82Zm-6.717 9.546 6.717-6.718-1.414-1.414-6.717 6.718 1.414 1.414Z", + clipRule: "evenodd" + })] + }); +} +; +ComposeIcon.displayName = "ComposeIcon"; +export default ComposeIcon; \ No newline at end of file diff --git a/assets/web/icons/compose.svg b/assets/web/icons/compose.svg deleted file mode 100644 index 519c4f16..00000000 --- a/assets/web/icons/compose.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/assets/web/icons/computer.d.ts b/assets/web/icons/computer.d.ts new file mode 100644 index 00000000..a60b826f --- /dev/null +++ b/assets/web/icons/computer.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * computer.svg + */ +declare const ComputerIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ComputerIcon; diff --git a/assets/web/icons/computer.js b/assets/web/icons/computer.js new file mode 100644 index 00000000..15f79e18 --- /dev/null +++ b/assets/web/icons/computer.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ComputerIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 18c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 16V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 4 3h16c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v11c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 18H4Zm0-2h16V5H4v11Zm-2 5a.967.967 0 0 1-.712-.288A.968.968 0 0 1 1 20c0-.283.096-.52.288-.712A.967.967 0 0 1 2 19h20c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 22 21H2Z" + }) + }); +} +; +ComputerIcon.displayName = "ComputerIcon"; +export default ComputerIcon; \ No newline at end of file diff --git a/assets/web/icons/computer.svg b/assets/web/icons/computer.svg deleted file mode 100644 index 6c26de0b..00000000 --- a/assets/web/icons/computer.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/copy.d.ts b/assets/web/icons/copy.d.ts new file mode 100644 index 00000000..ab4afe62 --- /dev/null +++ b/assets/web/icons/copy.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * copy.svg + */ +declare const CopyIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default CopyIcon; diff --git a/assets/web/icons/copy.js b/assets/web/icons/copy.js new file mode 100644 index 00000000..a2716e50 --- /dev/null +++ b/assets/web/icons/copy.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function CopyIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M14 5H5v9h1a1 1 0 1 1 0 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h9a2 2 0 0 1 2 2v1a1 1 0 1 1-2 0V5Z" + }), /*#__PURE__*/_jsx("path", { + d: "M8 10a2 2 0 0 1 2-2h9a2 2 0 0 1 2 2v9a2 2 0 0 1-2 2h-9a2 2 0 0 1-2-2v-9Zm2 0v9h9v-9h-9Z" + })] + }); +} +; +CopyIcon.displayName = "CopyIcon"; +export default CopyIcon; \ No newline at end of file diff --git a/assets/web/icons/copy.svg b/assets/web/icons/copy.svg deleted file mode 100644 index 0e441187..00000000 --- a/assets/web/icons/copy.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/dark-mode.d.ts b/assets/web/icons/dark-mode.d.ts new file mode 100644 index 00000000..f339d081 --- /dev/null +++ b/assets/web/icons/dark-mode.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * dark-mode.svg + */ +declare const DarkModeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DarkModeIcon; diff --git a/assets/web/icons/dark-mode.js b/assets/web/icons/dark-mode.js new file mode 100644 index 00000000..cf98afcb --- /dev/null +++ b/assets/web/icons/dark-mode.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DarkModeIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M17.983 17.31C13.332 15.66 10 11.22 10 6c0-.604.045-1.199.132-1.78a8 8 0 1 0 7.852 13.091Zm1.82-1.552c.668.15 1.094.863.737 1.447A9.994 9.994 0 0 1 12 22C6.477 22 2 17.523 2 12S6.477 2 12 2c.402 0 .653.416.524.797A9.988 9.988 0 0 0 12 6c0 4.768 3.337 8.757 7.803 9.758Z", + clipRule: "evenodd" + }) + }); +} +; +DarkModeIcon.displayName = "DarkModeIcon"; +export default DarkModeIcon; \ No newline at end of file diff --git a/assets/web/icons/dark-mode.svg b/assets/web/icons/dark-mode.svg deleted file mode 100644 index 01b469de..00000000 --- a/assets/web/icons/dark-mode.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/delete.d.ts b/assets/web/icons/delete.d.ts new file mode 100644 index 00000000..5faaae43 --- /dev/null +++ b/assets/web/icons/delete.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * delete.svg + */ +declare const DeleteIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DeleteIcon; diff --git a/assets/web/icons/delete.js b/assets/web/icons/delete.js new file mode 100644 index 00000000..e7920510 --- /dev/null +++ b/assets/web/icons/delete.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DeleteIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M7 21c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 5 19V6a.968.968 0 0 1-.713-.287A.968.968 0 0 1 4 5c0-.283.096-.52.287-.713A.968.968 0 0 1 5 4h4a.97.97 0 0 1 .287-.712A.968.968 0 0 1 10 3h4a.97.97 0 0 1 .713.288A.968.968 0 0 1 15 4h4a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 19 6v13c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 17 21H7ZM7 6v13h10V6H7Zm2 10c0 .283.096.52.287.712.192.192.43.288.713.288s.52-.096.713-.288A.968.968 0 0 0 11 16V9a.967.967 0 0 0-.287-.713A.968.968 0 0 0 10 8a.968.968 0 0 0-.713.287A.968.968 0 0 0 9 9v7Zm4 0c0 .283.096.52.287.712.192.192.43.288.713.288s.52-.096.713-.288A.968.968 0 0 0 15 16V9a.967.967 0 0 0-.287-.713A.968.968 0 0 0 14 8a.968.968 0 0 0-.713.287A.967.967 0 0 0 13 9v7Z" + }) + }); +} +; +DeleteIcon.displayName = "DeleteIcon"; +export default DeleteIcon; \ No newline at end of file diff --git a/assets/web/icons/delete.svg b/assets/web/icons/delete.svg deleted file mode 100644 index c68e090c..00000000 --- a/assets/web/icons/delete.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/devices.d.ts b/assets/web/icons/devices.d.ts new file mode 100644 index 00000000..5eee22a7 --- /dev/null +++ b/assets/web/icons/devices.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * devices.svg + */ +declare const DevicesIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DevicesIcon; diff --git a/assets/web/icons/devices.js b/assets/web/icons/devices.js new file mode 100644 index 00000000..2bb3882d --- /dev/null +++ b/assets/web/icons/devices.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DevicesIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M3.5 20c-.417 0-.77-.146-1.063-.438A1.447 1.447 0 0 1 2 18.5c0-.417.146-.77.438-1.063A1.446 1.446 0 0 1 3.5 17H4V6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 4h14a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 6H6v11h4.5c.417 0 .77.146 1.063.438.291.291.437.645.437 1.062 0 .417-.146.77-.438 1.063A1.446 1.446 0 0 1 10.5 20h-7ZM15 20a.968.968 0 0 1-.713-.288A.968.968 0 0 1 14 19V9c0-.283.096-.52.287-.713A.968.968 0 0 1 15 8h6a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v10c0 .283-.096.52-.288.712A.968.968 0 0 1 21 20h-6Zm1-3h4v-7h-4v7Z" + }) + }); +} +; +DevicesIcon.displayName = "DevicesIcon"; +export default DevicesIcon; \ No newline at end of file diff --git a/assets/web/icons/devices.svg b/assets/web/icons/devices.svg deleted file mode 100644 index 27cae1cc..00000000 --- a/assets/web/icons/devices.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/document.d.ts b/assets/web/icons/document.d.ts new file mode 100644 index 00000000..6555dfeb --- /dev/null +++ b/assets/web/icons/document.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * document.svg + */ +declare const DocumentIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DocumentIcon; diff --git a/assets/web/icons/document.js b/assets/web/icons/document.js new file mode 100644 index 00000000..beed309a --- /dev/null +++ b/assets/web/icons/document.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DocumentIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M9 18h6a.97.97 0 0 0 .713-.288A.968.968 0 0 0 16 17a.968.968 0 0 0-.287-.712A.968.968 0 0 0 15 16H9a.967.967 0 0 0-.713.288A.968.968 0 0 0 8 17c0 .283.096.52.287.712.192.192.43.288.713.288Zm0-4h6c.283 0 .52-.096.713-.287A.968.968 0 0 0 16 13a.968.968 0 0 0-.287-.713A.968.968 0 0 0 15 12H9a.967.967 0 0 0-.713.287A.968.968 0 0 0 8 13c0 .283.096.52.287.713.192.191.43.287.713.287Zm-3 8c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V4c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 6 2h7.175a1.975 1.975 0 0 1 1.4.575l4.85 4.85a1.975 1.975 0 0 1 .575 1.4V20c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6Zm7-14V4H6v16h12V9h-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 13 8Z" + }) + }); +} +; +DocumentIcon.displayName = "DocumentIcon"; +export default DocumentIcon; \ No newline at end of file diff --git a/assets/web/icons/document.svg b/assets/web/icons/document.svg deleted file mode 100644 index 0ed7adfa..00000000 --- a/assets/web/icons/document.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/download.d.ts b/assets/web/icons/download.d.ts new file mode 100644 index 00000000..ab62628c --- /dev/null +++ b/assets/web/icons/download.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * download.svg + */ +declare const DownloadIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DownloadIcon; diff --git a/assets/web/icons/download.js b/assets/web/icons/download.js new file mode 100644 index 00000000..48d7d0e3 --- /dev/null +++ b/assets/web/icons/download.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DownloadIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 15.575c-.133 0-.258-.02-.375-.063a.877.877 0 0 1-.325-.212l-3.6-3.6a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7c.183-.183.42-.28.712-.288.292-.008.53.08.713.263L11 12.15V5c0-.283.096-.52.287-.713A.968.968 0 0 1 12 4c.283 0 .52.096.713.287.191.192.287.43.287.713v7.15l1.875-1.875c.183-.183.42-.27.713-.263.291.009.529.105.712.288a.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7l-3.6 3.6c-.1.1-.208.17-.325.212a1.106 1.106 0 0 1-.375.063ZM6 20c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18v-2c0-.283.096-.52.287-.713A.967.967 0 0 1 5 15c.283 0 .52.096.713.287.191.192.287.43.287.713v2h12v-2a.97.97 0 0 1 .288-.713A.968.968 0 0 1 19 15a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v2c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6Z" + }) + }); +} +; +DownloadIcon.displayName = "DownloadIcon"; +export default DownloadIcon; \ No newline at end of file diff --git a/assets/web/icons/download.svg b/assets/web/icons/download.svg deleted file mode 100644 index 5fccf6bc..00000000 --- a/assets/web/icons/download.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/drag-grid.d.ts b/assets/web/icons/drag-grid.d.ts new file mode 100644 index 00000000..c7161d12 --- /dev/null +++ b/assets/web/icons/drag-grid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * drag-grid.svg + */ +declare const DragGridIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DragGridIcon; diff --git a/assets/web/icons/drag-grid.js b/assets/web/icons/drag-grid.js new file mode 100644 index 00000000..94f1ee5d --- /dev/null +++ b/assets/web/icons/drag-grid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DragGridIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M9 20c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 7 18c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 9 16c.55 0 1.02.196 1.412.587.392.392.588.863.588 1.413s-.196 1.02-.588 1.413A1.926 1.926 0 0 1 9 20Zm6 0c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 13 18c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 15 16c.55 0 1.02.196 1.413.587.391.392.587.863.587 1.413s-.196 1.02-.587 1.413A1.926 1.926 0 0 1 15 20Zm-6-6c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 7 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 9 14Zm6 0c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 13 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 15 10c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412 0 .55-.196 1.02-.587 1.412A1.926 1.926 0 0 1 15 14ZM9 8c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 7 6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 4c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 9 8Zm6 0c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 13 6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 15 4c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412 0 .55-.196 1.02-.587 1.412A1.926 1.926 0 0 1 15 8Z" + }) + }); +} +; +DragGridIcon.displayName = "DragGridIcon"; +export default DragGridIcon; \ No newline at end of file diff --git a/assets/web/icons/drag-grid.svg b/assets/web/icons/drag-grid.svg deleted file mode 100644 index a4489eb9..00000000 --- a/assets/web/icons/drag-grid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/drag-list.d.ts b/assets/web/icons/drag-list.d.ts new file mode 100644 index 00000000..bff24c1b --- /dev/null +++ b/assets/web/icons/drag-list.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * drag-list.svg + */ +declare const DragListIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default DragListIcon; diff --git a/assets/web/icons/drag-list.js b/assets/web/icons/drag-list.js new file mode 100644 index 00000000..97ee6475 --- /dev/null +++ b/assets/web/icons/drag-list.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function DragListIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M5 15a.967.967 0 0 1-.713-.287A.968.968 0 0 1 4 14c0-.283.096-.52.287-.713A.967.967 0 0 1 5 13h14a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 19 15H5Zm0-4a.967.967 0 0 1-.713-.287A.968.968 0 0 1 4 10c0-.283.096-.52.287-.713A.968.968 0 0 1 5 9h14a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 19 11H5Z" + }) + }); +} +; +DragListIcon.displayName = "DragListIcon"; +export default DragListIcon; \ No newline at end of file diff --git a/assets/web/icons/drag-list.svg b/assets/web/icons/drag-list.svg deleted file mode 100644 index ff023a90..00000000 --- a/assets/web/icons/drag-list.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/edit-solid.d.ts b/assets/web/icons/edit-solid.d.ts new file mode 100644 index 00000000..a640a7bf --- /dev/null +++ b/assets/web/icons/edit-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * edit-solid.svg + */ +declare const EditSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default EditSolidIcon; diff --git a/assets/web/icons/edit-solid.js b/assets/web/icons/edit-solid.js new file mode 100644 index 00000000..3e964f92 --- /dev/null +++ b/assets/web/icons/edit-solid.js @@ -0,0 +1,29 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function EditSolidIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("mask", { + id: "a", + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "m4.393 13.95-.02.02-.42.42a1 1 0 0 0-.264.465l-1.414 5.657a1 1 0 0 0 1.213 1.213l5.657-1.414a1 1 0 0 0 .464-.263L21.363 8.294a2 2 0 0 0 0-2.829l-2.828-2.828a2 2 0 0 0-2.829 0L4.393 13.95ZM17.12 4.052l-2.972 2.972 2.829 2.829 2.972-2.972L17.12 4.05Z", + clipRule: "evenodd" + }) + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "m4.393 13.95-.02.02-.42.42a1 1 0 0 0-.264.465l-1.414 5.657a1 1 0 0 0 1.213 1.213l5.657-1.414a1 1 0 0 0 .464-.263L21.363 8.294a2 2 0 0 0 0-2.829l-2.828-2.828a2 2 0 0 0-2.829 0L4.393 13.95ZM17.12 4.052l-2.972 2.972 2.829 2.829 2.972-2.972L17.12 4.05Z", + clipRule: "evenodd" + }), /*#__PURE__*/_jsx("path", { + d: "m4.373 13.97 1.414 1.414.01-.01-1.424-1.404Zm.02-.02-1.415-1.414-.01.01 1.425 1.405Zm-.44.44 1.414 1.415-1.414-1.414Zm-.264.465 1.94.485-1.94-.485Zm-1.414 5.657-1.94-.485 1.94.485Zm1.213 1.213-.485-1.94.485 1.94Zm5.657-1.414.485 1.94-.485-1.94Zm.464-.263 1.415 1.414-1.415-1.414ZM21.363 8.294 19.95 6.88l1.414 1.414Zm0-2.829 1.414-1.414-1.414 1.414Zm-2.828-2.828L17.12 4.05l1.415-1.414Zm-2.829 0-1.414-1.414 1.414 1.414Zm-1.558 4.386L12.734 5.61 11.32 7.023l1.414 1.414 1.414-1.414Zm2.973-2.972 1.414-1.414-1.415-1.414-1.414 1.414 1.415 1.414Zm-.144 5.8-1.415 1.415 1.415 1.414 1.414-1.414-1.414-1.414Zm2.972-2.971 1.414 1.414 1.414-1.414-1.414-1.415L19.95 6.88ZM5.797 15.375l.02-.02-2.848-2.81-.02.02 2.848 2.81Zm-.43.43.42-.42-2.828-2.83-.42.422 2.828 2.828Zm.263-.465a1 1 0 0 1-.263.465l-2.829-2.829a3 3 0 0 0-.789 1.394l3.88.97Zm-1.414 5.657L5.63 15.34l-3.88-.97-1.415 5.657 3.88.97Zm-1.213-1.212a1 1 0 0 1 1.213 1.212l-3.88-.97c-.55 2.197 1.44 4.187 3.637 3.638l-.97-3.88ZM8.66 18.37l-5.657 1.415.97 3.88 5.657-1.414-.97-3.88Zm-.465.263a1 1 0 0 1 .465-.263l.97 3.881a3 3 0 0 0 1.394-.79l-2.829-2.828ZM19.95 6.88l2.828 2.828a4 4 0 0 0 0-5.657L19.95 6.88Zm-2.83-2.83 2.83 2.83 2.828-2.829-2.828-2.828-2.83 2.827Zm0 0 2.829-2.828a4 4 0 0 0-5.657 0L17.12 4.05ZM5.807 15.365 17.12 4.05l-2.828-2.828L2.978 12.536l2.829 2.829Zm9.755-6.928 2.973-2.972-2.829-2.828-2.972 2.972 2.829 2.828Zm2.829 0L15.563 5.61l-2.829 2.828 2.829 2.829 2.828-2.829Zm.144-2.972-2.973 2.972 2.829 2.829 2.972-2.972-2.828-2.829Zm-2.829 0 2.829 2.829 2.828-2.829-2.828-2.828-2.829 2.828ZM19.95 6.88 8.195 18.634l2.829 2.828L22.777 9.708 19.95 6.88Z", + mask: "url(#a)" + })] + }); +} +; +EditSolidIcon.displayName = "EditSolidIcon"; +export default EditSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/edit-solid.svg b/assets/web/icons/edit-solid.svg deleted file mode 100644 index e1674916..00000000 --- a/assets/web/icons/edit-solid.svg +++ /dev/null @@ -1,7 +0,0 @@ - - - - - - - diff --git a/assets/web/icons/edit.d.ts b/assets/web/icons/edit.d.ts new file mode 100644 index 00000000..04489bb8 --- /dev/null +++ b/assets/web/icons/edit.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * edit.svg + */ +declare const EditIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default EditIcon; diff --git a/assets/web/icons/edit.js b/assets/web/icons/edit.js new file mode 100644 index 00000000..7dd01ccc --- /dev/null +++ b/assets/web/icons/edit.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function EditIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M15.706 2.637a2 2 0 0 1 2.829 0l2.828 2.828a2 2 0 0 1 0 2.829L9.605 20.052a1 1 0 0 1-.465.263L3.483 21.73a1 1 0 0 1-1.212-1.213l1.414-5.657a1 1 0 0 1 .263-.465L15.706 2.637Zm1.224 7.262L14.1 7.07l-8.543 8.544-.943 3.771 3.771-.943L16.93 9.9Z", + clipRule: "evenodd" + }) + }); +} +; +EditIcon.displayName = "EditIcon"; +export default EditIcon; \ No newline at end of file diff --git a/assets/web/icons/edit.svg b/assets/web/icons/edit.svg deleted file mode 100644 index 06f9c784..00000000 --- a/assets/web/icons/edit.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/email-solid.d.ts b/assets/web/icons/email-solid.d.ts new file mode 100644 index 00000000..db2a2897 --- /dev/null +++ b/assets/web/icons/email-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * email-solid.svg + */ +declare const EmailSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default EmailSolidIcon; diff --git a/assets/web/icons/email-solid.js b/assets/web/icons/email-solid.js new file mode 100644 index 00000000..35542584 --- /dev/null +++ b/assets/web/icons/email-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function EmailSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 4h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2Zm0 5.111a1 1 0 0 0 .514.874l7 3.89a1 1 0 0 0 .972 0l7-3.89a1 1 0 1 0-.972-1.748L12 11.856 5.486 8.237A1 1 0 0 0 4 9.111Z" + }) + }); +} +; +EmailSolidIcon.displayName = "EmailSolidIcon"; +export default EmailSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/email-solid.svg b/assets/web/icons/email-solid.svg deleted file mode 100644 index 8c9ceaa3..00000000 --- a/assets/web/icons/email-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/email.d.ts b/assets/web/icons/email.d.ts new file mode 100644 index 00000000..d0a8d31a --- /dev/null +++ b/assets/web/icons/email.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * email.svg + */ +declare const EmailIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default EmailIcon; diff --git a/assets/web/icons/email.js b/assets/web/icons/email.js new file mode 100644 index 00000000..953b101c --- /dev/null +++ b/assets/web/icons/email.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function EmailIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2 6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V6Zm2 0v1.412l8 4.444 8-4.444V6H4Zm0 3.7V18h16V9.7l-7.514 4.174a1 1 0 0 1-.972 0L4 9.7Z" + }) + }); +} +; +EmailIcon.displayName = "EmailIcon"; +export default EmailIcon; \ No newline at end of file diff --git a/assets/web/icons/email.svg b/assets/web/icons/email.svg deleted file mode 100644 index 4c7aebf3..00000000 --- a/assets/web/icons/email.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/end-call.d.ts b/assets/web/icons/end-call.d.ts new file mode 100644 index 00000000..ed7a409a --- /dev/null +++ b/assets/web/icons/end-call.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * end-call.svg + */ +declare const EndCallIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default EndCallIcon; diff --git a/assets/web/icons/end-call.js b/assets/web/icons/end-call.js new file mode 100644 index 00000000..9ceb3b74 --- /dev/null +++ b/assets/web/icons/end-call.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function EndCallIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m2.765 16.02-2.47-2.416A1.018 1.018 0 0 1 0 12.852c0-.304.098-.555.295-.751a15.64 15.64 0 0 1 5.316-3.786A15.89 15.89 0 0 1 12 7c2.237 0 4.367.443 6.39 1.329a15.977 15.977 0 0 1 5.315 3.772c.197.196.295.447.295.751 0 .305-.098.555-.295.752l-2.47 2.416a1.047 1.047 0 0 1-1.396.108l-3.114-2.363a1.067 1.067 0 0 1-.322-.376 1.066 1.066 0 0 1-.108-.483v-2.27a13.593 13.593 0 0 0-2.12-.524C13.459 9.996 12 9.937 12 9.937s-1.459.059-2.175.175c-.715.116-1.422.29-2.12.523v2.271c0 .179-.036.34-.108.483a1.066 1.066 0 0 1-.322.376l-3.114 2.363a1.047 1.047 0 0 1-1.396-.107Z" + }) + }); +} +; +EndCallIcon.displayName = "EndCallIcon"; +export default EndCallIcon; \ No newline at end of file diff --git a/assets/web/icons/end-call.svg b/assets/web/icons/end-call.svg deleted file mode 100644 index 666e9802..00000000 --- a/assets/web/icons/end-call.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/error.d.ts b/assets/web/icons/error.d.ts new file mode 100644 index 00000000..5f4b6be0 --- /dev/null +++ b/assets/web/icons/error.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * error.svg + */ +declare const ErrorIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ErrorIcon; diff --git a/assets/web/icons/error.js b/assets/web/icons/error.js new file mode 100644 index 00000000..35d62f01 --- /dev/null +++ b/assets/web/icons/error.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ErrorIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 17a.97.97 0 0 0 .713-.288A.968.968 0 0 0 13 16a.968.968 0 0 0-.287-.713A.968.968 0 0 0 12 15a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 16c0 .283.096.52.287.712.192.192.43.288.713.288Zm0-4c.283 0 .52-.096.713-.287A.968.968 0 0 0 13 12V8a.967.967 0 0 0-.287-.713A.968.968 0 0 0 12 7a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 8v4c0 .283.096.52.287.713.192.191.43.287.713.287Zm0 9a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Z" + }) + }); +} +; +ErrorIcon.displayName = "ErrorIcon"; +export default ErrorIcon; \ No newline at end of file diff --git a/assets/web/icons/error.svg b/assets/web/icons/error.svg deleted file mode 100644 index 4b88fe7d..00000000 --- a/assets/web/icons/error.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/expand.d.ts b/assets/web/icons/expand.d.ts new file mode 100644 index 00000000..f59c8f89 --- /dev/null +++ b/assets/web/icons/expand.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * expand.svg + */ +declare const ExpandIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ExpandIcon; diff --git a/assets/web/icons/expand.js b/assets/web/icons/expand.js new file mode 100644 index 00000000..2dd55877 --- /dev/null +++ b/assets/web/icons/expand.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ExpandIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M21 3.997a.996.996 0 0 0-.29-.702l-.005-.004A.997.997 0 0 0 20 3h-8a1 1 0 1 0 0 2h5.586L5 17.586V12a1 1 0 1 0-2 0v8.003a.997.997 0 0 0 .29.702l.005.004c.18.18.43.291.705.291h8a1 1 0 1 0 0-2H6.414L19 6.414V12a1 1 0 1 0 2 0V3.997Z" + }) + }); +} +; +ExpandIcon.displayName = "ExpandIcon"; +export default ExpandIcon; \ No newline at end of file diff --git a/assets/web/icons/expand.svg b/assets/web/icons/expand.svg deleted file mode 100644 index 5f198dc5..00000000 --- a/assets/web/icons/expand.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/export-archive.d.ts b/assets/web/icons/export-archive.d.ts new file mode 100644 index 00000000..bf2a05ef --- /dev/null +++ b/assets/web/icons/export-archive.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * export-archive.svg + */ +declare const ExportArchiveIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ExportArchiveIcon; diff --git a/assets/web/icons/export-archive.js b/assets/web/icons/export-archive.js new file mode 100644 index 00000000..4aa6d38d --- /dev/null +++ b/assets/web/icons/export-archive.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ExportArchiveIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V6.5c0-.25.042-.475.125-.675.083-.2.192-.392.325-.575l1.4-1.7c.133-.183.3-.32.5-.412C5.55 3.046 5.767 3 6 3h12c.233 0 .45.046.65.138.2.091.367.229.5.412l1.4 1.7c.133.183.242.375.325.575.083.2.125.425.125.675V19c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm.4-15h13.2l-.85-1H6.25L5.4 6ZM5 19h14V8H5v11Zm7-1.425c.133 0 .258-.02.375-.063a.877.877 0 0 0 .325-.212l2.6-2.6a.948.948 0 0 0 .275-.7.948.948 0 0 0-.275-.7.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275l-.9.9V11a.968.968 0 0 0-.287-.713A.968.968 0 0 0 12 10a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 11v3.2l-.9-.9a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7l2.6 2.6c.1.1.208.17.325.212.117.042.242.063.375.063Z" + }) + }); +} +; +ExportArchiveIcon.displayName = "ExportArchiveIcon"; +export default ExportArchiveIcon; \ No newline at end of file diff --git a/assets/web/icons/export-archive.svg b/assets/web/icons/export-archive.svg deleted file mode 100644 index 11c2c44f..00000000 --- a/assets/web/icons/export-archive.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/extensions-solid.d.ts b/assets/web/icons/extensions-solid.d.ts new file mode 100644 index 00000000..087a20b2 --- /dev/null +++ b/assets/web/icons/extensions-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * extensions-solid.svg + */ +declare const ExtensionsSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ExtensionsSolidIcon; diff --git a/assets/web/icons/extensions-solid.js b/assets/web/icons/extensions-solid.js new file mode 100644 index 00000000..39164728 --- /dev/null +++ b/assets/web/icons/extensions-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ExtensionsSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M17.913 11.39a.907.907 0 0 1-.663.282.907.907 0 0 1-.663-.282L12.61 7.413a.907.907 0 0 1-.282-.663c0-.254.094-.475.282-.663l3.977-3.977a.907.907 0 0 1 .663-.282c.254 0 .475.094.663.282l3.977 3.977a.907.907 0 0 1 .282.663.907.907 0 0 1-.282.663l-3.977 3.977Zm-14.625-.677A.968.968 0 0 0 4 11h6c.283 0 .52-.096.713-.287A.968.968 0 0 0 11 10V4a.967.967 0 0 0-.287-.712A.968.968 0 0 0 10 3H4a.968.968 0 0 0-.712.288A.968.968 0 0 0 3 4v6c0 .283.096.52.288.713Zm9.999 9.999c.192.192.43.288.713.288h6c.283 0 .52-.096.712-.288A.968.968 0 0 0 21 20v-6a.968.968 0 0 0-.288-.713A.968.968 0 0 0 20 13h-6a.968.968 0 0 0-.713.287A.968.968 0 0 0 13 14v6c0 .283.096.52.287.712Zm-9.999 0A.965.965 0 0 0 4 21h6a.97.97 0 0 0 .713-.288A.968.968 0 0 0 11 20v-6a.968.968 0 0 0-.287-.713A.968.968 0 0 0 10 13H4a.967.967 0 0 0-.712.287A.968.968 0 0 0 3 14v6c0 .283.096.52.288.712Z" + }) + }); +} +; +ExtensionsSolidIcon.displayName = "ExtensionsSolidIcon"; +export default ExtensionsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/extensions-solid.svg b/assets/web/icons/extensions-solid.svg deleted file mode 100644 index 49964341..00000000 --- a/assets/web/icons/extensions-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/extensions.d.ts b/assets/web/icons/extensions.d.ts new file mode 100644 index 00000000..5b5711f4 --- /dev/null +++ b/assets/web/icons/extensions.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * extensions.svg + */ +declare const ExtensionsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ExtensionsIcon; diff --git a/assets/web/icons/extensions.js b/assets/web/icons/extensions.js new file mode 100644 index 00000000..1d679ade --- /dev/null +++ b/assets/web/icons/extensions.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ExtensionsIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M17.25 11.672a.907.907 0 0 1-.663-.282L12.61 7.413a.907.907 0 0 1-.282-.663c0-.254.094-.475.282-.663l3.977-3.977a.907.907 0 0 1 .663-.282c.254 0 .475.094.663.282l3.977 3.977a.907.907 0 0 1 .282.663.907.907 0 0 1-.282.663l-3.977 3.977a.907.907 0 0 1-.663.282Zm2.475-4.922L17.25 4.275 14.775 6.75l2.475 2.475 2.475-2.475ZM4 11a.967.967 0 0 1-.712-.287A.968.968 0 0 1 3 10V4c0-.283.096-.52.288-.712A.968.968 0 0 1 4 3h6a.97.97 0 0 1 .713.288A.968.968 0 0 1 11 4v6c0 .283-.096.52-.287.713A.968.968 0 0 1 10 11H4Zm5-2V5H5v4h4Zm5 12a.968.968 0 0 1-.713-.288A.968.968 0 0 1 13 20v-6c0-.283.096-.52.287-.713A.968.968 0 0 1 14 13h6a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v6c0 .283-.096.52-.288.712A.968.968 0 0 1 20 21h-6Zm5-2v-4h-4v4h4ZM4 21a.967.967 0 0 1-.712-.288A.968.968 0 0 1 3 20v-6a.97.97 0 0 1 .288-.713A.967.967 0 0 1 4 13h6c.283 0 .52.096.713.287.191.192.287.43.287.713v6a.97.97 0 0 1-.287.712A.968.968 0 0 1 10 21H4Zm5-2v-4H5v4h4Z" + }) + }); +} +; +ExtensionsIcon.displayName = "ExtensionsIcon"; +export default ExtensionsIcon; \ No newline at end of file diff --git a/assets/web/icons/extensions.svg b/assets/web/icons/extensions.svg deleted file mode 100644 index 9fa5bfd2..00000000 --- a/assets/web/icons/extensions.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/favourite-solid.d.ts b/assets/web/icons/favourite-solid.d.ts new file mode 100644 index 00000000..73950e66 --- /dev/null +++ b/assets/web/icons/favourite-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * favourite-solid.svg + */ +declare const FavouriteSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default FavouriteSolidIcon; diff --git a/assets/web/icons/favourite-solid.js b/assets/web/icons/favourite-solid.js new file mode 100644 index 00000000..63fe1b03 --- /dev/null +++ b/assets/web/icons/favourite-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function FavouriteSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m12.897 2.817 2.336 4.733 5.223.76a1 1 0 0 1 .555 1.705L17.23 13.7l.892 5.202a1 1 0 0 1-1.45 1.054L12 17.5l-4.672 2.456a1 1 0 0 1-1.451-1.054l.892-5.202-3.78-3.685a1 1 0 0 1 .555-1.706l5.223-.759 2.336-4.733a1 1 0 0 1 1.794 0Z" + }) + }); +} +; +FavouriteSolidIcon.displayName = "FavouriteSolidIcon"; +export default FavouriteSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/favourite-solid.svg b/assets/web/icons/favourite-solid.svg deleted file mode 100644 index 6c2f7509..00000000 --- a/assets/web/icons/favourite-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/favourite.d.ts b/assets/web/icons/favourite.d.ts new file mode 100644 index 00000000..64f18391 --- /dev/null +++ b/assets/web/icons/favourite.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * favourite.svg + */ +declare const FavouriteIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default FavouriteIcon; diff --git a/assets/web/icons/favourite.js b/assets/web/icons/favourite.js new file mode 100644 index 00000000..3169ebf9 --- /dev/null +++ b/assets/web/icons/favourite.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function FavouriteIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M13.905 9.378 12 5.52l-1.905 3.86-4.259.618 3.082 3.004-.727 4.242L12 15.24l3.81 2.003-.728-4.242 3.082-3.004-4.26-.619ZM8.767 7.55l2.336-4.733a1 1 0 0 1 1.794 0l2.336 4.733 5.223.76a1 1 0 0 1 .555 1.705L17.23 13.7l.892 5.202a1 1 0 0 1-1.45 1.054L12 17.5l-4.672 2.456a1 1 0 0 1-1.451-1.054l.892-5.202-3.78-3.685a1 1 0 0 1 .555-1.706l5.223-.759Z" + }) + }); +} +; +FavouriteIcon.displayName = "FavouriteIcon"; +export default FavouriteIcon; \ No newline at end of file diff --git a/assets/web/icons/favourite.svg b/assets/web/icons/favourite.svg deleted file mode 100644 index 78245e51..00000000 --- a/assets/web/icons/favourite.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/file-error.d.ts b/assets/web/icons/file-error.d.ts new file mode 100644 index 00000000..1af3f7ed --- /dev/null +++ b/assets/web/icons/file-error.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * file-error.svg + */ +declare const FileErrorIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default FileErrorIcon; diff --git a/assets/web/icons/file-error.js b/assets/web/icons/file-error.js new file mode 100644 index 00000000..ee798cee --- /dev/null +++ b/assets/web/icons/file-error.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function FileErrorIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V4c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 6 2h7.175a1.975 1.975 0 0 1 1.4.575l4.85 4.85a1.975 1.975 0 0 1 .575 1.4v3.516A5.99 5.99 0 0 0 18 12V9h-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 13 8V4H6v16h6.341c.264.745.67 1.423 1.187 2H6Z" + }), /*#__PURE__*/_jsx("path", { + d: "M18 14a1 1 0 0 1 1 1v3a1 1 0 1 1-2 0v-3a1 1 0 0 1 1-1Zm-1 7a1 1 0 1 1 2 0 1 1 0 0 1-2 0Z" + })] + }); +} +; +FileErrorIcon.displayName = "FileErrorIcon"; +export default FileErrorIcon; \ No newline at end of file diff --git a/assets/web/icons/file-error.svg b/assets/web/icons/file-error.svg deleted file mode 100644 index 3ce2b3eb..00000000 --- a/assets/web/icons/file-error.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/files.d.ts b/assets/web/icons/files.d.ts new file mode 100644 index 00000000..45c62f62 --- /dev/null +++ b/assets/web/icons/files.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * files.svg + */ +declare const FilesIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default FilesIcon; diff --git a/assets/web/icons/files.js b/assets/web/icons/files.js new file mode 100644 index 00000000..f7d463eb --- /dev/null +++ b/assets/web/icons/files.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function FilesIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V4c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 6 2h7.175a1.975 1.975 0 0 1 1.4.575l4.85 4.85a1.975 1.975 0 0 1 .575 1.4V20c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6Zm7-14V4H6v16h12V9h-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 13 8Z" + }) + }); +} +; +FilesIcon.displayName = "FilesIcon"; +export default FilesIcon; \ No newline at end of file diff --git a/assets/web/icons/files.svg b/assets/web/icons/files.svg deleted file mode 100644 index 2e72df65..00000000 --- a/assets/web/icons/files.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/filter.d.ts b/assets/web/icons/filter.d.ts new file mode 100644 index 00000000..d20c4764 --- /dev/null +++ b/assets/web/icons/filter.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * filter.svg + */ +declare const FilterIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default FilterIcon; diff --git a/assets/web/icons/filter.js b/assets/web/icons/filter.js new file mode 100644 index 00000000..4151cdb4 --- /dev/null +++ b/assets/web/icons/filter.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function FilterIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M5 7a1 1 0 0 0 0 2h14a1 1 0 1 0 0-2H5Zm3 4a1 1 0 1 0 0 2h8a1 1 0 1 0 0-2H8Zm2 5a1 1 0 0 1 1-1h2a1 1 0 1 1 0 2h-2a1 1 0 0 1-1-1Z" + }) + }); +} +; +FilterIcon.displayName = "FilterIcon"; +export default FilterIcon; \ No newline at end of file diff --git a/assets/web/icons/filter.svg b/assets/web/icons/filter.svg deleted file mode 100644 index 41087446..00000000 --- a/assets/web/icons/filter.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/forward.d.ts b/assets/web/icons/forward.d.ts new file mode 100644 index 00000000..160842f8 --- /dev/null +++ b/assets/web/icons/forward.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * forward.svg + */ +declare const ForwardIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ForwardIcon; diff --git a/assets/web/icons/forward.js b/assets/web/icons/forward.js new file mode 100644 index 00000000..f0826d76 --- /dev/null +++ b/assets/web/icons/forward.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ForwardIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M14.597 5.708a1.004 1.004 0 0 1 0-1.416.996.996 0 0 1 1.412 0l4.698 4.714c.39.391.39 1.025 0 1.416l-4.698 4.714a.996.996 0 0 1-1.412 0 1.004 1.004 0 0 1 0-1.416l3.043-3.053H8.487C6.599 10.667 5 12.27 5 14.333 5.001 16.396 6.6 18 8.487 18h2.093a1 1 0 1 1 0 2H8.487C5.42 20 3 17.425 3 14.333c0-3.091 2.42-5.666 5.486-5.666h9.059l-2.95-2.959Z" + }) + }); +} +; +ForwardIcon.displayName = "ForwardIcon"; +export default ForwardIcon; \ No newline at end of file diff --git a/assets/web/icons/forward.svg b/assets/web/icons/forward.svg deleted file mode 100644 index a5d14207..00000000 --- a/assets/web/icons/forward.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/grid.d.ts b/assets/web/icons/grid.d.ts new file mode 100644 index 00000000..c9f4f082 --- /dev/null +++ b/assets/web/icons/grid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * grid.svg + */ +declare const GridIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default GridIcon; diff --git a/assets/web/icons/grid.js b/assets/web/icons/grid.js new file mode 100644 index 00000000..ae982c4b --- /dev/null +++ b/assets/web/icons/grid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function GridIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 11a.967.967 0 0 1-.712-.287A.968.968 0 0 1 3 10V4c0-.283.096-.52.288-.712A.968.968 0 0 1 4 3h6a.97.97 0 0 1 .713.288A.968.968 0 0 1 11 4v6c0 .283-.096.52-.287.713A.968.968 0 0 1 10 11H4Zm5-2V5H5v4h4Zm5 12a.968.968 0 0 1-.713-.288A.968.968 0 0 1 13 20v-6c0-.283.096-.52.287-.713A.968.968 0 0 1 14 13h6a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v6c0 .283-.096.52-.288.712A.968.968 0 0 1 20 21h-6Zm5-2v-4h-4v4h4ZM4 21a.967.967 0 0 1-.712-.288A.968.968 0 0 1 3 20v-6a.97.97 0 0 1 .288-.713A.967.967 0 0 1 4 13h6c.283 0 .52.096.713.287.191.192.287.43.287.713v6a.97.97 0 0 1-.287.712A.968.968 0 0 1 10 21H4Zm5-2v-4H5v4h4Zm5-8a.968.968 0 0 1-.713-.287A.968.968 0 0 1 13 10V4a.97.97 0 0 1 .287-.712A.968.968 0 0 1 14 3h6c.283 0 .52.096.712.288A.965.965 0 0 1 21 4v6a.97.97 0 0 1-.288.713A.968.968 0 0 1 20 11h-6Zm5-2V5h-4v4h4Z" + }) + }); +} +; +GridIcon.displayName = "GridIcon"; +export default GridIcon; \ No newline at end of file diff --git a/assets/web/icons/grid.svg b/assets/web/icons/grid.svg deleted file mode 100644 index dd4014a4..00000000 --- a/assets/web/icons/grid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/help-solid.d.ts b/assets/web/icons/help-solid.d.ts new file mode 100644 index 00000000..0c96f03a --- /dev/null +++ b/assets/web/icons/help-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * help-solid.svg + */ +declare const HelpSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default HelpSolidIcon; diff --git a/assets/web/icons/help-solid.js b/assets/web/icons/help-solid.js new file mode 100644 index 00000000..fa785263 --- /dev/null +++ b/assets/web/icons/help-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function HelpSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 22a9.738 9.738 0 0 0 3.9-.788 10.098 10.098 0 0 0 3.175-2.137c.9-.9 1.613-1.958 2.137-3.175A9.738 9.738 0 0 0 22 12a9.738 9.738 0 0 0-.788-3.9 10.099 10.099 0 0 0-2.137-3.175c-.9-.9-1.958-1.612-3.175-2.137A9.738 9.738 0 0 0 12 2a9.738 9.738 0 0 0-3.9.788 10.099 10.099 0 0 0-3.175 2.137c-.9.9-1.612 1.958-2.137 3.175A9.738 9.738 0 0 0 2 12a9.74 9.74 0 0 0 .788 3.9 10.098 10.098 0 0 0 2.137 3.175c.9.9 1.958 1.613 3.175 2.137A9.738 9.738 0 0 0 12 22Zm0-14a1.5 1.5 0 0 0-1.5 1.5 1 1 0 1 1-2 0 3.5 3.5 0 1 1 6.01 2.439c-.122.126-.24.243-.352.355-.287.288-.54.54-.76.824-.293.375-.398.651-.398.882a1 1 0 1 1-2 0c0-.874.407-1.58.819-2.11.305-.392.688-.775 1-1.085l.257-.26A1.5 1.5 0 0 0 12 8Zm1 9a1 1 0 1 1-2 0 1 1 0 0 1 2 0Z" + }) + }); +} +; +HelpSolidIcon.displayName = "HelpSolidIcon"; +export default HelpSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/help-solid.svg b/assets/web/icons/help-solid.svg deleted file mode 100644 index f54a7258..00000000 --- a/assets/web/icons/help-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/help.d.ts b/assets/web/icons/help.d.ts new file mode 100644 index 00000000..3aea8e21 --- /dev/null +++ b/assets/web/icons/help.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * help.svg + */ +declare const HelpIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default HelpIcon; diff --git a/assets/web/icons/help.js b/assets/web/icons/help.js new file mode 100644 index 00000000..f5edc5e2 --- /dev/null +++ b/assets/web/icons/help.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function HelpIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M12 8a1.5 1.5 0 0 0-1.5 1.5 1 1 0 1 1-2 0 3.5 3.5 0 1 1 6.01 2.439c-.122.126-.24.243-.352.355-.287.288-.54.54-.76.824-.293.375-.398.651-.398.882a1 1 0 1 1-2 0c0-.874.407-1.58.819-2.11.305-.392.688-.775 1-1.085l.257-.26A1.5 1.5 0 0 0 12 8Zm1 9a1 1 0 1 1-2 0 1 1 0 0 1 2 0Z" + }), /*#__PURE__*/_jsx("path", { + d: "M8.1 21.212A9.738 9.738 0 0 0 12 22a9.738 9.738 0 0 0 3.9-.788 10.098 10.098 0 0 0 3.175-2.137c.9-.9 1.613-1.958 2.137-3.175A9.738 9.738 0 0 0 22 12a9.738 9.738 0 0 0-.788-3.9 10.099 10.099 0 0 0-2.137-3.175c-.9-.9-1.958-1.612-3.175-2.137A9.738 9.738 0 0 0 12 2a9.738 9.738 0 0 0-3.9.788 10.099 10.099 0 0 0-3.175 2.137c-.9.9-1.612 1.958-2.137 3.175A9.738 9.738 0 0 0 2 12a9.74 9.74 0 0 0 .788 3.9 10.098 10.098 0 0 0 2.137 3.175c.9.9 1.958 1.613 3.175 2.137Zm9.575-3.537C16.125 19.225 14.233 20 12 20c-2.233 0-4.125-.775-5.675-2.325C4.775 16.125 4 14.233 4 12c0-2.233.775-4.125 2.325-5.675C7.875 4.775 9.767 4 12 4c2.233 0 4.125.775 5.675 2.325C19.225 7.875 20 9.767 20 12c0 2.233-.775 4.125-2.325 5.675Z" + })] + }); +} +; +HelpIcon.displayName = "HelpIcon"; +export default HelpIcon; \ No newline at end of file diff --git a/assets/web/icons/help.svg b/assets/web/icons/help.svg deleted file mode 100644 index d798ea05..00000000 --- a/assets/web/icons/help.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/history.d.ts b/assets/web/icons/history.d.ts new file mode 100644 index 00000000..64ea2671 --- /dev/null +++ b/assets/web/icons/history.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * history.svg + */ +declare const HistoryIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default HistoryIcon; diff --git a/assets/web/icons/history.js b/assets/web/icons/history.js new file mode 100644 index 00000000..1d548875 --- /dev/null +++ b/assets/web/icons/history.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function HistoryIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M18.93 8A8 8 0 1 1 4 12a1 1 0 1 0-2 0c0 5.523 4.477 10 10 10s10-4.477 10-10a9.966 9.966 0 0 0-.832-4A10.002 10.002 0 0 0 12 2a9.985 9.985 0 0 0-8 3.999V4a1 1 0 0 0-2 0v4a1 1 0 0 0 1 1h4a1 1 0 0 0 0-2H5.755A7.985 7.985 0 0 1 12 4a7.997 7.997 0 0 1 6.93 4Z" + }), /*#__PURE__*/_jsx("path", { + d: "M13 8a1 1 0 1 0-2 0v4a1 1 0 0 0 .293.707l2.83 2.83a1 1 0 0 0 1.414-1.414L13 11.586V8Z" + })] + }); +} +; +HistoryIcon.displayName = "HistoryIcon"; +export default HistoryIcon; \ No newline at end of file diff --git a/assets/web/icons/history.svg b/assets/web/icons/history.svg deleted file mode 100644 index 61831fc7..00000000 --- a/assets/web/icons/history.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/home-solid.d.ts b/assets/web/icons/home-solid.d.ts new file mode 100644 index 00000000..200d653b --- /dev/null +++ b/assets/web/icons/home-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * home-solid.svg + */ +declare const HomeSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default HomeSolidIcon; diff --git a/assets/web/icons/home-solid.js b/assets/web/icons/home-solid.js new file mode 100644 index 00000000..5cd8f779 --- /dev/null +++ b/assets/web/icons/home-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function HomeSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m12.971 3.54 7 3.889A2 2 0 0 1 21 9.177V19a2 2 0 0 1-2 2h-4v-9H9v9H5a2 2 0 0 1-2-2V9.177a2 2 0 0 1 1.029-1.748l7-3.89a2 2 0 0 1 1.942 0Z" + }) + }); +} +; +HomeSolidIcon.displayName = "HomeSolidIcon"; +export default HomeSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/home-solid.svg b/assets/web/icons/home-solid.svg deleted file mode 100644 index f3de1487..00000000 --- a/assets/web/icons/home-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/home.d.ts b/assets/web/icons/home.d.ts new file mode 100644 index 00000000..070c5a58 --- /dev/null +++ b/assets/web/icons/home.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * home.svg + */ +declare const HomeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default HomeIcon; diff --git a/assets/web/icons/home.js b/assets/web/icons/home.js new file mode 100644 index 00000000..657a2f65 --- /dev/null +++ b/assets/web/icons/home.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function HomeIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M16 11v8h3V9.177l-7-3.889-7 3.889V19h3v-8h8Zm-6 10H5a2 2 0 0 1-2-2V9.177a2 2 0 0 1 1.029-1.748l7-3.89a2 2 0 0 1 1.942 0l7 3.89A2 2 0 0 1 21 9.177V19a2 2 0 0 1-2 2h-5v-8h-4v8Z", + clipRule: "evenodd" + }) + }); +} +; +HomeIcon.displayName = "HomeIcon"; +export default HomeIcon; \ No newline at end of file diff --git a/assets/web/icons/home.svg b/assets/web/icons/home.svg deleted file mode 100644 index 869031f1..00000000 --- a/assets/web/icons/home.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/host.d.ts b/assets/web/icons/host.d.ts new file mode 100644 index 00000000..8690e60b --- /dev/null +++ b/assets/web/icons/host.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * host.svg + */ +declare const HostIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default HostIcon; diff --git a/assets/web/icons/host.js b/assets/web/icons/host.js new file mode 100644 index 00000000..09e83066 --- /dev/null +++ b/assets/web/icons/host.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function HostIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M16.712 6.713A.968.968 0 0 1 16 7a.968.968 0 0 1-.713-.287A.967.967 0 0 1 15 6c0-.283.096-.52.287-.713A.968.968 0 0 1 16 5a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M6 2a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V4a2 2 0 0 0-2-2H6Zm12 2H6v4h12V4ZM6 12v-2h12v2H6Zm0 2v2h12v-2H6Zm0 6v-2h12v2H6Z", + clipRule: "evenodd" + })] + }); +} +; +HostIcon.displayName = "HostIcon"; +export default HostIcon; \ No newline at end of file diff --git a/assets/web/icons/host.svg b/assets/web/icons/host.svg deleted file mode 100644 index 3df8c26a..00000000 --- a/assets/web/icons/host.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/image-error.d.ts b/assets/web/icons/image-error.d.ts new file mode 100644 index 00000000..aa6189f2 --- /dev/null +++ b/assets/web/icons/image-error.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * image-error.svg + */ +declare const ImageErrorIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ImageErrorIcon; diff --git a/assets/web/icons/image-error.js b/assets/web/icons/image-error.js new file mode 100644 index 00000000..d79ddd8f --- /dev/null +++ b/assets/web/icons/image-error.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ImageErrorIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M5 3a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h7.803a5.958 5.958 0 0 1-.72-2H5v-3.172l4-4 3.585 3.585a6.015 6.015 0 0 1 1.172-1.656l-3.343-3.343a2 2 0 0 0-2.828 0L5 13V5h14v7.083c.718.12 1.393.368 2 .72V5a2 2 0 0 0-2-2H5Z" + }), /*#__PURE__*/_jsx("path", { + d: "M17 9a2 2 0 1 1-4 0 2 2 0 0 1 4 0Zm1 5a1 1 0 0 1 1 1v3a1 1 0 1 1-2 0v-3a1 1 0 0 1 1-1Zm-1 7a1 1 0 1 1 2 0 1 1 0 0 1-2 0Z" + })] + }); +} +; +ImageErrorIcon.displayName = "ImageErrorIcon"; +export default ImageErrorIcon; \ No newline at end of file diff --git a/assets/web/icons/image-error.svg b/assets/web/icons/image-error.svg deleted file mode 100644 index 918bd35e..00000000 --- a/assets/web/icons/image-error.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/image.d.ts b/assets/web/icons/image.d.ts new file mode 100644 index 00000000..53b5719b --- /dev/null +++ b/assets/web/icons/image.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * image.svg + */ +declare const ImageIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ImageIcon; diff --git a/assets/web/icons/image.js b/assets/web/icons/image.js new file mode 100644 index 00000000..b02e325d --- /dev/null +++ b/assets/web/icons/image.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ImageIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M17 9a2 2 0 1 1-4 0 2 2 0 0 1 4 0Z" + }), /*#__PURE__*/_jsx("path", { + d: "M5 3a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2V5a2 2 0 0 0-2-2H5Zm14 2v14H5v-3.172l4-4L16.172 19H19l-8.586-8.586a2 2 0 0 0-2.828 0L5 13V5h14Z" + })] + }); +} +; +ImageIcon.displayName = "ImageIcon"; +export default ImageIcon; \ No newline at end of file diff --git a/assets/web/icons/image.svg b/assets/web/icons/image.svg deleted file mode 100644 index 2cbcf345..00000000 --- a/assets/web/icons/image.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/indent-decrease.d.ts b/assets/web/icons/indent-decrease.d.ts new file mode 100644 index 00000000..f85a3810 --- /dev/null +++ b/assets/web/icons/indent-decrease.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * indent-decrease.svg + */ +declare const IndentDecreaseIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default IndentDecreaseIcon; diff --git a/assets/web/icons/indent-decrease.js b/assets/web/icons/indent-decrease.js new file mode 100644 index 00000000..5f2f05f8 --- /dev/null +++ b/assets/web/icons/indent-decrease.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function IndentDecreaseIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M3.288 18.712A.965.965 0 0 0 4 19h16c.283 0 .52-.096.712-.288A.968.968 0 0 0 21 18a.968.968 0 0 0-.288-.712A.968.968 0 0 0 20 17H4a.967.967 0 0 0-.712.288A.968.968 0 0 0 3 18c0 .283.096.52.288.712Zm7.999-3.999c.192.191.43.287.713.287h8a.97.97 0 0 0 .712-.287A.968.968 0 0 0 21 14a.968.968 0 0 0-.288-.713A.968.968 0 0 0 20 13h-8a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 14c0 .283.096.52.287.713Zm0-4c.192.191.43.287.713.287h8a.97.97 0 0 0 .712-.287A.968.968 0 0 0 21 10a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 9h-8a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 10c0 .283.096.52.287.713Zm0-4c.192.191.43.287.713.287h8a.97.97 0 0 0 .712-.287A.967.967 0 0 0 21 6a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 5h-8a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 6c0 .283.096.52.287.713ZM6.15 13.15l-2.8-2.8a.48.48 0 0 1 0-.7l2.8-2.8c.167-.167.35-.208.55-.125.2.083.3.242.3.475v5.6c0 .233-.1.392-.3.475-.2.083-.383.042-.55-.125Z" + }) + }); +} +; +IndentDecreaseIcon.displayName = "IndentDecreaseIcon"; +export default IndentDecreaseIcon; \ No newline at end of file diff --git a/assets/web/icons/indent-decrease.svg b/assets/web/icons/indent-decrease.svg deleted file mode 100644 index ab8e9450..00000000 --- a/assets/web/icons/indent-decrease.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/indent-increase.d.ts b/assets/web/icons/indent-increase.d.ts new file mode 100644 index 00000000..98fafd61 --- /dev/null +++ b/assets/web/icons/indent-increase.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * indent-increase.svg + */ +declare const IndentIncreaseIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default IndentIncreaseIcon; diff --git a/assets/web/icons/indent-increase.js b/assets/web/icons/indent-increase.js new file mode 100644 index 00000000..5b741d98 --- /dev/null +++ b/assets/web/icons/indent-increase.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function IndentIncreaseIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 19a.967.967 0 0 1-.712-.288A.968.968 0 0 1 3 18c0-.283.096-.52.288-.712A.967.967 0 0 1 4 17h16c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 20 19H4Zm8-4a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 14c0-.283.096-.52.287-.713A.968.968 0 0 1 12 13h8a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 15h-8Zm0-4a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 10c0-.283.096-.52.287-.713A.968.968 0 0 1 12 9h8a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 11h-8Zm0-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 11 6c0-.283.096-.52.287-.713A.968.968 0 0 1 12 5h8a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 7h-8Zm-8.15 6.15c-.167.167-.35.208-.55.125-.2-.083-.3-.242-.3-.475V7.2c0-.233.1-.392.3-.475.2-.083.383-.042.55.125l2.8 2.8a.48.48 0 0 1 0 .7l-2.8 2.8Z" + }) + }); +} +; +IndentIncreaseIcon.displayName = "IndentIncreaseIcon"; +export default IndentIncreaseIcon; \ No newline at end of file diff --git a/assets/web/icons/indent-increase.svg b/assets/web/icons/indent-increase.svg deleted file mode 100644 index 4886b177..00000000 --- a/assets/web/icons/indent-increase.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/index.d.ts b/assets/web/icons/index.d.ts new file mode 100644 index 00000000..56bf8f7d --- /dev/null +++ b/assets/web/icons/index.d.ts @@ -0,0 +1,170 @@ +export { default as AdminIcon } from "./admin.js"; +export { default as ArrowDownIcon } from "./arrow-down.js"; +export { default as ArrowLeftIcon } from "./arrow-left.js"; +export { default as ArrowRightIcon } from "./arrow-right.js"; +export { default as ArrowUpRightIcon } from "./arrow-up-right.js"; +export { default as ArrowUpIcon } from "./arrow-up.js"; +export { default as AttachmentIcon } from "./attachment.js"; +export { default as BlockIcon } from "./block.js"; +export { default as BoldIcon } from "./bold.js"; +export { default as ChartIcon } from "./chart.js"; +export { default as ChatNewIcon } from "./chat-new.js"; +export { default as ChatProblemIcon } from "./chat-problem.js"; +export { default as ChatSolidIcon } from "./chat-solid.js"; +export { default as ChatIcon } from "./chat.js"; +export { default as CheckCircleSolidIcon } from "./check-circle-solid.js"; +export { default as CheckCircleIcon } from "./check-circle.js"; +export { default as CheckIcon } from "./check.js"; +export { default as ChevronDownIcon } from "./chevron-down.js"; +export { default as ChevronLeftIcon } from "./chevron-left.js"; +export { default as ChevronRightIcon } from "./chevron-right.js"; +export { default as ChevronUpDownIcon } from "./chevron-up-down.js"; +export { default as ChevronUpIcon } from "./chevron-up.js"; +export { default as CircleIcon } from "./circle.js"; +export { default as CloseIcon } from "./close.js"; +export { default as CloudSolidIcon } from "./cloud-solid.js"; +export { default as CloudIcon } from "./cloud.js"; +export { default as CodeIcon } from "./code.js"; +export { default as CollapseIcon } from "./collapse.js"; +export { default as CompanyIcon } from "./company.js"; +export { default as ComposeIcon } from "./compose.js"; +export { default as ComputerIcon } from "./computer.js"; +export { default as CopyIcon } from "./copy.js"; +export { default as DarkModeIcon } from "./dark-mode.js"; +export { default as DeleteIcon } from "./delete.js"; +export { default as DevicesIcon } from "./devices.js"; +export { default as DocumentIcon } from "./document.js"; +export { default as DownloadIcon } from "./download.js"; +export { default as DragGridIcon } from "./drag-grid.js"; +export { default as DragListIcon } from "./drag-list.js"; +export { default as EditSolidIcon } from "./edit-solid.js"; +export { default as EditIcon } from "./edit.js"; +export { default as EmailSolidIcon } from "./email-solid.js"; +export { default as EmailIcon } from "./email.js"; +export { default as EndCallIcon } from "./end-call.js"; +export { default as ErrorIcon } from "./error.js"; +export { default as ExpandIcon } from "./expand.js"; +export { default as ExportArchiveIcon } from "./export-archive.js"; +export { default as ExtensionsSolidIcon } from "./extensions-solid.js"; +export { default as ExtensionsIcon } from "./extensions.js"; +export { default as FavouriteSolidIcon } from "./favourite-solid.js"; +export { default as FavouriteIcon } from "./favourite.js"; +export { default as FileErrorIcon } from "./file-error.js"; +export { default as FilesIcon } from "./files.js"; +export { default as FilterIcon } from "./filter.js"; +export { default as ForwardIcon } from "./forward.js"; +export { default as GridIcon } from "./grid.js"; +export { default as HelpSolidIcon } from "./help-solid.js"; +export { default as HelpIcon } from "./help.js"; +export { default as HistoryIcon } from "./history.js"; +export { default as HomeSolidIcon } from "./home-solid.js"; +export { default as HomeIcon } from "./home.js"; +export { default as HostIcon } from "./host.js"; +export { default as ImageErrorIcon } from "./image-error.js"; +export { default as ImageIcon } from "./image.js"; +export { default as IndentDecreaseIcon } from "./indent-decrease.js"; +export { default as IndentIncreaseIcon } from "./indent-increase.js"; +export { default as InfoSolidIcon } from "./info-solid.js"; +export { default as InfoIcon } from "./info.js"; +export { default as InlineCodeIcon } from "./inline-code.js"; +export { default as ItalicIcon } from "./italic.js"; +export { default as KeyOffSolidIcon } from "./key-off-solid.js"; +export { default as KeyOffIcon } from "./key-off.js"; +export { default as KeySolidIcon } from "./key-solid.js"; +export { default as KeyIcon } from "./key.js"; +export { default as KeyboardIcon } from "./keyboard.js"; +export { default as LabsIcon } from "./labs.js"; +export { default as LeaveIcon } from "./leave.js"; +export { default as LinkIcon } from "./link.js"; +export { default as ListBulletedIcon } from "./list-bulleted.js"; +export { default as ListNumberedIcon } from "./list-numbered.js"; +export { default as LocationNavigatorCentredIcon } from "./location-navigator-centred.js"; +export { default as LocationNavigatorIcon } from "./location-navigator.js"; +export { default as LocationPinSolidIcon } from "./location-pin-solid.js"; +export { default as LocationPinIcon } from "./location-pin.js"; +export { default as LockOffIcon } from "./lock-off.js"; +export { default as LockSolidIcon } from "./lock-solid.js"; +export { default as LockIcon } from "./lock.js"; +export { default as MarkAsReadIcon } from "./mark-as-read.js"; +export { default as MarkAsUnreadIcon } from "./mark-as-unread.js"; +export { default as MarkerReadReceiptsIcon } from "./marker-read-receipts.js"; +export { default as MentionIcon } from "./mention.js"; +export { default as MenuIcon } from "./menu.js"; +export { default as MicOffSolidIcon } from "./mic-off-solid.js"; +export { default as MicOffIcon } from "./mic-off.js"; +export { default as MicOnSolidIcon } from "./mic-on-solid.js"; +export { default as MicOnIcon } from "./mic-on.js"; +export { default as MinusIcon } from "./minus.js"; +export { default as MobileIcon } from "./mobile.js"; +export { default as NotificationsOffSolidIcon } from "./notifications-off-solid.js"; +export { default as NotificationsOffIcon } from "./notifications-off.js"; +export { default as NotificationsSolidIcon } from "./notifications-solid.js"; +export { default as NotificationsIcon } from "./notifications.js"; +export { default as OfflineIcon } from "./offline.js"; +export { default as OverflowHorizontalIcon } from "./overflow-horizontal.js"; +export { default as OverflowVerticalIcon } from "./overflow-vertical.js"; +export { default as PauseSolidIcon } from "./pause-solid.js"; +export { default as PauseIcon } from "./pause.js"; +export { default as PinSolidIcon } from "./pin-solid.js"; +export { default as PinIcon } from "./pin.js"; +export { default as PlaySolidIcon } from "./play-solid.js"; +export { default as PlayIcon } from "./play.js"; +export { default as PlusIcon } from "./plus.js"; +export { default as PollsEndIcon } from "./polls-end.js"; +export { default as PollsIcon } from "./polls.js"; +export { default as PopOutIcon } from "./pop-out.js"; +export { default as PreferencesIcon } from "./preferences.js"; +export { default as PublicIcon } from "./public.js"; +export { default as QrCodeIcon } from "./qr-code.js"; +export { default as QuoteIcon } from "./quote.js"; +export { default as ReactionAddIcon } from "./reaction-add.js"; +export { default as ReactionIcon } from "./reaction.js"; +export { default as ReplyIcon } from "./reply.js"; +export { default as RestartIcon } from "./restart.js"; +export { default as SearchIcon } from "./search.js"; +export { default as SendSolidIcon } from "./send-solid.js"; +export { default as SendIcon } from "./send.js"; +export { default as SettingsSolidIcon } from "./settings-solid.js"; +export { default as SettingsIcon } from "./settings.js"; +export { default as ShareAndroidIcon } from "./share-android.js"; +export { default as ShareIosIcon } from "./share-ios.js"; +export { default as ShareScreenSolidIcon } from "./share-screen-solid.js"; +export { default as ShareScreenIcon } from "./share-screen.js"; +export { default as ShareIcon } from "./share.js"; +export { default as SidebarIcon } from "./sidebar.js"; +export { default as SignOutIcon } from "./sign-out.js"; +export { default as SpinnerIcon } from "./spinner.js"; +export { default as SpotlightIcon } from "./spotlight.js"; +export { default as StrikethroughIcon } from "./strikethrough.js"; +export { default as SwitchCameraSolidIcon } from "./switch-camera-solid.js"; +export { default as TakePhotoSolidIcon } from "./take-photo-solid.js"; +export { default as TakePhotoIcon } from "./take-photo.js"; +export { default as TextFormattingIcon } from "./text-formatting.js"; +export { default as ThreadsSolidIcon } from "./threads-solid.js"; +export { default as ThreadsIcon } from "./threads.js"; +export { default as TimeIcon } from "./time.js"; +export { default as UnderlineIcon } from "./underline.js"; +export { default as UnknownSolidIcon } from "./unknown-solid.js"; +export { default as UnknownIcon } from "./unknown.js"; +export { default as UserAddSolidIcon } from "./user-add-solid.js"; +export { default as UserAddIcon } from "./user-add.js"; +export { default as UserProfileSolidIcon } from "./user-profile-solid.js"; +export { default as UserProfileIcon } from "./user-profile.js"; +export { default as UserSolidIcon } from "./user-solid.js"; +export { default as UserIcon } from "./user.js"; +export { default as VerifiedIcon } from "./verified.js"; +export { default as VideoCallDeclinedSolidIcon } from "./video-call-declined-solid.js"; +export { default as VideoCallMissedSolidIcon } from "./video-call-missed-solid.js"; +export { default as VideoCallOffSolidIcon } from "./video-call-off-solid.js"; +export { default as VideoCallOffIcon } from "./video-call-off.js"; +export { default as VideoCallSolidIcon } from "./video-call-solid.js"; +export { default as VideoCallIcon } from "./video-call.js"; +export { default as VisibilityOffIcon } from "./visibility-off.js"; +export { default as VisibilityOnIcon } from "./visibility-on.js"; +export { default as VoiceCallIcon } from "./voice-call.js"; +export { default as VolumeOffSolidIcon } from "./volume-off-solid.js"; +export { default as VolumeOffIcon } from "./volume-off.js"; +export { default as VolumeOnSolidIcon } from "./volume-on-solid.js"; +export { default as VolumeOnIcon } from "./volume-on.js"; +export { default as WarningIcon } from "./warning.js"; +export { default as WebBrowserIcon } from "./web-browser.js"; \ No newline at end of file diff --git a/assets/web/icons/index.js b/assets/web/icons/index.js new file mode 100644 index 00000000..56bf8f7d --- /dev/null +++ b/assets/web/icons/index.js @@ -0,0 +1,170 @@ +export { default as AdminIcon } from "./admin.js"; +export { default as ArrowDownIcon } from "./arrow-down.js"; +export { default as ArrowLeftIcon } from "./arrow-left.js"; +export { default as ArrowRightIcon } from "./arrow-right.js"; +export { default as ArrowUpRightIcon } from "./arrow-up-right.js"; +export { default as ArrowUpIcon } from "./arrow-up.js"; +export { default as AttachmentIcon } from "./attachment.js"; +export { default as BlockIcon } from "./block.js"; +export { default as BoldIcon } from "./bold.js"; +export { default as ChartIcon } from "./chart.js"; +export { default as ChatNewIcon } from "./chat-new.js"; +export { default as ChatProblemIcon } from "./chat-problem.js"; +export { default as ChatSolidIcon } from "./chat-solid.js"; +export { default as ChatIcon } from "./chat.js"; +export { default as CheckCircleSolidIcon } from "./check-circle-solid.js"; +export { default as CheckCircleIcon } from "./check-circle.js"; +export { default as CheckIcon } from "./check.js"; +export { default as ChevronDownIcon } from "./chevron-down.js"; +export { default as ChevronLeftIcon } from "./chevron-left.js"; +export { default as ChevronRightIcon } from "./chevron-right.js"; +export { default as ChevronUpDownIcon } from "./chevron-up-down.js"; +export { default as ChevronUpIcon } from "./chevron-up.js"; +export { default as CircleIcon } from "./circle.js"; +export { default as CloseIcon } from "./close.js"; +export { default as CloudSolidIcon } from "./cloud-solid.js"; +export { default as CloudIcon } from "./cloud.js"; +export { default as CodeIcon } from "./code.js"; +export { default as CollapseIcon } from "./collapse.js"; +export { default as CompanyIcon } from "./company.js"; +export { default as ComposeIcon } from "./compose.js"; +export { default as ComputerIcon } from "./computer.js"; +export { default as CopyIcon } from "./copy.js"; +export { default as DarkModeIcon } from "./dark-mode.js"; +export { default as DeleteIcon } from "./delete.js"; +export { default as DevicesIcon } from "./devices.js"; +export { default as DocumentIcon } from "./document.js"; +export { default as DownloadIcon } from "./download.js"; +export { default as DragGridIcon } from "./drag-grid.js"; +export { default as DragListIcon } from "./drag-list.js"; +export { default as EditSolidIcon } from "./edit-solid.js"; +export { default as EditIcon } from "./edit.js"; +export { default as EmailSolidIcon } from "./email-solid.js"; +export { default as EmailIcon } from "./email.js"; +export { default as EndCallIcon } from "./end-call.js"; +export { default as ErrorIcon } from "./error.js"; +export { default as ExpandIcon } from "./expand.js"; +export { default as ExportArchiveIcon } from "./export-archive.js"; +export { default as ExtensionsSolidIcon } from "./extensions-solid.js"; +export { default as ExtensionsIcon } from "./extensions.js"; +export { default as FavouriteSolidIcon } from "./favourite-solid.js"; +export { default as FavouriteIcon } from "./favourite.js"; +export { default as FileErrorIcon } from "./file-error.js"; +export { default as FilesIcon } from "./files.js"; +export { default as FilterIcon } from "./filter.js"; +export { default as ForwardIcon } from "./forward.js"; +export { default as GridIcon } from "./grid.js"; +export { default as HelpSolidIcon } from "./help-solid.js"; +export { default as HelpIcon } from "./help.js"; +export { default as HistoryIcon } from "./history.js"; +export { default as HomeSolidIcon } from "./home-solid.js"; +export { default as HomeIcon } from "./home.js"; +export { default as HostIcon } from "./host.js"; +export { default as ImageErrorIcon } from "./image-error.js"; +export { default as ImageIcon } from "./image.js"; +export { default as IndentDecreaseIcon } from "./indent-decrease.js"; +export { default as IndentIncreaseIcon } from "./indent-increase.js"; +export { default as InfoSolidIcon } from "./info-solid.js"; +export { default as InfoIcon } from "./info.js"; +export { default as InlineCodeIcon } from "./inline-code.js"; +export { default as ItalicIcon } from "./italic.js"; +export { default as KeyOffSolidIcon } from "./key-off-solid.js"; +export { default as KeyOffIcon } from "./key-off.js"; +export { default as KeySolidIcon } from "./key-solid.js"; +export { default as KeyIcon } from "./key.js"; +export { default as KeyboardIcon } from "./keyboard.js"; +export { default as LabsIcon } from "./labs.js"; +export { default as LeaveIcon } from "./leave.js"; +export { default as LinkIcon } from "./link.js"; +export { default as ListBulletedIcon } from "./list-bulleted.js"; +export { default as ListNumberedIcon } from "./list-numbered.js"; +export { default as LocationNavigatorCentredIcon } from "./location-navigator-centred.js"; +export { default as LocationNavigatorIcon } from "./location-navigator.js"; +export { default as LocationPinSolidIcon } from "./location-pin-solid.js"; +export { default as LocationPinIcon } from "./location-pin.js"; +export { default as LockOffIcon } from "./lock-off.js"; +export { default as LockSolidIcon } from "./lock-solid.js"; +export { default as LockIcon } from "./lock.js"; +export { default as MarkAsReadIcon } from "./mark-as-read.js"; +export { default as MarkAsUnreadIcon } from "./mark-as-unread.js"; +export { default as MarkerReadReceiptsIcon } from "./marker-read-receipts.js"; +export { default as MentionIcon } from "./mention.js"; +export { default as MenuIcon } from "./menu.js"; +export { default as MicOffSolidIcon } from "./mic-off-solid.js"; +export { default as MicOffIcon } from "./mic-off.js"; +export { default as MicOnSolidIcon } from "./mic-on-solid.js"; +export { default as MicOnIcon } from "./mic-on.js"; +export { default as MinusIcon } from "./minus.js"; +export { default as MobileIcon } from "./mobile.js"; +export { default as NotificationsOffSolidIcon } from "./notifications-off-solid.js"; +export { default as NotificationsOffIcon } from "./notifications-off.js"; +export { default as NotificationsSolidIcon } from "./notifications-solid.js"; +export { default as NotificationsIcon } from "./notifications.js"; +export { default as OfflineIcon } from "./offline.js"; +export { default as OverflowHorizontalIcon } from "./overflow-horizontal.js"; +export { default as OverflowVerticalIcon } from "./overflow-vertical.js"; +export { default as PauseSolidIcon } from "./pause-solid.js"; +export { default as PauseIcon } from "./pause.js"; +export { default as PinSolidIcon } from "./pin-solid.js"; +export { default as PinIcon } from "./pin.js"; +export { default as PlaySolidIcon } from "./play-solid.js"; +export { default as PlayIcon } from "./play.js"; +export { default as PlusIcon } from "./plus.js"; +export { default as PollsEndIcon } from "./polls-end.js"; +export { default as PollsIcon } from "./polls.js"; +export { default as PopOutIcon } from "./pop-out.js"; +export { default as PreferencesIcon } from "./preferences.js"; +export { default as PublicIcon } from "./public.js"; +export { default as QrCodeIcon } from "./qr-code.js"; +export { default as QuoteIcon } from "./quote.js"; +export { default as ReactionAddIcon } from "./reaction-add.js"; +export { default as ReactionIcon } from "./reaction.js"; +export { default as ReplyIcon } from "./reply.js"; +export { default as RestartIcon } from "./restart.js"; +export { default as SearchIcon } from "./search.js"; +export { default as SendSolidIcon } from "./send-solid.js"; +export { default as SendIcon } from "./send.js"; +export { default as SettingsSolidIcon } from "./settings-solid.js"; +export { default as SettingsIcon } from "./settings.js"; +export { default as ShareAndroidIcon } from "./share-android.js"; +export { default as ShareIosIcon } from "./share-ios.js"; +export { default as ShareScreenSolidIcon } from "./share-screen-solid.js"; +export { default as ShareScreenIcon } from "./share-screen.js"; +export { default as ShareIcon } from "./share.js"; +export { default as SidebarIcon } from "./sidebar.js"; +export { default as SignOutIcon } from "./sign-out.js"; +export { default as SpinnerIcon } from "./spinner.js"; +export { default as SpotlightIcon } from "./spotlight.js"; +export { default as StrikethroughIcon } from "./strikethrough.js"; +export { default as SwitchCameraSolidIcon } from "./switch-camera-solid.js"; +export { default as TakePhotoSolidIcon } from "./take-photo-solid.js"; +export { default as TakePhotoIcon } from "./take-photo.js"; +export { default as TextFormattingIcon } from "./text-formatting.js"; +export { default as ThreadsSolidIcon } from "./threads-solid.js"; +export { default as ThreadsIcon } from "./threads.js"; +export { default as TimeIcon } from "./time.js"; +export { default as UnderlineIcon } from "./underline.js"; +export { default as UnknownSolidIcon } from "./unknown-solid.js"; +export { default as UnknownIcon } from "./unknown.js"; +export { default as UserAddSolidIcon } from "./user-add-solid.js"; +export { default as UserAddIcon } from "./user-add.js"; +export { default as UserProfileSolidIcon } from "./user-profile-solid.js"; +export { default as UserProfileIcon } from "./user-profile.js"; +export { default as UserSolidIcon } from "./user-solid.js"; +export { default as UserIcon } from "./user.js"; +export { default as VerifiedIcon } from "./verified.js"; +export { default as VideoCallDeclinedSolidIcon } from "./video-call-declined-solid.js"; +export { default as VideoCallMissedSolidIcon } from "./video-call-missed-solid.js"; +export { default as VideoCallOffSolidIcon } from "./video-call-off-solid.js"; +export { default as VideoCallOffIcon } from "./video-call-off.js"; +export { default as VideoCallSolidIcon } from "./video-call-solid.js"; +export { default as VideoCallIcon } from "./video-call.js"; +export { default as VisibilityOffIcon } from "./visibility-off.js"; +export { default as VisibilityOnIcon } from "./visibility-on.js"; +export { default as VoiceCallIcon } from "./voice-call.js"; +export { default as VolumeOffSolidIcon } from "./volume-off-solid.js"; +export { default as VolumeOffIcon } from "./volume-off.js"; +export { default as VolumeOnSolidIcon } from "./volume-on-solid.js"; +export { default as VolumeOnIcon } from "./volume-on.js"; +export { default as WarningIcon } from "./warning.js"; +export { default as WebBrowserIcon } from "./web-browser.js"; \ No newline at end of file diff --git a/assets/web/icons/info-solid.d.ts b/assets/web/icons/info-solid.d.ts new file mode 100644 index 00000000..dada47ea --- /dev/null +++ b/assets/web/icons/info-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * info-solid.svg + */ +declare const InfoSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default InfoSolidIcon; diff --git a/assets/web/icons/info-solid.js b/assets/web/icons/info-solid.js new file mode 100644 index 00000000..28342aa6 --- /dev/null +++ b/assets/web/icons/info-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function InfoSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 17a.97.97 0 0 0 .713-.288A.968.968 0 0 0 13 16v-4a.968.968 0 0 0-.287-.713A.968.968 0 0 0 12 11a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 12v4c0 .283.096.52.287.712.192.192.43.288.713.288Zm0-8c.283 0 .52-.096.713-.287A.967.967 0 0 0 13 8a.967.967 0 0 0-.287-.713A.968.968 0 0 0 12 7a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 8c0 .283.096.52.287.713.192.191.43.287.713.287Zm0 13a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Z" + }) + }); +} +; +InfoSolidIcon.displayName = "InfoSolidIcon"; +export default InfoSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/info-solid.svg b/assets/web/icons/info-solid.svg deleted file mode 100644 index 7b3542f3..00000000 --- a/assets/web/icons/info-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/info.d.ts b/assets/web/icons/info.d.ts new file mode 100644 index 00000000..0e4f4fe6 --- /dev/null +++ b/assets/web/icons/info.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * info.svg + */ +declare const InfoIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default InfoIcon; diff --git a/assets/web/icons/info.js b/assets/web/icons/info.js new file mode 100644 index 00000000..93684d0e --- /dev/null +++ b/assets/web/icons/info.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function InfoIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M11.287 7.287A.968.968 0 0 1 12 7c.283 0 .52.096.713.287.191.192.287.43.287.713s-.096.52-.287.713A.968.968 0 0 1 12 9a.968.968 0 0 1-.713-.287A.967.967 0 0 1 11 8c0-.283.096-.52.287-.713Zm0 4A.968.968 0 0 1 12 11c.283 0 .52.096.713.287.191.192.287.43.287.713v4a.97.97 0 0 1-.287.712A.968.968 0 0 1 12 17a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 16v-4c0-.283.096-.52.287-.713Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M22 12c0 5.523-4.477 10-10 10S2 17.523 2 12 6.477 2 12 2s10 4.477 10 10Zm-2 0a8 8 0 1 1-16 0 8 8 0 0 1 16 0Z", + clipRule: "evenodd" + })] + }); +} +; +InfoIcon.displayName = "InfoIcon"; +export default InfoIcon; \ No newline at end of file diff --git a/assets/web/icons/info.svg b/assets/web/icons/info.svg deleted file mode 100644 index d2c6bcfd..00000000 --- a/assets/web/icons/info.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/inline-code.d.ts b/assets/web/icons/inline-code.d.ts new file mode 100644 index 00000000..cf3eeca5 --- /dev/null +++ b/assets/web/icons/inline-code.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * inline-code.svg + */ +declare const InlineCodeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default InlineCodeIcon; diff --git a/assets/web/icons/inline-code.js b/assets/web/icons/inline-code.js new file mode 100644 index 00000000..00d43c67 --- /dev/null +++ b/assets/web/icons/inline-code.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function InlineCodeIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M14.958 5.62a1 1 0 0 0-1.916-.574l-4 13.333a1 1 0 0 0 1.916.575l4-13.333ZM5.974 7.232a1 1 0 0 0-1.409.128l-3.333 4a1 1 0 0 0 0 1.28l3.333 4a1 1 0 0 0 1.537-1.28L3.302 12l2.8-3.36a1 1 0 0 0-.128-1.408Zm12.052 0a1 1 0 0 1 1.409.128l3.333 4a1 1 0 0 1 0 1.28l-3.333 4a1 1 0 0 1-1.537-1.28l2.8-3.36-2.8-3.36a1 1 0 0 1 .128-1.408Z" + }) + }); +} +; +InlineCodeIcon.displayName = "InlineCodeIcon"; +export default InlineCodeIcon; \ No newline at end of file diff --git a/assets/web/icons/inline-code.svg b/assets/web/icons/inline-code.svg deleted file mode 100644 index 788874f4..00000000 --- a/assets/web/icons/inline-code.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/italic.d.ts b/assets/web/icons/italic.d.ts new file mode 100644 index 00000000..f83a3222 --- /dev/null +++ b/assets/web/icons/italic.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * italic.svg + */ +declare const ItalicIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ItalicIcon; diff --git a/assets/web/icons/italic.js b/assets/web/icons/italic.js new file mode 100644 index 00000000..b71c3e93 --- /dev/null +++ b/assets/web/icons/italic.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ItalicIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6.25 19c-.35 0-.646-.12-.888-.363A1.207 1.207 0 0 1 5 17.75c0-.35.12-.646.362-.887.242-.242.538-.363.888-.363H9l3-9H9.25c-.35 0-.646-.12-.887-.362A1.207 1.207 0 0 1 8 6.25c0-.35.12-.646.363-.888A1.21 1.21 0 0 1 9.25 5h7.5c.35 0 .646.12.887.362.242.242.363.538.363.888s-.12.646-.363.888a1.207 1.207 0 0 1-.887.362H14.5l-3 9h2.25c.35 0 .646.12.887.363.242.241.363.537.363.887s-.12.646-.363.887a1.207 1.207 0 0 1-.887.363h-7.5Z" + }) + }); +} +; +ItalicIcon.displayName = "ItalicIcon"; +export default ItalicIcon; \ No newline at end of file diff --git a/assets/web/icons/italic.svg b/assets/web/icons/italic.svg deleted file mode 100644 index 51a2ea2e..00000000 --- a/assets/web/icons/italic.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/key-off-solid.d.ts b/assets/web/icons/key-off-solid.d.ts new file mode 100644 index 00000000..746cc239 --- /dev/null +++ b/assets/web/icons/key-off-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * key-off-solid.svg + */ +declare const KeyOffSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default KeyOffSolidIcon; diff --git a/assets/web/icons/key-off-solid.js b/assets/web/icons/key-off-solid.js new file mode 100644 index 00000000..63ba6527 --- /dev/null +++ b/assets/web/icons/key-off-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function KeyOffSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4.917 2.083a1 1 0 0 0-1.414 1.414L6.07 6.064c-1.27.18-2.377.743-3.32 1.686C1.583 8.917 1 10.333 1 12c0 1.667.583 3.083 1.75 4.25C3.917 17.417 5.333 18 7 18a5.863 5.863 0 0 0 3.475-1.1A5.81 5.81 0 0 0 12.65 14H13l1.3 1.3c.1.1.208.17.325.213.117.041.242.062.375.062s.258-.02.375-.062a.782.782 0 0 0 .1-.044l5.028 5.028a1 1 0 0 0 1.414-1.414l-17-17Zm.67 11.33A1.926 1.926 0 0 1 5 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 7 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.413A1.926 1.926 0 0 1 7 14c-.55 0-1.02-.196-1.412-.587Zm14.9 1.423L15.65 10h4.95a1.033 1.033 0 0 1 .725.3l1.025 1.025c.083.083.15.18.2.288.05.108.075.229.075.362a1.067 1.067 0 0 1-.25.7l-1.888 2.16Z" + }) + }); +} +; +KeyOffSolidIcon.displayName = "KeyOffSolidIcon"; +export default KeyOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/key-off-solid.svg b/assets/web/icons/key-off-solid.svg deleted file mode 100644 index c61a5615..00000000 --- a/assets/web/icons/key-off-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/key-off.d.ts b/assets/web/icons/key-off.d.ts new file mode 100644 index 00000000..d7578389 --- /dev/null +++ b/assets/web/icons/key-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * key-off.svg + */ +declare const KeyOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default KeyOffIcon; diff --git a/assets/web/icons/key-off.js b/assets/web/icons/key-off.js new file mode 100644 index 00000000..7f2e981f --- /dev/null +++ b/assets/web/icons/key-off.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function KeyOffIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M7 14c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 5 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 7 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.413A1.926 1.926 0 0 1 7 14Z" + }), /*#__PURE__*/_jsx("path", { + d: "M4.917 2.083a1 1 0 0 0-1.414 1.414L6.07 6.064c-1.27.18-2.377.743-3.32 1.686C1.583 8.917 1 10.333 1 12c0 1.667.583 3.083 1.75 4.25C3.917 17.417 5.333 18 7 18c1.117 0 2.13-.275 3.037-.825A6.212 6.212 0 0 0 12.2 15h1.175l1.525 1.075c.083.067.18.117.287.15a.945.945 0 0 0 .887-.15l.004-.002 4.425 4.424a1 1 0 0 0 1.414-1.414l-17-17ZM13.006 13h-2.131a4.033 4.033 0 0 1-1.412 2.15c-.709.567-1.53.85-2.463.85-1.1 0-2.042-.392-2.825-1.175C3.392 14.042 3 13.1 3 12s.392-2.042 1.175-2.825C4.958 8.392 5.9 8 7 8c.413 0 .803.055 1.172.166l2.649 2.65c.02.06.037.122.054.184h.13l2 2Zm8.144-1-1.75 1.75 1.426 1.425L23.3 12.7c.1-.1.17-.208.212-.325.042-.117.063-.242.063-.375s-.02-.258-.063-.375a.877.877 0 0 0-.212-.325l-2-2a.999.999 0 0 0-.338-.225A1.034 1.034 0 0 0 20.575 9h-5.924l2 2h3.499l1 1Z" + })] + }); +} +; +KeyOffIcon.displayName = "KeyOffIcon"; +export default KeyOffIcon; \ No newline at end of file diff --git a/assets/web/icons/key-off.svg b/assets/web/icons/key-off.svg deleted file mode 100644 index d16c68dc..00000000 --- a/assets/web/icons/key-off.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/key-solid.d.ts b/assets/web/icons/key-solid.d.ts new file mode 100644 index 00000000..1003fa7c --- /dev/null +++ b/assets/web/icons/key-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * key-solid.svg + */ +declare const KeySolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default KeySolidIcon; diff --git a/assets/web/icons/key-solid.js b/assets/web/icons/key-solid.js new file mode 100644 index 00000000..308d13c9 --- /dev/null +++ b/assets/web/icons/key-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function KeySolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M10.475 16.9A5.863 5.863 0 0 1 7 18c-1.667 0-3.083-.583-4.25-1.75C1.583 15.083 1 13.667 1 12c0-1.667.583-3.083 1.75-4.25C3.917 6.583 5.333 6 7 6c1.35 0 2.53.383 3.537 1.15 1.009.767 1.713 1.717 2.113 2.85h7.95a1.033 1.033 0 0 1 .725.3l1.025 1.025a.99.99 0 0 1 .2.288c.05.108.075.229.075.362a1.066 1.066 0 0 1-.25.7l-2.25 2.575a.973.973 0 0 1-1.038.313 1.033 1.033 0 0 1-.337-.188L17 14l-1.3 1.3c-.1.1-.208.17-.325.212a1.106 1.106 0 0 1-.375.063c-.133 0-.258-.02-.375-.063a.877.877 0 0 1-.325-.212L13 14h-.35a5.81 5.81 0 0 1-2.175 2.9Zm-4.887-3.487c.391.39.862.587 1.412.587.55 0 1.02-.196 1.412-.588C8.804 13.021 9 12.55 9 12c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 7 10c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 5 12c0 .55.196 1.02.588 1.412Z" + }) + }); +} +; +KeySolidIcon.displayName = "KeySolidIcon"; +export default KeySolidIcon; \ No newline at end of file diff --git a/assets/web/icons/key-solid.svg b/assets/web/icons/key-solid.svg deleted file mode 100644 index 4056d9db..00000000 --- a/assets/web/icons/key-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/key.d.ts b/assets/web/icons/key.d.ts new file mode 100644 index 00000000..45e2ed11 --- /dev/null +++ b/assets/web/icons/key.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * key.svg + */ +declare const KeyIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default KeyIcon; diff --git a/assets/web/icons/key.js b/assets/web/icons/key.js new file mode 100644 index 00000000..ea3424ac --- /dev/null +++ b/assets/web/icons/key.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function KeyIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M7 14c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 5 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 7 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 7 14Zm0 4c-1.667 0-3.083-.583-4.25-1.75C1.583 15.083 1 13.667 1 12c0-1.667.583-3.083 1.75-4.25C3.917 6.583 5.333 6 7 6c1.117 0 2.13.275 3.037.825A6.212 6.212 0 0 1 12.2 9h8.375a1.033 1.033 0 0 1 .725.3l2 2c.1.1.17.208.212.325.042.117.063.242.063.375s-.02.258-.063.375a.877.877 0 0 1-.212.325l-3.175 3.175a.946.946 0 0 1-.3.2c-.117.05-.233.083-.35.1a.832.832 0 0 1-.35-.025.884.884 0 0 1-.325-.175L17.5 15l-1.425 1.075a.945.945 0 0 1-.887.15.859.859 0 0 1-.288-.15L13.375 15H12.2a6.212 6.212 0 0 1-2.162 2.175C9.128 17.725 8.117 18 7 18Zm0-2c.933 0 1.754-.283 2.463-.85A4.032 4.032 0 0 0 10.875 13H14l1.45 1.025L17.5 12.5l1.775 1.375L21.15 12l-1-1h-9.275a4.032 4.032 0 0 0-1.412-2.15C8.754 8.283 7.933 8 7 8c-1.1 0-2.042.392-2.825 1.175C3.392 9.958 3 10.9 3 12s.392 2.042 1.175 2.825C4.958 15.608 5.9 16 7 16Z" + }) + }); +} +; +KeyIcon.displayName = "KeyIcon"; +export default KeyIcon; \ No newline at end of file diff --git a/assets/web/icons/key.svg b/assets/web/icons/key.svg deleted file mode 100644 index 8b2ad86e..00000000 --- a/assets/web/icons/key.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/keyboard.d.ts b/assets/web/icons/keyboard.d.ts new file mode 100644 index 00000000..5e77618e --- /dev/null +++ b/assets/web/icons/keyboard.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * keyboard.svg + */ +declare const KeyboardIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default KeyboardIcon; diff --git a/assets/web/icons/keyboard.js b/assets/web/icons/keyboard.js new file mode 100644 index 00000000..7c2e30fa --- /dev/null +++ b/assets/web/icons/keyboard.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function KeyboardIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M5.188 8v2h2V8h-2Zm3.875 0v2h2V8h-2Zm3.875 0v2h2V8h-2Zm3.875 0v2h2V8h-2ZM5.188 11.531v2h2v-2h-2Zm3.875 0v2h2v-2h-2Zm3.875 0v2h2v-2h-2Zm3.875 0v2h2v-2h-2ZM9 15a1 1 0 1 0 0 2h6a1 1 0 1 0 0-2H9Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M2 6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V6Zm2 0h16v12H4V6Z", + clipRule: "evenodd" + })] + }); +} +; +KeyboardIcon.displayName = "KeyboardIcon"; +export default KeyboardIcon; \ No newline at end of file diff --git a/assets/web/icons/keyboard.svg b/assets/web/icons/keyboard.svg deleted file mode 100644 index 8249eebb..00000000 --- a/assets/web/icons/keyboard.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/labs.d.ts b/assets/web/icons/labs.d.ts new file mode 100644 index 00000000..8094fab4 --- /dev/null +++ b/assets/web/icons/labs.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * labs.svg + */ +declare const LabsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LabsIcon; diff --git a/assets/web/icons/labs.js b/assets/web/icons/labs.js new file mode 100644 index 00000000..c9256de5 --- /dev/null +++ b/assets/web/icons/labs.js @@ -0,0 +1,23 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function LabsIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M12 5a1 1 0 0 1-1-1V3a1 1 0 1 1 2 0v1a1 1 0 0 1-1 1Zm-7.071-.071a1 1 0 0 1 1.414 0l.707.707A1 1 0 0 1 5.636 7.05l-.707-.707a1 1 0 0 1 0-1.414Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M15.734 15.325C15.316 15.795 15 16.371 15 17v2a2 2 0 0 1-2 2h-2a2 2 0 0 1-2-2v-2c0-.63-.316-1.205-.734-1.675a5 5 0 1 1 7.468 0Zm-1.493-1.33a3 3 0 1 0-4.482 0c.433.486.894 1.166 1.112 2.005h2.258c.218-.84.679-1.52 1.112-2.005ZM13 18h-2v1h2v-1Z", + clipRule: "evenodd" + }), /*#__PURE__*/_jsx("path", { + d: "M2 12a1 1 0 0 1 1-1h1a1 1 0 1 1 0 2H3a1 1 0 0 1-1-1Zm18-1a1 1 0 1 0 0 2h1a1 1 0 1 0 0-2h-1Zm-3.05-5.364a1 1 0 0 0 1.414 1.414l.707-.707a1 1 0 0 0-1.414-1.414l-.707.707Z" + })] + }); +} +; +LabsIcon.displayName = "LabsIcon"; +export default LabsIcon; \ No newline at end of file diff --git a/assets/web/icons/labs.svg b/assets/web/icons/labs.svg deleted file mode 100644 index 57dc13ca..00000000 --- a/assets/web/icons/labs.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/assets/web/icons/leave.d.ts b/assets/web/icons/leave.d.ts new file mode 100644 index 00000000..5776b94e --- /dev/null +++ b/assets/web/icons/leave.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * leave.svg + */ +declare const LeaveIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LeaveIcon; diff --git a/assets/web/icons/leave.js b/assets/web/icons/leave.js new file mode 100644 index 00000000..1eec25ca --- /dev/null +++ b/assets/web/icons/leave.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function LeaveIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M14 13c.283 0 .52-.096.713-.287A.968.968 0 0 0 15 12a.968.968 0 0 0-.287-.713A.968.968 0 0 0 14 11a.968.968 0 0 0-.713.287A.968.968 0 0 0 13 12c0 .283.096.52.287.713.192.191.43.287.713.287Z" + }), /*#__PURE__*/_jsx("path", { + d: "M10.385 21.788A.998.998 0 0 1 10 21V3a1.003 1.003 0 0 1 1.242-.97l8 2A1 1 0 0 1 20 5v14a1 1 0 0 1-.758.97l-8 2a.998.998 0 0 1-.857-.182ZM18 5.781l-6-1.5v15.438l6-1.5V5.781ZM9 6H7v12h2v2H7a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2v2Z" + })] + }); +} +; +LeaveIcon.displayName = "LeaveIcon"; +export default LeaveIcon; \ No newline at end of file diff --git a/assets/web/icons/leave.svg b/assets/web/icons/leave.svg deleted file mode 100644 index f21e8722..00000000 --- a/assets/web/icons/leave.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/link.d.ts b/assets/web/icons/link.d.ts new file mode 100644 index 00000000..f7d1689e --- /dev/null +++ b/assets/web/icons/link.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * link.svg + */ +declare const LinkIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LinkIcon; diff --git a/assets/web/icons/link.js b/assets/web/icons/link.js new file mode 100644 index 00000000..794a68d7 --- /dev/null +++ b/assets/web/icons/link.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LinkIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 19.071c-.978.978-2.157 1.467-3.536 1.467-1.378 0-2.557-.489-3.535-1.467-.978-.978-1.467-2.157-1.467-3.535 0-1.38.489-2.558 1.467-3.536L7.05 9.879c.2-.2.436-.3.707-.3.271 0 .507.1.707.3.2.2.301.436.301.707 0 .27-.1.507-.3.707l-2.122 2.121a2.893 2.893 0 0 0-.884 2.122c0 .824.295 1.532.884 2.12.59.59 1.296.885 2.121.885s1.533-.295 2.122-.884l2.121-2.121c.2-.2.436-.3.707-.3.271 0 .507.1.707.3.2.2.3.436.3.707 0 .27-.1.506-.3.707L12 19.07Zm-1.414-4.243c-.2.2-.436.301-.707.301a.968.968 0 0 1-.707-.3.97.97 0 0 1-.301-.708c0-.27.1-.506.3-.707l4.243-4.242c.2-.2.436-.3.707-.3.271 0 .507.1.707.3.2.2.3.436.3.707 0 .27-.1.507-.3.707l-4.242 4.242Zm6.364-.707c-.2.2-.436.3-.707.3a.968.968 0 0 1-.707-.3.969.969 0 0 1-.301-.707c0-.27.1-.506.3-.707l2.122-2.121c.59-.59.884-1.297.884-2.121 0-.825-.295-1.533-.884-2.122a2.893 2.893 0 0 0-2.121-.884c-.825 0-1.532.295-2.122.884l-2.121 2.122c-.2.2-.436.3-.707.3a.968.968 0 0 1-.707-.3.97.97 0 0 1-.3-.708c0-.27.1-.506.3-.707L12 4.93c.978-.978 2.157-1.467 3.536-1.467 1.378 0 2.557.489 3.535 1.467.978.978 1.467 2.157 1.467 3.536 0 1.378-.489 2.557-1.467 3.535l-2.121 2.121Z" + }) + }); +} +; +LinkIcon.displayName = "LinkIcon"; +export default LinkIcon; \ No newline at end of file diff --git a/assets/web/icons/link.svg b/assets/web/icons/link.svg deleted file mode 100644 index e55c9a32..00000000 --- a/assets/web/icons/link.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/list-bulleted.d.ts b/assets/web/icons/list-bulleted.d.ts new file mode 100644 index 00000000..6df2b5ef --- /dev/null +++ b/assets/web/icons/list-bulleted.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * list-bulleted.svg + */ +declare const ListBulletedIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ListBulletedIcon; diff --git a/assets/web/icons/list-bulleted.js b/assets/web/icons/list-bulleted.js new file mode 100644 index 00000000..95596c9c --- /dev/null +++ b/assets/web/icons/list-bulleted.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ListBulletedIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4.5 7.5a1.45 1.45 0 0 1-1.06-.44A1.444 1.444 0 0 1 3 6c0-.412.147-.766.44-1.06A1.45 1.45 0 0 1 4.5 4.5c.412 0 .766.147 1.06.44.293.294.44.647.44 1.06 0 .412-.147.766-.44 1.06-.294.293-.647.44-1.06.44Zm4.787 11.212c.192.192.43.288.713.288h10c.283 0 .52-.096.712-.288A.968.968 0 0 0 21 18a.968.968 0 0 0-.288-.712A.968.968 0 0 0 20 17H10a.967.967 0 0 0-.713.288A.968.968 0 0 0 9 18c0 .283.096.52.287.712Zm0-5.999c.192.191.43.287.713.287h10a.97.97 0 0 0 .712-.287A.968.968 0 0 0 21 12a.968.968 0 0 0-.288-.713A.968.968 0 0 0 20 11H10a.967.967 0 0 0-.713.287A.968.968 0 0 0 9 12c0 .283.096.52.287.713Zm0-6c.192.191.43.287.713.287h10a.97.97 0 0 0 .712-.287A.967.967 0 0 0 21 6a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 5H10a.968.968 0 0 0-.713.287A.968.968 0 0 0 9 6c0 .283.096.52.287.713ZM3.44 19.06c.294.293.648.44 1.06.44a1.45 1.45 0 0 0 1.06-.44c.293-.294.44-.647.44-1.06 0-.413-.147-.766-.44-1.06a1.445 1.445 0 0 0-1.06-.44 1.45 1.45 0 0 0-1.06.44c-.293.294-.44.647-.44 1.06 0 .413.147.766.44 1.06ZM4.5 13.5a1.45 1.45 0 0 1-1.06-.44A1.445 1.445 0 0 1 3 12c0-.412.147-.766.44-1.06a1.45 1.45 0 0 1 1.06-.44c.412 0 .766.147 1.06.44.293.294.44.648.44 1.06 0 .412-.147.766-.44 1.06-.294.293-.647.44-1.06.44Z" + }) + }); +} +; +ListBulletedIcon.displayName = "ListBulletedIcon"; +export default ListBulletedIcon; \ No newline at end of file diff --git a/assets/web/icons/list-bulleted.svg b/assets/web/icons/list-bulleted.svg deleted file mode 100644 index ab5177b6..00000000 --- a/assets/web/icons/list-bulleted.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/list-numbered.d.ts b/assets/web/icons/list-numbered.d.ts new file mode 100644 index 00000000..bd600372 --- /dev/null +++ b/assets/web/icons/list-numbered.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * list-numbered.svg + */ +declare const ListNumberedIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ListNumberedIcon; diff --git a/assets/web/icons/list-numbered.js b/assets/web/icons/list-numbered.js new file mode 100644 index 00000000..cf940d76 --- /dev/null +++ b/assets/web/icons/list-numbered.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ListNumberedIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M9 6a1 1 0 0 1 1-1h10a1 1 0 1 1 0 2H10a1 1 0 0 1-1-1Zm0 6a1 1 0 0 1 1-1h10a1 1 0 1 1 0 2H10a1 1 0 0 1-1-1Zm0 6a1 1 0 0 1 1-1h10a1 1 0 1 1 0 2H10a1 1 0 0 1-1-1ZM5.604 5.089A.75.75 0 0 1 6 5.75v4.5a.75.75 0 0 1-1.5 0V7.151l-.334.223a.75.75 0 0 1-.832-1.248l1.5-1a.75.75 0 0 1 .77-.037ZM5 13a2.02 2.02 0 0 0-1.139.321 1.846 1.846 0 0 0-.626.719 2.286 2.286 0 0 0-.234.921v.023l-.001.01v.005l.75.001H3a.75.75 0 0 0 1.5.01V15a.789.789 0 0 1 .077-.29.35.35 0 0 1 .116-.14c.04-.027.126-.07.307-.07s.267.043.307.07a.35.35 0 0 1 .116.14.788.788 0 0 1 .076.29v.008a.532.532 0 0 1-.14.352l-2.161 2.351a.748.748 0 0 0-.198.523v.016c0 .414.336.75.75.75h2.5a.75.75 0 0 0 0-1.5h-.82l1.034-1.124C6.809 16 7 15.51 7 15h-.75H7v-.039l-.004-.068a2.285 2.285 0 0 0-.231-.853 1.846 1.846 0 0 0-.626-.719A2.02 2.02 0 0 0 5 13Zm-.5 2.003V15v.01-.008Z" + }) + }); +} +; +ListNumberedIcon.displayName = "ListNumberedIcon"; +export default ListNumberedIcon; \ No newline at end of file diff --git a/assets/web/icons/list-numbered.svg b/assets/web/icons/list-numbered.svg deleted file mode 100644 index dcaf5926..00000000 --- a/assets/web/icons/list-numbered.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/location-navigator-centred.d.ts b/assets/web/icons/location-navigator-centred.d.ts new file mode 100644 index 00000000..9ecdd541 --- /dev/null +++ b/assets/web/icons/location-navigator-centred.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * location-navigator-centred.svg + */ +declare const LocationNavigatorCentredIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LocationNavigatorCentredIcon; diff --git a/assets/web/icons/location-navigator-centred.js b/assets/web/icons/location-navigator-centred.js new file mode 100644 index 00000000..50c7cf88 --- /dev/null +++ b/assets/web/icons/location-navigator-centred.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LocationNavigatorCentredIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M11 21.95v-1c-2.084-.233-3.871-1.096-5.363-2.587C4.146 16.87 3.283 15.083 3.05 13h-1a.967.967 0 0 1-.713-.287A.968.968 0 0 1 1.05 12c0-.283.096-.52.287-.713A.967.967 0 0 1 2.05 11h1c.233-2.083 1.096-3.87 2.587-5.363C7.13 4.146 8.917 3.283 11 3.05v-1c0-.283.096-.52.287-.713A.968.968 0 0 1 12 1.05a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v1c2.083.233 3.87 1.096 5.362 2.587C19.854 7.13 20.717 8.917 20.95 11h1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713a.968.968 0 0 1-.712.287h-1c-.233 2.083-1.096 3.87-2.588 5.363-1.491 1.491-3.279 2.354-5.362 2.587v1a.97.97 0 0 1-.288.713.968.968 0 0 1-.712.287.968.968 0 0 1-.713-.287.968.968 0 0 1-.287-.713ZM12 19c1.933 0 3.583-.683 4.95-2.05C18.317 15.583 19 13.933 19 12c0-1.933-.683-3.583-2.05-4.95C15.583 5.683 13.933 5 12 5c-1.934 0-3.584.683-4.95 2.05C5.683 8.417 5 10.067 5 12c0 1.933.683 3.583 2.05 4.95C8.416 18.317 10.066 19 12 19Zm0-3c-1.1 0-2.042-.392-2.825-1.175C8.39 14.042 8 13.1 8 12s.391-2.042 1.175-2.825C9.958 8.392 10.9 8 12 8s2.041.392 2.825 1.175C15.608 9.958 16 10.9 16 12s-.392 2.042-1.175 2.825C14.04 15.608 13.1 16 12 16Z" + }) + }); +} +; +LocationNavigatorCentredIcon.displayName = "LocationNavigatorCentredIcon"; +export default LocationNavigatorCentredIcon; \ No newline at end of file diff --git a/assets/web/icons/location-navigator-centred.svg b/assets/web/icons/location-navigator-centred.svg deleted file mode 100644 index bf8bdd86..00000000 --- a/assets/web/icons/location-navigator-centred.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/location-navigator.d.ts b/assets/web/icons/location-navigator.d.ts new file mode 100644 index 00000000..c25a327d --- /dev/null +++ b/assets/web/icons/location-navigator.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * location-navigator.svg + */ +declare const LocationNavigatorIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LocationNavigatorIcon; diff --git a/assets/web/icons/location-navigator.js b/assets/web/icons/location-navigator.js new file mode 100644 index 00000000..2b90a921 --- /dev/null +++ b/assets/web/icons/location-navigator.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LocationNavigatorIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M11 22v-1c-2.084-.233-3.871-1.096-5.363-2.587-1.491-1.492-2.354-3.28-2.587-5.363h-1a.968.968 0 0 1-.713-.288.968.968 0 0 1-.287-.712c0-.283.096-.52.287-.713a.967.967 0 0 1 .713-.287h1c.233-2.083 1.096-3.87 2.587-5.363C7.13 4.196 8.917 3.333 11 3.1v-1c0-.283.096-.52.287-.713A.968.968 0 0 1 12 1.1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v1c2.083.233 3.87 1.096 5.362 2.587 1.492 1.492 2.355 3.28 2.588 5.363h1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.712a.968.968 0 0 1-.712.288h-1c-.233 2.083-1.096 3.87-2.588 5.363C16.871 19.904 15.083 20.767 13 21v1c0 .283-.096.52-.288.712A.968.968 0 0 1 12 23a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 22Zm1-2.95c1.933 0 3.583-.683 4.95-2.05 1.367-1.367 2.05-3.017 2.05-4.95 0-1.933-.683-3.583-2.05-4.95-1.367-1.367-3.017-2.05-4.95-2.05-1.934 0-3.584.683-4.95 2.05C5.683 8.467 5 10.117 5 12.05c0 1.933.683 3.583 2.05 4.95 1.366 1.367 3.016 2.05 4.95 2.05Z" + }) + }); +} +; +LocationNavigatorIcon.displayName = "LocationNavigatorIcon"; +export default LocationNavigatorIcon; \ No newline at end of file diff --git a/assets/web/icons/location-navigator.svg b/assets/web/icons/location-navigator.svg deleted file mode 100644 index 11219c3c..00000000 --- a/assets/web/icons/location-navigator.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/location-pin-solid.d.ts b/assets/web/icons/location-pin-solid.d.ts new file mode 100644 index 00000000..fbbac971 --- /dev/null +++ b/assets/web/icons/location-pin-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * location-pin-solid.svg + */ +declare const LocationPinSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LocationPinSolidIcon; diff --git a/assets/web/icons/location-pin-solid.js b/assets/web/icons/location-pin-solid.js new file mode 100644 index 00000000..1cb218bf --- /dev/null +++ b/assets/web/icons/location-pin-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LocationPinSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 21.325a2.07 2.07 0 0 1-.7-.125 1.84 1.84 0 0 1-.625-.375A39.112 39.112 0 0 1 7.8 17.9c-.833-.95-1.53-1.87-2.087-2.762-.559-.892-.984-1.75-1.276-2.575C4.146 11.738 4 10.95 4 10.2c0-2.5.804-4.492 2.412-5.975C8.021 2.742 9.883 2 12 2s3.98.742 5.587 2.225C19.197 5.708 20 7.7 20 10.2c0 .75-.146 1.538-.438 2.363-.291.824-.716 1.683-1.274 2.574A21.678 21.678 0 0 1 16.2 17.9a39.112 39.112 0 0 1-2.875 2.925 1.84 1.84 0 0 1-.625.375 2.07 2.07 0 0 1-.7.125ZM12 12c.55 0 1.02-.196 1.412-.588.392-.391.588-.862.588-1.412 0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 12 8c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 10 10c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Z" + }) + }); +} +; +LocationPinSolidIcon.displayName = "LocationPinSolidIcon"; +export default LocationPinSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/location-pin-solid.svg b/assets/web/icons/location-pin-solid.svg deleted file mode 100644 index 647af5c9..00000000 --- a/assets/web/icons/location-pin-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/location-pin.d.ts b/assets/web/icons/location-pin.d.ts new file mode 100644 index 00000000..b0d9c734 --- /dev/null +++ b/assets/web/icons/location-pin.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * location-pin.svg + */ +declare const LocationPinIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LocationPinIcon; diff --git a/assets/web/icons/location-pin.js b/assets/web/icons/location-pin.js new file mode 100644 index 00000000..6ae750b4 --- /dev/null +++ b/assets/web/icons/location-pin.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LocationPinIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 19.35c2.033-1.867 3.542-3.563 4.525-5.088C17.508 12.738 18 11.383 18 10.2c0-1.817-.58-3.304-1.738-4.462C15.104 4.579 13.683 4 12 4c-1.683 0-3.104.58-4.263 1.737C6.58 6.896 6 8.383 6 10.2c0 1.183.492 2.538 1.475 4.063.983 1.524 2.492 3.22 4.525 5.087Zm0 1.975a2.07 2.07 0 0 1-.7-.125 1.84 1.84 0 0 1-.625-.375A39.112 39.112 0 0 1 7.8 17.9c-.833-.95-1.53-1.87-2.087-2.762-.559-.892-.984-1.75-1.276-2.575C4.146 11.738 4 10.95 4 10.2c0-2.5.804-4.492 2.412-5.975C8.021 2.742 9.883 2 12 2s3.98.742 5.587 2.225C19.197 5.708 20 7.7 20 10.2c0 .75-.146 1.538-.438 2.363-.291.824-.716 1.683-1.274 2.574A21.678 21.678 0 0 1 16.2 17.9a39.112 39.112 0 0 1-2.875 2.925 1.84 1.84 0 0 1-.625.375 2.07 2.07 0 0 1-.7.125ZM12 12c.55 0 1.02-.196 1.412-.588.392-.391.588-.862.588-1.412 0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 12 8c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 10 10c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Z" + }) + }); +} +; +LocationPinIcon.displayName = "LocationPinIcon"; +export default LocationPinIcon; \ No newline at end of file diff --git a/assets/web/icons/location-pin.svg b/assets/web/icons/location-pin.svg deleted file mode 100644 index 43acde01..00000000 --- a/assets/web/icons/location-pin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/lock-off.d.ts b/assets/web/icons/lock-off.d.ts new file mode 100644 index 00000000..d0c04269 --- /dev/null +++ b/assets/web/icons/lock-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * lock-off.svg + */ +declare const LockOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LockOffIcon; diff --git a/assets/web/icons/lock-off.js b/assets/web/icons/lock-off.js new file mode 100644 index 00000000..14d55cad --- /dev/null +++ b/assets/web/icons/lock-off.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LockOffIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V10c0-.55.196-1.02.588-1.412a1.98 1.98 0 0 1 .702-.463L1.333 4.167a1 1 0 0 1 1.414-1.414L7 7.006v-.012l13 13v.012l1.247 1.247a1 1 0 1 1-1.414 1.414l-.896-.896A1.935 1.935 0 0 1 18 22H6Zm14-4.834V10c0-.55-.196-1.02-.587-1.412A1.926 1.926 0 0 0 18 8h-1V6c0-1.383-.488-2.563-1.463-3.538C14.563 1.487 13.383 1 12 1s-2.562.488-3.537 1.462a4.876 4.876 0 0 0-1.22 1.947L9 6.166V6c0-.833.292-1.542.875-2.125A2.893 2.893 0 0 1 12 3c.833 0 1.542.292 2.125.875S15 5.167 15 6v2h-4.166L20 17.166Z" + }) + }); +} +; +LockOffIcon.displayName = "LockOffIcon"; +export default LockOffIcon; \ No newline at end of file diff --git a/assets/web/icons/lock-off.svg b/assets/web/icons/lock-off.svg deleted file mode 100644 index 6fd4c108..00000000 --- a/assets/web/icons/lock-off.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/lock-solid.d.ts b/assets/web/icons/lock-solid.d.ts new file mode 100644 index 00000000..1febe7c5 --- /dev/null +++ b/assets/web/icons/lock-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * lock-solid.svg + */ +declare const LockSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LockSolidIcon; diff --git a/assets/web/icons/lock-solid.js b/assets/web/icons/lock-solid.js new file mode 100644 index 00000000..90ea58d0 --- /dev/null +++ b/assets/web/icons/lock-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LockSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V10c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 8h1V6c0-1.383.487-2.563 1.463-3.538C9.438 1.487 10.617 1 12 1s2.563.488 3.537 1.462C16.512 3.438 17 4.617 17 6v2h1c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v10c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6ZM9 8h6V6c0-.833-.292-1.542-.875-2.125A2.893 2.893 0 0 0 12 3c-.833 0-1.542.292-2.125.875A2.893 2.893 0 0 0 9 6v2Z" + }) + }); +} +; +LockSolidIcon.displayName = "LockSolidIcon"; +export default LockSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/lock-solid.svg b/assets/web/icons/lock-solid.svg deleted file mode 100644 index 1be6f128..00000000 --- a/assets/web/icons/lock-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/lock.d.ts b/assets/web/icons/lock.d.ts new file mode 100644 index 00000000..bdc2a496 --- /dev/null +++ b/assets/web/icons/lock.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * lock.svg + */ +declare const LockIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default LockIcon; diff --git a/assets/web/icons/lock.js b/assets/web/icons/lock.js new file mode 100644 index 00000000..4d76e006 --- /dev/null +++ b/assets/web/icons/lock.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function LockIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V10c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 8h1V6c0-1.383.487-2.563 1.463-3.538C9.438 1.487 10.617 1 12 1s2.563.488 3.537 1.462C16.512 3.438 17 4.617 17 6v2h1c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v10c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6Zm0-2h12V10H6v10ZM9 8h6V6c0-.833-.292-1.542-.875-2.125A2.893 2.893 0 0 0 12 3c-.833 0-1.542.292-2.125.875A2.893 2.893 0 0 0 9 6v2Z" + }) + }); +} +; +LockIcon.displayName = "LockIcon"; +export default LockIcon; \ No newline at end of file diff --git a/assets/web/icons/lock.svg b/assets/web/icons/lock.svg deleted file mode 100644 index 4913bbac..00000000 --- a/assets/web/icons/lock.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/mark-as-read.d.ts b/assets/web/icons/mark-as-read.d.ts new file mode 100644 index 00000000..04f6c202 --- /dev/null +++ b/assets/web/icons/mark-as-read.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mark-as-read.svg + */ +declare const MarkAsReadIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MarkAsReadIcon; diff --git a/assets/web/icons/mark-as-read.js b/assets/web/icons/mark-as-read.js new file mode 100644 index 00000000..7c62960c --- /dev/null +++ b/assets/web/icons/mark-as-read.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function MarkAsReadIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M21.324 9.13c0-.66-.339-1.237-.862-1.558l-7.37-4.318a1.812 1.812 0 0 0-1.851 0L3.87 7.572C3.348 7.892 3 8.47 3 9.13v9.167c0 1.008.825 1.833 1.833 1.833H19.5a1.839 1.839 0 0 0 1.833-1.833l-.009-9.167Zm-10.129 3.978-6.6-4.124 6.646-3.896a1.812 1.812 0 0 1 1.851 0l6.646 3.896-6.6 4.124a1.854 1.854 0 0 1-1.943 0Z" + }) + }); +} +; +MarkAsReadIcon.displayName = "MarkAsReadIcon"; +export default MarkAsReadIcon; \ No newline at end of file diff --git a/assets/web/icons/mark-as-read.svg b/assets/web/icons/mark-as-read.svg deleted file mode 100644 index d8540579..00000000 --- a/assets/web/icons/mark-as-read.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/mark-as-unread.d.ts b/assets/web/icons/mark-as-unread.d.ts new file mode 100644 index 00000000..ecb463da --- /dev/null +++ b/assets/web/icons/mark-as-unread.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mark-as-unread.svg + */ +declare const MarkAsUnreadIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MarkAsUnreadIcon; diff --git a/assets/web/icons/mark-as-unread.js b/assets/web/icons/mark-as-unread.js new file mode 100644 index 00000000..53ea54df --- /dev/null +++ b/assets/web/icons/mark-as-unread.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function MarkAsUnreadIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M20 7a2 2 0 1 0 0-4 2 2 0 0 0 0 4Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M17 5H5a2 2 0 0 0-2 2v10.4a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2V7.83a2.995 2.995 0 0 1-2 0 3.056 3.056 0 0 1-.595-.288L12 11.89 5 7.138V7h12.764A2.99 2.99 0 0 1 17 5Zm-4.438 8.927L19 9.555V17.4H5V9.555l6.438 4.372a1 1 0 0 0 1.124 0Z", + clipRule: "evenodd" + })] + }); +} +; +MarkAsUnreadIcon.displayName = "MarkAsUnreadIcon"; +export default MarkAsUnreadIcon; \ No newline at end of file diff --git a/assets/web/icons/mark-as-unread.svg b/assets/web/icons/mark-as-unread.svg deleted file mode 100644 index edf39e81..00000000 --- a/assets/web/icons/mark-as-unread.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/marker-read-receipts.d.ts b/assets/web/icons/marker-read-receipts.d.ts new file mode 100644 index 00000000..8b619cec --- /dev/null +++ b/assets/web/icons/marker-read-receipts.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * marker-read-receipts.svg + */ +declare const MarkerReadReceiptsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MarkerReadReceiptsIcon; diff --git a/assets/web/icons/marker-read-receipts.js b/assets/web/icons/marker-read-receipts.js new file mode 100644 index 00000000..f80332dd --- /dev/null +++ b/assets/web/icons/marker-read-receipts.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function MarkerReadReceiptsIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M14.707 10.707a1 1 0 0 0-1.414-1.414L10 12.586l-1.293-1.293a1 1 0 0 0-1.414 1.414l2 2a1 1 0 0 0 1.414 0l4-4Z" + }), /*#__PURE__*/_jsx("path", { + d: "M22.4 12.625c.067-.2.1-.408.1-.625 0-.217-.033-.425-.1-.625a2.112 2.112 0 0 0-.3-.575l-4.5-6A1.986 1.986 0 0 0 16 4H4c-.55 0-1.02.196-1.413.588A1.926 1.926 0 0 0 2 6v12c0 .55.196 1.02.587 1.413.393.39.863.587 1.413.587h12a1.985 1.985 0 0 0 1.6-.8l4.5-6c.133-.183.233-.375.3-.575ZM16 6l4.5 6-4.5 6H4V6h12Z" + })] + }); +} +; +MarkerReadReceiptsIcon.displayName = "MarkerReadReceiptsIcon"; +export default MarkerReadReceiptsIcon; \ No newline at end of file diff --git a/assets/web/icons/marker-read-receipts.svg b/assets/web/icons/marker-read-receipts.svg deleted file mode 100644 index 7e588b65..00000000 --- a/assets/web/icons/marker-read-receipts.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/mention.d.ts b/assets/web/icons/mention.d.ts new file mode 100644 index 00000000..e0d1dd31 --- /dev/null +++ b/assets/web/icons/mention.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mention.svg + */ +declare const MentionIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MentionIcon; diff --git a/assets/web/icons/mention.js b/assets/web/icons/mention.js new file mode 100644 index 00000000..406fdca1 --- /dev/null +++ b/assets/web/icons/mention.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function MentionIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 4a8 8 0 1 0 0 16 1 1 0 1 1 0 2C6.477 22 2 17.523 2 12S6.477 2 12 2s10 4.477 10 10v1.5a3.5 3.5 0 0 1-6.396 1.966A5 5 0 1 1 17 12v1.5a1.5 1.5 0 0 0 3 0V12a8 8 0 0 0-8-8Zm3 8a3 3 0 1 0-6 0 3 3 0 0 0 6 0Z" + }) + }); +} +; +MentionIcon.displayName = "MentionIcon"; +export default MentionIcon; \ No newline at end of file diff --git a/assets/web/icons/mention.svg b/assets/web/icons/mention.svg deleted file mode 100644 index 3d5207a1..00000000 --- a/assets/web/icons/mention.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/menu.d.ts b/assets/web/icons/menu.d.ts new file mode 100644 index 00000000..cbe0cae9 --- /dev/null +++ b/assets/web/icons/menu.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * menu.svg + */ +declare const MenuIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MenuIcon; diff --git a/assets/web/icons/menu.js b/assets/web/icons/menu.js new file mode 100644 index 00000000..96a396ab --- /dev/null +++ b/assets/web/icons/menu.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function MenuIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 8a1 1 0 0 1 1-1h14a1 1 0 1 1 0 2H5a1 1 0 0 1-1-1Zm0 4a1 1 0 0 1 1-1h14a1 1 0 1 1 0 2H5a1 1 0 0 1-1-1Zm1 3a1 1 0 1 0 0 2h14a1 1 0 1 0 0-2H5Z" + }) + }); +} +; +MenuIcon.displayName = "MenuIcon"; +export default MenuIcon; \ No newline at end of file diff --git a/assets/web/icons/menu.svg b/assets/web/icons/menu.svg deleted file mode 100644 index 72d2ac8e..00000000 --- a/assets/web/icons/menu.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/mic-off-solid.d.ts b/assets/web/icons/mic-off-solid.d.ts new file mode 100644 index 00000000..ecf79b54 --- /dev/null +++ b/assets/web/icons/mic-off-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mic-off-solid.svg + */ +declare const MicOffSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MicOffSolidIcon; diff --git a/assets/web/icons/mic-off-solid.js b/assets/web/icons/mic-off-solid.js new file mode 100644 index 00000000..b0414723 --- /dev/null +++ b/assets/web/icons/mic-off-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function MicOffSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8 8v-.006l6.831 6.832-.002.002 1.414 1.415.003-.003 1.414 1.414-.003.003L20.5 20.5a1 1 0 0 1-1.414 1.414l-3.022-3.022A7.949 7.949 0 0 1 13 19.938V21a1 1 0 0 1-2 0v-1.062A8.001 8.001 0 0 1 4 12a1 1 0 1 1 2 0 6 6 0 0 0 8.587 5.415l-1.55-1.55A4.005 4.005 0 0 1 8 12v-1.172L2.086 4.914A1 1 0 0 1 3.5 3.5L8 8Zm9.417 6.583 1.478 1.477A7.963 7.963 0 0 0 20 12a1 1 0 0 0-2 0c0 .925-.21 1.8-.583 2.583ZM8.073 5.238l7.793 7.793c.087-.329.134-.674.134-1.031V6a4 4 0 0 0-7.927-.762Z" + }) + }); +} +; +MicOffSolidIcon.displayName = "MicOffSolidIcon"; +export default MicOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-off-solid.svg b/assets/web/icons/mic-off-solid.svg deleted file mode 100644 index 243ab1e6..00000000 --- a/assets/web/icons/mic-off-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/mic-off.d.ts b/assets/web/icons/mic-off.d.ts new file mode 100644 index 00000000..0f713cc0 --- /dev/null +++ b/assets/web/icons/mic-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mic-off.svg + */ +declare const MicOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MicOffIcon; diff --git a/assets/web/icons/mic-off.js b/assets/web/icons/mic-off.js new file mode 100644 index 00000000..6242929a --- /dev/null +++ b/assets/web/icons/mic-off.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function MicOffIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M8 8v-.006l2 2V10l3.414 3.414.003-.003 1.414 1.415-.002.002 1.414 1.415.003-.003 1.414 1.414-.003.003L20.5 20.5a1 1 0 0 1-1.414 1.414l-3.022-3.022A7.947 7.947 0 0 1 13 19.938V21a1 1 0 1 1-2 0v-1.062A8.001 8.001 0 0 1 4 12a1 1 0 1 1 2 0 6 6 0 0 0 8.587 5.415l-1.55-1.55A4.005 4.005 0 0 1 8 12v-1.172L2.086 4.914A1 1 0 0 1 3.5 3.5L8 8Z", + clipRule: "evenodd" + }), /*#__PURE__*/_jsx("path", { + d: "M14 6v5.166l1.866 1.866c.087-.33.134-.675.134-1.032V6a4 4 0 0 0-7.928-.762L10 7.166V6a2 2 0 1 1 4 0Zm3.417 8.583 1.477 1.477A7.963 7.963 0 0 0 20 12a1 1 0 1 0-2 0c0 .925-.21 1.8-.583 2.583Z" + })] + }); +} +; +MicOffIcon.displayName = "MicOffIcon"; +export default MicOffIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-off.svg b/assets/web/icons/mic-off.svg deleted file mode 100644 index d06fd5ee..00000000 --- a/assets/web/icons/mic-off.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/mic-on-solid.d.ts b/assets/web/icons/mic-on-solid.d.ts new file mode 100644 index 00000000..45b0d590 --- /dev/null +++ b/assets/web/icons/mic-on-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mic-on-solid.svg + */ +declare const MicOnSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MicOnSolidIcon; diff --git a/assets/web/icons/mic-on-solid.js b/assets/web/icons/mic-on-solid.js new file mode 100644 index 00000000..138bd192 --- /dev/null +++ b/assets/web/icons/mic-on-solid.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function MicOnSolidIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M8 6a4 4 0 1 1 8 0v6a4 4 0 0 1-8 0V6Z" + }), /*#__PURE__*/_jsx("path", { + d: "M5 11a1 1 0 0 1 1 1 6 6 0 0 0 12 0 1 1 0 1 1 2 0 8.001 8.001 0 0 1-7 7.938V21a1 1 0 1 1-2 0v-1.062A8.001 8.001 0 0 1 4 12a1 1 0 0 1 1-1Z" + })] + }); +} +; +MicOnSolidIcon.displayName = "MicOnSolidIcon"; +export default MicOnSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-on-solid.svg b/assets/web/icons/mic-on-solid.svg deleted file mode 100644 index 95cf669a..00000000 --- a/assets/web/icons/mic-on-solid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/mic-on.d.ts b/assets/web/icons/mic-on.d.ts new file mode 100644 index 00000000..d5d7bbaf --- /dev/null +++ b/assets/web/icons/mic-on.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mic-on.svg + */ +declare const MicOnIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MicOnIcon; diff --git a/assets/web/icons/mic-on.js b/assets/web/icons/mic-on.js new file mode 100644 index 00000000..fbdf1668 --- /dev/null +++ b/assets/web/icons/mic-on.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function MicOnIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M6 12a1 1 0 1 0-2 0 8.001 8.001 0 0 0 7 7.938V21a1 1 0 1 0 2 0v-1.062A8.001 8.001 0 0 0 20 12a1 1 0 1 0-2 0 6 6 0 0 1-12 0Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M14 12V6a2 2 0 1 0-4 0v6a2 2 0 1 0 4 0ZM12 2a4 4 0 0 0-4 4v6a4 4 0 0 0 8 0V6a4 4 0 0 0-4-4Z", + clipRule: "evenodd" + })] + }); +} +; +MicOnIcon.displayName = "MicOnIcon"; +export default MicOnIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-on.svg b/assets/web/icons/mic-on.svg deleted file mode 100644 index 8d42ced6..00000000 --- a/assets/web/icons/mic-on.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/minus.d.ts b/assets/web/icons/minus.d.ts new file mode 100644 index 00000000..af7d6308 --- /dev/null +++ b/assets/web/icons/minus.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * minus.svg + */ +declare const MinusIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MinusIcon; diff --git a/assets/web/icons/minus.js b/assets/web/icons/minus.js new file mode 100644 index 00000000..73e6cbd4 --- /dev/null +++ b/assets/web/icons/minus.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function MinusIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 13a.967.967 0 0 1-.713-.287A.968.968 0 0 1 5 12c0-.283.096-.52.287-.713A.967.967 0 0 1 6 11h12a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 18 13H6Z" + }) + }); +} +; +MinusIcon.displayName = "MinusIcon"; +export default MinusIcon; \ No newline at end of file diff --git a/assets/web/icons/minus.svg b/assets/web/icons/minus.svg deleted file mode 100644 index ac48c5de..00000000 --- a/assets/web/icons/minus.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/mobile.d.ts b/assets/web/icons/mobile.d.ts new file mode 100644 index 00000000..faa7f81e --- /dev/null +++ b/assets/web/icons/mobile.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * mobile.svg + */ +declare const MobileIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default MobileIcon; diff --git a/assets/web/icons/mobile.js b/assets/web/icons/mobile.js new file mode 100644 index 00000000..955dc295 --- /dev/null +++ b/assets/web/icons/mobile.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function MobileIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M7 23c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 5 21V3c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 7 1h10c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v18c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 17 23H7Zm0-5h10V6H7v12Z" + }) + }); +} +; +MobileIcon.displayName = "MobileIcon"; +export default MobileIcon; \ No newline at end of file diff --git a/assets/web/icons/mobile.svg b/assets/web/icons/mobile.svg deleted file mode 100644 index 94e95b15..00000000 --- a/assets/web/icons/mobile.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/notifications-off-solid.d.ts b/assets/web/icons/notifications-off-solid.d.ts new file mode 100644 index 00000000..f012b228 --- /dev/null +++ b/assets/web/icons/notifications-off-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * notifications-off-solid.svg + */ +declare const NotificationsOffSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default NotificationsOffSolidIcon; diff --git a/assets/web/icons/notifications-off-solid.js b/assets/web/icons/notifications-off-solid.js new file mode 100644 index 00000000..8a2850ef --- /dev/null +++ b/assets/web/icons/notifications-off-solid.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function NotificationsOffSolidIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "m4.917 2.083 17 17a1 1 0 0 1-1.414 1.414L19.006 19H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-2.034 1.096-3.91L3.503 3.498a1 1 0 0 1 1.414-1.414ZM19 13.349 9.136 3.485C9.93 3.181 10.874 3 12 3c7 0 7 7 7 7v3.349Z" + }), /*#__PURE__*/_jsx("path", { + d: "M10 20h4a2 2 0 1 1-4 0Z" + })] + }); +} +; +NotificationsOffSolidIcon.displayName = "NotificationsOffSolidIcon"; +export default NotificationsOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications-off-solid.svg b/assets/web/icons/notifications-off-solid.svg deleted file mode 100644 index 3cfaeccc..00000000 --- a/assets/web/icons/notifications-off-solid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/notifications-off.d.ts b/assets/web/icons/notifications-off.d.ts new file mode 100644 index 00000000..b744f8d6 --- /dev/null +++ b/assets/web/icons/notifications-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * notifications-off.svg + */ +declare const NotificationsOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default NotificationsOffIcon; diff --git a/assets/web/icons/notifications-off.js b/assets/web/icons/notifications-off.js new file mode 100644 index 00000000..ec24544f --- /dev/null +++ b/assets/web/icons/notifications-off.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function NotificationsOffIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "m4.917 2.083 17 17a1 1 0 0 1-1.414 1.414L19.006 19H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-2.034 1.096-3.91L3.503 3.498a1 1 0 0 1 1.414-1.414ZM17.006 17 7.579 7.573a6.731 6.731 0 0 0-.497 1.662 6.596 6.596 0 0 0-.081.753L7 10.01v6.818L6.828 17h10.178ZM17 11.349V9.988l-.009-.146a6.591 6.591 0 0 0-.073-.607 6.608 6.608 0 0 0-.582-1.84c-.319-.638-.766-1.215-1.398-1.637C14.318 5.344 13.4 5 12 5c-.466 0-.879.038-1.245.104L9.136 3.485C9.93 3.181 10.874 3 12 3c7 0 7 7 7 7v3.349l-2-2Z" + }), /*#__PURE__*/_jsx("path", { + d: "M10 20h4a2 2 0 1 1-4 0Z" + })] + }); +} +; +NotificationsOffIcon.displayName = "NotificationsOffIcon"; +export default NotificationsOffIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications-off.svg b/assets/web/icons/notifications-off.svg deleted file mode 100644 index ee66a1c6..00000000 --- a/assets/web/icons/notifications-off.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/notifications-solid.d.ts b/assets/web/icons/notifications-solid.d.ts new file mode 100644 index 00000000..f863d88d --- /dev/null +++ b/assets/web/icons/notifications-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * notifications-solid.svg + */ +declare const NotificationsSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default NotificationsSolidIcon; diff --git a/assets/web/icons/notifications-solid.js b/assets/web/icons/notifications-solid.js new file mode 100644 index 00000000..aac796a7 --- /dev/null +++ b/assets/web/icons/notifications-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function NotificationsSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M20.293 17.293c.63.63.184 1.707-.707 1.707H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-7 7-7 7 7 7 7v6l1.293 1.293ZM12 22a2 2 0 0 1-2-2h4a2 2 0 0 1-2 2Z" + }) + }); +} +; +NotificationsSolidIcon.displayName = "NotificationsSolidIcon"; +export default NotificationsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications-solid.svg b/assets/web/icons/notifications-solid.svg deleted file mode 100644 index 198cb465..00000000 --- a/assets/web/icons/notifications-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/notifications.d.ts b/assets/web/icons/notifications.d.ts new file mode 100644 index 00000000..3b0c3283 --- /dev/null +++ b/assets/web/icons/notifications.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * notifications.svg + */ +declare const NotificationsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default NotificationsIcon; diff --git a/assets/web/icons/notifications.js b/assets/web/icons/notifications.js new file mode 100644 index 00000000..5738d582 --- /dev/null +++ b/assets/web/icons/notifications.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function NotificationsIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 3c7 0 7 7 7 7v6l1.293 1.293c.63.63.184 1.707-.707 1.707H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-7 7-7Zm5 7.01v-.022l-.009-.146a6.598 6.598 0 0 0-.073-.607 6.604 6.604 0 0 0-.582-1.84c-.319-.638-.766-1.215-1.399-1.637C14.317 5.344 13.4 5 12 5s-2.317.344-2.938.758c-.632.422-1.08.999-1.398 1.636a6.607 6.607 0 0 0-.582 1.841A6.593 6.593 0 0 0 7 9.988v6.84L6.828 17h10.344L17 16.828V10.01ZM12 22a2 2 0 0 1-2-2h4a2 2 0 0 1-2 2Z" + }) + }); +} +; +NotificationsIcon.displayName = "NotificationsIcon"; +export default NotificationsIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications.svg b/assets/web/icons/notifications.svg deleted file mode 100644 index 6d233a05..00000000 --- a/assets/web/icons/notifications.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/offline.d.ts b/assets/web/icons/offline.d.ts new file mode 100644 index 00000000..7dec8861 --- /dev/null +++ b/assets/web/icons/offline.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * offline.svg + */ +declare const OfflineIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default OfflineIcon; diff --git a/assets/web/icons/offline.js b/assets/web/icons/offline.js new file mode 100644 index 00000000..a4d39659 --- /dev/null +++ b/assets/web/icons/offline.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function OfflineIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M3.5 3.5a1 1 0 1 0-1.414 1.414l4.113 4.114a5.484 5.484 0 0 0-.184 1.07A5.002 5.002 0 0 0 7 20h10.172l1.914 1.914A1 1 0 1 0 20.5 20.5l-.979-.979.004-.001L7.145 7.14l-.002.003L3.5 3.5Zm18.5 12a4.48 4.48 0 0 1-.928 2.738L8.637 5.803A5.474 5.474 0 0 1 11.5 5a5.49 5.49 0 0 1 4.25 2.008 4 4 0 0 1 4.187 4.708A4.496 4.496 0 0 1 22 15.5Z" + }) + }); +} +; +OfflineIcon.displayName = "OfflineIcon"; +export default OfflineIcon; \ No newline at end of file diff --git a/assets/web/icons/offline.svg b/assets/web/icons/offline.svg deleted file mode 100644 index 74d01914..00000000 --- a/assets/web/icons/offline.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/overflow-horizontal.d.ts b/assets/web/icons/overflow-horizontal.d.ts new file mode 100644 index 00000000..c093f386 --- /dev/null +++ b/assets/web/icons/overflow-horizontal.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * overflow-horizontal.svg + */ +declare const OverflowHorizontalIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default OverflowHorizontalIcon; diff --git a/assets/web/icons/overflow-horizontal.js b/assets/web/icons/overflow-horizontal.js new file mode 100644 index 00000000..309ef873 --- /dev/null +++ b/assets/web/icons/overflow-horizontal.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function OverflowHorizontalIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 14c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 4 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 6 14Zm6 0c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 12 14Zm6 0c-.55 0-1.02-.196-1.413-.588A1.926 1.926 0 0 1 16 12c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 18 10c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412 0 .55-.196 1.02-.587 1.412A1.926 1.926 0 0 1 18 14Z" + }) + }); +} +; +OverflowHorizontalIcon.displayName = "OverflowHorizontalIcon"; +export default OverflowHorizontalIcon; \ No newline at end of file diff --git a/assets/web/icons/overflow-horizontal.svg b/assets/web/icons/overflow-horizontal.svg deleted file mode 100644 index d5f48a05..00000000 --- a/assets/web/icons/overflow-horizontal.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/overflow-vertical.d.ts b/assets/web/icons/overflow-vertical.d.ts new file mode 100644 index 00000000..0cefd8af --- /dev/null +++ b/assets/web/icons/overflow-vertical.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * overflow-vertical.svg + */ +declare const OverflowVerticalIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default OverflowVerticalIcon; diff --git a/assets/web/icons/overflow-vertical.js b/assets/web/icons/overflow-vertical.js new file mode 100644 index 00000000..8126b0af --- /dev/null +++ b/assets/web/icons/overflow-vertical.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function OverflowVerticalIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 20c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 10 18c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 12 16c.55 0 1.02.196 1.412.587.392.392.588.863.588 1.413s-.196 1.02-.588 1.413A1.926 1.926 0 0 1 12 20Zm0-6c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 12 14Zm0-6c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 4c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 12 8Z" + }) + }); +} +; +OverflowVerticalIcon.displayName = "OverflowVerticalIcon"; +export default OverflowVerticalIcon; \ No newline at end of file diff --git a/assets/web/icons/overflow-vertical.svg b/assets/web/icons/overflow-vertical.svg deleted file mode 100644 index 82777bc6..00000000 --- a/assets/web/icons/overflow-vertical.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/pause-solid.d.ts b/assets/web/icons/pause-solid.d.ts new file mode 100644 index 00000000..8c9e4bd5 --- /dev/null +++ b/assets/web/icons/pause-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * pause-solid.svg + */ +declare const PauseSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PauseSolidIcon; diff --git a/assets/web/icons/pause-solid.js b/assets/web/icons/pause-solid.js new file mode 100644 index 00000000..0f3ae7ae --- /dev/null +++ b/assets/web/icons/pause-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PauseSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8 4a2 2 0 0 0-2 2v12a2 2 0 1 0 4 0V6a2 2 0 0 0-2-2Zm8 0a2 2 0 0 0-2 2v12a2 2 0 1 0 4 0V6a2 2 0 0 0-2-2Z" + }) + }); +} +; +PauseSolidIcon.displayName = "PauseSolidIcon"; +export default PauseSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/pause-solid.svg b/assets/web/icons/pause-solid.svg deleted file mode 100644 index 81fbf611..00000000 --- a/assets/web/icons/pause-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/pause.d.ts b/assets/web/icons/pause.d.ts new file mode 100644 index 00000000..6a5d4053 --- /dev/null +++ b/assets/web/icons/pause.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * pause.svg + */ +declare const PauseIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PauseIcon; diff --git a/assets/web/icons/pause.js b/assets/web/icons/pause.js new file mode 100644 index 00000000..35fd705e --- /dev/null +++ b/assets/web/icons/pause.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PauseIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M5 6a2 2 0 0 1 2-2h2a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H7a2 2 0 0 1-2-2V6Zm2 0v12h2V6H7Zm6 0a2 2 0 0 1 2-2h2a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2h-2a2 2 0 0 1-2-2V6Zm2 0v12h2V6h-2Z" + }) + }); +} +; +PauseIcon.displayName = "PauseIcon"; +export default PauseIcon; \ No newline at end of file diff --git a/assets/web/icons/pause.svg b/assets/web/icons/pause.svg deleted file mode 100644 index c6db8ae4..00000000 --- a/assets/web/icons/pause.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/pin-solid.d.ts b/assets/web/icons/pin-solid.d.ts new file mode 100644 index 00000000..a211cc0f --- /dev/null +++ b/assets/web/icons/pin-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * pin-solid.svg + */ +declare const PinSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PinSolidIcon; diff --git a/assets/web/icons/pin-solid.js b/assets/web/icons/pin-solid.js new file mode 100644 index 00000000..a70b51ab --- /dev/null +++ b/assets/web/icons/pin-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PinSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M5.769 2.857A.5.5 0 0 1 6.119 2h11.762a.5.5 0 0 1 .35.857L16.15 4.9a.5.5 0 0 0-.15.357v4.487a.5.5 0 0 0 .15.356l3.7 3.644a.5.5 0 0 1 .15.356v1.4a.5.5 0 0 1-.5.5H13v6a1 1 0 1 1-2 0v-6H4.5a.5.5 0 0 1-.5-.5v-1.4a.5.5 0 0 1 .15-.356l3.7-3.644A.5.5 0 0 0 8 9.744V5.257a.5.5 0 0 0-.15-.357L5.77 2.857Z" + }) + }); +} +; +PinSolidIcon.displayName = "PinSolidIcon"; +export default PinSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/pin-solid.svg b/assets/web/icons/pin-solid.svg deleted file mode 100644 index bc37c9c4..00000000 --- a/assets/web/icons/pin-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/pin.d.ts b/assets/web/icons/pin.d.ts new file mode 100644 index 00000000..f56bfcea --- /dev/null +++ b/assets/web/icons/pin.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * pin.svg + */ +declare const PinIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PinIcon; diff --git a/assets/web/icons/pin.js b/assets/web/icons/pin.js new file mode 100644 index 00000000..ce608c12 --- /dev/null +++ b/assets/web/icons/pin.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PinIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M6.119 2a.5.5 0 0 0-.35.857L7.85 4.9a.5.5 0 0 1 .15.357v4.487a.5.5 0 0 1-.15.356l-3.7 3.644A.5.5 0 0 0 4 14.1v1.4a.5.5 0 0 0 .5.5H11v6a1 1 0 1 0 2 0v-6h6.5a.5.5 0 0 0 .5-.5v-1.4a.5.5 0 0 0-.15-.356l-3.7-3.644a.5.5 0 0 1-.15-.356V5.257a.5.5 0 0 1 .15-.357l2.081-2.043a.5.5 0 0 0-.35-.857H6.119ZM10 4h4v5.744a2.5 2.5 0 0 0 .746 1.781L17.26 14H6.74l2.514-2.475A2.5 2.5 0 0 0 10 9.744V4Z", + clipRule: "evenodd" + }) + }); +} +; +PinIcon.displayName = "PinIcon"; +export default PinIcon; \ No newline at end of file diff --git a/assets/web/icons/pin.svg b/assets/web/icons/pin.svg deleted file mode 100644 index 321eae50..00000000 --- a/assets/web/icons/pin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/play-solid.d.ts b/assets/web/icons/play-solid.d.ts new file mode 100644 index 00000000..5e7a25d3 --- /dev/null +++ b/assets/web/icons/play-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * play-solid.svg + */ +declare const PlaySolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PlaySolidIcon; diff --git a/assets/web/icons/play-solid.js b/assets/web/icons/play-solid.js new file mode 100644 index 00000000..8d253889 --- /dev/null +++ b/assets/web/icons/play-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PlaySolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m8.98 4.677 9.921 5.58c1.36.764 1.36 2.722 0 3.486l-9.92 5.58C7.647 20.073 6 19.11 6 17.58V6.42c0-1.53 1.647-2.493 2.98-1.743Z" + }) + }); +} +; +PlaySolidIcon.displayName = "PlaySolidIcon"; +export default PlaySolidIcon; \ No newline at end of file diff --git a/assets/web/icons/play-solid.svg b/assets/web/icons/play-solid.svg deleted file mode 100644 index 663d84ec..00000000 --- a/assets/web/icons/play-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/play.d.ts b/assets/web/icons/play.d.ts new file mode 100644 index 00000000..a06141b3 --- /dev/null +++ b/assets/web/icons/play.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * play.svg + */ +declare const PlayIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PlayIcon; diff --git a/assets/web/icons/play.js b/assets/web/icons/play.js new file mode 100644 index 00000000..79ce8773 --- /dev/null +++ b/assets/web/icons/play.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PlayIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M17.92 12 8 17.58V6.42L17.92 12Zm.981-1.743-9.92-5.58C7.647 3.927 6 4.89 6 6.42v11.16c0 1.53 1.647 2.493 2.98 1.743l9.921-5.58c1.36-.764 1.36-2.722 0-3.486Z" + }) + }); +} +; +PlayIcon.displayName = "PlayIcon"; +export default PlayIcon; \ No newline at end of file diff --git a/assets/web/icons/play.svg b/assets/web/icons/play.svg deleted file mode 100644 index e3869ad5..00000000 --- a/assets/web/icons/play.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/plus.d.ts b/assets/web/icons/plus.d.ts new file mode 100644 index 00000000..37939bae --- /dev/null +++ b/assets/web/icons/plus.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * plus.svg + */ +declare const PlusIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PlusIcon; diff --git a/assets/web/icons/plus.js b/assets/web/icons/plus.js new file mode 100644 index 00000000..104c0983 --- /dev/null +++ b/assets/web/icons/plus.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PlusIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M11 13H6a.967.967 0 0 1-.713-.287A.968.968 0 0 1 5 12c0-.283.096-.52.287-.713A.967.967 0 0 1 6 11h5V6c0-.283.096-.52.287-.713A.968.968 0 0 1 12 5c.283 0 .52.096.713.287.191.192.287.43.287.713v5h5a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 18 13h-5v5a.97.97 0 0 1-.287.712A.968.968 0 0 1 12 19a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 18v-5Z" + }) + }); +} +; +PlusIcon.displayName = "PlusIcon"; +export default PlusIcon; \ No newline at end of file diff --git a/assets/web/icons/plus.svg b/assets/web/icons/plus.svg deleted file mode 100644 index 5e634098..00000000 --- a/assets/web/icons/plus.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/polls-end.d.ts b/assets/web/icons/polls-end.d.ts new file mode 100644 index 00000000..cdde711c --- /dev/null +++ b/assets/web/icons/polls-end.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * polls-end.svg + */ +declare const PollsEndIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PollsEndIcon; diff --git a/assets/web/icons/polls-end.js b/assets/web/icons/polls-end.js new file mode 100644 index 00000000..5ab52a85 --- /dev/null +++ b/assets/web/icons/polls-end.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function PollsEndIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M21 10.659V19c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h8.341A5.99 5.99 0 0 0 13 5H5v14h14v-8a5.99 5.99 0 0 0 2-.341Z" + }), /*#__PURE__*/_jsx("path", { + d: "M13.803 8a6.03 6.03 0 0 0 1.88 2H13a.968.968 0 0 1-.713-.287A.967.967 0 0 1 12 9c0-.283.096-.52.287-.713A.968.968 0 0 1 13 8h.803Zm2.909 7.713A.968.968 0 0 1 16 16h-3a.968.968 0 0 1-.713-.287A.968.968 0 0 1 12 15c0-.283.096-.52.287-.713A.968.968 0 0 1 13 14h3a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713Zm-6.3-5.301A1.926 1.926 0 0 1 9 11c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 7 9c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 7c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412Zm0 6.001A1.926 1.926 0 0 1 9 17c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 7 15c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 13c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.413Zm12.295-14.12a1 1 0 0 1 0 1.414l-4 4a1 1 0 0 1-1.414 0l-2-2a1 1 0 0 1 1.414-1.414L18 5.586l3.293-3.293a1 1 0 0 1 1.414 0Z" + })] + }); +} +; +PollsEndIcon.displayName = "PollsEndIcon"; +export default PollsEndIcon; \ No newline at end of file diff --git a/assets/web/icons/polls-end.svg b/assets/web/icons/polls-end.svg deleted file mode 100644 index 3be24d02..00000000 --- a/assets/web/icons/polls-end.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/polls.d.ts b/assets/web/icons/polls.d.ts new file mode 100644 index 00000000..d3d00511 --- /dev/null +++ b/assets/web/icons/polls.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * polls.svg + */ +declare const PollsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PollsIcon; diff --git a/assets/web/icons/polls.js b/assets/web/icons/polls.js new file mode 100644 index 00000000..49d18cca --- /dev/null +++ b/assets/web/icons/polls.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PollsIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M16 10a.97.97 0 0 0 .712-.287A.967.967 0 0 0 17 9a.967.967 0 0 0-.288-.713A.968.968 0 0 0 16 8h-3a.968.968 0 0 0-.713.287A.967.967 0 0 0 12 9c0 .283.096.52.287.713.192.191.43.287.713.287h3Zm0 6a.97.97 0 0 0 .712-.287A.968.968 0 0 0 17 15a.968.968 0 0 0-.288-.713A.968.968 0 0 0 16 14h-3a.968.968 0 0 0-.713.287A.968.968 0 0 0 12 15c0 .283.096.52.287.713.192.191.43.287.713.287h3Zm-7-5c.55 0 1.02-.196 1.412-.588C10.804 10.021 11 9.55 11 9c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 9 7c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 7 9c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Zm0 6c.55 0 1.02-.196 1.412-.587.392-.392.588-.863.588-1.413s-.196-1.02-.588-1.412A1.926 1.926 0 0 0 9 13c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 7 15c0 .55.196 1.02.588 1.413.391.391.862.587 1.412.587Zm-4 4c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }) + }); +} +; +PollsIcon.displayName = "PollsIcon"; +export default PollsIcon; \ No newline at end of file diff --git a/assets/web/icons/polls.svg b/assets/web/icons/polls.svg deleted file mode 100644 index 5868ca3a..00000000 --- a/assets/web/icons/polls.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/pop-out.d.ts b/assets/web/icons/pop-out.d.ts new file mode 100644 index 00000000..16272e67 --- /dev/null +++ b/assets/web/icons/pop-out.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * pop-out.svg + */ +declare const PopOutIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PopOutIcon; diff --git a/assets/web/icons/pop-out.js b/assets/web/icons/pop-out.js new file mode 100644 index 00000000..2ac945d3 --- /dev/null +++ b/assets/web/icons/pop-out.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function PopOutIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M5 3h6a1 1 0 1 1 0 2H5v14h14v-6a1 1 0 1 1 2 0v6a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2Z" + }), /*#__PURE__*/_jsx("path", { + d: "M15 3h5a1 1 0 0 1 1 1v5a1 1 0 1 1-2 0V6.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L17.586 5H15a1 1 0 1 1 0-2Z" + })] + }); +} +; +PopOutIcon.displayName = "PopOutIcon"; +export default PopOutIcon; \ No newline at end of file diff --git a/assets/web/icons/pop-out.svg b/assets/web/icons/pop-out.svg deleted file mode 100644 index aaf48b35..00000000 --- a/assets/web/icons/pop-out.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/preferences.d.ts b/assets/web/icons/preferences.d.ts new file mode 100644 index 00000000..a55f8fa6 --- /dev/null +++ b/assets/web/icons/preferences.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * preferences.svg + */ +declare const PreferencesIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PreferencesIcon; diff --git a/assets/web/icons/preferences.js b/assets/web/icons/preferences.js new file mode 100644 index 00000000..ff3ffd36 --- /dev/null +++ b/assets/web/icons/preferences.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PreferencesIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M6.5 2h11a4.5 4.5 0 1 1 0 9h-11a4.5 4.5 0 0 1 0-9Zm0 2h7.258A4.479 4.479 0 0 0 13 6.5c0 .925.28 1.785.758 2.5H6.5a2.5 2.5 0 0 1 0-5ZM15 6.5a2.5 2.5 0 1 1 5 0 2.5 2.5 0 0 1-5 0Zm-13 11A4.5 4.5 0 0 1 6.5 13h11a4.5 4.5 0 1 1 0 9h-11A4.5 4.5 0 0 1 2 17.5Zm8.242-2.5H17.5a2.5 2.5 0 0 1 0 5h-7.258A4.478 4.478 0 0 0 11 17.5c0-.925-.28-1.785-.758-2.5ZM6.5 15a2.5 2.5 0 1 0 0 5 2.5 2.5 0 0 0 0-5Z", + clipRule: "evenodd" + }) + }); +} +; +PreferencesIcon.displayName = "PreferencesIcon"; +export default PreferencesIcon; \ No newline at end of file diff --git a/assets/web/icons/preferences.svg b/assets/web/icons/preferences.svg deleted file mode 100644 index b7d59d4e..00000000 --- a/assets/web/icons/preferences.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/public.d.ts b/assets/web/icons/public.d.ts new file mode 100644 index 00000000..2cbd4e28 --- /dev/null +++ b/assets/web/icons/public.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * public.svg + */ +declare const PublicIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default PublicIcon; diff --git a/assets/web/icons/public.js b/assets/web/icons/public.js new file mode 100644 index 00000000..ea93df42 --- /dev/null +++ b/assets/web/icons/public.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function PublicIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm-1-2.05V18c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 9 16v-1l-4.8-4.8c-.05.3-.096.6-.138.9-.041.3-.062.6-.062.9 0 2.017.662 3.783 1.987 5.3 1.325 1.517 2.996 2.4 5.013 2.65Zm6.9-2.55c.333-.367.633-.762.9-1.188a7.45 7.45 0 0 0 .662-1.325c.175-.458.309-.929.4-1.412.092-.483.138-.975.138-1.475a7.845 7.845 0 0 0-1.363-4.475A7.701 7.701 0 0 0 15 4.6V5c0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 13 7h-2v2c0 .283-.096.52-.287.713A.968.968 0 0 1 10 10H8v2h6c.283 0 .52.096.713.287.191.192.287.43.287.713v3h1c.433 0 .825.13 1.175.387.35.259.592.596.725 1.013Z" + }) + }); +} +; +PublicIcon.displayName = "PublicIcon"; +export default PublicIcon; \ No newline at end of file diff --git a/assets/web/icons/public.svg b/assets/web/icons/public.svg deleted file mode 100644 index 8ee34c32..00000000 --- a/assets/web/icons/public.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/qr-code.d.ts b/assets/web/icons/qr-code.d.ts new file mode 100644 index 00000000..5318ef44 --- /dev/null +++ b/assets/web/icons/qr-code.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * qr-code.svg + */ +declare const QrCodeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default QrCodeIcon; diff --git a/assets/web/icons/qr-code.js b/assets/web/icons/qr-code.js new file mode 100644 index 00000000..8ccac9e9 --- /dev/null +++ b/assets/web/icons/qr-code.js @@ -0,0 +1,23 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function QrCodeIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M3 4a1 1 0 0 1 1-1h6a1 1 0 0 1 1 1v6a1 1 0 0 1-1 1H4a1 1 0 0 1-1-1V4Zm2 5V5h4v4H5Zm-2 5a1 1 0 0 1 1-1h6a1 1 0 0 1 1 1v6a1 1 0 0 1-1 1H4a1 1 0 0 1-1-1v-6Zm2 5v-4h4v4H5Zm9-16a1 1 0 0 0-1 1v6a1 1 0 0 0 1 1h6a1 1 0 0 0 1-1V4a1 1 0 0 0-1-1h-6Zm1 2v4h4V5h-4Z", + clipRule: "evenodd" + }), /*#__PURE__*/_jsx("path", { + d: "M15 16v-3h-2v3h2Z" + }), /*#__PURE__*/_jsx("path", { + d: "M17 16h-2v2h-2v3h2v-3h2v2h4v-2h-2v-5h-2v3Z" + })] + }); +} +; +QrCodeIcon.displayName = "QrCodeIcon"; +export default QrCodeIcon; \ No newline at end of file diff --git a/assets/web/icons/qr-code.svg b/assets/web/icons/qr-code.svg deleted file mode 100644 index 043a3d50..00000000 --- a/assets/web/icons/qr-code.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/assets/web/icons/quote.d.ts b/assets/web/icons/quote.d.ts new file mode 100644 index 00000000..f2da57b2 --- /dev/null +++ b/assets/web/icons/quote.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * quote.svg + */ +declare const QuoteIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default QuoteIcon; diff --git a/assets/web/icons/quote.js b/assets/web/icons/quote.js new file mode 100644 index 00000000..ac62468b --- /dev/null +++ b/assets/web/icons/quote.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function QuoteIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4.719 4.34c.094-.642-.366-1.236-1.028-1.328-.663-.092-1.276.354-1.371.996l-.808 5.478c-.094.642.366 1.237 1.028 1.328.663.092 1.276-.354 1.371-.996l.808-5.478Zm12.115 10.174c.095-.642-.366-1.237-1.028-1.328-.662-.092-1.276.354-1.37.996l-.809 5.478c-.094.642.366 1.236 1.028 1.328.663.092 1.277-.354 1.371-.996l.808-5.478ZM9.318 3.009c.665.077 1.138.662 1.058 1.306l-.022.175a220.467 220.467 0 0 1-.266 2.006c-.161 1.171-.368 2.579-.535 3.386-.13.636-.769 1.049-1.425.921-.656-.127-1.082-.745-.95-1.381.148-.72.345-2.052.509-3.237a190.652 190.652 0 0 0 .262-1.981l.021-.17c.08-.644.684-1.103 1.348-1.025Zm13.17 11.505c.094-.642-.366-1.237-1.028-1.328-.663-.092-1.276.354-1.371.996l-.808 5.478c-.094.642.366 1.236 1.028 1.328.663.092 1.276-.354 1.371-.996l.808-5.478Z" + }) + }); +} +; +QuoteIcon.displayName = "QuoteIcon"; +export default QuoteIcon; \ No newline at end of file diff --git a/assets/web/icons/quote.svg b/assets/web/icons/quote.svg deleted file mode 100644 index 13f0f873..00000000 --- a/assets/web/icons/quote.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/reaction-add.d.ts b/assets/web/icons/reaction-add.d.ts new file mode 100644 index 00000000..6c99d200 --- /dev/null +++ b/assets/web/icons/reaction-add.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * reaction-add.svg + */ +declare const ReactionAddIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ReactionAddIcon; diff --git a/assets/web/icons/reaction-add.js b/assets/web/icons/reaction-add.js new file mode 100644 index 00000000..fd9dcca5 --- /dev/null +++ b/assets/web/icons/reaction-add.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ReactionAddIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M14.74 2.38C13.87 2.133 12.95 2 12 2 6.477 2 2 6.477 2 12s4.477 10 10 10 10-4.477 10-10c0-.95-.133-1.87-.38-2.74a4.969 4.969 0 0 1-1.886.687 8 8 0 1 1-5.68-5.68c.1-.684.339-1.323.687-1.887Z" + }), /*#__PURE__*/_jsx("path", { + d: "M15.536 14.121a1 1 0 0 1 0 1.415A4.987 4.987 0 0 1 12 17c-1.38 0-2.632-.56-3.535-1.464a1 1 0 1 1 1.414-1.415A2.988 2.988 0 0 0 12 15c.829 0 1.577-.335 2.121-.879a1 1 0 0 1 1.415 0ZM8.5 12a1.5 1.5 0 1 0 0-3 1.5 1.5 0 0 0 0 3Zm8.5-1.5a1.5 1.5 0 1 1-3 0 1.5 1.5 0 0 1 3 0ZM18 6h-1a.968.968 0 0 1-.712-.287A.967.967 0 0 1 16 5a.97.97 0 0 1 .288-.713A.968.968 0 0 1 17 4h1V3c0-.283.096-.52.288-.712A.968.968 0 0 1 19 2c.283 0 .52.096.712.288A.965.965 0 0 1 20 3v1h1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 21 6h-1v1a.97.97 0 0 1-.288.713A.968.968 0 0 1 19 8a.968.968 0 0 1-.712-.287A.967.967 0 0 1 18 7V6Z" + })] + }); +} +; +ReactionAddIcon.displayName = "ReactionAddIcon"; +export default ReactionAddIcon; \ No newline at end of file diff --git a/assets/web/icons/reaction-add.svg b/assets/web/icons/reaction-add.svg deleted file mode 100644 index fdcda4fa..00000000 --- a/assets/web/icons/reaction-add.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/reaction.d.ts b/assets/web/icons/reaction.d.ts new file mode 100644 index 00000000..b0aab08b --- /dev/null +++ b/assets/web/icons/reaction.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * reaction.svg + */ +declare const ReactionIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ReactionIcon; diff --git a/assets/web/icons/reaction.js b/assets/web/icons/reaction.js new file mode 100644 index 00000000..009c0f5a --- /dev/null +++ b/assets/web/icons/reaction.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ReactionIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M15.536 15.536a1 1 0 0 0-1.415-1.415 2.987 2.987 0 0 1-2.12.879 2.988 2.988 0 0 1-2.122-.879 1 1 0 1 0-1.414 1.415A4.987 4.987 0 0 0 12 17c1.38 0 2.632-.56 3.536-1.464ZM10 10.5a1.5 1.5 0 1 1-3 0 1.5 1.5 0 0 1 3 0Zm5.5 1.5a1.5 1.5 0 1 0 0-3 1.5 1.5 0 0 0 0 3Z" + }), /*#__PURE__*/_jsx("path", { + d: "M22 12c0 5.523-4.477 10-10 10S2 17.523 2 12 6.477 2 12 2s10 4.477 10 10Zm-2 0a8 8 0 1 0-16 0 8 8 0 0 0 16 0Z" + })] + }); +} +; +ReactionIcon.displayName = "ReactionIcon"; +export default ReactionIcon; \ No newline at end of file diff --git a/assets/web/icons/reaction.svg b/assets/web/icons/reaction.svg deleted file mode 100644 index 8da1ef02..00000000 --- a/assets/web/icons/reaction.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/reply.d.ts b/assets/web/icons/reply.d.ts new file mode 100644 index 00000000..f338e784 --- /dev/null +++ b/assets/web/icons/reply.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * reply.svg + */ +declare const ReplyIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ReplyIcon; diff --git a/assets/web/icons/reply.js b/assets/web/icons/reply.js new file mode 100644 index 00000000..b32e4ba8 --- /dev/null +++ b/assets/web/icons/reply.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ReplyIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M9.405 5.708c.39-.39.39-1.025 0-1.416a.996.996 0 0 0-1.412 0L3.294 9.006a1.004 1.004 0 0 0 0 1.416l4.699 4.714a.996.996 0 0 0 1.412 0c.39-.39.39-1.025 0-1.416l-3.043-3.053h9.153c1.887 0 3.485 1.604 3.485 3.666C19 16.396 17.402 18 15.515 18h-2.093a1 1 0 1 0 0 2h2.093C18.58 20 21 17.425 21 14.333c0-3.091-2.419-5.666-5.485-5.666H6.456l2.949-2.959Z" + }) + }); +} +; +ReplyIcon.displayName = "ReplyIcon"; +export default ReplyIcon; \ No newline at end of file diff --git a/assets/web/icons/reply.svg b/assets/web/icons/reply.svg deleted file mode 100644 index 5634a09f..00000000 --- a/assets/web/icons/reply.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/restart.d.ts b/assets/web/icons/restart.d.ts new file mode 100644 index 00000000..e8e784c5 --- /dev/null +++ b/assets/web/icons/restart.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * restart.svg + */ +declare const RestartIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default RestartIcon; diff --git a/assets/web/icons/restart.js b/assets/web/icons/restart.js new file mode 100644 index 00000000..60d7a7a0 --- /dev/null +++ b/assets/web/icons/restart.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function RestartIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M18.93 8A8 8 0 1 1 4 12a1 1 0 1 0-2 0c0 5.523 4.477 10 10 10s10-4.477 10-10a9.966 9.966 0 0 0-.832-4A10.002 10.002 0 0 0 12 2a9.985 9.985 0 0 0-8 3.999V4a1 1 0 0 0-2 0v4a1 1 0 0 0 1 1h4a1 1 0 0 0 0-2H5.755A7.985 7.985 0 0 1 12 4a7.997 7.997 0 0 1 6.93 4Z" + }) + }); +} +; +RestartIcon.displayName = "RestartIcon"; +export default RestartIcon; \ No newline at end of file diff --git a/assets/web/icons/restart.svg b/assets/web/icons/restart.svg deleted file mode 100644 index 517ca800..00000000 --- a/assets/web/icons/restart.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/search.d.ts b/assets/web/icons/search.d.ts new file mode 100644 index 00000000..1df21a95 --- /dev/null +++ b/assets/web/icons/search.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * search.svg + */ +declare const SearchIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SearchIcon; diff --git a/assets/web/icons/search.js b/assets/web/icons/search.js new file mode 100644 index 00000000..db984937 --- /dev/null +++ b/assets/web/icons/search.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SearchIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M15.05 16.463a7.5 7.5 0 1 1 1.414-1.414l3.243 3.244a1 1 0 0 1-1.414 1.414l-3.244-3.244ZM16 10.5a5.5 5.5 0 1 0-11 0 5.5 5.5 0 0 0 11 0Z" + }) + }); +} +; +SearchIcon.displayName = "SearchIcon"; +export default SearchIcon; \ No newline at end of file diff --git a/assets/web/icons/search.svg b/assets/web/icons/search.svg deleted file mode 100644 index 82587bcf..00000000 --- a/assets/web/icons/search.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/send-solid.d.ts b/assets/web/icons/send-solid.d.ts new file mode 100644 index 00000000..35e9058a --- /dev/null +++ b/assets/web/icons/send-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * send-solid.svg + */ +declare const SendSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SendSolidIcon; diff --git a/assets/web/icons/send-solid.js b/assets/web/icons/send-solid.js new file mode 100644 index 00000000..75406086 --- /dev/null +++ b/assets/web/icons/send-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SendSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m21.211 12.895-16.14 8.07c-.785.392-1.658-.342-1.406-1.182L5.7 13h6.55a1 1 0 1 0 0-2H5.7L3.665 4.217c-.252-.84.621-1.574 1.405-1.182l16.141 8.07a1 1 0 0 1 0 1.79Z" + }) + }); +} +; +SendSolidIcon.displayName = "SendSolidIcon"; +export default SendSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/send-solid.svg b/assets/web/icons/send-solid.svg deleted file mode 100644 index 347eee84..00000000 --- a/assets/web/icons/send-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/send.d.ts b/assets/web/icons/send.d.ts new file mode 100644 index 00000000..30450f7c --- /dev/null +++ b/assets/web/icons/send.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * send.svg + */ +declare const SendIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SendIcon; diff --git a/assets/web/icons/send.js b/assets/web/icons/send.js new file mode 100644 index 00000000..f5dad41d --- /dev/null +++ b/assets/web/icons/send.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SendIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "m5.07 20.965 16.141-8.07a1 1 0 0 0 0-1.79l-16.14-8.07c-.785-.392-1.658.342-1.406 1.182l2.249 7.496a1 1 0 0 1 0 .574l-2.249 7.496c-.252.84.621 1.574 1.405 1.182ZM6.246 5.859 18.528 12 6.246 18.141 7.788 13h4.462a1 1 0 1 0 0-2H7.788L6.246 5.859Z", + clipRule: "evenodd" + }) + }); +} +; +SendIcon.displayName = "SendIcon"; +export default SendIcon; \ No newline at end of file diff --git a/assets/web/icons/send.svg b/assets/web/icons/send.svg deleted file mode 100644 index c6d3c79f..00000000 --- a/assets/web/icons/send.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/settings-solid.d.ts b/assets/web/icons/settings-solid.d.ts new file mode 100644 index 00000000..11843e41 --- /dev/null +++ b/assets/web/icons/settings-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * settings-solid.svg + */ +declare const SettingsSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SettingsSolidIcon; diff --git a/assets/web/icons/settings-solid.js b/assets/web/icons/settings-solid.js new file mode 100644 index 00000000..926642cb --- /dev/null +++ b/assets/web/icons/settings-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SettingsSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12.731 2C13.432 2 14 2.568 14 3.269c0 .578.396 1.074.935 1.286.085.034.17.07.253.106.531.23 1.162.16 1.572-.25a1.269 1.269 0 0 1 1.794 0l1.034 1.035a1.269 1.269 0 0 1 0 1.794c-.41.41-.48 1.04-.248 1.572.036.084.07.168.105.253.212.539.708.935 1.286.935.701 0 1.269.568 1.269 1.269v1.462c0 .701-.568 1.269-1.269 1.269-.578 0-1.074.396-1.287.935-.033.085-.068.17-.104.253-.232.531-.161 1.162.248 1.572a1.269 1.269 0 0 1 0 1.794l-1.034 1.034a1.269 1.269 0 0 1-1.794 0c-.41-.41-1.04-.48-1.572-.248a7.935 7.935 0 0 1-.253.105c-.539.212-.935.708-.935 1.286 0 .701-.568 1.269-1.269 1.269H11.27c-.702 0-1.27-.568-1.27-1.269 0-.578-.396-1.074-.935-1.287a7.975 7.975 0 0 1-.253-.104c-.531-.232-1.162-.161-1.572.248a1.269 1.269 0 0 1-1.794 0l-1.034-1.034a1.269 1.269 0 0 1 0-1.794c.41-.41.48-1.04.249-1.572a7.89 7.89 0 0 1-.106-.253C4.343 14.396 3.847 14 3.27 14 2.568 14 2 13.432 2 12.731V11.27c0-.702.568-1.27 1.269-1.27.578 0 1.074-.396 1.286-.935.034-.085.07-.17.106-.253.23-.531.16-1.162-.25-1.572a1.269 1.269 0 0 1 0-1.794l1.035-1.034a1.269 1.269 0 0 1 1.794 0c.41.41 1.04.48 1.572.249a7.93 7.93 0 0 1 .253-.106c.539-.212.935-.708.935-1.286C10 2.568 10.568 2 11.269 2h1.462ZM12 16a4 4 0 1 0 0-8 4 4 0 0 0 0 8Z" + }) + }); +} +; +SettingsSolidIcon.displayName = "SettingsSolidIcon"; +export default SettingsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/settings-solid.svg b/assets/web/icons/settings-solid.svg deleted file mode 100644 index 68275b86..00000000 --- a/assets/web/icons/settings-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/settings.d.ts b/assets/web/icons/settings.d.ts new file mode 100644 index 00000000..200b3823 --- /dev/null +++ b/assets/web/icons/settings.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * settings.svg + */ +declare const SettingsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SettingsIcon; diff --git a/assets/web/icons/settings.js b/assets/web/icons/settings.js new file mode 100644 index 00000000..71d44117 --- /dev/null +++ b/assets/web/icons/settings.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function SettingsIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M16 12a4 4 0 1 1-8 0 4 4 0 0 1 8 0Zm-2 0a2 2 0 1 0-4 0 2 2 0 0 0 4 0Z" + }), /*#__PURE__*/_jsx("path", { + d: "M11.312 2h1.376A2.312 2.312 0 0 1 15 4.312v.247l.002.003c.01.014.031.033.064.047.03.013.056.013.07.01h.002l.177-.177a2.312 2.312 0 0 1 3.27 0l.973.974a2.312 2.312 0 0 1 0 3.269l-.177.177v.003a.134.134 0 0 0 .01.07.153.153 0 0 0 .047.063l.003.002h.247A2.312 2.312 0 0 1 22 11.312v1.376A2.312 2.312 0 0 1 19.688 15h-.247l-.003.002a.152.152 0 0 0-.047.064.134.134 0 0 0-.01.07v.002l.177.177a2.312 2.312 0 0 1 0 3.27l-.974.973a2.312 2.312 0 0 1-3.269 0l-.177-.177h-.003a.134.134 0 0 0-.07.01.152.152 0 0 0-.063.047l-.002.003v.247A2.312 2.312 0 0 1 12.688 22h-1.376A2.312 2.312 0 0 1 9 19.688v-.247l-.002-.003a.153.153 0 0 0-.064-.047.134.134 0 0 0-.07-.01h-.002l-.177.177a2.312 2.312 0 0 1-3.27 0l-.973-.974a2.312 2.312 0 0 1 0-3.269l.177-.177v-.003a.135.135 0 0 0-.01-.07.152.152 0 0 0-.047-.063L4.559 15h-.247A2.312 2.312 0 0 1 2 12.688v-1.376A2.312 2.312 0 0 1 4.312 9h.247l.003-.002a.153.153 0 0 0 .047-.064.135.135 0 0 0 .01-.07v-.002l-.177-.177a2.312 2.312 0 0 1 0-3.27l.974-.973a2.312 2.312 0 0 1 3.269 0l.177.177h.003a.135.135 0 0 0 .07-.01.153.153 0 0 0 .063-.047L9 4.559v-.247A2.312 2.312 0 0 1 11.312 2ZM11 4.312v.257c0 .893-.59 1.593-1.299 1.887-.716.297-1.622.21-2.248-.418l-.182-.182a.312.312 0 0 0-.441 0l-.974.974a.312.312 0 0 0 0 .44l.182.183c.627.626.715 1.531.418 2.248C6.162 10.41 5.462 11 4.569 11h-.257a.312.312 0 0 0-.312.312v1.376c0 .172.14.312.312.312h.257c.893 0 1.593.59 1.887 1.299.297.716.21 1.622-.418 2.248l-.182.182a.312.312 0 0 0 0 .441l.974.973a.31.31 0 0 0 .44 0l.183-.181c.626-.627 1.532-.715 2.248-.418.709.294 1.299.994 1.299 1.887v.257c0 .172.14.312.312.312h1.376c.172 0 .312-.14.312-.312v-.257c0-.893.59-1.593 1.299-1.887.716-.297 1.622-.21 2.248.418l.182.181c.122.122.32.122.441 0l.973-.973a.312.312 0 0 0 0-.44l-.181-.183c-.627-.627-.715-1.532-.418-2.248.294-.709.994-1.299 1.887-1.299h.257c.172 0 .312-.14.312-.312v-1.376a.312.312 0 0 0-.312-.312h-.257c-.893 0-1.593-.59-1.887-1.299-.297-.717-.21-1.622.418-2.248l.181-.182a.312.312 0 0 0 0-.441l-.973-.974a.312.312 0 0 0-.44 0l-.183.182c-.627.627-1.532.715-2.248.418C13.59 6.162 13 5.462 13 4.569v-.257A.312.312 0 0 0 12.688 4h-1.376a.312.312 0 0 0-.312.312Z" + })] + }); +} +; +SettingsIcon.displayName = "SettingsIcon"; +export default SettingsIcon; \ No newline at end of file diff --git a/assets/web/icons/settings.svg b/assets/web/icons/settings.svg deleted file mode 100644 index 73dd6c1b..00000000 --- a/assets/web/icons/settings.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/share-android.d.ts b/assets/web/icons/share-android.d.ts new file mode 100644 index 00000000..1473416f --- /dev/null +++ b/assets/web/icons/share-android.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * share-android.svg + */ +declare const ShareAndroidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ShareAndroidIcon; diff --git a/assets/web/icons/share-android.js b/assets/web/icons/share-android.js new file mode 100644 index 00000000..d507bd9f --- /dev/null +++ b/assets/web/icons/share-android.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ShareAndroidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M13 5a4 4 0 1 1 1.4 3.04l-3.653 2.558a3.998 3.998 0 0 1 0 2.804L14.4 15.96a4 4 0 1 1-1.148 1.638L9.6 15.04a4 4 0 1 1 0-6.08l3.654-2.558A3.992 3.992 0 0 1 13 5Zm4-2a2 2 0 1 0 0 4 2 2 0 0 0 0-4ZM7 10a2 2 0 1 0 0 4 2 2 0 0 0 0-4Zm10 7a2 2 0 1 0 0 4 2 2 0 0 0 0-4Z" + }) + }); +} +; +ShareAndroidIcon.displayName = "ShareAndroidIcon"; +export default ShareAndroidIcon; \ No newline at end of file diff --git a/assets/web/icons/share-android.svg b/assets/web/icons/share-android.svg deleted file mode 100644 index 950fcfb3..00000000 --- a/assets/web/icons/share-android.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/share-ios.d.ts b/assets/web/icons/share-ios.d.ts new file mode 100644 index 00000000..a67bf3ae --- /dev/null +++ b/assets/web/icons/share-ios.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * share-ios.svg + */ +declare const ShareIosIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ShareIosIcon; diff --git a/assets/web/icons/share-ios.js b/assets/web/icons/share-ios.js new file mode 100644 index 00000000..ce6ab703 --- /dev/null +++ b/assets/web/icons/share-ios.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ShareIosIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M12.707 2.293a1 1 0 0 0-1.414 0l-2.5 2.5a1 1 0 0 0 1.414 1.414L11 5.414V14a1 1 0 1 0 2 0V5.414l.793.793a1 1 0 1 0 1.414-1.414l-2.5-2.5Z" + }), /*#__PURE__*/_jsx("path", { + d: "M6 20V10h2a1 1 0 0 0 0-2H6a2 2 0 0 0-2 2v10a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V10a2 2 0 0 0-2-2h-2a1 1 0 1 0 0 2h2v10H6Z" + })] + }); +} +; +ShareIosIcon.displayName = "ShareIosIcon"; +export default ShareIosIcon; \ No newline at end of file diff --git a/assets/web/icons/share-ios.svg b/assets/web/icons/share-ios.svg deleted file mode 100644 index 2721d847..00000000 --- a/assets/web/icons/share-ios.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/share-screen-solid.d.ts b/assets/web/icons/share-screen-solid.d.ts new file mode 100644 index 00000000..1c4ce860 --- /dev/null +++ b/assets/web/icons/share-screen-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * share-screen-solid.svg + */ +declare const ShareScreenSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ShareScreenSolidIcon; diff --git a/assets/web/icons/share-screen-solid.js b/assets/web/icons/share-screen-solid.js new file mode 100644 index 00000000..720df3c3 --- /dev/null +++ b/assets/web/icons/share-screen-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ShareScreenSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M1.288 20.712A.965.965 0 0 0 2 21h20c.283 0 .52-.096.712-.288A.968.968 0 0 0 23 20a.968.968 0 0 0-.288-.712A.968.968 0 0 0 22 19H2a.967.967 0 0 0-.712.288A.968.968 0 0 0 1 20c0 .283.096.52.288.712Zm1.299-3.299A1.926 1.926 0 0 1 2 16V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 4 3h16c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v11c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 18H4c-.55 0-1.02-.196-1.413-.587Zm10.12-10.12a1 1 0 0 0-1.414 0l-2.5 2.5a1 1 0 0 0 1.414 1.414l.793-.793V13a1 1 0 1 0 2 0v-2.586l.793.793a1 1 0 0 0 1.414-1.414l-2.5-2.5Z" + }) + }); +} +; +ShareScreenSolidIcon.displayName = "ShareScreenSolidIcon"; +export default ShareScreenSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/share-screen-solid.svg b/assets/web/icons/share-screen-solid.svg deleted file mode 100644 index b24d8048..00000000 --- a/assets/web/icons/share-screen-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/share-screen.d.ts b/assets/web/icons/share-screen.d.ts new file mode 100644 index 00000000..e4bd4060 --- /dev/null +++ b/assets/web/icons/share-screen.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * share-screen.svg + */ +declare const ShareScreenIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ShareScreenIcon; diff --git a/assets/web/icons/share-screen.js b/assets/web/icons/share-screen.js new file mode 100644 index 00000000..954a386d --- /dev/null +++ b/assets/web/icons/share-screen.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ShareScreenIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M1.288 20.712A.965.965 0 0 0 2 21h20c.283 0 .52-.096.712-.288A.968.968 0 0 0 23 20a.968.968 0 0 0-.288-.712A.968.968 0 0 0 22 19H2a.967.967 0 0 0-.712.288A.968.968 0 0 0 1 20c0 .283.096.52.288.712ZM12.707 7.293a1 1 0 0 0-1.414 0l-2.5 2.5a1 1 0 0 0 1.414 1.414l.793-.793V13a1 1 0 1 0 2 0v-2.586l.793.793a1 1 0 0 0 1.414-1.414l-2.5-2.5Z" + }), /*#__PURE__*/_jsx("path", { + d: "M2.587 17.413C2.98 17.803 3.45 18 4 18h16c.55 0 1.02-.196 1.413-.587A1.93 1.93 0 0 0 22 16V5c0-.55-.196-1.02-.587-1.413A1.926 1.926 0 0 0 20 3H4c-.55 0-1.02.196-1.413.587A1.926 1.926 0 0 0 2 5v11c0 .55.196 1.02.587 1.413ZM20 5v11H4V5h16Z" + })] + }); +} +; +ShareScreenIcon.displayName = "ShareScreenIcon"; +export default ShareScreenIcon; \ No newline at end of file diff --git a/assets/web/icons/share-screen.svg b/assets/web/icons/share-screen.svg deleted file mode 100644 index 35a164c5..00000000 --- a/assets/web/icons/share-screen.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/share.d.ts b/assets/web/icons/share.d.ts new file mode 100644 index 00000000..000cfff3 --- /dev/null +++ b/assets/web/icons/share.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * share.svg + */ +declare const ShareIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ShareIcon; diff --git a/assets/web/icons/share.js b/assets/web/icons/share.js new file mode 100644 index 00000000..e4466891 --- /dev/null +++ b/assets/web/icons/share.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ShareIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 16a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 15V7.85L9.125 9.725c-.2.2-.433.3-.7.3-.267 0-.508-.108-.725-.325a.93.93 0 0 1-.288-.713A.977.977 0 0 1 7.7 8.3l3.6-3.6c.1-.1.208-.17.325-.213.117-.041.242-.062.375-.062s.258.02.375.062a.877.877 0 0 1 .325.213l3.6 3.6c.2.2.296.437.287.712a.977.977 0 0 1-.287.688c-.2.2-.438.304-.713.313a.93.93 0 0 1-.712-.288L13 7.85V15c0 .283-.096.52-.287.713A.968.968 0 0 1 12 16Zm-6 4c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18v-2c0-.283.096-.52.287-.713A.967.967 0 0 1 5 15c.283 0 .52.096.713.287.191.192.287.43.287.713v2h12v-2a.97.97 0 0 1 .288-.713A.968.968 0 0 1 19 15a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v2c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6Z" + }) + }); +} +; +ShareIcon.displayName = "ShareIcon"; +export default ShareIcon; \ No newline at end of file diff --git a/assets/web/icons/share.svg b/assets/web/icons/share.svg deleted file mode 100644 index 684dcb04..00000000 --- a/assets/web/icons/share.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/sidebar.d.ts b/assets/web/icons/sidebar.d.ts new file mode 100644 index 00000000..63abbd1a --- /dev/null +++ b/assets/web/icons/sidebar.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * sidebar.svg + */ +declare const SidebarIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SidebarIcon; diff --git a/assets/web/icons/sidebar.js b/assets/web/icons/sidebar.js new file mode 100644 index 00000000..f4952f5b --- /dev/null +++ b/assets/web/icons/sidebar.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SidebarIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M18 3a4 4 0 0 1 4 4v10a4 4 0 0 1-4 4H6a4 4 0 0 1-4-4V7a4 4 0 0 1 4-4h12Zm-8 2h8a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2h-8V5ZM8 19H6a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2h2v14Z", + clipRule: "evenodd" + }) + }); +} +; +SidebarIcon.displayName = "SidebarIcon"; +export default SidebarIcon; \ No newline at end of file diff --git a/assets/web/icons/sidebar.svg b/assets/web/icons/sidebar.svg deleted file mode 100644 index 8241ea7e..00000000 --- a/assets/web/icons/sidebar.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/sign-out.d.ts b/assets/web/icons/sign-out.d.ts new file mode 100644 index 00000000..34d30f46 --- /dev/null +++ b/assets/web/icons/sign-out.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * sign-out.svg + */ +declare const SignOutIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SignOutIcon; diff --git a/assets/web/icons/sign-out.js b/assets/web/icons/sign-out.js new file mode 100644 index 00000000..ee836a45 --- /dev/null +++ b/assets/web/icons/sign-out.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SignOutIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M9 12.031a.97.97 0 0 1 .287-.712.968.968 0 0 1 .713-.289h7.15l-1.875-1.875a.96.96 0 0 1-.3-.7c0-.266.108-.508.325-.725a.93.93 0 0 1 .712-.287.977.977 0 0 1 .688.287l3.6 3.6c.1.1.17.209.212.325.042.117.063.242.063.375 0 .134-.02.259-.063.375a.877.877 0 0 1-.212.325l-3.6 3.6a.93.93 0 0 1-.712.288.977.977 0 0 1-.688-.288 1.02 1.02 0 0 1-.313-.712.93.93 0 0 1 .288-.713l1.875-1.875H10a.968.968 0 0 1-.713-.287A.968.968 0 0 1 9 12.03Zm-6-7c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 5 3.03h6a.97.97 0 0 1 .713.288.968.968 0 0 1 .287.712.97.97 0 0 1-.287.713.968.968 0 0 1-.713.287H5v14h6a.97.97 0 0 1 .713.288.968.968 0 0 1 .287.712.97.97 0 0 1-.287.713.968.968 0 0 1-.713.287H5c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19.03v-14Z" + }) + }); +} +; +SignOutIcon.displayName = "SignOutIcon"; +export default SignOutIcon; \ No newline at end of file diff --git a/assets/web/icons/sign-out.svg b/assets/web/icons/sign-out.svg deleted file mode 100644 index 0ce3f876..00000000 --- a/assets/web/icons/sign-out.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/spinner.d.ts b/assets/web/icons/spinner.d.ts new file mode 100644 index 00000000..5315356f --- /dev/null +++ b/assets/web/icons/spinner.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * spinner.svg + */ +declare const SpinnerIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SpinnerIcon; diff --git a/assets/web/icons/spinner.js b/assets/web/icons/spinner.js new file mode 100644 index 00000000..1ff441d8 --- /dev/null +++ b/assets/web/icons/spinner.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SpinnerIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M12 4.031a8 8 0 1 0 8 8 1 1 0 0 1 2 0c0 5.523-4.477 10-10 10s-10-4.477-10-10 4.477-10 10-10a1 1 0 1 1 0 2Z", + clipRule: "evenodd" + }) + }); +} +; +SpinnerIcon.displayName = "SpinnerIcon"; +export default SpinnerIcon; \ No newline at end of file diff --git a/assets/web/icons/spinner.svg b/assets/web/icons/spinner.svg deleted file mode 100644 index 06b72cd0..00000000 --- a/assets/web/icons/spinner.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/spotlight.d.ts b/assets/web/icons/spotlight.d.ts new file mode 100644 index 00000000..2105ad4d --- /dev/null +++ b/assets/web/icons/spotlight.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * spotlight.svg + */ +declare const SpotlightIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SpotlightIcon; diff --git a/assets/web/icons/spotlight.js b/assets/web/icons/spotlight.js new file mode 100644 index 00000000..6cd52610 --- /dev/null +++ b/assets/web/icons/spotlight.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function SpotlightIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M5 5h14v8h-5a1 1 0 0 0-1 1v5H5V5Zm10 14v-4h4v4h-4ZM5 21h14a2 2 0 0 0 2-2V5a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2Z" + }) + }); +} +; +SpotlightIcon.displayName = "SpotlightIcon"; +export default SpotlightIcon; \ No newline at end of file diff --git a/assets/web/icons/spotlight.svg b/assets/web/icons/spotlight.svg deleted file mode 100644 index bf20d7fa..00000000 --- a/assets/web/icons/spotlight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/strikethrough.d.ts b/assets/web/icons/strikethrough.d.ts new file mode 100644 index 00000000..2fbf90a7 --- /dev/null +++ b/assets/web/icons/strikethrough.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * strikethrough.svg + */ +declare const StrikethroughIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default StrikethroughIcon; diff --git a/assets/web/icons/strikethrough.js b/assets/web/icons/strikethrough.js new file mode 100644 index 00000000..acae78a3 --- /dev/null +++ b/assets/web/icons/strikethrough.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function StrikethroughIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12.15 20c-1.267 0-2.392-.375-3.375-1.125-.983-.75-1.692-1.775-2.125-3.075l2.2-.95c.233.8.638 1.458 1.213 1.975.574.517 1.287.775 2.137.775.7 0 1.333-.167 1.9-.5.567-.333.85-.867.85-1.6 0-.3-.058-.575-.175-.825A2.362 2.362 0 0 0 14.3 14h2.8a4.279 4.279 0 0 1 .25 1.5c0 1.433-.513 2.542-1.538 3.325C14.788 19.608 13.567 20 12.15 20ZM3 12a.968.968 0 0 1-.712-.287A.968.968 0 0 1 2 11a.97.97 0 0 1 .288-.713A.967.967 0 0 1 3 10h18a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 21 12H3Zm9.05-8.15c1.1 0 2.063.27 2.887.812.825.542 1.463 1.371 1.913 2.488l-2.2.975a2.987 2.987 0 0 0-.838-1.3c-.408-.383-.979-.575-1.712-.575-.683 0-1.25.154-1.7.462-.45.309-.7.738-.75 1.288h-2.4c.033-1.15.487-2.13 1.363-2.938.875-.808 2.02-1.212 3.437-1.212Z" + }) + }); +} +; +StrikethroughIcon.displayName = "StrikethroughIcon"; +export default StrikethroughIcon; \ No newline at end of file diff --git a/assets/web/icons/strikethrough.svg b/assets/web/icons/strikethrough.svg deleted file mode 100644 index 39469256..00000000 --- a/assets/web/icons/strikethrough.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/switch-camera-solid.d.ts b/assets/web/icons/switch-camera-solid.d.ts new file mode 100644 index 00000000..df5a37ed --- /dev/null +++ b/assets/web/icons/switch-camera-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * switch-camera-solid.svg + */ +declare const SwitchCameraSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default SwitchCameraSolidIcon; diff --git a/assets/web/icons/switch-camera-solid.js b/assets/web/icons/switch-camera-solid.js new file mode 100644 index 00000000..be67a72c --- /dev/null +++ b/assets/web/icons/switch-camera-solid.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function SwitchCameraSolidIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M15.793 2.293a1 1 0 0 1 1.414 0l2 2a1 1 0 0 1 0 1.414l-2 2a1 1 0 1 1-1.414-1.414L16.086 6H5.5a2 2 0 0 0-2 2v7a1 1 0 1 1-2 0V8a4 4 0 0 1 4-4h10.586l-.293-.293a1 1 0 0 1 0-1.414ZM17.5 18H6.914l.293-.293a1 1 0 1 0-1.414-1.414l-2 2a1 1 0 0 0 0 1.414l2 2a1 1 0 1 0 1.414-1.414L6.914 20H17.5a4 4 0 0 0 4-4V9a1 1 0 1 0-2 0v7a2 2 0 0 1-2 2Z" + }), /*#__PURE__*/_jsx("path", { + d: "M11.5 15a3 3 0 1 0 0-6 3 3 0 0 0 0 6Z" + })] + }); +} +; +SwitchCameraSolidIcon.displayName = "SwitchCameraSolidIcon"; +export default SwitchCameraSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/switch-camera-solid.svg b/assets/web/icons/switch-camera-solid.svg deleted file mode 100644 index abed3491..00000000 --- a/assets/web/icons/switch-camera-solid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/take-photo-solid.d.ts b/assets/web/icons/take-photo-solid.d.ts new file mode 100644 index 00000000..f1d3d26f --- /dev/null +++ b/assets/web/icons/take-photo-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * take-photo-solid.svg + */ +declare const TakePhotoSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default TakePhotoSolidIcon; diff --git a/assets/web/icons/take-photo-solid.js b/assets/web/icons/take-photo-solid.js new file mode 100644 index 00000000..a40e8ae0 --- /dev/null +++ b/assets/web/icons/take-photo-solid.js @@ -0,0 +1,19 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function TakePhotoSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M2.587 20.413C2.98 20.803 3.45 21 4 21h16c.55 0 1.02-.196 1.413-.587A1.93 1.93 0 0 0 22 19V7c0-.55-.196-1.02-.587-1.412A1.926 1.926 0 0 0 20 5h-3.15L15.6 3.65a2.009 2.009 0 0 0-.662-.475A1.952 1.952 0 0 0 14.124 3h-4.25a2.011 2.011 0 0 0-1.475.65L7.15 5H4c-.55 0-1.02.196-1.413.588A1.926 1.926 0 0 0 2 7v12c0 .55.196 1.02.587 1.413ZM12 16.5a3.5 3.5 0 1 0 0-7 3.5 3.5 0 0 0 0 7Z", + clipRule: "evenodd" + }) + }); +} +; +TakePhotoSolidIcon.displayName = "TakePhotoSolidIcon"; +export default TakePhotoSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/take-photo-solid.svg b/assets/web/icons/take-photo-solid.svg deleted file mode 100644 index b2ed817b..00000000 --- a/assets/web/icons/take-photo-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/take-photo.d.ts b/assets/web/icons/take-photo.d.ts new file mode 100644 index 00000000..521e76e8 --- /dev/null +++ b/assets/web/icons/take-photo.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * take-photo.svg + */ +declare const TakePhotoIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default TakePhotoIcon; diff --git a/assets/web/icons/take-photo.js b/assets/web/icons/take-photo.js new file mode 100644 index 00000000..125b5bf9 --- /dev/null +++ b/assets/web/icons/take-photo.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function TakePhotoIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 17.5c1.25 0 2.313-.438 3.188-1.313.874-.875 1.312-1.937 1.312-3.187 0-1.25-.438-2.313-1.313-3.188C14.313 8.938 13.25 8.5 12 8.5c-1.25 0-2.313.438-3.188 1.313C7.939 10.687 7.5 11.75 7.5 13c0 1.25.438 2.313 1.313 3.188.874.875 1.937 1.312 3.187 1.312Zm0-2c-.7 0-1.292-.242-1.775-.725C9.742 14.292 9.5 13.7 9.5 13s.242-1.292.725-1.775c.483-.483 1.075-.725 1.775-.725s1.292.242 1.775.725c.483.483.725 1.075.725 1.775s-.242 1.292-.725 1.775c-.483.483-1.075.725-1.775.725ZM4 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 19V7c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 4 5h3.15L8.4 3.65A2.011 2.011 0 0 1 9.875 3h4.25a2.011 2.011 0 0 1 1.475.65L16.85 5H20c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v12c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 21H4Zm0-2h16V7h-4.05l-1.825-2h-4.25L8.05 7H4v12Z" + }) + }); +} +; +TakePhotoIcon.displayName = "TakePhotoIcon"; +export default TakePhotoIcon; \ No newline at end of file diff --git a/assets/web/icons/take-photo.svg b/assets/web/icons/take-photo.svg deleted file mode 100644 index 3fa140ae..00000000 --- a/assets/web/icons/take-photo.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/text-formatting.d.ts b/assets/web/icons/text-formatting.d.ts new file mode 100644 index 00000000..c306d406 --- /dev/null +++ b/assets/web/icons/text-formatting.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * text-formatting.svg + */ +declare const TextFormattingIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default TextFormattingIcon; diff --git a/assets/web/icons/text-formatting.js b/assets/web/icons/text-formatting.js new file mode 100644 index 00000000..adc7f472 --- /dev/null +++ b/assets/web/icons/text-formatting.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function TextFormattingIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 19a.967.967 0 0 1-.713-.288A.968.968 0 0 1 5 18a.97.97 0 0 1 .287-.712A.967.967 0 0 1 6 17h12c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 18 19H6Zm1.35-5.2 3.425-9.2a.882.882 0 0 1 .338-.438A.93.93 0 0 1 11.65 4h.7c.2 0 .38.054.537.162a.886.886 0 0 1 .338.438l3.425 9.225c.1.283.067.55-.1.8a.795.795 0 0 1-.7.375.89.89 0 0 1-.512-.162A.882.882 0 0 1 15 14.4l-.75-2.2H9.8L9 14.425a.838.838 0 0 1-.325.425c-.15.1-.317.15-.5.15a.84.84 0 0 1-.738-.387.815.815 0 0 1-.087-.813Zm3-3.2h3.3l-1.6-4.55h-.1l-1.6 4.55Z" + }) + }); +} +; +TextFormattingIcon.displayName = "TextFormattingIcon"; +export default TextFormattingIcon; \ No newline at end of file diff --git a/assets/web/icons/text-formatting.svg b/assets/web/icons/text-formatting.svg deleted file mode 100644 index a5d0a26e..00000000 --- a/assets/web/icons/text-formatting.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/threads-solid.d.ts b/assets/web/icons/threads-solid.d.ts new file mode 100644 index 00000000..080fc558 --- /dev/null +++ b/assets/web/icons/threads-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * threads-solid.svg + */ +declare const ThreadsSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ThreadsSolidIcon; diff --git a/assets/web/icons/threads-solid.js b/assets/web/icons/threads-solid.js new file mode 100644 index 00000000..fe6fea56 --- /dev/null +++ b/assets/web/icons/threads-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function ThreadsSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 3h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H6l-2.293 2.293c-.63.63-1.707.184-1.707-.707V5a2 2 0 0 1 2-2Zm3 7h10a.97.97 0 0 0 .712-.287A.967.967 0 0 0 18 9a.967.967 0 0 0-.288-.713A.968.968 0 0 0 17 8H7a.968.968 0 0 0-.713.287A.968.968 0 0 0 6 9c0 .283.096.52.287.713.192.191.43.287.713.287Zm0 4h6c.283 0 .52-.096.713-.287A.968.968 0 0 0 14 13a.968.968 0 0 0-.287-.713A.968.968 0 0 0 13 12H7a.967.967 0 0 0-.713.287A.968.968 0 0 0 6 13c0 .283.096.52.287.713.192.191.43.287.713.287Z" + }) + }); +} +; +ThreadsSolidIcon.displayName = "ThreadsSolidIcon"; +export default ThreadsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/threads-solid.svg b/assets/web/icons/threads-solid.svg deleted file mode 100644 index 17ef20a5..00000000 --- a/assets/web/icons/threads-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/threads.d.ts b/assets/web/icons/threads.d.ts new file mode 100644 index 00000000..1ffa4168 --- /dev/null +++ b/assets/web/icons/threads.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * threads.svg + */ +declare const ThreadsIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default ThreadsIcon; diff --git a/assets/web/icons/threads.js b/assets/web/icons/threads.js new file mode 100644 index 00000000..0e5c9ff2 --- /dev/null +++ b/assets/web/icons/threads.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function ThreadsIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M7 10a.968.968 0 0 1-.713-.287A.968.968 0 0 1 6 9c0-.283.096-.52.287-.713A.968.968 0 0 1 7 8h10a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 17 10H7Zm0 4a.967.967 0 0 1-.713-.287A.968.968 0 0 1 6 13c0-.283.096-.52.287-.713A.967.967 0 0 1 7 12h6c.283 0 .52.096.713.287.191.192.287.43.287.713s-.096.52-.287.713A.968.968 0 0 1 13 14H7Z" + }), /*#__PURE__*/_jsx("path", { + d: "M3.707 21.293c-.63.63-1.707.184-1.707-.707V5a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H6l-2.293 2.293ZM6 17h14V5H4v13.172l.586-.586A2 2 0 0 1 6 17Z" + })] + }); +} +; +ThreadsIcon.displayName = "ThreadsIcon"; +export default ThreadsIcon; \ No newline at end of file diff --git a/assets/web/icons/threads.svg b/assets/web/icons/threads.svg deleted file mode 100644 index cf1055d1..00000000 --- a/assets/web/icons/threads.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/time.d.ts b/assets/web/icons/time.d.ts new file mode 100644 index 00000000..041bae8d --- /dev/null +++ b/assets/web/icons/time.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * time.svg + */ +declare const TimeIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default TimeIcon; diff --git a/assets/web/icons/time.js b/assets/web/icons/time.js new file mode 100644 index 00000000..dd7f94de --- /dev/null +++ b/assets/web/icons/time.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function TimeIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M13 8a1 1 0 1 0-2 0v4a1 1 0 0 0 .293.707l2.83 2.83a1 1 0 0 0 1.414-1.414L13 11.586V8Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M22 11.915c0 5.523-4.477 10-10 10s-10-4.477-10-10 4.477-10 10-10 10 4.477 10 10Zm-2 0a8 8 0 1 1-16 0 8 8 0 0 1 16 0Z", + clipRule: "evenodd" + })] + }); +} +; +TimeIcon.displayName = "TimeIcon"; +export default TimeIcon; \ No newline at end of file diff --git a/assets/web/icons/time.svg b/assets/web/icons/time.svg deleted file mode 100644 index fbdbb721..00000000 --- a/assets/web/icons/time.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/underline.d.ts b/assets/web/icons/underline.d.ts new file mode 100644 index 00000000..cd773a80 --- /dev/null +++ b/assets/web/icons/underline.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * underline.svg + */ +declare const UnderlineIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UnderlineIcon; diff --git a/assets/web/icons/underline.js b/assets/web/icons/underline.js new file mode 100644 index 00000000..7d40961c --- /dev/null +++ b/assets/web/icons/underline.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function UnderlineIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 21a.967.967 0 0 1-.713-.288A.968.968 0 0 1 5 20a.97.97 0 0 1 .287-.712A.967.967 0 0 1 6 19h12c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 18 21H6Zm6-4c-1.683 0-2.992-.525-3.925-1.575-.933-1.05-1.4-2.442-1.4-4.175V4.275c0-.35.13-.65.388-.9A1.27 1.27 0 0 1 7.974 3c.35 0 .65.125.9.375s.375.55.375.9V11.4c0 .933.233 1.692.7 2.275.467.583 1.15.875 2.05.875.9 0 1.583-.292 2.05-.875.467-.583.7-1.342.7-2.275V4.275c0-.35.13-.65.387-.9A1.27 1.27 0 0 1 16.05 3c.35 0 .65.125.9.375s.375.55.375.9v6.975c0 1.733-.467 3.125-1.4 4.175C14.992 16.475 13.683 17 12 17Z" + }) + }); +} +; +UnderlineIcon.displayName = "UnderlineIcon"; +export default UnderlineIcon; \ No newline at end of file diff --git a/assets/web/icons/underline.svg b/assets/web/icons/underline.svg deleted file mode 100644 index 69196ced..00000000 --- a/assets/web/icons/underline.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/unknown-solid.d.ts b/assets/web/icons/unknown-solid.d.ts new file mode 100644 index 00000000..c0e02bf7 --- /dev/null +++ b/assets/web/icons/unknown-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * unknown-solid.svg + */ +declare const UnknownSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UnknownSolidIcon; diff --git a/assets/web/icons/unknown-solid.js b/assets/web/icons/unknown-solid.js new file mode 100644 index 00000000..3f47887b --- /dev/null +++ b/assets/web/icons/unknown-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function UnknownSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12.999 13.011v-.004.005Zm-9.412 7.402C3.98 20.803 4.45 21 5 21h14c.55 0 1.02-.196 1.413-.587A1.93 1.93 0 0 0 21 19V5c0-.55-.196-1.02-.587-1.413A1.926 1.926 0 0 0 19 3H5c-.55 0-1.02.196-1.413.587A1.926 1.926 0 0 0 3 5v14c0 .55.196 1.02.587 1.413ZM12 9a1 1 0 0 0-1 1 1 1 0 1 1-2 0 3 3 0 1 1 4.44 2.633 1.404 1.404 0 0 0-.383.288.3.3 0 0 0-.057.085A1 1 0 0 1 11 13c0-.58.253-1.047.539-1.38.281-.33.63-.572.94-.742A1 1 0 0 0 12 9Zm1 7a1 1 0 1 1-2 0 1 1 0 0 1 2 0Z" + }) + }); +} +; +UnknownSolidIcon.displayName = "UnknownSolidIcon"; +export default UnknownSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/unknown-solid.svg b/assets/web/icons/unknown-solid.svg deleted file mode 100644 index cc67e482..00000000 --- a/assets/web/icons/unknown-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/unknown.d.ts b/assets/web/icons/unknown.d.ts new file mode 100644 index 00000000..19b95868 --- /dev/null +++ b/assets/web/icons/unknown.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * unknown.svg + */ +declare const UnknownIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UnknownIcon; diff --git a/assets/web/icons/unknown.js b/assets/web/icons/unknown.js new file mode 100644 index 00000000..39d53a33 --- /dev/null +++ b/assets/web/icons/unknown.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function UnknownIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }), /*#__PURE__*/_jsx("path", { + d: "M11 10a1 1 0 1 1 1.479.878c-.31.17-.659.413-.94.741-.286.334-.539.8-.539 1.381a1 1 0 0 0 2 .006.3.3 0 0 1 .057-.085 1.39 1.39 0 0 1 .382-.288A3 3 0 1 0 9 10a1 1 0 1 0 2 0Zm1.999 3.011v-.004.005ZM12 17a1 1 0 1 0 0-2 1 1 0 0 0 0 2Z" + })] + }); +} +; +UnknownIcon.displayName = "UnknownIcon"; +export default UnknownIcon; \ No newline at end of file diff --git a/assets/web/icons/unknown.svg b/assets/web/icons/unknown.svg deleted file mode 100644 index 1fa5bc83..00000000 --- a/assets/web/icons/unknown.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/user-add-solid.d.ts b/assets/web/icons/user-add-solid.d.ts new file mode 100644 index 00000000..06ff1fae --- /dev/null +++ b/assets/web/icons/user-add-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * user-add-solid.svg + */ +declare const UserAddSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UserAddSolidIcon; diff --git a/assets/web/icons/user-add-solid.js b/assets/web/icons/user-add-solid.js new file mode 100644 index 00000000..898cbdcc --- /dev/null +++ b/assets/web/icons/user-add-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function UserAddSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M10 12c-1.1 0-2.042-.392-2.825-1.175C6.392 10.042 6 9.1 6 8s.392-2.042 1.175-2.825C7.958 4.392 8.9 4 10 4s2.042.392 2.825 1.175C13.608 5.958 14 6.9 14 8s-.392 2.042-1.175 2.825C12.042 11.608 11.1 12 10 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 3.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 10 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 16 20H4c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 18Zm15-7h2v2c0 .283.096.52.288.713.191.191.429.287.712.287s.52-.096.712-.287A.968.968 0 0 0 21 13v-2h2a.97.97 0 0 0 .712-.287A.968.968 0 0 0 24 10a.967.967 0 0 0-.288-.713A.968.968 0 0 0 23 9h-2V7a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 6a.968.968 0 0 0-.712.287A.967.967 0 0 0 19 7v2h-2a.968.968 0 0 0-.712.287A.967.967 0 0 0 16 10c0 .283.096.52.288.713A.968.968 0 0 0 17 11Z" + }) + }); +} +; +UserAddSolidIcon.displayName = "UserAddSolidIcon"; +export default UserAddSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/user-add-solid.svg b/assets/web/icons/user-add-solid.svg deleted file mode 100644 index 25a384d0..00000000 --- a/assets/web/icons/user-add-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/user-add.d.ts b/assets/web/icons/user-add.d.ts new file mode 100644 index 00000000..154776d7 --- /dev/null +++ b/assets/web/icons/user-add.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * user-add.svg + */ +declare const UserAddIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UserAddIcon; diff --git a/assets/web/icons/user-add.js b/assets/web/icons/user-add.js new file mode 100644 index 00000000..839aa141 --- /dev/null +++ b/assets/web/icons/user-add.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function UserAddIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M10 12c-1.1 0-2.042-.392-2.825-1.175C6.392 10.042 6 9.1 6 8s.392-2.042 1.175-2.825C7.958 4.392 8.9 4 10 4s2.042.392 2.825 1.175C13.608 5.958 14 6.9 14 8s-.392 2.042-1.175 2.825C12.042 11.608 11.1 12 10 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 3.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 10 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 16 20H4c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 18Zm2 0h12v-.8a.973.973 0 0 0-.5-.85c-.9-.45-1.808-.787-2.725-1.012a11.6 11.6 0 0 0-5.55 0c-.917.225-1.825.562-2.725 1.012a.973.973 0 0 0-.5.85v.8Zm6-8c.55 0 1.02-.196 1.412-.588C11.804 9.021 12 8.55 12 8c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 10 6c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 8 8c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Zm7 1h2v2c0 .283.096.52.288.713.191.191.429.287.712.287s.52-.096.712-.287A.968.968 0 0 0 21 13v-2h2a.97.97 0 0 0 .712-.287A.968.968 0 0 0 24 10a.967.967 0 0 0-.288-.713A.968.968 0 0 0 23 9h-2V7a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 6a.968.968 0 0 0-.712.287A.967.967 0 0 0 19 7v2h-2a.968.968 0 0 0-.712.287A.967.967 0 0 0 16 10c0 .283.096.52.288.713A.968.968 0 0 0 17 11Z" + }) + }); +} +; +UserAddIcon.displayName = "UserAddIcon"; +export default UserAddIcon; \ No newline at end of file diff --git a/assets/web/icons/user-add.svg b/assets/web/icons/user-add.svg deleted file mode 100644 index 33de8df9..00000000 --- a/assets/web/icons/user-add.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/user-profile-solid.d.ts b/assets/web/icons/user-profile-solid.d.ts new file mode 100644 index 00000000..952d6c19 --- /dev/null +++ b/assets/web/icons/user-profile-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * user-profile-solid.svg + */ +declare const UserProfileSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UserProfileSolidIcon; diff --git a/assets/web/icons/user-profile-solid.js b/assets/web/icons/user-profile-solid.js new file mode 100644 index 00000000..ff49c7f2 --- /dev/null +++ b/assets/web/icons/user-profile-solid.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function UserProfileSolidIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M12 15c-1.1 0-2.042-.392-2.825-1.175C8.392 13.042 8 12.1 8 11s.392-2.042 1.175-2.825C9.958 7.392 10.9 7 12 7s2.042.392 2.825 1.175C15.608 8.958 16 9.9 16 11s-.392 2.042-1.175 2.825C14.042 14.608 13.1 15 12 15Z" + }), /*#__PURE__*/_jsx("path", { + d: "M19.528 18.583A9.962 9.962 0 0 0 22 12c0-5.523-4.477-10-10-10S2 6.477 2 12c0 2.52.933 4.824 2.472 6.583A9.976 9.976 0 0 0 12 22a9.976 9.976 0 0 0 7.528-3.417ZM8.75 16.388c-.915.221-1.818.538-2.709.95a8 8 0 1 1 11.918 0 14.679 14.679 0 0 0-2.709-.95A13.76 13.76 0 0 0 12 16c-1.1 0-2.183.13-3.25.387Z" + })] + }); +} +; +UserProfileSolidIcon.displayName = "UserProfileSolidIcon"; +export default UserProfileSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/user-profile-solid.svg b/assets/web/icons/user-profile-solid.svg deleted file mode 100644 index 1f5cb087..00000000 --- a/assets/web/icons/user-profile-solid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/user-profile.d.ts b/assets/web/icons/user-profile.d.ts new file mode 100644 index 00000000..5980ff5f --- /dev/null +++ b/assets/web/icons/user-profile.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * user-profile.svg + */ +declare const UserProfileIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UserProfileIcon; diff --git a/assets/web/icons/user-profile.js b/assets/web/icons/user-profile.js new file mode 100644 index 00000000..aa7d76af --- /dev/null +++ b/assets/web/icons/user-profile.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function UserProfileIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M9.175 13.825C9.958 14.608 10.9 15 12 15s2.042-.392 2.825-1.175C15.608 13.042 16 12.1 16 11s-.392-2.042-1.175-2.825C14.042 7.392 13.1 7 12 7s-2.042.392-2.825 1.175C8.392 8.958 8 9.9 8 11s.392 2.042 1.175 2.825Zm4.237-1.412A1.926 1.926 0 0 1 12 13c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 11c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 9c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412Z" + }), /*#__PURE__*/_jsx("path", { + d: "M22 12c0 5.523-4.477 10-10 10S2 17.523 2 12 6.477 2 12 2s10 4.477 10 10Zm-2 0a8 8 0 1 0-16 0 8 8 0 0 0 16 0Z" + }), /*#__PURE__*/_jsx("path", { + d: "M16.23 18.792a12.47 12.47 0 0 0-1.455-.455 11.6 11.6 0 0 0-5.55 0c-.487.12-.972.271-1.455.455a8.04 8.04 0 0 1-1.729-1.454c.89-.412 1.794-.729 2.709-.95A13.76 13.76 0 0 1 12 16c1.1 0 2.183.13 3.25.387a14.78 14.78 0 0 1 2.709.95 8.042 8.042 0 0 1-1.73 1.455Z" + })] + }); +} +; +UserProfileIcon.displayName = "UserProfileIcon"; +export default UserProfileIcon; \ No newline at end of file diff --git a/assets/web/icons/user-profile.svg b/assets/web/icons/user-profile.svg deleted file mode 100644 index 19f45e2f..00000000 --- a/assets/web/icons/user-profile.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/assets/web/icons/user-solid.d.ts b/assets/web/icons/user-solid.d.ts new file mode 100644 index 00000000..2287a447 --- /dev/null +++ b/assets/web/icons/user-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * user-solid.svg + */ +declare const UserSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UserSolidIcon; diff --git a/assets/web/icons/user-solid.js b/assets/web/icons/user-solid.js new file mode 100644 index 00000000..20d0cba5 --- /dev/null +++ b/assets/web/icons/user-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function UserSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 12c-1.1 0-2.042-.392-2.825-1.175C8.392 10.042 8 9.1 8 8s.392-2.042 1.175-2.825C9.958 4.392 10.9 4 12 4s2.042.392 2.825 1.175C15.608 5.958 16 6.9 16 8s-.392 2.042-1.175 2.825C14.042 11.608 13.1 12 12 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 5.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 12 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18Z" + }) + }); +} +; +UserSolidIcon.displayName = "UserSolidIcon"; +export default UserSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/user-solid.svg b/assets/web/icons/user-solid.svg deleted file mode 100644 index 959dde50..00000000 --- a/assets/web/icons/user-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/user.d.ts b/assets/web/icons/user.d.ts new file mode 100644 index 00000000..326c41db --- /dev/null +++ b/assets/web/icons/user.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * user.svg + */ +declare const UserIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default UserIcon; diff --git a/assets/web/icons/user.js b/assets/web/icons/user.js new file mode 100644 index 00000000..18e8cc02 --- /dev/null +++ b/assets/web/icons/user.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function UserIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 12c-1.1 0-2.042-.392-2.825-1.175C8.392 10.042 8 9.1 8 8s.392-2.042 1.175-2.825C9.958 4.392 10.9 4 12 4s2.042.392 2.825 1.175C15.608 5.958 16 6.9 16 8s-.392 2.042-1.175 2.825C14.042 11.608 13.1 12 12 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 5.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 12 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18Zm2 0h12v-.8a.973.973 0 0 0-.5-.85c-.9-.45-1.808-.787-2.725-1.012a11.6 11.6 0 0 0-5.55 0c-.917.225-1.825.562-2.725 1.012a.973.973 0 0 0-.5.85v.8Zm6-8c.55 0 1.02-.196 1.412-.588C13.804 9.021 14 8.55 14 8c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 12 6c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 10 8c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Z" + }) + }); +} +; +UserIcon.displayName = "UserIcon"; +export default UserIcon; \ No newline at end of file diff --git a/assets/web/icons/user.svg b/assets/web/icons/user.svg deleted file mode 100644 index d492fd72..00000000 --- a/assets/web/icons/user.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/verified.d.ts b/assets/web/icons/verified.d.ts new file mode 100644 index 00000000..42efb7fa --- /dev/null +++ b/assets/web/icons/verified.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * verified.svg + */ +declare const VerifiedIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VerifiedIcon; diff --git a/assets/web/icons/verified.js b/assets/web/icons/verified.js new file mode 100644 index 00000000..8984325b --- /dev/null +++ b/assets/web/icons/verified.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VerifiedIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M8.15 21.75 6.7 19.3l-2.75-.6a.943.943 0 0 1-.6-.387.928.928 0 0 1-.175-.688L3.45 14.8l-1.875-2.15a.934.934 0 0 1-.25-.65c0-.25.084-.467.25-.65L3.45 9.2l-.275-2.825a.928.928 0 0 1 .175-.688.943.943 0 0 1 .6-.387l2.75-.6 1.45-2.45a.983.983 0 0 1 .55-.438.97.97 0 0 1 .7.038l2.6 1.1 2.6-1.1a.97.97 0 0 1 .7-.038.983.983 0 0 1 .55.438L17.3 4.7l2.75.6c.25.05.45.18.6.388.15.208.209.437.175.687L20.55 9.2l1.875 2.15c.167.183.25.4.25.65s-.083.467-.25.65L20.55 14.8l.275 2.825a.928.928 0 0 1-.175.688.943.943 0 0 1-.6.387l-2.75.6-1.45 2.45a.983.983 0 0 1-.55.438.97.97 0 0 1-.7-.038l-2.6-1.1-2.6 1.1a.97.97 0 0 1-.7.038.983.983 0 0 1-.55-.438Zm2.8-9.05L9.5 11.275A.933.933 0 0 0 8.813 11c-.275 0-.513.1-.713.3a.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7l2.15 2.15c.2.2.434.3.7.3.267 0 .5-.1.7-.3l4.25-4.25c.2-.2.296-.433.288-.7a1.055 1.055 0 0 0-.288-.7 1.02 1.02 0 0 0-.712-.313.93.93 0 0 0-.713.288L10.95 12.7Z" + }) + }); +} +; +VerifiedIcon.displayName = "VerifiedIcon"; +export default VerifiedIcon; \ No newline at end of file diff --git a/assets/web/icons/verified.svg b/assets/web/icons/verified.svg deleted file mode 100644 index 5b753f24..00000000 --- a/assets/web/icons/verified.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/video-call-declined-solid.d.ts b/assets/web/icons/video-call-declined-solid.d.ts new file mode 100644 index 00000000..664410bc --- /dev/null +++ b/assets/web/icons/video-call-declined-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * video-call-declined-solid.svg + */ +declare const VideoCallDeclinedSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VideoCallDeclinedSolidIcon; diff --git a/assets/web/icons/video-call-declined-solid.js b/assets/web/icons/video-call-declined-solid.js new file mode 100644 index 00000000..0f8b2363 --- /dev/null +++ b/assets/web/icons/video-call-declined-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VideoCallDeclinedSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2 8a4 4 0 0 1 4-4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8Zm10.828 6.828c.2-.2.3-.436.3-.707 0-.27-.1-.506-.3-.707L11.414 12l1.414-1.414c.2-.2.3-.436.3-.707 0-.271-.1-.507-.3-.707a.969.969 0 0 0-.707-.301c-.27 0-.506.1-.707.3L10 10.587 8.586 9.172a.969.969 0 0 0-.707-.301c-.271 0-.507.1-.707.3-.2.2-.3.437-.3.708 0 .27.1.506.3.707L8.586 12l-1.414 1.414c-.2.2-.3.436-.3.707 0 .271.1.507.3.707.2.2.436.3.707.3.27 0 .506-.1.707-.3L10 13.414l1.414 1.414c.2.2.436.3.707.3.271 0 .507-.1.707-.3Z" + }) + }); +} +; +VideoCallDeclinedSolidIcon.displayName = "VideoCallDeclinedSolidIcon"; +export default VideoCallDeclinedSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-declined-solid.svg b/assets/web/icons/video-call-declined-solid.svg deleted file mode 100644 index ead6edff..00000000 --- a/assets/web/icons/video-call-declined-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/video-call-missed-solid.d.ts b/assets/web/icons/video-call-missed-solid.d.ts new file mode 100644 index 00000000..f4065682 --- /dev/null +++ b/assets/web/icons/video-call-missed-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * video-call-missed-solid.svg + */ +declare const VideoCallMissedSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VideoCallMissedSolidIcon; diff --git a/assets/web/icons/video-call-missed-solid.js b/assets/web/icons/video-call-missed-solid.js new file mode 100644 index 00000000..b939617a --- /dev/null +++ b/assets/web/icons/video-call-missed-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VideoCallMissedSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2 8a4 4 0 0 1 4-4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8Zm8.7 5.15L8.5 11H9c.283 0 .52-.096.713-.287A.968.968 0 0 0 10 10a.968.968 0 0 0-.287-.713A.968.968 0 0 0 9 9H6a.968.968 0 0 0-.713.287A.968.968 0 0 0 5 10v3c0 .283.096.52.287.713.192.191.43.287.713.287s.52-.096.713-.287A.968.968 0 0 0 7 13v-.7l3 3a1.034 1.034 0 0 0 1.088.2.773.773 0 0 0 .312-.225l3.125-3.15a.918.918 0 0 0 .275-.675c0-.267-.1-.5-.3-.7a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275l-2.4 2.4Z" + }) + }); +} +; +VideoCallMissedSolidIcon.displayName = "VideoCallMissedSolidIcon"; +export default VideoCallMissedSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-missed-solid.svg b/assets/web/icons/video-call-missed-solid.svg deleted file mode 100644 index 8bd71477..00000000 --- a/assets/web/icons/video-call-missed-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/video-call-off-solid.d.ts b/assets/web/icons/video-call-off-solid.d.ts new file mode 100644 index 00000000..6c857e03 --- /dev/null +++ b/assets/web/icons/video-call-off-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * video-call-off-solid.svg + */ +declare const VideoCallOffSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VideoCallOffSolidIcon; diff --git a/assets/web/icons/video-call-off-solid.js b/assets/web/icons/video-call-off-solid.js new file mode 100644 index 00000000..a96bbbcb --- /dev/null +++ b/assets/web/icons/video-call-off-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VideoCallOffSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2.747 2.753 4.35 4.355l.008-.003L18 17.994v.012l3.247 3.247a1 1 0 1 1-1.414 1.414l-2.898-2.898A1.99 1.99 0 0 1 16 20H6a4 4 0 0 1-4-4V8c0-.892.292-1.715.785-2.38L1.333 4.166a1 1 0 0 1 1.414-1.414ZM18 15.166 6.834 4H16a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715v1.45Z" + }) + }); +} +; +VideoCallOffSolidIcon.displayName = "VideoCallOffSolidIcon"; +export default VideoCallOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-off-solid.svg b/assets/web/icons/video-call-off-solid.svg deleted file mode 100644 index c008d68f..00000000 --- a/assets/web/icons/video-call-off-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/video-call-off.d.ts b/assets/web/icons/video-call-off.d.ts new file mode 100644 index 00000000..421599db --- /dev/null +++ b/assets/web/icons/video-call-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * video-call-off.svg + */ +declare const VideoCallOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VideoCallOffIcon; diff --git a/assets/web/icons/video-call-off.js b/assets/web/icons/video-call-off.js new file mode 100644 index 00000000..6167ae0d --- /dev/null +++ b/assets/web/icons/video-call-off.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VideoCallOffIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2.747 2.753 4.35 4.355l.008-.003L6.006 6h-.012L16 16.006v-.012l2 2v.012l3.247 3.247a1 1 0 1 1-1.414 1.414l-2.898-2.898A1.99 1.99 0 0 1 16 20H6a4 4 0 0 1-4-4V8c0-.892.292-1.715.785-2.38L1.333 4.166a1 1 0 0 1 1.414-1.414Zm1.484 4.313a1.991 1.991 0 0 0-.23.934v8A2 2 0 0 0 6 18h9.166L4.23 7.066ZM16 6H8.834l-2-2H16a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715v1.45l-2-2V6Zm5 7.652v-3.303L19.073 12 21 13.652Z" + }) + }); +} +; +VideoCallOffIcon.displayName = "VideoCallOffIcon"; +export default VideoCallOffIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-off.svg b/assets/web/icons/video-call-off.svg deleted file mode 100644 index de132cc5..00000000 --- a/assets/web/icons/video-call-off.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/video-call-solid.d.ts b/assets/web/icons/video-call-solid.d.ts new file mode 100644 index 00000000..6ee4cb90 --- /dev/null +++ b/assets/web/icons/video-call-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * video-call-solid.svg + */ +declare const VideoCallSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VideoCallSolidIcon; diff --git a/assets/web/icons/video-call-solid.js b/assets/web/icons/video-call-solid.js new file mode 100644 index 00000000..8d6c6f42 --- /dev/null +++ b/assets/web/icons/video-call-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VideoCallSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M6 4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8a4 4 0 0 1 4-4Z" + }) + }); +} +; +VideoCallSolidIcon.displayName = "VideoCallSolidIcon"; +export default VideoCallSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-solid.svg b/assets/web/icons/video-call-solid.svg deleted file mode 100644 index 285c5745..00000000 --- a/assets/web/icons/video-call-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/video-call.d.ts b/assets/web/icons/video-call.d.ts new file mode 100644 index 00000000..8926c70d --- /dev/null +++ b/assets/web/icons/video-call.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * video-call.svg + */ +declare const VideoCallIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VideoCallIcon; diff --git a/assets/web/icons/video-call.js b/assets/web/icons/video-call.js new file mode 100644 index 00000000..ca09ddde --- /dev/null +++ b/assets/web/icons/video-call.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VideoCallIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M2 8a4 4 0 0 1 4-4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8Zm4-2a2 2 0 0 0-2 2v8a2 2 0 0 0 2 2h10V6H6Zm15 7.652v-3.303L19.073 12 21 13.652Z" + }) + }); +} +; +VideoCallIcon.displayName = "VideoCallIcon"; +export default VideoCallIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call.svg b/assets/web/icons/video-call.svg deleted file mode 100644 index 78161008..00000000 --- a/assets/web/icons/video-call.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/visibility-off.d.ts b/assets/web/icons/visibility-off.d.ts new file mode 100644 index 00000000..e068485b --- /dev/null +++ b/assets/web/icons/visibility-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * visibility-off.svg + */ +declare const VisibilityOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VisibilityOffIcon; diff --git a/assets/web/icons/visibility-off.js b/assets/web/icons/visibility-off.js new file mode 100644 index 00000000..a72fc035 --- /dev/null +++ b/assets/web/icons/visibility-off.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VisibilityOffIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m16.1 13.3-1.45-1.45c.15-.783-.075-1.517-.675-2.2-.6-.683-1.375-.95-2.325-.8L10.2 7.4a4.24 4.24 0 0 1 .862-.3A4.2 4.2 0 0 1 12 7c1.25 0 2.312.437 3.187 1.312S16.5 10.25 16.5 11.5c0 .333-.034.646-.1.938a4.25 4.25 0 0 1-.3.862Zm3.2 3.15-1.45-1.4a10.956 10.956 0 0 0 1.687-1.588A8.898 8.898 0 0 0 20.8 11.5c-.834-1.683-2.03-3.02-3.588-4.013C15.654 6.496 13.916 6 12 6c-.483 0-.959.033-1.425.1a9.622 9.622 0 0 0-1.375.3L7.65 4.85A11.08 11.08 0 0 1 12 4c2.383 0 4.525.63 6.425 1.887 1.9 1.259 3.325 2.896 4.275 4.913.05.083.083.188.1.313s.025.254.025.387a1.972 1.972 0 0 1-.125.7 10.896 10.896 0 0 1-3.4 4.25Zm-.2 5.45-3.5-3.45c-.583.183-1.171.32-1.763.413-.591.091-1.204.137-1.837.137-2.384 0-4.525-.63-6.425-1.887-1.9-1.259-3.325-2.896-4.275-4.913a.813.813 0 0 1-.1-.313 2.932 2.932 0 0 1 0-.762.796.796 0 0 1 .1-.3A11.2 11.2 0 0 1 2.55 8.75 13.292 13.292 0 0 1 4.15 7L2.075 4.9a.933.933 0 0 1-.275-.688c0-.275.1-.512.3-.712a.948.948 0 0 1 .7-.275c.283 0 .516.092.7.275l17 17a.977.977 0 0 1 .287.688.93.93 0 0 1-.287.712.948.948 0 0 1-.7.275.948.948 0 0 1-.7-.275ZM5.55 8.4c-.484.433-.925.908-1.325 1.425A9.014 9.014 0 0 0 3.2 11.5c.833 1.683 2.029 3.02 3.587 4.012C8.346 16.505 10.083 17 12 17c.333 0 .658-.02.975-.063.316-.041.642-.087.975-.137l-.9-.95c-.184.05-.359.088-.525.113A3.539 3.539 0 0 1 12 16c-1.25 0-2.313-.438-3.188-1.313C7.937 13.813 7.5 12.75 7.5 11.5c0-.183.012-.358.037-.525.025-.167.063-.342.113-.525L5.55 8.4Z" + }) + }); +} +; +VisibilityOffIcon.displayName = "VisibilityOffIcon"; +export default VisibilityOffIcon; \ No newline at end of file diff --git a/assets/web/icons/visibility-off.svg b/assets/web/icons/visibility-off.svg deleted file mode 100644 index edc1eec1..00000000 --- a/assets/web/icons/visibility-off.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/visibility-on.d.ts b/assets/web/icons/visibility-on.d.ts new file mode 100644 index 00000000..6f86a965 --- /dev/null +++ b/assets/web/icons/visibility-on.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * visibility-on.svg + */ +declare const VisibilityOnIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VisibilityOnIcon; diff --git a/assets/web/icons/visibility-on.js b/assets/web/icons/visibility-on.js new file mode 100644 index 00000000..27ea3d53 --- /dev/null +++ b/assets/web/icons/visibility-on.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VisibilityOnIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M12 16c1.25 0 2.313-.438 3.188-1.313.874-.874 1.312-1.937 1.312-3.187 0-1.25-.438-2.313-1.313-3.188C14.313 7.439 13.25 7 12 7c-1.25 0-2.312.438-3.187 1.313C7.938 9.187 7.5 10.25 7.5 11.5c0 1.25.438 2.313 1.313 3.188C9.688 15.562 10.75 16 12 16Zm0-1.8c-.75 0-1.387-.262-1.912-.787A2.604 2.604 0 0 1 9.3 11.5c0-.75.263-1.387.787-1.912A2.604 2.604 0 0 1 12 8.8c.75 0 1.387.262 1.912.787.525.526.788 1.163.788 1.913s-.262 1.387-.787 1.912A2.604 2.604 0 0 1 12 14.2Zm0 4.8c-2.317 0-4.433-.613-6.35-1.837-1.917-1.226-3.367-2.88-4.35-4.963a.812.812 0 0 1-.1-.313 2.93 2.93 0 0 1 0-.774.812.812 0 0 1 .1-.313c.983-2.083 2.433-3.738 4.35-4.963C7.567 4.614 9.683 4 12 4c2.317 0 4.433.612 6.35 1.838 1.917 1.224 3.367 2.879 4.35 4.962a.81.81 0 0 1 .1.313 2.925 2.925 0 0 1 0 .774.81.81 0 0 1-.1.313c-.983 2.083-2.433 3.738-4.35 4.963C16.433 18.387 14.317 19 12 19Zm0-2a9.544 9.544 0 0 0 5.188-1.488A9.773 9.773 0 0 0 20.8 11.5a9.773 9.773 0 0 0-3.613-4.013A9.544 9.544 0 0 0 12 6a9.545 9.545 0 0 0-5.187 1.487A9.773 9.773 0 0 0 3.2 11.5a9.773 9.773 0 0 0 3.613 4.012A9.544 9.544 0 0 0 12 17Z" + }) + }); +} +; +VisibilityOnIcon.displayName = "VisibilityOnIcon"; +export default VisibilityOnIcon; \ No newline at end of file diff --git a/assets/web/icons/visibility-on.svg b/assets/web/icons/visibility-on.svg deleted file mode 100644 index 3c33602e..00000000 --- a/assets/web/icons/visibility-on.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/voice-call.d.ts b/assets/web/icons/voice-call.d.ts new file mode 100644 index 00000000..06c0a070 --- /dev/null +++ b/assets/web/icons/voice-call.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * voice-call.svg + */ +declare const VoiceCallIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VoiceCallIcon; diff --git a/assets/web/icons/voice-call.js b/assets/web/icons/voice-call.js new file mode 100644 index 00000000..4494c5ae --- /dev/null +++ b/assets/web/icons/voice-call.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VoiceCallIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m20.958 16.374.039 3.527c0 .284-.11.536-.33.756-.22.22-.472.33-.756.33a15.97 15.97 0 0 1-6.57-1.105 16.225 16.225 0 0 1-5.563-3.663 16.084 16.084 0 0 1-3.653-5.573 16.313 16.313 0 0 1-1.115-6.56c0-.285.11-.537.33-.757.22-.22.471-.33.755-.33l3.528.04a1.069 1.069 0 0 1 1.085.93l.543 3.954c.026.18.013.349-.039.504a1.088 1.088 0 0 1-.271.426l-1.64 1.64c.337.672.721 1.308 1.154 1.909.433.6 1.444 1.696 1.444 1.696s1.095 1.01 1.696 1.444c.6.433 1.237.817 1.909 1.153l1.64-1.64a1.07 1.07 0 0 1 .426-.27c.155-.052.323-.065.504-.04l3.954.543a1.068 1.068 0 0 1 .93 1.085Z" + }) + }); +} +; +VoiceCallIcon.displayName = "VoiceCallIcon"; +export default VoiceCallIcon; \ No newline at end of file diff --git a/assets/web/icons/voice-call.svg b/assets/web/icons/voice-call.svg deleted file mode 100644 index 6b5d69d5..00000000 --- a/assets/web/icons/voice-call.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/volume-off-solid.d.ts b/assets/web/icons/volume-off-solid.d.ts new file mode 100644 index 00000000..2761ba0e --- /dev/null +++ b/assets/web/icons/volume-off-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * volume-off-solid.svg + */ +declare const VolumeOffSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VolumeOffSolidIcon; diff --git a/assets/web/icons/volume-off-solid.js b/assets/web/icons/volume-off-solid.js new file mode 100644 index 00000000..ff3c36ae --- /dev/null +++ b/assets/web/icons/volume-off-solid.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VolumeOffSolidIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M3.5 3.5a1 1 0 1 0-1.414 1.414L5.172 8H5a2 2 0 0 0-2 2v4a2 2 0 0 0 2 2h2l3.293 3.293c.63.63 1.707.184 1.707-.707v-3.758l7.086 7.086A1 1 0 0 0 20.5 20.5l-2.136-2.136.003-.003-1.414-1.414-.003.003-1.414-1.414.003-.003-1.415-1.415-.002.003L12 12v-.006L7.503 7.497 7.5 7.5l-4-4Zm11.496 8.662 1.661 1.66c.222-.564.343-1.18.343-1.822 0-1.38-.56-2.632-1.464-3.536a1 1 0 1 0-1.414 1.414 2.987 2.987 0 0 1 .874 2.284Zm3.164 3.164 1.462 1.462A8.961 8.961 0 0 0 21 12a8.975 8.975 0 0 0-2.636-6.364A1 1 0 0 0 16.95 7.05 6.975 6.975 0 0 1 19 12a6.966 6.966 0 0 1-.84 3.326ZM8.917 6.083 12 9.166V5.414c0-.89-1.077-1.337-1.707-.707L8.917 6.083Z" + }) + }); +} +; +VolumeOffSolidIcon.displayName = "VolumeOffSolidIcon"; +export default VolumeOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-off-solid.svg b/assets/web/icons/volume-off-solid.svg deleted file mode 100644 index d7729823..00000000 --- a/assets/web/icons/volume-off-solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/volume-off.d.ts b/assets/web/icons/volume-off.d.ts new file mode 100644 index 00000000..5bd1db94 --- /dev/null +++ b/assets/web/icons/volume-off.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * volume-off.svg + */ +declare const VolumeOffIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VolumeOffIcon; diff --git a/assets/web/icons/volume-off.js b/assets/web/icons/volume-off.js new file mode 100644 index 00000000..22487133 --- /dev/null +++ b/assets/web/icons/volume-off.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function VolumeOffIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "m3.5 3.5 4 4 .003-.003L8.917 8.91l-.003.003L10 10v-.006l2 2V12l2.122 2.121.002-.003 1.415 1.415-.003.003 1.414 1.414.003-.003 1.414 1.414-.003.003L20.5 20.5a1 1 0 0 1-1.414 1.414L12 14.828v3.758c0 .89-1.077 1.337-1.707.707L7 16H5a2 2 0 0 1-2-2v-4a2 2 0 0 1 2-2h.172L2.086 4.914A1 1 0 0 1 3.5 3.5ZM7.172 10H5v4h2.828L10 16.17v-3.343L7.172 10Zm7.824 2.162 1.661 1.66c.222-.564.343-1.18.343-1.822 0-1.38-.56-2.632-1.464-3.536a1 1 0 1 0-1.414 1.414 2.987 2.987 0 0 1 .874 2.284Zm3.164 3.164 1.462 1.462A8.961 8.961 0 0 0 21 12a8.975 8.975 0 0 0-2.636-6.364A1 1 0 0 0 16.95 7.05 6.975 6.975 0 0 1 19 12a6.966 6.966 0 0 1-.84 3.326ZM8.917 6.083 12 9.166V5.414c0-.89-1.077-1.337-1.707-.707L8.917 6.083Z" + }) + }); +} +; +VolumeOffIcon.displayName = "VolumeOffIcon"; +export default VolumeOffIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-off.svg b/assets/web/icons/volume-off.svg deleted file mode 100644 index 90df346f..00000000 --- a/assets/web/icons/volume-off.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/assets/web/icons/volume-on-solid.d.ts b/assets/web/icons/volume-on-solid.d.ts new file mode 100644 index 00000000..bf136036 --- /dev/null +++ b/assets/web/icons/volume-on-solid.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * volume-on-solid.svg + */ +declare const VolumeOnSolidIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VolumeOnSolidIcon; diff --git a/assets/web/icons/volume-on-solid.js b/assets/web/icons/volume-on-solid.js new file mode 100644 index 00000000..fe7b2505 --- /dev/null +++ b/assets/web/icons/volume-on-solid.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function VolumeOnSolidIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M3 14v-4a2 2 0 0 1 2-2h2l3.293-3.293c.63-.63 1.707-.184 1.707.707v13.172c0 .89-1.077 1.337-1.707.707L7 16H5a2 2 0 0 1-2-2Zm11.121-5.536a1 1 0 0 1 1.415 0A4.987 4.987 0 0 1 17 12c0 1.38-.56 2.632-1.464 3.536a1 1 0 0 1-1.415-1.415 2.988 2.988 0 0 0 .88-2.121c0-.829-.335-1.577-.88-2.121a1 1 0 0 1 0-1.415Z" + }), /*#__PURE__*/_jsx("path", { + d: "M16.95 5.636a1 1 0 0 1 1.414 0A8.975 8.975 0 0 1 21 12a8.975 8.975 0 0 1-2.636 6.364 1 1 0 0 1-1.414-1.414A6.975 6.975 0 0 0 19 12a6.975 6.975 0 0 0-2.05-4.95 1 1 0 0 1 0-1.414Z" + })] + }); +} +; +VolumeOnSolidIcon.displayName = "VolumeOnSolidIcon"; +export default VolumeOnSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-on-solid.svg b/assets/web/icons/volume-on-solid.svg deleted file mode 100644 index a616f728..00000000 --- a/assets/web/icons/volume-on-solid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/volume-on.d.ts b/assets/web/icons/volume-on.d.ts new file mode 100644 index 00000000..03300d4b --- /dev/null +++ b/assets/web/icons/volume-on.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * volume-on.svg + */ +declare const VolumeOnIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default VolumeOnIcon; diff --git a/assets/web/icons/volume-on.js b/assets/web/icons/volume-on.js new file mode 100644 index 00000000..5bf5d8d8 --- /dev/null +++ b/assets/web/icons/volume-on.js @@ -0,0 +1,19 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function VolumeOnIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M3 10a2 2 0 0 1 2-2h2l3.293-3.293c.63-.63 1.707-.184 1.707.707v13.172c0 .89-1.077 1.337-1.707.707L7 16H5a2 2 0 0 1-2-2v-4Zm4.828 4L10 16.172V7.828L7.828 10H5v4h2.828Zm6.293-5.536a1 1 0 0 1 1.415 0A4.988 4.988 0 0 1 17 12c0 1.38-.56 2.632-1.464 3.535a1 1 0 1 1-1.415-1.414 2.987 2.987 0 0 0 .88-2.121c0-.829-.335-1.578-.88-2.122a1 1 0 0 1 0-1.414Z" + }), /*#__PURE__*/_jsx("path", { + d: "M18.364 5.636A1 1 0 1 0 16.95 7.05 6.975 6.975 0 0 1 19 12a6.975 6.975 0 0 1-2.05 4.95 1 1 0 0 0 1.414 1.414A8.975 8.975 0 0 0 21 12a8.975 8.975 0 0 0-2.636-6.364Z" + })] + }); +} +; +VolumeOnIcon.displayName = "VolumeOnIcon"; +export default VolumeOnIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-on.svg b/assets/web/icons/volume-on.svg deleted file mode 100644 index 39f7a3a9..00000000 --- a/assets/web/icons/volume-on.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/warning.d.ts b/assets/web/icons/warning.d.ts new file mode 100644 index 00000000..aae7b922 --- /dev/null +++ b/assets/web/icons/warning.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * warning.svg + */ +declare const WarningIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default WarningIcon; diff --git a/assets/web/icons/warning.js b/assets/web/icons/warning.js new file mode 100644 index 00000000..c931ae0f --- /dev/null +++ b/assets/web/icons/warning.js @@ -0,0 +1,21 @@ +import { jsx as _jsx, jsxs as _jsxs } from "react/jsx-runtime"; +function WarningIcon(props) { + return /*#__PURE__*/_jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_jsx("path", { + d: "M12.713 17.712A.968.968 0 0 1 12 18a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 17a.97.97 0 0 1 .287-.712A.968.968 0 0 1 12 16a.97.97 0 0 1 .713.288c.191.191.287.429.287.712s-.096.52-.287.712Zm0-3.999A.968.968 0 0 1 12 14a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 13V9c0-.283.096-.52.287-.713A.968.968 0 0 1 12 8c.283 0 .52.096.713.287.191.192.287.43.287.713v4c0 .283-.096.52-.287.713Z" + }), /*#__PURE__*/_jsx("path", { + fillRule: "evenodd", + d: "M10.264 3.039c.767-1.344 2.705-1.344 3.472 0l8.554 14.969c.762 1.333-.2 2.992-1.736 2.992H3.446c-1.535 0-2.498-1.659-1.736-2.992l8.553-14.97ZM3.446 19 12 4.031 20.554 19H3.446Z", + clipRule: "evenodd" + })] + }); +} +; +WarningIcon.displayName = "WarningIcon"; +export default WarningIcon; \ No newline at end of file diff --git a/assets/web/icons/warning.svg b/assets/web/icons/warning.svg deleted file mode 100644 index 3a6d9bb9..00000000 --- a/assets/web/icons/warning.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/assets/web/icons/web-browser.d.ts b/assets/web/icons/web-browser.d.ts new file mode 100644 index 00000000..28ae80b3 --- /dev/null +++ b/assets/web/icons/web-browser.d.ts @@ -0,0 +1,10 @@ +import * as React from "react"; + +/** + * web-browser.svg + */ +declare const WebBrowserIcon: React.FunctionComponent< + React.ComponentProps<"svg"> +>; + +export default WebBrowserIcon; diff --git a/assets/web/icons/web-browser.js b/assets/web/icons/web-browser.js new file mode 100644 index 00000000..b7fd7fdd --- /dev/null +++ b/assets/web/icons/web-browser.js @@ -0,0 +1,17 @@ +import { jsx as _jsx } from "react/jsx-runtime"; +function WebBrowserIcon(props) { + return /*#__PURE__*/_jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_jsx("path", { + d: "M4 20c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 18V6c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 4 4h16c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v12c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 20H4Zm0-2h16V8H4v10Z" + }) + }); +} +; +WebBrowserIcon.displayName = "WebBrowserIcon"; +export default WebBrowserIcon; \ No newline at end of file diff --git a/assets/web/icons/web-browser.svg b/assets/web/icons/web-browser.svg deleted file mode 100644 index 0580784d..00000000 --- a/assets/web/icons/web-browser.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - From 378cce8ed07ade472fc938c870843a166c89b530 Mon Sep 17 00:00:00 2001 From: Quentin Gliech Date: Thu, 20 Jun 2024 18:10:38 +0200 Subject: [PATCH 3/6] Generate the cjs components --- assets/web/icons/admin.cjs | 19 ++ assets/web/icons/arrow-down.cjs | 17 ++ assets/web/icons/arrow-left.cjs | 17 ++ assets/web/icons/arrow-right.cjs | 17 ++ assets/web/icons/arrow-up-right.cjs | 17 ++ assets/web/icons/arrow-up.cjs | 17 ++ assets/web/icons/attachment.cjs | 17 ++ assets/web/icons/block.cjs | 17 ++ assets/web/icons/bold.cjs | 17 ++ assets/web/icons/chart.cjs | 17 ++ assets/web/icons/chat-new.cjs | 19 ++ assets/web/icons/chat-problem.cjs | 19 ++ assets/web/icons/chat-solid.cjs | 17 ++ assets/web/icons/chat.cjs | 17 ++ assets/web/icons/check-circle-solid.cjs | 17 ++ assets/web/icons/check-circle.cjs | 17 ++ assets/web/icons/check.cjs | 17 ++ assets/web/icons/chevron-down.cjs | 17 ++ assets/web/icons/chevron-left.cjs | 17 ++ assets/web/icons/chevron-right.cjs | 17 ++ assets/web/icons/chevron-up-down.cjs | 17 ++ assets/web/icons/chevron-up.cjs | 17 ++ assets/web/icons/circle.cjs | 17 ++ assets/web/icons/close.cjs | 17 ++ assets/web/icons/cloud-solid.cjs | 17 ++ assets/web/icons/cloud.cjs | 19 ++ assets/web/icons/code.cjs | 17 ++ assets/web/icons/collapse.cjs | 17 ++ assets/web/icons/company.cjs | 17 ++ assets/web/icons/compose.cjs | 25 +++ assets/web/icons/computer.cjs | 17 ++ assets/web/icons/copy.cjs | 19 ++ assets/web/icons/dark-mode.cjs | 19 ++ assets/web/icons/delete.cjs | 17 ++ assets/web/icons/devices.cjs | 17 ++ assets/web/icons/document.cjs | 17 ++ assets/web/icons/download.cjs | 17 ++ assets/web/icons/drag-grid.cjs | 17 ++ assets/web/icons/drag-list.cjs | 17 ++ assets/web/icons/edit-solid.cjs | 29 +++ assets/web/icons/edit.cjs | 19 ++ assets/web/icons/email-solid.cjs | 17 ++ assets/web/icons/email.cjs | 17 ++ assets/web/icons/end-call.cjs | 17 ++ assets/web/icons/error.cjs | 17 ++ assets/web/icons/expand.cjs | 17 ++ assets/web/icons/export-archive.cjs | 17 ++ assets/web/icons/extensions-solid.cjs | 17 ++ assets/web/icons/extensions.cjs | 17 ++ assets/web/icons/favourite-solid.cjs | 17 ++ assets/web/icons/favourite.cjs | 17 ++ assets/web/icons/file-error.cjs | 19 ++ assets/web/icons/files.cjs | 17 ++ assets/web/icons/filter.cjs | 17 ++ assets/web/icons/forward.cjs | 17 ++ assets/web/icons/grid.cjs | 17 ++ assets/web/icons/help-solid.cjs | 17 ++ assets/web/icons/help.cjs | 19 ++ assets/web/icons/history.cjs | 19 ++ assets/web/icons/home-solid.cjs | 17 ++ assets/web/icons/home.cjs | 19 ++ assets/web/icons/host.cjs | 21 +++ assets/web/icons/image-error.cjs | 19 ++ assets/web/icons/image.cjs | 19 ++ assets/web/icons/indent-decrease.cjs | 17 ++ assets/web/icons/indent-increase.cjs | 17 ++ assets/web/icons/index.cjs | 172 ++++++++++++++++++ assets/web/icons/info-solid.cjs | 17 ++ assets/web/icons/info.cjs | 21 +++ assets/web/icons/inline-code.cjs | 17 ++ assets/web/icons/italic.cjs | 17 ++ assets/web/icons/key-off-solid.cjs | 17 ++ assets/web/icons/key-off.cjs | 19 ++ assets/web/icons/key-solid.cjs | 17 ++ assets/web/icons/key.cjs | 17 ++ assets/web/icons/keyboard.cjs | 21 +++ assets/web/icons/labs.cjs | 23 +++ assets/web/icons/leave.cjs | 19 ++ assets/web/icons/link.cjs | 17 ++ assets/web/icons/list-bulleted.cjs | 17 ++ assets/web/icons/list-numbered.cjs | 17 ++ .../web/icons/location-navigator-centred.cjs | 17 ++ assets/web/icons/location-navigator.cjs | 17 ++ assets/web/icons/location-pin-solid.cjs | 17 ++ assets/web/icons/location-pin.cjs | 17 ++ assets/web/icons/lock-off.cjs | 17 ++ assets/web/icons/lock-solid.cjs | 17 ++ assets/web/icons/lock.cjs | 17 ++ assets/web/icons/mark-as-read.cjs | 17 ++ assets/web/icons/mark-as-unread.cjs | 21 +++ assets/web/icons/marker-read-receipts.cjs | 19 ++ assets/web/icons/mention.cjs | 17 ++ assets/web/icons/menu.cjs | 17 ++ assets/web/icons/mic-off-solid.cjs | 17 ++ assets/web/icons/mic-off.cjs | 21 +++ assets/web/icons/mic-on-solid.cjs | 19 ++ assets/web/icons/mic-on.cjs | 21 +++ assets/web/icons/minus.cjs | 17 ++ assets/web/icons/mobile.cjs | 17 ++ assets/web/icons/notifications-off-solid.cjs | 19 ++ assets/web/icons/notifications-off.cjs | 19 ++ assets/web/icons/notifications-solid.cjs | 17 ++ assets/web/icons/notifications.cjs | 17 ++ assets/web/icons/offline.cjs | 17 ++ assets/web/icons/overflow-horizontal.cjs | 17 ++ assets/web/icons/overflow-vertical.cjs | 17 ++ assets/web/icons/pause-solid.cjs | 17 ++ assets/web/icons/pause.cjs | 17 ++ assets/web/icons/pin-solid.cjs | 17 ++ assets/web/icons/pin.cjs | 19 ++ assets/web/icons/play-solid.cjs | 17 ++ assets/web/icons/play.cjs | 17 ++ assets/web/icons/plus.cjs | 17 ++ assets/web/icons/polls-end.cjs | 19 ++ assets/web/icons/polls.cjs | 17 ++ assets/web/icons/pop-out.cjs | 19 ++ assets/web/icons/preferences.cjs | 19 ++ assets/web/icons/public.cjs | 17 ++ assets/web/icons/qr-code.cjs | 23 +++ assets/web/icons/quote.cjs | 17 ++ assets/web/icons/reaction-add.cjs | 19 ++ assets/web/icons/reaction.cjs | 19 ++ assets/web/icons/reply.cjs | 17 ++ assets/web/icons/restart.cjs | 17 ++ assets/web/icons/search.cjs | 17 ++ assets/web/icons/send-solid.cjs | 17 ++ assets/web/icons/send.cjs | 19 ++ assets/web/icons/settings-solid.cjs | 17 ++ assets/web/icons/settings.cjs | 19 ++ assets/web/icons/share-android.cjs | 17 ++ assets/web/icons/share-ios.cjs | 19 ++ assets/web/icons/share-screen-solid.cjs | 17 ++ assets/web/icons/share-screen.cjs | 19 ++ assets/web/icons/share.cjs | 17 ++ assets/web/icons/sidebar.cjs | 19 ++ assets/web/icons/sign-out.cjs | 17 ++ assets/web/icons/spinner.cjs | 19 ++ assets/web/icons/spotlight.cjs | 17 ++ assets/web/icons/strikethrough.cjs | 17 ++ assets/web/icons/switch-camera-solid.cjs | 19 ++ assets/web/icons/take-photo-solid.cjs | 19 ++ assets/web/icons/take-photo.cjs | 17 ++ assets/web/icons/text-formatting.cjs | 17 ++ assets/web/icons/threads-solid.cjs | 17 ++ assets/web/icons/threads.cjs | 19 ++ assets/web/icons/time.cjs | 21 +++ assets/web/icons/underline.cjs | 17 ++ assets/web/icons/unknown-solid.cjs | 17 ++ assets/web/icons/unknown.cjs | 19 ++ assets/web/icons/user-add-solid.cjs | 17 ++ assets/web/icons/user-add.cjs | 17 ++ assets/web/icons/user-profile-solid.cjs | 19 ++ assets/web/icons/user-profile.cjs | 21 +++ assets/web/icons/user-solid.cjs | 17 ++ assets/web/icons/user.cjs | 17 ++ assets/web/icons/verified.cjs | 17 ++ .../web/icons/video-call-declined-solid.cjs | 17 ++ assets/web/icons/video-call-missed-solid.cjs | 17 ++ assets/web/icons/video-call-off-solid.cjs | 17 ++ assets/web/icons/video-call-off.cjs | 17 ++ assets/web/icons/video-call-solid.cjs | 17 ++ assets/web/icons/video-call.cjs | 17 ++ assets/web/icons/visibility-off.cjs | 17 ++ assets/web/icons/visibility-on.cjs | 17 ++ assets/web/icons/voice-call.cjs | 17 ++ assets/web/icons/volume-off-solid.cjs | 17 ++ assets/web/icons/volume-off.cjs | 17 ++ assets/web/icons/volume-on-solid.cjs | 19 ++ assets/web/icons/volume-on.cjs | 19 ++ assets/web/icons/warning.cjs | 21 +++ assets/web/icons/web-browser.cjs | 17 ++ 171 files changed, 3206 insertions(+) create mode 100644 assets/web/icons/admin.cjs create mode 100644 assets/web/icons/arrow-down.cjs create mode 100644 assets/web/icons/arrow-left.cjs create mode 100644 assets/web/icons/arrow-right.cjs create mode 100644 assets/web/icons/arrow-up-right.cjs create mode 100644 assets/web/icons/arrow-up.cjs create mode 100644 assets/web/icons/attachment.cjs create mode 100644 assets/web/icons/block.cjs create mode 100644 assets/web/icons/bold.cjs create mode 100644 assets/web/icons/chart.cjs create mode 100644 assets/web/icons/chat-new.cjs create mode 100644 assets/web/icons/chat-problem.cjs create mode 100644 assets/web/icons/chat-solid.cjs create mode 100644 assets/web/icons/chat.cjs create mode 100644 assets/web/icons/check-circle-solid.cjs create mode 100644 assets/web/icons/check-circle.cjs create mode 100644 assets/web/icons/check.cjs create mode 100644 assets/web/icons/chevron-down.cjs create mode 100644 assets/web/icons/chevron-left.cjs create mode 100644 assets/web/icons/chevron-right.cjs create mode 100644 assets/web/icons/chevron-up-down.cjs create mode 100644 assets/web/icons/chevron-up.cjs create mode 100644 assets/web/icons/circle.cjs create mode 100644 assets/web/icons/close.cjs create mode 100644 assets/web/icons/cloud-solid.cjs create mode 100644 assets/web/icons/cloud.cjs create mode 100644 assets/web/icons/code.cjs create mode 100644 assets/web/icons/collapse.cjs create mode 100644 assets/web/icons/company.cjs create mode 100644 assets/web/icons/compose.cjs create mode 100644 assets/web/icons/computer.cjs create mode 100644 assets/web/icons/copy.cjs create mode 100644 assets/web/icons/dark-mode.cjs create mode 100644 assets/web/icons/delete.cjs create mode 100644 assets/web/icons/devices.cjs create mode 100644 assets/web/icons/document.cjs create mode 100644 assets/web/icons/download.cjs create mode 100644 assets/web/icons/drag-grid.cjs create mode 100644 assets/web/icons/drag-list.cjs create mode 100644 assets/web/icons/edit-solid.cjs create mode 100644 assets/web/icons/edit.cjs create mode 100644 assets/web/icons/email-solid.cjs create mode 100644 assets/web/icons/email.cjs create mode 100644 assets/web/icons/end-call.cjs create mode 100644 assets/web/icons/error.cjs create mode 100644 assets/web/icons/expand.cjs create mode 100644 assets/web/icons/export-archive.cjs create mode 100644 assets/web/icons/extensions-solid.cjs create mode 100644 assets/web/icons/extensions.cjs create mode 100644 assets/web/icons/favourite-solid.cjs create mode 100644 assets/web/icons/favourite.cjs create mode 100644 assets/web/icons/file-error.cjs create mode 100644 assets/web/icons/files.cjs create mode 100644 assets/web/icons/filter.cjs create mode 100644 assets/web/icons/forward.cjs create mode 100644 assets/web/icons/grid.cjs create mode 100644 assets/web/icons/help-solid.cjs create mode 100644 assets/web/icons/help.cjs create mode 100644 assets/web/icons/history.cjs create mode 100644 assets/web/icons/home-solid.cjs create mode 100644 assets/web/icons/home.cjs create mode 100644 assets/web/icons/host.cjs create mode 100644 assets/web/icons/image-error.cjs create mode 100644 assets/web/icons/image.cjs create mode 100644 assets/web/icons/indent-decrease.cjs create mode 100644 assets/web/icons/indent-increase.cjs create mode 100644 assets/web/icons/index.cjs create mode 100644 assets/web/icons/info-solid.cjs create mode 100644 assets/web/icons/info.cjs create mode 100644 assets/web/icons/inline-code.cjs create mode 100644 assets/web/icons/italic.cjs create mode 100644 assets/web/icons/key-off-solid.cjs create mode 100644 assets/web/icons/key-off.cjs create mode 100644 assets/web/icons/key-solid.cjs create mode 100644 assets/web/icons/key.cjs create mode 100644 assets/web/icons/keyboard.cjs create mode 100644 assets/web/icons/labs.cjs create mode 100644 assets/web/icons/leave.cjs create mode 100644 assets/web/icons/link.cjs create mode 100644 assets/web/icons/list-bulleted.cjs create mode 100644 assets/web/icons/list-numbered.cjs create mode 100644 assets/web/icons/location-navigator-centred.cjs create mode 100644 assets/web/icons/location-navigator.cjs create mode 100644 assets/web/icons/location-pin-solid.cjs create mode 100644 assets/web/icons/location-pin.cjs create mode 100644 assets/web/icons/lock-off.cjs create mode 100644 assets/web/icons/lock-solid.cjs create mode 100644 assets/web/icons/lock.cjs create mode 100644 assets/web/icons/mark-as-read.cjs create mode 100644 assets/web/icons/mark-as-unread.cjs create mode 100644 assets/web/icons/marker-read-receipts.cjs create mode 100644 assets/web/icons/mention.cjs create mode 100644 assets/web/icons/menu.cjs create mode 100644 assets/web/icons/mic-off-solid.cjs create mode 100644 assets/web/icons/mic-off.cjs create mode 100644 assets/web/icons/mic-on-solid.cjs create mode 100644 assets/web/icons/mic-on.cjs create mode 100644 assets/web/icons/minus.cjs create mode 100644 assets/web/icons/mobile.cjs create mode 100644 assets/web/icons/notifications-off-solid.cjs create mode 100644 assets/web/icons/notifications-off.cjs create mode 100644 assets/web/icons/notifications-solid.cjs create mode 100644 assets/web/icons/notifications.cjs create mode 100644 assets/web/icons/offline.cjs create mode 100644 assets/web/icons/overflow-horizontal.cjs create mode 100644 assets/web/icons/overflow-vertical.cjs create mode 100644 assets/web/icons/pause-solid.cjs create mode 100644 assets/web/icons/pause.cjs create mode 100644 assets/web/icons/pin-solid.cjs create mode 100644 assets/web/icons/pin.cjs create mode 100644 assets/web/icons/play-solid.cjs create mode 100644 assets/web/icons/play.cjs create mode 100644 assets/web/icons/plus.cjs create mode 100644 assets/web/icons/polls-end.cjs create mode 100644 assets/web/icons/polls.cjs create mode 100644 assets/web/icons/pop-out.cjs create mode 100644 assets/web/icons/preferences.cjs create mode 100644 assets/web/icons/public.cjs create mode 100644 assets/web/icons/qr-code.cjs create mode 100644 assets/web/icons/quote.cjs create mode 100644 assets/web/icons/reaction-add.cjs create mode 100644 assets/web/icons/reaction.cjs create mode 100644 assets/web/icons/reply.cjs create mode 100644 assets/web/icons/restart.cjs create mode 100644 assets/web/icons/search.cjs create mode 100644 assets/web/icons/send-solid.cjs create mode 100644 assets/web/icons/send.cjs create mode 100644 assets/web/icons/settings-solid.cjs create mode 100644 assets/web/icons/settings.cjs create mode 100644 assets/web/icons/share-android.cjs create mode 100644 assets/web/icons/share-ios.cjs create mode 100644 assets/web/icons/share-screen-solid.cjs create mode 100644 assets/web/icons/share-screen.cjs create mode 100644 assets/web/icons/share.cjs create mode 100644 assets/web/icons/sidebar.cjs create mode 100644 assets/web/icons/sign-out.cjs create mode 100644 assets/web/icons/spinner.cjs create mode 100644 assets/web/icons/spotlight.cjs create mode 100644 assets/web/icons/strikethrough.cjs create mode 100644 assets/web/icons/switch-camera-solid.cjs create mode 100644 assets/web/icons/take-photo-solid.cjs create mode 100644 assets/web/icons/take-photo.cjs create mode 100644 assets/web/icons/text-formatting.cjs create mode 100644 assets/web/icons/threads-solid.cjs create mode 100644 assets/web/icons/threads.cjs create mode 100644 assets/web/icons/time.cjs create mode 100644 assets/web/icons/underline.cjs create mode 100644 assets/web/icons/unknown-solid.cjs create mode 100644 assets/web/icons/unknown.cjs create mode 100644 assets/web/icons/user-add-solid.cjs create mode 100644 assets/web/icons/user-add.cjs create mode 100644 assets/web/icons/user-profile-solid.cjs create mode 100644 assets/web/icons/user-profile.cjs create mode 100644 assets/web/icons/user-solid.cjs create mode 100644 assets/web/icons/user.cjs create mode 100644 assets/web/icons/verified.cjs create mode 100644 assets/web/icons/video-call-declined-solid.cjs create mode 100644 assets/web/icons/video-call-missed-solid.cjs create mode 100644 assets/web/icons/video-call-off-solid.cjs create mode 100644 assets/web/icons/video-call-off.cjs create mode 100644 assets/web/icons/video-call-solid.cjs create mode 100644 assets/web/icons/video-call.cjs create mode 100644 assets/web/icons/visibility-off.cjs create mode 100644 assets/web/icons/visibility-on.cjs create mode 100644 assets/web/icons/voice-call.cjs create mode 100644 assets/web/icons/volume-off-solid.cjs create mode 100644 assets/web/icons/volume-off.cjs create mode 100644 assets/web/icons/volume-on-solid.cjs create mode 100644 assets/web/icons/volume-on.cjs create mode 100644 assets/web/icons/warning.cjs create mode 100644 assets/web/icons/web-browser.cjs diff --git a/assets/web/icons/admin.cjs b/assets/web/icons/admin.cjs new file mode 100644 index 00000000..db877958 --- /dev/null +++ b/assets/web/icons/admin.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function AdminIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "m12 4.236-6 3V12c0 5.156 4.239 7.254 6 7.898 1.761-.644 6-2.742 6-7.898V7.236l-6-3Zm-.894-1.789a2 2 0 0 1 1.788 0l6 3A2 2 0 0 1 20 7.236V12c0 6.742-5.773 9.246-7.51 9.846-.32.111-.66.111-.98 0C9.774 21.246 4 18.742 4 12V7.236a2 2 0 0 1 1.106-1.789l6-3Z", + clipRule: "evenodd" + }) + }); +} +; +AdminIcon.displayName = "AdminIcon"; +module.exports = AdminIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-down.cjs b/assets/web/icons/arrow-down.cjs new file mode 100644 index 00000000..dab3e50a --- /dev/null +++ b/assets/web/icons/arrow-down.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ArrowDownIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 4.5a1 1 0 0 1 1 1v10.586l4.293-4.293a1 1 0 0 1 1.414 1.414l-6 6a1 1 0 0 1-1.414 0l-6-6a1 1 0 1 1 1.414-1.414L11 16.086V5.5a1 1 0 0 1 1-1Z" + }) + }); +} +; +ArrowDownIcon.displayName = "ArrowDownIcon"; +module.exports = ArrowDownIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-left.cjs b/assets/web/icons/arrow-left.cjs new file mode 100644 index 00000000..910f1978 --- /dev/null +++ b/assets/web/icons/arrow-left.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ArrowLeftIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.207 5.293a1 1 0 0 1 0 1.414L7.914 11H18.5a1 1 0 1 1 0 2H7.914l4.293 4.293a1 1 0 0 1-1.414 1.414l-6-6a1 1 0 0 1 0-1.414l6-6a1 1 0 0 1 1.414 0Z" + }) + }); +} +; +ArrowLeftIcon.displayName = "ArrowLeftIcon"; +module.exports = ArrowLeftIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-right.cjs b/assets/web/icons/arrow-right.cjs new file mode 100644 index 00000000..b1404bfe --- /dev/null +++ b/assets/web/icons/arrow-right.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ArrowRightIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11.793 5.293a1 1 0 0 1 1.414 0l6 6a1 1 0 0 1 0 1.414l-6 6a1 1 0 0 1-1.414-1.414L16.086 13H5.5a1 1 0 1 1 0-2h10.586l-4.293-4.293a1 1 0 0 1 0-1.414Z" + }) + }); +} +; +ArrowRightIcon.displayName = "ArrowRightIcon"; +module.exports = ArrowRightIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-up-right.cjs b/assets/web/icons/arrow-up-right.cjs new file mode 100644 index 00000000..249ac734 --- /dev/null +++ b/assets/web/icons/arrow-up-right.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ArrowUpRightIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17.924 6.617a.996.996 0 0 1 .076.38V15a1 1 0 1 1-2 0V9.414l-8.293 8.293a1 1 0 0 1-1.414-1.414L14.586 8H9a1 1 0 0 1 0-2h8a.997.997 0 0 1 .924.617Z" + }) + }); +} +; +ArrowUpRightIcon.displayName = "ArrowUpRightIcon"; +module.exports = ArrowUpRightIcon; \ No newline at end of file diff --git a/assets/web/icons/arrow-up.cjs b/assets/web/icons/arrow-up.cjs new file mode 100644 index 00000000..d6a6587a --- /dev/null +++ b/assets/web/icons/arrow-up.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ArrowUpIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 19.5a1 1 0 0 0 1-1V7.914l4.293 4.293a1 1 0 0 0 1.414-1.414l-6-6a1 1 0 0 0-1.414 0l-6 6a1 1 0 1 0 1.414 1.414L11 7.914V18.5a1 1 0 0 0 1 1Z" + }) + }); +} +; +ArrowUpIcon.displayName = "ArrowUpIcon"; +module.exports = ArrowUpIcon; \ No newline at end of file diff --git a/assets/web/icons/attachment.cjs b/assets/web/icons/attachment.cjs new file mode 100644 index 00000000..1113718e --- /dev/null +++ b/assets/web/icons/attachment.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function AttachmentIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11.5 22c-1.533 0-2.833-.533-3.9-1.6C6.533 19.333 6 18.033 6 16.5V6c0-1.1.392-2.042 1.175-2.825C7.958 2.392 8.9 2 10 2s2.042.392 2.825 1.175C13.608 3.958 14 4.9 14 6v9.5c0 .7-.242 1.292-.725 1.775-.483.483-1.075.725-1.775.725s-1.292-.242-1.775-.725C9.242 16.792 9 16.2 9 15.5V6.75A.728.728 0 0 1 9.75 6a.729.729 0 0 1 .75.75v8.75c0 .283.096.52.287.712.192.192.43.288.713.288s.52-.096.713-.288a.968.968 0 0 0 .287-.712V6c0-.7-.242-1.292-.725-1.775C11.292 3.742 10.7 3.5 10 3.5s-1.292.242-1.775.725C7.742 4.708 7.5 5.3 7.5 6v10.5c0 1.1.392 2.042 1.175 2.825.783.783 1.725 1.175 2.825 1.175s2.042-.392 2.825-1.175c.783-.783 1.175-1.725 1.175-2.825V6.75a.728.728 0 0 1 .75-.75.728.728 0 0 1 .75.75v9.75c0 1.533-.533 2.833-1.6 3.9-1.067 1.067-2.367 1.6-3.9 1.6Z" + }) + }); +} +; +AttachmentIcon.displayName = "AttachmentIcon"; +module.exports = AttachmentIcon; \ No newline at end of file diff --git a/assets/web/icons/block.cjs b/assets/web/icons/block.cjs new file mode 100644 index 00000000..42763192 --- /dev/null +++ b/assets/web/icons/block.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function BlockIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm0-2c2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-.9-.146-1.767-.438-2.6A7.951 7.951 0 0 0 18.3 7.1L7.1 18.3c.7.55 1.467.97 2.3 1.262.833.292 1.7.438 2.6.438Zm-6.3-3.1L16.9 5.7a7.95 7.95 0 0 0-2.3-1.263A7.813 7.813 0 0 0 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 .9.146 1.767.438 2.6A7.95 7.95 0 0 0 5.7 16.9Z" + }) + }); +} +; +BlockIcon.displayName = "BlockIcon"; +module.exports = BlockIcon; \ No newline at end of file diff --git a/assets/web/icons/bold.cjs b/assets/web/icons/bold.cjs new file mode 100644 index 00000000..6018c52c --- /dev/null +++ b/assets/web/icons/bold.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function BoldIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8.8 19c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 6.8 17V7c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 8.8 5h3.525c1.083 0 2.083.333 3 1 .917.667 1.375 1.592 1.375 2.775 0 .85-.192 1.504-.575 1.963-.383.458-.742.787-1.075.987.417.183.88.525 1.387 1.025.509.5.763 1.25.763 2.25 0 1.483-.542 2.52-1.625 3.113-1.083.591-2.1.887-3.05.887H8.8Zm1.025-2.8h2.6c.8 0 1.287-.204 1.462-.612.175-.409.263-.705.263-.888 0-.183-.088-.48-.263-.887-.175-.409-.687-.613-1.537-.613H9.825v3Zm0-5.7h2.325c.55 0 .95-.142 1.2-.425a1.4 1.4 0 0 0 .375-.95c0-.4-.142-.725-.425-.975-.283-.25-.65-.375-1.1-.375H9.825V10.5Z" + }) + }); +} +; +BoldIcon.displayName = "BoldIcon"; +module.exports = BoldIcon; \ No newline at end of file diff --git a/assets/web/icons/chart.cjs b/assets/web/icons/chart.cjs new file mode 100644 index 00000000..0c209bcb --- /dev/null +++ b/assets/web/icons/chart.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChartIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8 17a.97.97 0 0 0 .713-.288A.968.968 0 0 0 9 16v-5a.968.968 0 0 0-.287-.713A.967.967 0 0 0 8 10a.967.967 0 0 0-.713.287A.968.968 0 0 0 7 11v5c0 .283.096.52.287.712.192.192.43.288.713.288Zm4 0a.97.97 0 0 0 .713-.288A.968.968 0 0 0 13 16V8a.967.967 0 0 0-.287-.713A.968.968 0 0 0 12 7a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 8v8c0 .283.096.52.287.712.192.192.43.288.713.288Zm4 0c.283 0 .52-.096.712-.288A.968.968 0 0 0 17 16v-2a.968.968 0 0 0-.288-.713A.968.968 0 0 0 16 13a.968.968 0 0 0-.713.287A.968.968 0 0 0 15 14v2c0 .283.096.52.287.712.192.192.43.288.713.288ZM5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }) + }); +} +; +ChartIcon.displayName = "ChartIcon"; +module.exports = ChartIcon; \ No newline at end of file diff --git a/assets/web/icons/chat-new.cjs b/assets/web/icons/chat-new.cjs new file mode 100644 index 00000000..573e8760 --- /dev/null +++ b/assets/web/icons/chat-new.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChatNewIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M19 6h-2a.968.968 0 0 1-.712-.287A.967.967 0 0 1 16 5a.97.97 0 0 1 .288-.713A.968.968 0 0 1 17 4h2V2c0-.283.096-.52.288-.712A.968.968 0 0 1 20 1c.283 0 .52.096.712.288A.965.965 0 0 1 21 2v2h2a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 23 6h-2v2a.97.97 0 0 1-.288.713A.968.968 0 0 1 20 9a.968.968 0 0 1-.712-.287A.967.967 0 0 1 19 8V6Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M22 17v-6.341A5.99 5.99 0 0 1 20 11v6H6a2 2 0 0 0-1.414.586L4 18.172V5h10c0-.701.12-1.374.341-2H4a2 2 0 0 0-2 2v15.586c0 .89 1.077 1.337 1.707.707L6 19h14a2 2 0 0 0 2-2Z" + })] + }); +} +; +ChatNewIcon.displayName = "ChatNewIcon"; +module.exports = ChatNewIcon; \ No newline at end of file diff --git a/assets/web/icons/chat-problem.cjs b/assets/web/icons/chat-problem.cjs new file mode 100644 index 00000000..365c708d --- /dev/null +++ b/assets/web/icons/chat-problem.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChatProblemIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.712 16.712A.968.968 0 0 1 12 17a.967.967 0 0 1-.713-.288A.968.968 0 0 1 11 16c0-.283.096-.52.287-.713A.967.967 0 0 1 12 15a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.712Zm0-3.999A.968.968 0 0 1 12 13a.967.967 0 0 1-.713-.287A.968.968 0 0 1 11 12V8c0-.283.096-.52.287-.713A.967.967 0 0 1 12 7a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v4a.97.97 0 0 1-.288.713Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2.95 16.3a10.233 10.233 0 0 1-.713-2.1A10.168 10.168 0 0 1 2 12a9.74 9.74 0 0 1 .787-3.9 10.099 10.099 0 0 1 2.138-3.175c.9-.9 1.958-1.612 3.175-2.137A9.737 9.737 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.1 10.1 0 0 1 3.175 2.137c.9.9 1.612 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175 10.1 10.1 0 0 1-3.175 2.137A9.738 9.738 0 0 1 12 22c-.75 0-1.484-.08-2.2-.238a10.23 10.23 0 0 1-2.1-.712L2.75 22.5a.936.936 0 0 1-1-.25.936.936 0 0 1-.25-1l1.45-4.95Zm4.2 2.8a.949.949 0 0 1 .275-.063c.1-.008.191-.012.275-.012.15 0 .296.013.437.038.142.024.28.07.413.137a7.434 7.434 0 0 0 1.675.6c.583.133 1.175.2 1.775.2 2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.234 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 .6.066 1.192.2 1.775.133.583.333 1.142.6 1.675.116.217.179.446.187.688.009.241-.02.479-.087.712l-.95 3.2 3.2-.95Z" + })] + }); +} +; +ChatProblemIcon.displayName = "ChatProblemIcon"; +module.exports = ChatProblemIcon; \ No newline at end of file diff --git a/assets/web/icons/chat-solid.cjs b/assets/web/icons/chat-solid.cjs new file mode 100644 index 00000000..30a5291d --- /dev/null +++ b/assets/web/icons/chat-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChatSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2.95 16.3 1.5 21.25a.936.936 0 0 0 .25 1 .936.936 0 0 0 1 .25l4.95-1.45a10.23 10.23 0 0 0 2.1.712c.717.159 1.45.238 2.2.238a9.738 9.738 0 0 0 3.9-.788 10.098 10.098 0 0 0 3.175-2.137c.9-.9 1.613-1.958 2.137-3.175A9.738 9.738 0 0 0 22 12a9.738 9.738 0 0 0-.788-3.9 10.099 10.099 0 0 0-2.137-3.175c-.9-.9-1.958-1.612-3.175-2.137A9.738 9.738 0 0 0 12 2a9.738 9.738 0 0 0-3.9.788 10.099 10.099 0 0 0-3.175 2.137c-.9.9-1.612 1.958-2.137 3.175A9.738 9.738 0 0 0 2 12a10.179 10.179 0 0 0 .95 4.3Z" + }) + }); +} +; +ChatSolidIcon.displayName = "ChatSolidIcon"; +module.exports = ChatSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/chat.cjs b/assets/web/icons/chat.cjs new file mode 100644 index 00000000..9e258e48 --- /dev/null +++ b/assets/web/icons/chat.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChatIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m1.5 21.25 1.45-4.95a10.232 10.232 0 0 1-.712-2.1A10.167 10.167 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.737 9.737 0 0 1 12 22c-.75 0-1.483-.08-2.2-.238a10.23 10.23 0 0 1-2.1-.712L2.75 22.5a.936.936 0 0 1-1-.25.936.936 0 0 1-.25-1Zm2.45-1.2 3.2-.95a.949.949 0 0 1 .275-.063c.1-.008.192-.012.275-.012.15 0 .296.013.438.038.141.024.279.07.412.137a7.434 7.434 0 0 0 1.675.6c.583.133 1.175.2 1.775.2 2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 .6.067 1.192.2 1.775s.333 1.142.6 1.675c.117.217.18.446.188.688a2.29 2.29 0 0 1-.088.712l-.95 3.2Z" + }) + }); +} +; +ChatIcon.displayName = "ChatIcon"; +module.exports = ChatIcon; \ No newline at end of file diff --git a/assets/web/icons/check-circle-solid.cjs b/assets/web/icons/check-circle-solid.cjs new file mode 100644 index 00000000..54102a2b --- /dev/null +++ b/assets/web/icons/check-circle-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CheckCircleSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m10.6 13.8-2.15-2.15a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7L9.9 15.9c.2.2.433.3.7.3.267 0 .5-.1.7-.3l5.65-5.65a.948.948 0 0 0 .275-.7.948.948 0 0 0-.275-.7.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275L10.6 13.8ZM12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Z" + }) + }); +} +; +CheckCircleSolidIcon.displayName = "CheckCircleSolidIcon"; +module.exports = CheckCircleSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/check-circle.cjs b/assets/web/icons/check-circle.cjs new file mode 100644 index 00000000..ac2e8a2f --- /dev/null +++ b/assets/web/icons/check-circle.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CheckCircleIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m10.6 13.8-2.15-2.15a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7L9.9 15.9c.2.2.433.3.7.3.267 0 .5-.1.7-.3l5.65-5.65a.948.948 0 0 0 .275-.7.948.948 0 0 0-.275-.7.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275L10.6 13.8ZM12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm0-2c2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 2.233.775 4.125 2.325 5.675C7.875 19.225 9.767 20 12 20Z" + }) + }); +} +; +CheckCircleIcon.displayName = "CheckCircleIcon"; +module.exports = CheckCircleIcon; \ No newline at end of file diff --git a/assets/web/icons/check.cjs b/assets/web/icons/check.cjs new file mode 100644 index 00000000..a751d10f --- /dev/null +++ b/assets/web/icons/check.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CheckIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9.55 17.575c-.133 0-.258-.02-.375-.063a.878.878 0 0 1-.325-.212L4.55 13c-.183-.183-.27-.42-.263-.713.009-.291.105-.529.288-.712a.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275L9.55 15.15l8.475-8.475c.183-.183.42-.275.712-.275s.53.092.713.275c.183.183.275.42.275.712s-.092.53-.275.713l-9.2 9.2c-.1.1-.208.17-.325.212a1.106 1.106 0 0 1-.375.063Z" + }) + }); +} +; +CheckIcon.displayName = "CheckIcon"; +module.exports = CheckIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-down.cjs b/assets/web/icons/chevron-down.cjs new file mode 100644 index 00000000..5d509bb0 --- /dev/null +++ b/assets/web/icons/chevron-down.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChevronDownIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 14.95c-.133 0-.258-.02-.375-.063a.878.878 0 0 1-.325-.212l-4.6-4.6a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275l3.9 3.9 3.9-3.9a.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7l-4.6 4.6c-.1.1-.208.17-.325.212a1.105 1.105 0 0 1-.375.063Z" + }) + }); +} +; +ChevronDownIcon.displayName = "ChevronDownIcon"; +module.exports = ChevronDownIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-left.cjs b/assets/web/icons/chevron-left.cjs new file mode 100644 index 00000000..d0045fb6 --- /dev/null +++ b/assets/web/icons/chevron-left.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChevronLeftIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m13.3 17.3-4.6-4.6a.877.877 0 0 1-.212-.325A1.107 1.107 0 0 1 8.425 12c0-.133.02-.258.063-.375A.877.877 0 0 1 8.7 11.3l4.6-4.6a.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7L10.8 12l3.9 3.9a.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7.948.948 0 0 1-.7.275.949.949 0 0 1-.7-.275Z" + }) + }); +} +; +ChevronLeftIcon.displayName = "ChevronLeftIcon"; +module.exports = ChevronLeftIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-right.cjs b/assets/web/icons/chevron-right.cjs new file mode 100644 index 00000000..1ec09f15 --- /dev/null +++ b/assets/web/icons/chevron-right.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChevronRightIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8.7 17.3a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7l3.9-3.9-3.9-3.9a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7.948.948 0 0 1 .7-.275.95.95 0 0 1 .7.275l4.6 4.6c.1.1.17.208.213.325.041.117.062.242.062.375s-.02.258-.063.375a.876.876 0 0 1-.212.325l-4.6 4.6a.948.948 0 0 1-.7.275.948.948 0 0 1-.7-.275Z" + }) + }); +} +; +ChevronRightIcon.displayName = "ChevronRightIcon"; +module.exports = ChevronRightIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-up-down.cjs b/assets/web/icons/chevron-up-down.cjs new file mode 100644 index 00000000..e5092dcc --- /dev/null +++ b/assets/web/icons/chevron-up-down.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChevronUpDownIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8.225 8.325C8.042 8.142 7.95 7.9 7.95 7.6s.092-.542.275-.725L11.3 3.8c.1-.1.208-.17.325-.213a1.218 1.218 0 0 1 .762 0 .68.68 0 0 1 .313.213l3.1 3.1c.183.183.27.42.262.712-.008.292-.104.53-.287.713-.183.183-.425.275-.725.275s-.542-.092-.725-.275L12 6 9.65 8.35c-.183.183-.42.27-.713.262a1.007 1.007 0 0 1-.712-.287ZM12 20.575a.941.941 0 0 1-.375-.075 1.315 1.315 0 0 1-.325-.2l-3.075-3.075c-.183-.183-.275-.425-.275-.725s.092-.542.275-.725c.183-.183.425-.275.725-.275s.542.092.725.275L12 18.1l2.35-2.35c.183-.183.42-.27.713-.262.291.008.529.104.712.287.183.183.275.425.275.725s-.092.542-.275.725L12.7 20.3a1.034 1.034 0 0 1-.7.275Z" + }) + }); +} +; +ChevronUpDownIcon.displayName = "ChevronUpDownIcon"; +module.exports = ChevronUpDownIcon; \ No newline at end of file diff --git a/assets/web/icons/chevron-up.cjs b/assets/web/icons/chevron-up.cjs new file mode 100644 index 00000000..12c60c4b --- /dev/null +++ b/assets/web/icons/chevron-up.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ChevronUpIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m12 10.775-3.9 3.9a.948.948 0 0 1-.7.275.948.948 0 0 1-.7-.275.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7l4.6-4.6c.1-.1.208-.17.325-.213.117-.041.242-.062.375-.062s.258.02.375.062a.878.878 0 0 1 .325.213l4.6 4.6a.948.948 0 0 1 .275.7.949.949 0 0 1-.275.7.949.949 0 0 1-.7.275.948.948 0 0 1-.7-.275l-3.9-3.9Z" + }) + }); +} +; +ChevronUpIcon.displayName = "ChevronUpIcon"; +module.exports = ChevronUpIcon; \ No newline at end of file diff --git a/assets/web/icons/circle.cjs b/assets/web/icons/circle.cjs new file mode 100644 index 00000000..40da9cc6 --- /dev/null +++ b/assets/web/icons/circle.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CircleIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137A10.1 10.1 0 0 1 2.788 15.9 9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.613 3.175-2.138A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.787 10.098 10.098 0 0 1 3.175 2.138c.9.9 1.613 1.958 2.137 3.175A9.737 9.737 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.1 10.1 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm0-2c2.233 0 4.125-.775 5.675-2.325C19.225 16.125 20 14.233 20 12c0-2.233-.775-4.125-2.325-5.675C16.125 4.775 14.233 4 12 4c-2.233 0-4.125.775-5.675 2.325C4.775 7.875 4 9.767 4 12c0 2.233.775 4.125 2.325 5.675C7.875 19.225 9.767 20 12 20Z" + }) + }); +} +; +CircleIcon.displayName = "CircleIcon"; +module.exports = CircleIcon; \ No newline at end of file diff --git a/assets/web/icons/close.cjs b/assets/web/icons/close.cjs new file mode 100644 index 00000000..4d462c85 --- /dev/null +++ b/assets/web/icons/close.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CloseIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6.293 6.293a1 1 0 0 1 1.414 0L12 10.586l4.293-4.293a1 1 0 1 1 1.414 1.414L13.414 12l4.293 4.293a1 1 0 0 1-1.414 1.414L12 13.414l-4.293 4.293a1 1 0 0 1-1.414-1.414L10.586 12 6.293 7.707a1 1 0 0 1 0-1.414Z" + }) + }); +} +; +CloseIcon.displayName = "CloseIcon"; +module.exports = CloseIcon; \ No newline at end of file diff --git a/assets/web/icons/cloud-solid.cjs b/assets/web/icons/cloud-solid.cjs new file mode 100644 index 00000000..7c035e94 --- /dev/null +++ b/assets/web/icons/cloud-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CloudSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M7 20a5 5 0 0 1-.985-9.903 5.5 5.5 0 0 1 9.734-3.09 4 4 0 0 1 4.187 4.708A4.5 4.5 0 0 1 18 19.973V20H7Z" + }) + }); +} +; +CloudSolidIcon.displayName = "CloudSolidIcon"; +module.exports = CloudSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/cloud.cjs b/assets/web/icons/cloud.cjs new file mode 100644 index 00000000..637959fc --- /dev/null +++ b/assets/web/icons/cloud.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CloudIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "m7.9 11.76-1.493.298A3.002 3.002 0 0 0 7 18h10.641l.14-.015a2.5 2.5 0 0 0 1.071-4.588l-1.121-.724.237-1.313a2 2 0 0 0-2.095-2.356l-1.02.063-.648-.789a3.5 3.5 0 0 0-6.195 1.963L7.9 11.76ZM18 19.973V20H7a5 5 0 0 1-.985-9.903 5.5 5.5 0 0 1 9.734-3.09 4 4 0 0 1 4.187 4.708A4.5 4.5 0 0 1 18 19.973Z", + clipRule: "evenodd" + }) + }); +} +; +CloudIcon.displayName = "CloudIcon"; +module.exports = CloudIcon; \ No newline at end of file diff --git a/assets/web/icons/code.cjs b/assets/web/icons/code.cjs new file mode 100644 index 00000000..9163aefb --- /dev/null +++ b/assets/web/icons/code.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CodeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m8.825 12 1.475-1.475c.2-.2.3-.433.3-.7 0-.267-.1-.5-.3-.7-.2-.2-.438-.3-.713-.3-.274 0-.512.1-.712.3L6.7 11.3c-.1.1-.17.208-.213.325a1.107 1.107 0 0 0-.062.375c0 .133.02.258.063.375a.877.877 0 0 0 .212.325l2.175 2.175c.2.2.438.3.713.3.275 0 .512-.1.712-.3.2-.2.3-.433.3-.7 0-.267-.1-.5-.3-.7L8.825 12Zm6.35 0L13.7 13.475c-.2.2-.3.433-.3.7 0 .267.1.5.3.7.2.2.438.3.713.3.274 0 .512-.1.712-.3L17.3 12.7c.1-.1.17-.208.212-.325.042-.117.063-.242.063-.375s-.02-.258-.063-.375a.877.877 0 0 0-.212-.325l-2.175-2.175a.999.999 0 0 0-1.425 0c-.2.2-.3.433-.3.7 0 .267.1.5.3.7L15.175 12ZM5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }) + }); +} +; +CodeIcon.displayName = "CodeIcon"; +module.exports = CodeIcon; \ No newline at end of file diff --git a/assets/web/icons/collapse.cjs b/assets/web/icons/collapse.cjs new file mode 100644 index 00000000..aeea607a --- /dev/null +++ b/assets/web/icons/collapse.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CollapseIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 11.034a.996.996 0 0 0 .29.702l.005.005c.18.18.43.29.705.29h8a1 1 0 0 0 0-2h-5.586L22 3.445a1 1 0 0 0-1.414-1.414L14 8.617V3.031a1 1 0 1 0-2 0v8.003Zm0 1.963a.997.997 0 0 0-.29-.702l-.005-.004A.997.997 0 0 0 11 12H3a1 1 0 1 0 0 2h5.586L2 20.586A1 1 0 1 0 3.414 22L10 15.414V21a1 1 0 0 0 2 0v-8.003Z" + }) + }); +} +; +CollapseIcon.displayName = "CollapseIcon"; +module.exports = CollapseIcon; \ No newline at end of file diff --git a/assets/web/icons/company.cjs b/assets/web/icons/company.cjs new file mode 100644 index 00000000..aea7edea --- /dev/null +++ b/assets/web/icons/company.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CompanyIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14 7h5a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h7a2 2 0 0 1 2 2v2Zm-2-2H5v2h3a1 1 0 0 1 0 2H5v2h3a1 1 0 1 1 0 2H5v2h3a1 1 0 1 1 0 2H5v2h7V5Zm2 4v2h2a1 1 0 1 1 0 2h-2v2h2a1 1 0 1 1 0 2h-2v2h5V9h-5Z" + }) + }); +} +; +CompanyIcon.displayName = "CompanyIcon"; +module.exports = CompanyIcon; \ No newline at end of file diff --git a/assets/web/icons/compose.cjs b/assets/web/icons/compose.cjs new file mode 100644 index 00000000..60ff4e9a --- /dev/null +++ b/assets/web/icons/compose.cjs @@ -0,0 +1,25 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ComposeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M3 5a2 2 0 0 1 2-2h6a1 1 0 1 1 0 2H5v14h14v-6a1 1 0 1 1 2 0v6a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5Z", + clipRule: "evenodd" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m8.023 14.711 1.331-3.992a1 1 0 0 1 1.656-.391l2.662 2.662a1 1 0 0 1-.391 1.655l-3.993 1.331a1 1 0 0 1-1.265-1.265Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M19.765 2.82a2 2 0 0 0-2.828 0L9.866 9.89c-.195.195-.341.42-.439.66a1.024 1.024 0 0 0-.073.168l-1.33 3.992a1 1 0 0 0 1.264 1.265l3.993-1.33c.059-.02.115-.045.167-.074.24-.097.466-.243.66-.438l7.072-7.071a2 2 0 0 0 0-2.829L19.765 2.82Zm-6.717 9.546 6.717-6.718-1.414-1.414-6.717 6.718 1.414 1.414Z", + clipRule: "evenodd" + })] + }); +} +; +ComposeIcon.displayName = "ComposeIcon"; +module.exports = ComposeIcon; \ No newline at end of file diff --git a/assets/web/icons/computer.cjs b/assets/web/icons/computer.cjs new file mode 100644 index 00000000..925c851a --- /dev/null +++ b/assets/web/icons/computer.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ComputerIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 18c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 16V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 4 3h16c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v11c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 18H4Zm0-2h16V5H4v11Zm-2 5a.967.967 0 0 1-.712-.288A.968.968 0 0 1 1 20c0-.283.096-.52.288-.712A.967.967 0 0 1 2 19h20c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 22 21H2Z" + }) + }); +} +; +ComputerIcon.displayName = "ComputerIcon"; +module.exports = ComputerIcon; \ No newline at end of file diff --git a/assets/web/icons/copy.cjs b/assets/web/icons/copy.cjs new file mode 100644 index 00000000..7aa344d4 --- /dev/null +++ b/assets/web/icons/copy.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function CopyIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14 5H5v9h1a1 1 0 1 1 0 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h9a2 2 0 0 1 2 2v1a1 1 0 1 1-2 0V5Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8 10a2 2 0 0 1 2-2h9a2 2 0 0 1 2 2v9a2 2 0 0 1-2 2h-9a2 2 0 0 1-2-2v-9Zm2 0v9h9v-9h-9Z" + })] + }); +} +; +CopyIcon.displayName = "CopyIcon"; +module.exports = CopyIcon; \ No newline at end of file diff --git a/assets/web/icons/dark-mode.cjs b/assets/web/icons/dark-mode.cjs new file mode 100644 index 00000000..bd89eea0 --- /dev/null +++ b/assets/web/icons/dark-mode.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DarkModeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M17.983 17.31C13.332 15.66 10 11.22 10 6c0-.604.045-1.199.132-1.78a8 8 0 1 0 7.852 13.091Zm1.82-1.552c.668.15 1.094.863.737 1.447A9.994 9.994 0 0 1 12 22C6.477 22 2 17.523 2 12S6.477 2 12 2c.402 0 .653.416.524.797A9.988 9.988 0 0 0 12 6c0 4.768 3.337 8.757 7.803 9.758Z", + clipRule: "evenodd" + }) + }); +} +; +DarkModeIcon.displayName = "DarkModeIcon"; +module.exports = DarkModeIcon; \ No newline at end of file diff --git a/assets/web/icons/delete.cjs b/assets/web/icons/delete.cjs new file mode 100644 index 00000000..8dd0ccb2 --- /dev/null +++ b/assets/web/icons/delete.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DeleteIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M7 21c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 5 19V6a.968.968 0 0 1-.713-.287A.968.968 0 0 1 4 5c0-.283.096-.52.287-.713A.968.968 0 0 1 5 4h4a.97.97 0 0 1 .287-.712A.968.968 0 0 1 10 3h4a.97.97 0 0 1 .713.288A.968.968 0 0 1 15 4h4a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 19 6v13c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 17 21H7ZM7 6v13h10V6H7Zm2 10c0 .283.096.52.287.712.192.192.43.288.713.288s.52-.096.713-.288A.968.968 0 0 0 11 16V9a.967.967 0 0 0-.287-.713A.968.968 0 0 0 10 8a.968.968 0 0 0-.713.287A.968.968 0 0 0 9 9v7Zm4 0c0 .283.096.52.287.712.192.192.43.288.713.288s.52-.096.713-.288A.968.968 0 0 0 15 16V9a.967.967 0 0 0-.287-.713A.968.968 0 0 0 14 8a.968.968 0 0 0-.713.287A.967.967 0 0 0 13 9v7Z" + }) + }); +} +; +DeleteIcon.displayName = "DeleteIcon"; +module.exports = DeleteIcon; \ No newline at end of file diff --git a/assets/web/icons/devices.cjs b/assets/web/icons/devices.cjs new file mode 100644 index 00000000..441b90e0 --- /dev/null +++ b/assets/web/icons/devices.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DevicesIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3.5 20c-.417 0-.77-.146-1.063-.438A1.447 1.447 0 0 1 2 18.5c0-.417.146-.77.438-1.063A1.446 1.446 0 0 1 3.5 17H4V6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 4h14a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 6H6v11h4.5c.417 0 .77.146 1.063.438.291.291.437.645.437 1.062 0 .417-.146.77-.438 1.063A1.446 1.446 0 0 1 10.5 20h-7ZM15 20a.968.968 0 0 1-.713-.288A.968.968 0 0 1 14 19V9c0-.283.096-.52.287-.713A.968.968 0 0 1 15 8h6a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v10c0 .283-.096.52-.288.712A.968.968 0 0 1 21 20h-6Zm1-3h4v-7h-4v7Z" + }) + }); +} +; +DevicesIcon.displayName = "DevicesIcon"; +module.exports = DevicesIcon; \ No newline at end of file diff --git a/assets/web/icons/document.cjs b/assets/web/icons/document.cjs new file mode 100644 index 00000000..75a56cd6 --- /dev/null +++ b/assets/web/icons/document.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DocumentIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9 18h6a.97.97 0 0 0 .713-.288A.968.968 0 0 0 16 17a.968.968 0 0 0-.287-.712A.968.968 0 0 0 15 16H9a.967.967 0 0 0-.713.288A.968.968 0 0 0 8 17c0 .283.096.52.287.712.192.192.43.288.713.288Zm0-4h6c.283 0 .52-.096.713-.287A.968.968 0 0 0 16 13a.968.968 0 0 0-.287-.713A.968.968 0 0 0 15 12H9a.967.967 0 0 0-.713.287A.968.968 0 0 0 8 13c0 .283.096.52.287.713.192.191.43.287.713.287Zm-3 8c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V4c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 6 2h7.175a1.975 1.975 0 0 1 1.4.575l4.85 4.85a1.975 1.975 0 0 1 .575 1.4V20c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6Zm7-14V4H6v16h12V9h-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 13 8Z" + }) + }); +} +; +DocumentIcon.displayName = "DocumentIcon"; +module.exports = DocumentIcon; \ No newline at end of file diff --git a/assets/web/icons/download.cjs b/assets/web/icons/download.cjs new file mode 100644 index 00000000..134d4a81 --- /dev/null +++ b/assets/web/icons/download.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DownloadIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 15.575c-.133 0-.258-.02-.375-.063a.877.877 0 0 1-.325-.212l-3.6-3.6a.948.948 0 0 1-.275-.7.95.95 0 0 1 .275-.7c.183-.183.42-.28.712-.288.292-.008.53.08.713.263L11 12.15V5c0-.283.096-.52.287-.713A.968.968 0 0 1 12 4c.283 0 .52.096.713.287.191.192.287.43.287.713v7.15l1.875-1.875c.183-.183.42-.27.713-.263.291.009.529.105.712.288a.948.948 0 0 1 .275.7.948.948 0 0 1-.275.7l-3.6 3.6c-.1.1-.208.17-.325.212a1.106 1.106 0 0 1-.375.063ZM6 20c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18v-2c0-.283.096-.52.287-.713A.967.967 0 0 1 5 15c.283 0 .52.096.713.287.191.192.287.43.287.713v2h12v-2a.97.97 0 0 1 .288-.713A.968.968 0 0 1 19 15a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v2c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6Z" + }) + }); +} +; +DownloadIcon.displayName = "DownloadIcon"; +module.exports = DownloadIcon; \ No newline at end of file diff --git a/assets/web/icons/drag-grid.cjs b/assets/web/icons/drag-grid.cjs new file mode 100644 index 00000000..343e1f7b --- /dev/null +++ b/assets/web/icons/drag-grid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DragGridIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9 20c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 7 18c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 9 16c.55 0 1.02.196 1.412.587.392.392.588.863.588 1.413s-.196 1.02-.588 1.413A1.926 1.926 0 0 1 9 20Zm6 0c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 13 18c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 15 16c.55 0 1.02.196 1.413.587.391.392.587.863.587 1.413s-.196 1.02-.587 1.413A1.926 1.926 0 0 1 15 20Zm-6-6c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 7 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 9 14Zm6 0c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 13 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 15 10c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412 0 .55-.196 1.02-.587 1.412A1.926 1.926 0 0 1 15 14ZM9 8c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 7 6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 4c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 9 8Zm6 0c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 13 6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 15 4c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412 0 .55-.196 1.02-.587 1.412A1.926 1.926 0 0 1 15 8Z" + }) + }); +} +; +DragGridIcon.displayName = "DragGridIcon"; +module.exports = DragGridIcon; \ No newline at end of file diff --git a/assets/web/icons/drag-list.cjs b/assets/web/icons/drag-list.cjs new file mode 100644 index 00000000..e3884668 --- /dev/null +++ b/assets/web/icons/drag-list.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function DragListIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 15a.967.967 0 0 1-.713-.287A.968.968 0 0 1 4 14c0-.283.096-.52.287-.713A.967.967 0 0 1 5 13h14a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 19 15H5Zm0-4a.967.967 0 0 1-.713-.287A.968.968 0 0 1 4 10c0-.283.096-.52.287-.713A.968.968 0 0 1 5 9h14a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 19 11H5Z" + }) + }); +} +; +DragListIcon.displayName = "DragListIcon"; +module.exports = DragListIcon; \ No newline at end of file diff --git a/assets/web/icons/edit-solid.cjs b/assets/web/icons/edit-solid.cjs new file mode 100644 index 00000000..5724ecd5 --- /dev/null +++ b/assets/web/icons/edit-solid.cjs @@ -0,0 +1,29 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function EditSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("mask", { + id: "a", + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "m4.393 13.95-.02.02-.42.42a1 1 0 0 0-.264.465l-1.414 5.657a1 1 0 0 0 1.213 1.213l5.657-1.414a1 1 0 0 0 .464-.263L21.363 8.294a2 2 0 0 0 0-2.829l-2.828-2.828a2 2 0 0 0-2.829 0L4.393 13.95ZM17.12 4.052l-2.972 2.972 2.829 2.829 2.972-2.972L17.12 4.05Z", + clipRule: "evenodd" + }) + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "m4.393 13.95-.02.02-.42.42a1 1 0 0 0-.264.465l-1.414 5.657a1 1 0 0 0 1.213 1.213l5.657-1.414a1 1 0 0 0 .464-.263L21.363 8.294a2 2 0 0 0 0-2.829l-2.828-2.828a2 2 0 0 0-2.829 0L4.393 13.95ZM17.12 4.052l-2.972 2.972 2.829 2.829 2.972-2.972L17.12 4.05Z", + clipRule: "evenodd" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m4.373 13.97 1.414 1.414.01-.01-1.424-1.404Zm.02-.02-1.415-1.414-.01.01 1.425 1.405Zm-.44.44 1.414 1.415-1.414-1.414Zm-.264.465 1.94.485-1.94-.485Zm-1.414 5.657-1.94-.485 1.94.485Zm1.213 1.213-.485-1.94.485 1.94Zm5.657-1.414.485 1.94-.485-1.94Zm.464-.263 1.415 1.414-1.415-1.414ZM21.363 8.294 19.95 6.88l1.414 1.414Zm0-2.829 1.414-1.414-1.414 1.414Zm-2.828-2.828L17.12 4.05l1.415-1.414Zm-2.829 0-1.414-1.414 1.414 1.414Zm-1.558 4.386L12.734 5.61 11.32 7.023l1.414 1.414 1.414-1.414Zm2.973-2.972 1.414-1.414-1.415-1.414-1.414 1.414 1.415 1.414Zm-.144 5.8-1.415 1.415 1.415 1.414 1.414-1.414-1.414-1.414Zm2.972-2.971 1.414 1.414 1.414-1.414-1.414-1.415L19.95 6.88ZM5.797 15.375l.02-.02-2.848-2.81-.02.02 2.848 2.81Zm-.43.43.42-.42-2.828-2.83-.42.422 2.828 2.828Zm.263-.465a1 1 0 0 1-.263.465l-2.829-2.829a3 3 0 0 0-.789 1.394l3.88.97Zm-1.414 5.657L5.63 15.34l-3.88-.97-1.415 5.657 3.88.97Zm-1.213-1.212a1 1 0 0 1 1.213 1.212l-3.88-.97c-.55 2.197 1.44 4.187 3.637 3.638l-.97-3.88ZM8.66 18.37l-5.657 1.415.97 3.88 5.657-1.414-.97-3.88Zm-.465.263a1 1 0 0 1 .465-.263l.97 3.881a3 3 0 0 0 1.394-.79l-2.829-2.828ZM19.95 6.88l2.828 2.828a4 4 0 0 0 0-5.657L19.95 6.88Zm-2.83-2.83 2.83 2.83 2.828-2.829-2.828-2.828-2.83 2.827Zm0 0 2.829-2.828a4 4 0 0 0-5.657 0L17.12 4.05ZM5.807 15.365 17.12 4.05l-2.828-2.828L2.978 12.536l2.829 2.829Zm9.755-6.928 2.973-2.972-2.829-2.828-2.972 2.972 2.829 2.828Zm2.829 0L15.563 5.61l-2.829 2.828 2.829 2.829 2.828-2.829Zm.144-2.972-2.973 2.972 2.829 2.829 2.972-2.972-2.828-2.829Zm-2.829 0 2.829 2.829 2.828-2.829-2.828-2.828-2.829 2.828ZM19.95 6.88 8.195 18.634l2.829 2.828L22.777 9.708 19.95 6.88Z", + mask: "url(#a)" + })] + }); +} +; +EditSolidIcon.displayName = "EditSolidIcon"; +module.exports = EditSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/edit.cjs b/assets/web/icons/edit.cjs new file mode 100644 index 00000000..d01f3cf7 --- /dev/null +++ b/assets/web/icons/edit.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function EditIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M15.706 2.637a2 2 0 0 1 2.829 0l2.828 2.828a2 2 0 0 1 0 2.829L9.605 20.052a1 1 0 0 1-.465.263L3.483 21.73a1 1 0 0 1-1.212-1.213l1.414-5.657a1 1 0 0 1 .263-.465L15.706 2.637Zm1.224 7.262L14.1 7.07l-8.543 8.544-.943 3.771 3.771-.943L16.93 9.9Z", + clipRule: "evenodd" + }) + }); +} +; +EditIcon.displayName = "EditIcon"; +module.exports = EditIcon; \ No newline at end of file diff --git a/assets/web/icons/email-solid.cjs b/assets/web/icons/email-solid.cjs new file mode 100644 index 00000000..42f2c2f3 --- /dev/null +++ b/assets/web/icons/email-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function EmailSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 4h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2Zm0 5.111a1 1 0 0 0 .514.874l7 3.89a1 1 0 0 0 .972 0l7-3.89a1 1 0 1 0-.972-1.748L12 11.856 5.486 8.237A1 1 0 0 0 4 9.111Z" + }) + }); +} +; +EmailSolidIcon.displayName = "EmailSolidIcon"; +module.exports = EmailSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/email.cjs b/assets/web/icons/email.cjs new file mode 100644 index 00000000..0d5a431b --- /dev/null +++ b/assets/web/icons/email.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function EmailIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2 6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V6Zm2 0v1.412l8 4.444 8-4.444V6H4Zm0 3.7V18h16V9.7l-7.514 4.174a1 1 0 0 1-.972 0L4 9.7Z" + }) + }); +} +; +EmailIcon.displayName = "EmailIcon"; +module.exports = EmailIcon; \ No newline at end of file diff --git a/assets/web/icons/end-call.cjs b/assets/web/icons/end-call.cjs new file mode 100644 index 00000000..77f20094 --- /dev/null +++ b/assets/web/icons/end-call.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function EndCallIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m2.765 16.02-2.47-2.416A1.018 1.018 0 0 1 0 12.852c0-.304.098-.555.295-.751a15.64 15.64 0 0 1 5.316-3.786A15.89 15.89 0 0 1 12 7c2.237 0 4.367.443 6.39 1.329a15.977 15.977 0 0 1 5.315 3.772c.197.196.295.447.295.751 0 .305-.098.555-.295.752l-2.47 2.416a1.047 1.047 0 0 1-1.396.108l-3.114-2.363a1.067 1.067 0 0 1-.322-.376 1.066 1.066 0 0 1-.108-.483v-2.27a13.593 13.593 0 0 0-2.12-.524C13.459 9.996 12 9.937 12 9.937s-1.459.059-2.175.175c-.715.116-1.422.29-2.12.523v2.271c0 .179-.036.34-.108.483a1.066 1.066 0 0 1-.322.376l-3.114 2.363a1.047 1.047 0 0 1-1.396-.107Z" + }) + }); +} +; +EndCallIcon.displayName = "EndCallIcon"; +module.exports = EndCallIcon; \ No newline at end of file diff --git a/assets/web/icons/error.cjs b/assets/web/icons/error.cjs new file mode 100644 index 00000000..2c1b99d1 --- /dev/null +++ b/assets/web/icons/error.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ErrorIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 17a.97.97 0 0 0 .713-.288A.968.968 0 0 0 13 16a.968.968 0 0 0-.287-.713A.968.968 0 0 0 12 15a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 16c0 .283.096.52.287.712.192.192.43.288.713.288Zm0-4c.283 0 .52-.096.713-.287A.968.968 0 0 0 13 12V8a.967.967 0 0 0-.287-.713A.968.968 0 0 0 12 7a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 8v4c0 .283.096.52.287.713.192.191.43.287.713.287Zm0 9a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Z" + }) + }); +} +; +ErrorIcon.displayName = "ErrorIcon"; +module.exports = ErrorIcon; \ No newline at end of file diff --git a/assets/web/icons/expand.cjs b/assets/web/icons/expand.cjs new file mode 100644 index 00000000..e3d0570e --- /dev/null +++ b/assets/web/icons/expand.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ExpandIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M21 3.997a.996.996 0 0 0-.29-.702l-.005-.004A.997.997 0 0 0 20 3h-8a1 1 0 1 0 0 2h5.586L5 17.586V12a1 1 0 1 0-2 0v8.003a.997.997 0 0 0 .29.702l.005.004c.18.18.43.291.705.291h8a1 1 0 1 0 0-2H6.414L19 6.414V12a1 1 0 1 0 2 0V3.997Z" + }) + }); +} +; +ExpandIcon.displayName = "ExpandIcon"; +module.exports = ExpandIcon; \ No newline at end of file diff --git a/assets/web/icons/export-archive.cjs b/assets/web/icons/export-archive.cjs new file mode 100644 index 00000000..d176e18e --- /dev/null +++ b/assets/web/icons/export-archive.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ExportArchiveIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V6.5c0-.25.042-.475.125-.675.083-.2.192-.392.325-.575l1.4-1.7c.133-.183.3-.32.5-.412C5.55 3.046 5.767 3 6 3h12c.233 0 .45.046.65.138.2.091.367.229.5.412l1.4 1.7c.133.183.242.375.325.575.083.2.125.425.125.675V19c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm.4-15h13.2l-.85-1H6.25L5.4 6ZM5 19h14V8H5v11Zm7-1.425c.133 0 .258-.02.375-.063a.877.877 0 0 0 .325-.212l2.6-2.6a.948.948 0 0 0 .275-.7.948.948 0 0 0-.275-.7.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275l-.9.9V11a.968.968 0 0 0-.287-.713A.968.968 0 0 0 12 10a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 11v3.2l-.9-.9a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7l2.6 2.6c.1.1.208.17.325.212.117.042.242.063.375.063Z" + }) + }); +} +; +ExportArchiveIcon.displayName = "ExportArchiveIcon"; +module.exports = ExportArchiveIcon; \ No newline at end of file diff --git a/assets/web/icons/extensions-solid.cjs b/assets/web/icons/extensions-solid.cjs new file mode 100644 index 00000000..ed77e34f --- /dev/null +++ b/assets/web/icons/extensions-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ExtensionsSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17.913 11.39a.907.907 0 0 1-.663.282.907.907 0 0 1-.663-.282L12.61 7.413a.907.907 0 0 1-.282-.663c0-.254.094-.475.282-.663l3.977-3.977a.907.907 0 0 1 .663-.282c.254 0 .475.094.663.282l3.977 3.977a.907.907 0 0 1 .282.663.907.907 0 0 1-.282.663l-3.977 3.977Zm-14.625-.677A.968.968 0 0 0 4 11h6c.283 0 .52-.096.713-.287A.968.968 0 0 0 11 10V4a.967.967 0 0 0-.287-.712A.968.968 0 0 0 10 3H4a.968.968 0 0 0-.712.288A.968.968 0 0 0 3 4v6c0 .283.096.52.288.713Zm9.999 9.999c.192.192.43.288.713.288h6c.283 0 .52-.096.712-.288A.968.968 0 0 0 21 20v-6a.968.968 0 0 0-.288-.713A.968.968 0 0 0 20 13h-6a.968.968 0 0 0-.713.287A.968.968 0 0 0 13 14v6c0 .283.096.52.287.712Zm-9.999 0A.965.965 0 0 0 4 21h6a.97.97 0 0 0 .713-.288A.968.968 0 0 0 11 20v-6a.968.968 0 0 0-.287-.713A.968.968 0 0 0 10 13H4a.967.967 0 0 0-.712.287A.968.968 0 0 0 3 14v6c0 .283.096.52.288.712Z" + }) + }); +} +; +ExtensionsSolidIcon.displayName = "ExtensionsSolidIcon"; +module.exports = ExtensionsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/extensions.cjs b/assets/web/icons/extensions.cjs new file mode 100644 index 00000000..a845a24b --- /dev/null +++ b/assets/web/icons/extensions.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ExtensionsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17.25 11.672a.907.907 0 0 1-.663-.282L12.61 7.413a.907.907 0 0 1-.282-.663c0-.254.094-.475.282-.663l3.977-3.977a.907.907 0 0 1 .663-.282c.254 0 .475.094.663.282l3.977 3.977a.907.907 0 0 1 .282.663.907.907 0 0 1-.282.663l-3.977 3.977a.907.907 0 0 1-.663.282Zm2.475-4.922L17.25 4.275 14.775 6.75l2.475 2.475 2.475-2.475ZM4 11a.967.967 0 0 1-.712-.287A.968.968 0 0 1 3 10V4c0-.283.096-.52.288-.712A.968.968 0 0 1 4 3h6a.97.97 0 0 1 .713.288A.968.968 0 0 1 11 4v6c0 .283-.096.52-.287.713A.968.968 0 0 1 10 11H4Zm5-2V5H5v4h4Zm5 12a.968.968 0 0 1-.713-.288A.968.968 0 0 1 13 20v-6c0-.283.096-.52.287-.713A.968.968 0 0 1 14 13h6a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v6c0 .283-.096.52-.288.712A.968.968 0 0 1 20 21h-6Zm5-2v-4h-4v4h4ZM4 21a.967.967 0 0 1-.712-.288A.968.968 0 0 1 3 20v-6a.97.97 0 0 1 .288-.713A.967.967 0 0 1 4 13h6c.283 0 .52.096.713.287.191.192.287.43.287.713v6a.97.97 0 0 1-.287.712A.968.968 0 0 1 10 21H4Zm5-2v-4H5v4h4Z" + }) + }); +} +; +ExtensionsIcon.displayName = "ExtensionsIcon"; +module.exports = ExtensionsIcon; \ No newline at end of file diff --git a/assets/web/icons/favourite-solid.cjs b/assets/web/icons/favourite-solid.cjs new file mode 100644 index 00000000..6117bb11 --- /dev/null +++ b/assets/web/icons/favourite-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function FavouriteSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m12.897 2.817 2.336 4.733 5.223.76a1 1 0 0 1 .555 1.705L17.23 13.7l.892 5.202a1 1 0 0 1-1.45 1.054L12 17.5l-4.672 2.456a1 1 0 0 1-1.451-1.054l.892-5.202-3.78-3.685a1 1 0 0 1 .555-1.706l5.223-.759 2.336-4.733a1 1 0 0 1 1.794 0Z" + }) + }); +} +; +FavouriteSolidIcon.displayName = "FavouriteSolidIcon"; +module.exports = FavouriteSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/favourite.cjs b/assets/web/icons/favourite.cjs new file mode 100644 index 00000000..21928bce --- /dev/null +++ b/assets/web/icons/favourite.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function FavouriteIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M13.905 9.378 12 5.52l-1.905 3.86-4.259.618 3.082 3.004-.727 4.242L12 15.24l3.81 2.003-.728-4.242 3.082-3.004-4.26-.619ZM8.767 7.55l2.336-4.733a1 1 0 0 1 1.794 0l2.336 4.733 5.223.76a1 1 0 0 1 .555 1.705L17.23 13.7l.892 5.202a1 1 0 0 1-1.45 1.054L12 17.5l-4.672 2.456a1 1 0 0 1-1.451-1.054l.892-5.202-3.78-3.685a1 1 0 0 1 .555-1.706l5.223-.759Z" + }) + }); +} +; +FavouriteIcon.displayName = "FavouriteIcon"; +module.exports = FavouriteIcon; \ No newline at end of file diff --git a/assets/web/icons/file-error.cjs b/assets/web/icons/file-error.cjs new file mode 100644 index 00000000..c5d00a03 --- /dev/null +++ b/assets/web/icons/file-error.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function FileErrorIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V4c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 6 2h7.175a1.975 1.975 0 0 1 1.4.575l4.85 4.85a1.975 1.975 0 0 1 .575 1.4v3.516A5.99 5.99 0 0 0 18 12V9h-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 13 8V4H6v16h6.341c.264.745.67 1.423 1.187 2H6Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M18 14a1 1 0 0 1 1 1v3a1 1 0 1 1-2 0v-3a1 1 0 0 1 1-1Zm-1 7a1 1 0 1 1 2 0 1 1 0 0 1-2 0Z" + })] + }); +} +; +FileErrorIcon.displayName = "FileErrorIcon"; +module.exports = FileErrorIcon; \ No newline at end of file diff --git a/assets/web/icons/files.cjs b/assets/web/icons/files.cjs new file mode 100644 index 00000000..1670380c --- /dev/null +++ b/assets/web/icons/files.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function FilesIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V4c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 6 2h7.175a1.975 1.975 0 0 1 1.4.575l4.85 4.85a1.975 1.975 0 0 1 .575 1.4V20c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6Zm7-14V4H6v16h12V9h-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 13 8Z" + }) + }); +} +; +FilesIcon.displayName = "FilesIcon"; +module.exports = FilesIcon; \ No newline at end of file diff --git a/assets/web/icons/filter.cjs b/assets/web/icons/filter.cjs new file mode 100644 index 00000000..6835cd32 --- /dev/null +++ b/assets/web/icons/filter.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function FilterIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 7a1 1 0 0 0 0 2h14a1 1 0 1 0 0-2H5Zm3 4a1 1 0 1 0 0 2h8a1 1 0 1 0 0-2H8Zm2 5a1 1 0 0 1 1-1h2a1 1 0 1 1 0 2h-2a1 1 0 0 1-1-1Z" + }) + }); +} +; +FilterIcon.displayName = "FilterIcon"; +module.exports = FilterIcon; \ No newline at end of file diff --git a/assets/web/icons/forward.cjs b/assets/web/icons/forward.cjs new file mode 100644 index 00000000..a09146d3 --- /dev/null +++ b/assets/web/icons/forward.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ForwardIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14.597 5.708a1.004 1.004 0 0 1 0-1.416.996.996 0 0 1 1.412 0l4.698 4.714c.39.391.39 1.025 0 1.416l-4.698 4.714a.996.996 0 0 1-1.412 0 1.004 1.004 0 0 1 0-1.416l3.043-3.053H8.487C6.599 10.667 5 12.27 5 14.333 5.001 16.396 6.6 18 8.487 18h2.093a1 1 0 1 1 0 2H8.487C5.42 20 3 17.425 3 14.333c0-3.091 2.42-5.666 5.486-5.666h9.059l-2.95-2.959Z" + }) + }); +} +; +ForwardIcon.displayName = "ForwardIcon"; +module.exports = ForwardIcon; \ No newline at end of file diff --git a/assets/web/icons/grid.cjs b/assets/web/icons/grid.cjs new file mode 100644 index 00000000..fdf67df0 --- /dev/null +++ b/assets/web/icons/grid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function GridIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 11a.967.967 0 0 1-.712-.287A.968.968 0 0 1 3 10V4c0-.283.096-.52.288-.712A.968.968 0 0 1 4 3h6a.97.97 0 0 1 .713.288A.968.968 0 0 1 11 4v6c0 .283-.096.52-.287.713A.968.968 0 0 1 10 11H4Zm5-2V5H5v4h4Zm5 12a.968.968 0 0 1-.713-.288A.968.968 0 0 1 13 20v-6c0-.283.096-.52.287-.713A.968.968 0 0 1 14 13h6a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v6c0 .283-.096.52-.288.712A.968.968 0 0 1 20 21h-6Zm5-2v-4h-4v4h4ZM4 21a.967.967 0 0 1-.712-.288A.968.968 0 0 1 3 20v-6a.97.97 0 0 1 .288-.713A.967.967 0 0 1 4 13h6c.283 0 .52.096.713.287.191.192.287.43.287.713v6a.97.97 0 0 1-.287.712A.968.968 0 0 1 10 21H4Zm5-2v-4H5v4h4Zm5-8a.968.968 0 0 1-.713-.287A.968.968 0 0 1 13 10V4a.97.97 0 0 1 .287-.712A.968.968 0 0 1 14 3h6c.283 0 .52.096.712.288A.965.965 0 0 1 21 4v6a.97.97 0 0 1-.288.713A.968.968 0 0 1 20 11h-6Zm5-2V5h-4v4h4Z" + }) + }); +} +; +GridIcon.displayName = "GridIcon"; +module.exports = GridIcon; \ No newline at end of file diff --git a/assets/web/icons/help-solid.cjs b/assets/web/icons/help-solid.cjs new file mode 100644 index 00000000..b5751542 --- /dev/null +++ b/assets/web/icons/help-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function HelpSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 22a9.738 9.738 0 0 0 3.9-.788 10.098 10.098 0 0 0 3.175-2.137c.9-.9 1.613-1.958 2.137-3.175A9.738 9.738 0 0 0 22 12a9.738 9.738 0 0 0-.788-3.9 10.099 10.099 0 0 0-2.137-3.175c-.9-.9-1.958-1.612-3.175-2.137A9.738 9.738 0 0 0 12 2a9.738 9.738 0 0 0-3.9.788 10.099 10.099 0 0 0-3.175 2.137c-.9.9-1.612 1.958-2.137 3.175A9.738 9.738 0 0 0 2 12a9.74 9.74 0 0 0 .788 3.9 10.098 10.098 0 0 0 2.137 3.175c.9.9 1.958 1.613 3.175 2.137A9.738 9.738 0 0 0 12 22Zm0-14a1.5 1.5 0 0 0-1.5 1.5 1 1 0 1 1-2 0 3.5 3.5 0 1 1 6.01 2.439c-.122.126-.24.243-.352.355-.287.288-.54.54-.76.824-.293.375-.398.651-.398.882a1 1 0 1 1-2 0c0-.874.407-1.58.819-2.11.305-.392.688-.775 1-1.085l.257-.26A1.5 1.5 0 0 0 12 8Zm1 9a1 1 0 1 1-2 0 1 1 0 0 1 2 0Z" + }) + }); +} +; +HelpSolidIcon.displayName = "HelpSolidIcon"; +module.exports = HelpSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/help.cjs b/assets/web/icons/help.cjs new file mode 100644 index 00000000..1b2a8cbf --- /dev/null +++ b/assets/web/icons/help.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function HelpIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 8a1.5 1.5 0 0 0-1.5 1.5 1 1 0 1 1-2 0 3.5 3.5 0 1 1 6.01 2.439c-.122.126-.24.243-.352.355-.287.288-.54.54-.76.824-.293.375-.398.651-.398.882a1 1 0 1 1-2 0c0-.874.407-1.58.819-2.11.305-.392.688-.775 1-1.085l.257-.26A1.5 1.5 0 0 0 12 8Zm1 9a1 1 0 1 1-2 0 1 1 0 0 1 2 0Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8.1 21.212A9.738 9.738 0 0 0 12 22a9.738 9.738 0 0 0 3.9-.788 10.098 10.098 0 0 0 3.175-2.137c.9-.9 1.613-1.958 2.137-3.175A9.738 9.738 0 0 0 22 12a9.738 9.738 0 0 0-.788-3.9 10.099 10.099 0 0 0-2.137-3.175c-.9-.9-1.958-1.612-3.175-2.137A9.738 9.738 0 0 0 12 2a9.738 9.738 0 0 0-3.9.788 10.099 10.099 0 0 0-3.175 2.137c-.9.9-1.612 1.958-2.137 3.175A9.738 9.738 0 0 0 2 12a9.74 9.74 0 0 0 .788 3.9 10.098 10.098 0 0 0 2.137 3.175c.9.9 1.958 1.613 3.175 2.137Zm9.575-3.537C16.125 19.225 14.233 20 12 20c-2.233 0-4.125-.775-5.675-2.325C4.775 16.125 4 14.233 4 12c0-2.233.775-4.125 2.325-5.675C7.875 4.775 9.767 4 12 4c2.233 0 4.125.775 5.675 2.325C19.225 7.875 20 9.767 20 12c0 2.233-.775 4.125-2.325 5.675Z" + })] + }); +} +; +HelpIcon.displayName = "HelpIcon"; +module.exports = HelpIcon; \ No newline at end of file diff --git a/assets/web/icons/history.cjs b/assets/web/icons/history.cjs new file mode 100644 index 00000000..d91c6018 --- /dev/null +++ b/assets/web/icons/history.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function HistoryIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M18.93 8A8 8 0 1 1 4 12a1 1 0 1 0-2 0c0 5.523 4.477 10 10 10s10-4.477 10-10a9.966 9.966 0 0 0-.832-4A10.002 10.002 0 0 0 12 2a9.985 9.985 0 0 0-8 3.999V4a1 1 0 0 0-2 0v4a1 1 0 0 0 1 1h4a1 1 0 0 0 0-2H5.755A7.985 7.985 0 0 1 12 4a7.997 7.997 0 0 1 6.93 4Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M13 8a1 1 0 1 0-2 0v4a1 1 0 0 0 .293.707l2.83 2.83a1 1 0 0 0 1.414-1.414L13 11.586V8Z" + })] + }); +} +; +HistoryIcon.displayName = "HistoryIcon"; +module.exports = HistoryIcon; \ No newline at end of file diff --git a/assets/web/icons/home-solid.cjs b/assets/web/icons/home-solid.cjs new file mode 100644 index 00000000..0efbab88 --- /dev/null +++ b/assets/web/icons/home-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function HomeSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m12.971 3.54 7 3.889A2 2 0 0 1 21 9.177V19a2 2 0 0 1-2 2h-4v-9H9v9H5a2 2 0 0 1-2-2V9.177a2 2 0 0 1 1.029-1.748l7-3.89a2 2 0 0 1 1.942 0Z" + }) + }); +} +; +HomeSolidIcon.displayName = "HomeSolidIcon"; +module.exports = HomeSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/home.cjs b/assets/web/icons/home.cjs new file mode 100644 index 00000000..c29b0847 --- /dev/null +++ b/assets/web/icons/home.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function HomeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M16 11v8h3V9.177l-7-3.889-7 3.889V19h3v-8h8Zm-6 10H5a2 2 0 0 1-2-2V9.177a2 2 0 0 1 1.029-1.748l7-3.89a2 2 0 0 1 1.942 0l7 3.89A2 2 0 0 1 21 9.177V19a2 2 0 0 1-2 2h-5v-8h-4v8Z", + clipRule: "evenodd" + }) + }); +} +; +HomeIcon.displayName = "HomeIcon"; +module.exports = HomeIcon; \ No newline at end of file diff --git a/assets/web/icons/host.cjs b/assets/web/icons/host.cjs new file mode 100644 index 00000000..1241773b --- /dev/null +++ b/assets/web/icons/host.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function HostIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M16.712 6.713A.968.968 0 0 1 16 7a.968.968 0 0 1-.713-.287A.967.967 0 0 1 15 6c0-.283.096-.52.287-.713A.968.968 0 0 1 16 5a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M6 2a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V4a2 2 0 0 0-2-2H6Zm12 2H6v4h12V4ZM6 12v-2h12v2H6Zm0 2v2h12v-2H6Zm0 6v-2h12v2H6Z", + clipRule: "evenodd" + })] + }); +} +; +HostIcon.displayName = "HostIcon"; +module.exports = HostIcon; \ No newline at end of file diff --git a/assets/web/icons/image-error.cjs b/assets/web/icons/image-error.cjs new file mode 100644 index 00000000..958498e1 --- /dev/null +++ b/assets/web/icons/image-error.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ImageErrorIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 3a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h7.803a5.958 5.958 0 0 1-.72-2H5v-3.172l4-4 3.585 3.585a6.015 6.015 0 0 1 1.172-1.656l-3.343-3.343a2 2 0 0 0-2.828 0L5 13V5h14v7.083c.718.12 1.393.368 2 .72V5a2 2 0 0 0-2-2H5Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17 9a2 2 0 1 1-4 0 2 2 0 0 1 4 0Zm1 5a1 1 0 0 1 1 1v3a1 1 0 1 1-2 0v-3a1 1 0 0 1 1-1Zm-1 7a1 1 0 1 1 2 0 1 1 0 0 1-2 0Z" + })] + }); +} +; +ImageErrorIcon.displayName = "ImageErrorIcon"; +module.exports = ImageErrorIcon; \ No newline at end of file diff --git a/assets/web/icons/image.cjs b/assets/web/icons/image.cjs new file mode 100644 index 00000000..56bd0c06 --- /dev/null +++ b/assets/web/icons/image.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ImageIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17 9a2 2 0 1 1-4 0 2 2 0 0 1 4 0Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 3a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2V5a2 2 0 0 0-2-2H5Zm14 2v14H5v-3.172l4-4L16.172 19H19l-8.586-8.586a2 2 0 0 0-2.828 0L5 13V5h14Z" + })] + }); +} +; +ImageIcon.displayName = "ImageIcon"; +module.exports = ImageIcon; \ No newline at end of file diff --git a/assets/web/icons/indent-decrease.cjs b/assets/web/icons/indent-decrease.cjs new file mode 100644 index 00000000..fa530814 --- /dev/null +++ b/assets/web/icons/indent-decrease.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function IndentDecreaseIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3.288 18.712A.965.965 0 0 0 4 19h16c.283 0 .52-.096.712-.288A.968.968 0 0 0 21 18a.968.968 0 0 0-.288-.712A.968.968 0 0 0 20 17H4a.967.967 0 0 0-.712.288A.968.968 0 0 0 3 18c0 .283.096.52.288.712Zm7.999-3.999c.192.191.43.287.713.287h8a.97.97 0 0 0 .712-.287A.968.968 0 0 0 21 14a.968.968 0 0 0-.288-.713A.968.968 0 0 0 20 13h-8a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 14c0 .283.096.52.287.713Zm0-4c.192.191.43.287.713.287h8a.97.97 0 0 0 .712-.287A.968.968 0 0 0 21 10a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 9h-8a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 10c0 .283.096.52.287.713Zm0-4c.192.191.43.287.713.287h8a.97.97 0 0 0 .712-.287A.967.967 0 0 0 21 6a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 5h-8a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 6c0 .283.096.52.287.713ZM6.15 13.15l-2.8-2.8a.48.48 0 0 1 0-.7l2.8-2.8c.167-.167.35-.208.55-.125.2.083.3.242.3.475v5.6c0 .233-.1.392-.3.475-.2.083-.383.042-.55-.125Z" + }) + }); +} +; +IndentDecreaseIcon.displayName = "IndentDecreaseIcon"; +module.exports = IndentDecreaseIcon; \ No newline at end of file diff --git a/assets/web/icons/indent-increase.cjs b/assets/web/icons/indent-increase.cjs new file mode 100644 index 00000000..945f5ea3 --- /dev/null +++ b/assets/web/icons/indent-increase.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function IndentIncreaseIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 19a.967.967 0 0 1-.712-.288A.968.968 0 0 1 3 18c0-.283.096-.52.288-.712A.967.967 0 0 1 4 17h16c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 20 19H4Zm8-4a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 14c0-.283.096-.52.287-.713A.968.968 0 0 1 12 13h8a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 15h-8Zm0-4a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 10c0-.283.096-.52.287-.713A.968.968 0 0 1 12 9h8a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 11h-8Zm0-4a.968.968 0 0 1-.713-.287A.967.967 0 0 1 11 6c0-.283.096-.52.287-.713A.968.968 0 0 1 12 5h8a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 20 7h-8Zm-8.15 6.15c-.167.167-.35.208-.55.125-.2-.083-.3-.242-.3-.475V7.2c0-.233.1-.392.3-.475.2-.083.383-.042.55.125l2.8 2.8a.48.48 0 0 1 0 .7l-2.8 2.8Z" + }) + }); +} +; +IndentIncreaseIcon.displayName = "IndentIncreaseIcon"; +module.exports = IndentIncreaseIcon; \ No newline at end of file diff --git a/assets/web/icons/index.cjs b/assets/web/icons/index.cjs new file mode 100644 index 00000000..c368d11a --- /dev/null +++ b/assets/web/icons/index.cjs @@ -0,0 +1,172 @@ +module.exports = { + AdminIcon: require("./admin.cjs"), + ArrowDownIcon: require("./arrow-down.cjs"), + ArrowLeftIcon: require("./arrow-left.cjs"), + ArrowRightIcon: require("./arrow-right.cjs"), + ArrowUpRightIcon: require("./arrow-up-right.cjs"), + ArrowUpIcon: require("./arrow-up.cjs"), + AttachmentIcon: require("./attachment.cjs"), + BlockIcon: require("./block.cjs"), + BoldIcon: require("./bold.cjs"), + ChartIcon: require("./chart.cjs"), + ChatNewIcon: require("./chat-new.cjs"), + ChatProblemIcon: require("./chat-problem.cjs"), + ChatSolidIcon: require("./chat-solid.cjs"), + ChatIcon: require("./chat.cjs"), + CheckCircleSolidIcon: require("./check-circle-solid.cjs"), + CheckCircleIcon: require("./check-circle.cjs"), + CheckIcon: require("./check.cjs"), + ChevronDownIcon: require("./chevron-down.cjs"), + ChevronLeftIcon: require("./chevron-left.cjs"), + ChevronRightIcon: require("./chevron-right.cjs"), + ChevronUpDownIcon: require("./chevron-up-down.cjs"), + ChevronUpIcon: require("./chevron-up.cjs"), + CircleIcon: require("./circle.cjs"), + CloseIcon: require("./close.cjs"), + CloudSolidIcon: require("./cloud-solid.cjs"), + CloudIcon: require("./cloud.cjs"), + CodeIcon: require("./code.cjs"), + CollapseIcon: require("./collapse.cjs"), + CompanyIcon: require("./company.cjs"), + ComposeIcon: require("./compose.cjs"), + ComputerIcon: require("./computer.cjs"), + CopyIcon: require("./copy.cjs"), + DarkModeIcon: require("./dark-mode.cjs"), + DeleteIcon: require("./delete.cjs"), + DevicesIcon: require("./devices.cjs"), + DocumentIcon: require("./document.cjs"), + DownloadIcon: require("./download.cjs"), + DragGridIcon: require("./drag-grid.cjs"), + DragListIcon: require("./drag-list.cjs"), + EditSolidIcon: require("./edit-solid.cjs"), + EditIcon: require("./edit.cjs"), + EmailSolidIcon: require("./email-solid.cjs"), + EmailIcon: require("./email.cjs"), + EndCallIcon: require("./end-call.cjs"), + ErrorIcon: require("./error.cjs"), + ExpandIcon: require("./expand.cjs"), + ExportArchiveIcon: require("./export-archive.cjs"), + ExtensionsSolidIcon: require("./extensions-solid.cjs"), + ExtensionsIcon: require("./extensions.cjs"), + FavouriteSolidIcon: require("./favourite-solid.cjs"), + FavouriteIcon: require("./favourite.cjs"), + FileErrorIcon: require("./file-error.cjs"), + FilesIcon: require("./files.cjs"), + FilterIcon: require("./filter.cjs"), + ForwardIcon: require("./forward.cjs"), + GridIcon: require("./grid.cjs"), + HelpSolidIcon: require("./help-solid.cjs"), + HelpIcon: require("./help.cjs"), + HistoryIcon: require("./history.cjs"), + HomeSolidIcon: require("./home-solid.cjs"), + HomeIcon: require("./home.cjs"), + HostIcon: require("./host.cjs"), + ImageErrorIcon: require("./image-error.cjs"), + ImageIcon: require("./image.cjs"), + IndentDecreaseIcon: require("./indent-decrease.cjs"), + IndentIncreaseIcon: require("./indent-increase.cjs"), + InfoSolidIcon: require("./info-solid.cjs"), + InfoIcon: require("./info.cjs"), + InlineCodeIcon: require("./inline-code.cjs"), + ItalicIcon: require("./italic.cjs"), + KeyOffSolidIcon: require("./key-off-solid.cjs"), + KeyOffIcon: require("./key-off.cjs"), + KeySolidIcon: require("./key-solid.cjs"), + KeyIcon: require("./key.cjs"), + KeyboardIcon: require("./keyboard.cjs"), + LabsIcon: require("./labs.cjs"), + LeaveIcon: require("./leave.cjs"), + LinkIcon: require("./link.cjs"), + ListBulletedIcon: require("./list-bulleted.cjs"), + ListNumberedIcon: require("./list-numbered.cjs"), + LocationNavigatorCentredIcon: require("./location-navigator-centred.cjs"), + LocationNavigatorIcon: require("./location-navigator.cjs"), + LocationPinSolidIcon: require("./location-pin-solid.cjs"), + LocationPinIcon: require("./location-pin.cjs"), + LockOffIcon: require("./lock-off.cjs"), + LockSolidIcon: require("./lock-solid.cjs"), + LockIcon: require("./lock.cjs"), + MarkAsReadIcon: require("./mark-as-read.cjs"), + MarkAsUnreadIcon: require("./mark-as-unread.cjs"), + MarkerReadReceiptsIcon: require("./marker-read-receipts.cjs"), + MentionIcon: require("./mention.cjs"), + MenuIcon: require("./menu.cjs"), + MicOffSolidIcon: require("./mic-off-solid.cjs"), + MicOffIcon: require("./mic-off.cjs"), + MicOnSolidIcon: require("./mic-on-solid.cjs"), + MicOnIcon: require("./mic-on.cjs"), + MinusIcon: require("./minus.cjs"), + MobileIcon: require("./mobile.cjs"), + NotificationsOffSolidIcon: require("./notifications-off-solid.cjs"), + NotificationsOffIcon: require("./notifications-off.cjs"), + NotificationsSolidIcon: require("./notifications-solid.cjs"), + NotificationsIcon: require("./notifications.cjs"), + OfflineIcon: require("./offline.cjs"), + OverflowHorizontalIcon: require("./overflow-horizontal.cjs"), + OverflowVerticalIcon: require("./overflow-vertical.cjs"), + PauseSolidIcon: require("./pause-solid.cjs"), + PauseIcon: require("./pause.cjs"), + PinSolidIcon: require("./pin-solid.cjs"), + PinIcon: require("./pin.cjs"), + PlaySolidIcon: require("./play-solid.cjs"), + PlayIcon: require("./play.cjs"), + PlusIcon: require("./plus.cjs"), + PollsEndIcon: require("./polls-end.cjs"), + PollsIcon: require("./polls.cjs"), + PopOutIcon: require("./pop-out.cjs"), + PreferencesIcon: require("./preferences.cjs"), + PublicIcon: require("./public.cjs"), + QrCodeIcon: require("./qr-code.cjs"), + QuoteIcon: require("./quote.cjs"), + ReactionAddIcon: require("./reaction-add.cjs"), + ReactionIcon: require("./reaction.cjs"), + ReplyIcon: require("./reply.cjs"), + RestartIcon: require("./restart.cjs"), + SearchIcon: require("./search.cjs"), + SendSolidIcon: require("./send-solid.cjs"), + SendIcon: require("./send.cjs"), + SettingsSolidIcon: require("./settings-solid.cjs"), + SettingsIcon: require("./settings.cjs"), + ShareAndroidIcon: require("./share-android.cjs"), + ShareIosIcon: require("./share-ios.cjs"), + ShareScreenSolidIcon: require("./share-screen-solid.cjs"), + ShareScreenIcon: require("./share-screen.cjs"), + ShareIcon: require("./share.cjs"), + SidebarIcon: require("./sidebar.cjs"), + SignOutIcon: require("./sign-out.cjs"), + SpinnerIcon: require("./spinner.cjs"), + SpotlightIcon: require("./spotlight.cjs"), + StrikethroughIcon: require("./strikethrough.cjs"), + SwitchCameraSolidIcon: require("./switch-camera-solid.cjs"), + TakePhotoSolidIcon: require("./take-photo-solid.cjs"), + TakePhotoIcon: require("./take-photo.cjs"), + TextFormattingIcon: require("./text-formatting.cjs"), + ThreadsSolidIcon: require("./threads-solid.cjs"), + ThreadsIcon: require("./threads.cjs"), + TimeIcon: require("./time.cjs"), + UnderlineIcon: require("./underline.cjs"), + UnknownSolidIcon: require("./unknown-solid.cjs"), + UnknownIcon: require("./unknown.cjs"), + UserAddSolidIcon: require("./user-add-solid.cjs"), + UserAddIcon: require("./user-add.cjs"), + UserProfileSolidIcon: require("./user-profile-solid.cjs"), + UserProfileIcon: require("./user-profile.cjs"), + UserSolidIcon: require("./user-solid.cjs"), + UserIcon: require("./user.cjs"), + VerifiedIcon: require("./verified.cjs"), + VideoCallDeclinedSolidIcon: require("./video-call-declined-solid.cjs"), + VideoCallMissedSolidIcon: require("./video-call-missed-solid.cjs"), + VideoCallOffSolidIcon: require("./video-call-off-solid.cjs"), + VideoCallOffIcon: require("./video-call-off.cjs"), + VideoCallSolidIcon: require("./video-call-solid.cjs"), + VideoCallIcon: require("./video-call.cjs"), + VisibilityOffIcon: require("./visibility-off.cjs"), + VisibilityOnIcon: require("./visibility-on.cjs"), + VoiceCallIcon: require("./voice-call.cjs"), + VolumeOffSolidIcon: require("./volume-off-solid.cjs"), + VolumeOffIcon: require("./volume-off.cjs"), + VolumeOnSolidIcon: require("./volume-on-solid.cjs"), + VolumeOnIcon: require("./volume-on.cjs"), + WarningIcon: require("./warning.cjs"), + WebBrowserIcon: require("./web-browser.cjs") +}; \ No newline at end of file diff --git a/assets/web/icons/info-solid.cjs b/assets/web/icons/info-solid.cjs new file mode 100644 index 00000000..953a9c50 --- /dev/null +++ b/assets/web/icons/info-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function InfoSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 17a.97.97 0 0 0 .713-.288A.968.968 0 0 0 13 16v-4a.968.968 0 0 0-.287-.713A.968.968 0 0 0 12 11a.968.968 0 0 0-.713.287A.968.968 0 0 0 11 12v4c0 .283.096.52.287.712.192.192.43.288.713.288Zm0-8c.283 0 .52-.096.713-.287A.967.967 0 0 0 13 8a.967.967 0 0 0-.287-.713A.968.968 0 0 0 12 7a.968.968 0 0 0-.713.287A.967.967 0 0 0 11 8c0 .283.096.52.287.713.192.191.43.287.713.287Zm0 13a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Z" + }) + }); +} +; +InfoSolidIcon.displayName = "InfoSolidIcon"; +module.exports = InfoSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/info.cjs b/assets/web/icons/info.cjs new file mode 100644 index 00000000..c23f182e --- /dev/null +++ b/assets/web/icons/info.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function InfoIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11.287 7.287A.968.968 0 0 1 12 7c.283 0 .52.096.713.287.191.192.287.43.287.713s-.096.52-.287.713A.968.968 0 0 1 12 9a.968.968 0 0 1-.713-.287A.967.967 0 0 1 11 8c0-.283.096-.52.287-.713Zm0 4A.968.968 0 0 1 12 11c.283 0 .52.096.713.287.191.192.287.43.287.713v4a.97.97 0 0 1-.287.712A.968.968 0 0 1 12 17a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 16v-4c0-.283.096-.52.287-.713Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M22 12c0 5.523-4.477 10-10 10S2 17.523 2 12 6.477 2 12 2s10 4.477 10 10Zm-2 0a8 8 0 1 1-16 0 8 8 0 0 1 16 0Z", + clipRule: "evenodd" + })] + }); +} +; +InfoIcon.displayName = "InfoIcon"; +module.exports = InfoIcon; \ No newline at end of file diff --git a/assets/web/icons/inline-code.cjs b/assets/web/icons/inline-code.cjs new file mode 100644 index 00000000..ad1eda8d --- /dev/null +++ b/assets/web/icons/inline-code.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function InlineCodeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14.958 5.62a1 1 0 0 0-1.916-.574l-4 13.333a1 1 0 0 0 1.916.575l4-13.333ZM5.974 7.232a1 1 0 0 0-1.409.128l-3.333 4a1 1 0 0 0 0 1.28l3.333 4a1 1 0 0 0 1.537-1.28L3.302 12l2.8-3.36a1 1 0 0 0-.128-1.408Zm12.052 0a1 1 0 0 1 1.409.128l3.333 4a1 1 0 0 1 0 1.28l-3.333 4a1 1 0 0 1-1.537-1.28l2.8-3.36-2.8-3.36a1 1 0 0 1 .128-1.408Z" + }) + }); +} +; +InlineCodeIcon.displayName = "InlineCodeIcon"; +module.exports = InlineCodeIcon; \ No newline at end of file diff --git a/assets/web/icons/italic.cjs b/assets/web/icons/italic.cjs new file mode 100644 index 00000000..524dee0a --- /dev/null +++ b/assets/web/icons/italic.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ItalicIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6.25 19c-.35 0-.646-.12-.888-.363A1.207 1.207 0 0 1 5 17.75c0-.35.12-.646.362-.887.242-.242.538-.363.888-.363H9l3-9H9.25c-.35 0-.646-.12-.887-.362A1.207 1.207 0 0 1 8 6.25c0-.35.12-.646.363-.888A1.21 1.21 0 0 1 9.25 5h7.5c.35 0 .646.12.887.362.242.242.363.538.363.888s-.12.646-.363.888a1.207 1.207 0 0 1-.887.362H14.5l-3 9h2.25c.35 0 .646.12.887.363.242.241.363.537.363.887s-.12.646-.363.887a1.207 1.207 0 0 1-.887.363h-7.5Z" + }) + }); +} +; +ItalicIcon.displayName = "ItalicIcon"; +module.exports = ItalicIcon; \ No newline at end of file diff --git a/assets/web/icons/key-off-solid.cjs b/assets/web/icons/key-off-solid.cjs new file mode 100644 index 00000000..887b4644 --- /dev/null +++ b/assets/web/icons/key-off-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function KeyOffSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4.917 2.083a1 1 0 0 0-1.414 1.414L6.07 6.064c-1.27.18-2.377.743-3.32 1.686C1.583 8.917 1 10.333 1 12c0 1.667.583 3.083 1.75 4.25C3.917 17.417 5.333 18 7 18a5.863 5.863 0 0 0 3.475-1.1A5.81 5.81 0 0 0 12.65 14H13l1.3 1.3c.1.1.208.17.325.213.117.041.242.062.375.062s.258-.02.375-.062a.782.782 0 0 0 .1-.044l5.028 5.028a1 1 0 0 0 1.414-1.414l-17-17Zm.67 11.33A1.926 1.926 0 0 1 5 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 7 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.413A1.926 1.926 0 0 1 7 14c-.55 0-1.02-.196-1.412-.587Zm14.9 1.423L15.65 10h4.95a1.033 1.033 0 0 1 .725.3l1.025 1.025c.083.083.15.18.2.288.05.108.075.229.075.362a1.067 1.067 0 0 1-.25.7l-1.888 2.16Z" + }) + }); +} +; +KeyOffSolidIcon.displayName = "KeyOffSolidIcon"; +module.exports = KeyOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/key-off.cjs b/assets/web/icons/key-off.cjs new file mode 100644 index 00000000..de300e0d --- /dev/null +++ b/assets/web/icons/key-off.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function KeyOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M7 14c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 5 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 7 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.413A1.926 1.926 0 0 1 7 14Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4.917 2.083a1 1 0 0 0-1.414 1.414L6.07 6.064c-1.27.18-2.377.743-3.32 1.686C1.583 8.917 1 10.333 1 12c0 1.667.583 3.083 1.75 4.25C3.917 17.417 5.333 18 7 18c1.117 0 2.13-.275 3.037-.825A6.212 6.212 0 0 0 12.2 15h1.175l1.525 1.075c.083.067.18.117.287.15a.945.945 0 0 0 .887-.15l.004-.002 4.425 4.424a1 1 0 0 0 1.414-1.414l-17-17ZM13.006 13h-2.131a4.033 4.033 0 0 1-1.412 2.15c-.709.567-1.53.85-2.463.85-1.1 0-2.042-.392-2.825-1.175C3.392 14.042 3 13.1 3 12s.392-2.042 1.175-2.825C4.958 8.392 5.9 8 7 8c.413 0 .803.055 1.172.166l2.649 2.65c.02.06.037.122.054.184h.13l2 2Zm8.144-1-1.75 1.75 1.426 1.425L23.3 12.7c.1-.1.17-.208.212-.325.042-.117.063-.242.063-.375s-.02-.258-.063-.375a.877.877 0 0 0-.212-.325l-2-2a.999.999 0 0 0-.338-.225A1.034 1.034 0 0 0 20.575 9h-5.924l2 2h3.499l1 1Z" + })] + }); +} +; +KeyOffIcon.displayName = "KeyOffIcon"; +module.exports = KeyOffIcon; \ No newline at end of file diff --git a/assets/web/icons/key-solid.cjs b/assets/web/icons/key-solid.cjs new file mode 100644 index 00000000..bf4b6f05 --- /dev/null +++ b/assets/web/icons/key-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function KeySolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M10.475 16.9A5.863 5.863 0 0 1 7 18c-1.667 0-3.083-.583-4.25-1.75C1.583 15.083 1 13.667 1 12c0-1.667.583-3.083 1.75-4.25C3.917 6.583 5.333 6 7 6c1.35 0 2.53.383 3.537 1.15 1.009.767 1.713 1.717 2.113 2.85h7.95a1.033 1.033 0 0 1 .725.3l1.025 1.025a.99.99 0 0 1 .2.288c.05.108.075.229.075.362a1.066 1.066 0 0 1-.25.7l-2.25 2.575a.973.973 0 0 1-1.038.313 1.033 1.033 0 0 1-.337-.188L17 14l-1.3 1.3c-.1.1-.208.17-.325.212a1.106 1.106 0 0 1-.375.063c-.133 0-.258-.02-.375-.063a.877.877 0 0 1-.325-.212L13 14h-.35a5.81 5.81 0 0 1-2.175 2.9Zm-4.887-3.487c.391.39.862.587 1.412.587.55 0 1.02-.196 1.412-.588C8.804 13.021 9 12.55 9 12c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 7 10c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 5 12c0 .55.196 1.02.588 1.412Z" + }) + }); +} +; +KeySolidIcon.displayName = "KeySolidIcon"; +module.exports = KeySolidIcon; \ No newline at end of file diff --git a/assets/web/icons/key.cjs b/assets/web/icons/key.cjs new file mode 100644 index 00000000..ab60df04 --- /dev/null +++ b/assets/web/icons/key.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function KeyIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M7 14c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 5 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 7 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 7 14Zm0 4c-1.667 0-3.083-.583-4.25-1.75C1.583 15.083 1 13.667 1 12c0-1.667.583-3.083 1.75-4.25C3.917 6.583 5.333 6 7 6c1.117 0 2.13.275 3.037.825A6.212 6.212 0 0 1 12.2 9h8.375a1.033 1.033 0 0 1 .725.3l2 2c.1.1.17.208.212.325.042.117.063.242.063.375s-.02.258-.063.375a.877.877 0 0 1-.212.325l-3.175 3.175a.946.946 0 0 1-.3.2c-.117.05-.233.083-.35.1a.832.832 0 0 1-.35-.025.884.884 0 0 1-.325-.175L17.5 15l-1.425 1.075a.945.945 0 0 1-.887.15.859.859 0 0 1-.288-.15L13.375 15H12.2a6.212 6.212 0 0 1-2.162 2.175C9.128 17.725 8.117 18 7 18Zm0-2c.933 0 1.754-.283 2.463-.85A4.032 4.032 0 0 0 10.875 13H14l1.45 1.025L17.5 12.5l1.775 1.375L21.15 12l-1-1h-9.275a4.032 4.032 0 0 0-1.412-2.15C8.754 8.283 7.933 8 7 8c-1.1 0-2.042.392-2.825 1.175C3.392 9.958 3 10.9 3 12s.392 2.042 1.175 2.825C4.958 15.608 5.9 16 7 16Z" + }) + }); +} +; +KeyIcon.displayName = "KeyIcon"; +module.exports = KeyIcon; \ No newline at end of file diff --git a/assets/web/icons/keyboard.cjs b/assets/web/icons/keyboard.cjs new file mode 100644 index 00000000..c006bc38 --- /dev/null +++ b/assets/web/icons/keyboard.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function KeyboardIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5.188 8v2h2V8h-2Zm3.875 0v2h2V8h-2Zm3.875 0v2h2V8h-2Zm3.875 0v2h2V8h-2ZM5.188 11.531v2h2v-2h-2Zm3.875 0v2h2v-2h-2Zm3.875 0v2h2v-2h-2Zm3.875 0v2h2v-2h-2ZM9 15a1 1 0 1 0 0 2h6a1 1 0 1 0 0-2H9Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M2 6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V6Zm2 0h16v12H4V6Z", + clipRule: "evenodd" + })] + }); +} +; +KeyboardIcon.displayName = "KeyboardIcon"; +module.exports = KeyboardIcon; \ No newline at end of file diff --git a/assets/web/icons/labs.cjs b/assets/web/icons/labs.cjs new file mode 100644 index 00000000..bb9f6c49 --- /dev/null +++ b/assets/web/icons/labs.cjs @@ -0,0 +1,23 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LabsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 5a1 1 0 0 1-1-1V3a1 1 0 1 1 2 0v1a1 1 0 0 1-1 1Zm-7.071-.071a1 1 0 0 1 1.414 0l.707.707A1 1 0 0 1 5.636 7.05l-.707-.707a1 1 0 0 1 0-1.414Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M15.734 15.325C15.316 15.795 15 16.371 15 17v2a2 2 0 0 1-2 2h-2a2 2 0 0 1-2-2v-2c0-.63-.316-1.205-.734-1.675a5 5 0 1 1 7.468 0Zm-1.493-1.33a3 3 0 1 0-4.482 0c.433.486.894 1.166 1.112 2.005h2.258c.218-.84.679-1.52 1.112-2.005ZM13 18h-2v1h2v-1Z", + clipRule: "evenodd" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2 12a1 1 0 0 1 1-1h1a1 1 0 1 1 0 2H3a1 1 0 0 1-1-1Zm18-1a1 1 0 1 0 0 2h1a1 1 0 1 0 0-2h-1Zm-3.05-5.364a1 1 0 0 0 1.414 1.414l.707-.707a1 1 0 0 0-1.414-1.414l-.707.707Z" + })] + }); +} +; +LabsIcon.displayName = "LabsIcon"; +module.exports = LabsIcon; \ No newline at end of file diff --git a/assets/web/icons/leave.cjs b/assets/web/icons/leave.cjs new file mode 100644 index 00000000..a6c97112 --- /dev/null +++ b/assets/web/icons/leave.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LeaveIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14 13c.283 0 .52-.096.713-.287A.968.968 0 0 0 15 12a.968.968 0 0 0-.287-.713A.968.968 0 0 0 14 11a.968.968 0 0 0-.713.287A.968.968 0 0 0 13 12c0 .283.096.52.287.713.192.191.43.287.713.287Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M10.385 21.788A.998.998 0 0 1 10 21V3a1.003 1.003 0 0 1 1.242-.97l8 2A1 1 0 0 1 20 5v14a1 1 0 0 1-.758.97l-8 2a.998.998 0 0 1-.857-.182ZM18 5.781l-6-1.5v15.438l6-1.5V5.781ZM9 6H7v12h2v2H7a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2v2Z" + })] + }); +} +; +LeaveIcon.displayName = "LeaveIcon"; +module.exports = LeaveIcon; \ No newline at end of file diff --git a/assets/web/icons/link.cjs b/assets/web/icons/link.cjs new file mode 100644 index 00000000..a6763b13 --- /dev/null +++ b/assets/web/icons/link.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LinkIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 19.071c-.978.978-2.157 1.467-3.536 1.467-1.378 0-2.557-.489-3.535-1.467-.978-.978-1.467-2.157-1.467-3.535 0-1.38.489-2.558 1.467-3.536L7.05 9.879c.2-.2.436-.3.707-.3.271 0 .507.1.707.3.2.2.301.436.301.707 0 .27-.1.507-.3.707l-2.122 2.121a2.893 2.893 0 0 0-.884 2.122c0 .824.295 1.532.884 2.12.59.59 1.296.885 2.121.885s1.533-.295 2.122-.884l2.121-2.121c.2-.2.436-.3.707-.3.271 0 .507.1.707.3.2.2.3.436.3.707 0 .27-.1.506-.3.707L12 19.07Zm-1.414-4.243c-.2.2-.436.301-.707.301a.968.968 0 0 1-.707-.3.97.97 0 0 1-.301-.708c0-.27.1-.506.3-.707l4.243-4.242c.2-.2.436-.3.707-.3.271 0 .507.1.707.3.2.2.3.436.3.707 0 .27-.1.507-.3.707l-4.242 4.242Zm6.364-.707c-.2.2-.436.3-.707.3a.968.968 0 0 1-.707-.3.969.969 0 0 1-.301-.707c0-.27.1-.506.3-.707l2.122-2.121c.59-.59.884-1.297.884-2.121 0-.825-.295-1.533-.884-2.122a2.893 2.893 0 0 0-2.121-.884c-.825 0-1.532.295-2.122.884l-2.121 2.122c-.2.2-.436.3-.707.3a.968.968 0 0 1-.707-.3.97.97 0 0 1-.3-.708c0-.27.1-.506.3-.707L12 4.93c.978-.978 2.157-1.467 3.536-1.467 1.378 0 2.557.489 3.535 1.467.978.978 1.467 2.157 1.467 3.536 0 1.378-.489 2.557-1.467 3.535l-2.121 2.121Z" + }) + }); +} +; +LinkIcon.displayName = "LinkIcon"; +module.exports = LinkIcon; \ No newline at end of file diff --git a/assets/web/icons/list-bulleted.cjs b/assets/web/icons/list-bulleted.cjs new file mode 100644 index 00000000..dbf2a6ac --- /dev/null +++ b/assets/web/icons/list-bulleted.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ListBulletedIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4.5 7.5a1.45 1.45 0 0 1-1.06-.44A1.444 1.444 0 0 1 3 6c0-.412.147-.766.44-1.06A1.45 1.45 0 0 1 4.5 4.5c.412 0 .766.147 1.06.44.293.294.44.647.44 1.06 0 .412-.147.766-.44 1.06-.294.293-.647.44-1.06.44Zm4.787 11.212c.192.192.43.288.713.288h10c.283 0 .52-.096.712-.288A.968.968 0 0 0 21 18a.968.968 0 0 0-.288-.712A.968.968 0 0 0 20 17H10a.967.967 0 0 0-.713.288A.968.968 0 0 0 9 18c0 .283.096.52.287.712Zm0-5.999c.192.191.43.287.713.287h10a.97.97 0 0 0 .712-.287A.968.968 0 0 0 21 12a.968.968 0 0 0-.288-.713A.968.968 0 0 0 20 11H10a.967.967 0 0 0-.713.287A.968.968 0 0 0 9 12c0 .283.096.52.287.713Zm0-6c.192.191.43.287.713.287h10a.97.97 0 0 0 .712-.287A.967.967 0 0 0 21 6a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 5H10a.968.968 0 0 0-.713.287A.968.968 0 0 0 9 6c0 .283.096.52.287.713ZM3.44 19.06c.294.293.648.44 1.06.44a1.45 1.45 0 0 0 1.06-.44c.293-.294.44-.647.44-1.06 0-.413-.147-.766-.44-1.06a1.445 1.445 0 0 0-1.06-.44 1.45 1.45 0 0 0-1.06.44c-.293.294-.44.647-.44 1.06 0 .413.147.766.44 1.06ZM4.5 13.5a1.45 1.45 0 0 1-1.06-.44A1.445 1.445 0 0 1 3 12c0-.412.147-.766.44-1.06a1.45 1.45 0 0 1 1.06-.44c.412 0 .766.147 1.06.44.293.294.44.648.44 1.06 0 .412-.147.766-.44 1.06-.294.293-.647.44-1.06.44Z" + }) + }); +} +; +ListBulletedIcon.displayName = "ListBulletedIcon"; +module.exports = ListBulletedIcon; \ No newline at end of file diff --git a/assets/web/icons/list-numbered.cjs b/assets/web/icons/list-numbered.cjs new file mode 100644 index 00000000..47b552ea --- /dev/null +++ b/assets/web/icons/list-numbered.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ListNumberedIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9 6a1 1 0 0 1 1-1h10a1 1 0 1 1 0 2H10a1 1 0 0 1-1-1Zm0 6a1 1 0 0 1 1-1h10a1 1 0 1 1 0 2H10a1 1 0 0 1-1-1Zm0 6a1 1 0 0 1 1-1h10a1 1 0 1 1 0 2H10a1 1 0 0 1-1-1ZM5.604 5.089A.75.75 0 0 1 6 5.75v4.5a.75.75 0 0 1-1.5 0V7.151l-.334.223a.75.75 0 0 1-.832-1.248l1.5-1a.75.75 0 0 1 .77-.037ZM5 13a2.02 2.02 0 0 0-1.139.321 1.846 1.846 0 0 0-.626.719 2.286 2.286 0 0 0-.234.921v.023l-.001.01v.005l.75.001H3a.75.75 0 0 0 1.5.01V15a.789.789 0 0 1 .077-.29.35.35 0 0 1 .116-.14c.04-.027.126-.07.307-.07s.267.043.307.07a.35.35 0 0 1 .116.14.788.788 0 0 1 .076.29v.008a.532.532 0 0 1-.14.352l-2.161 2.351a.748.748 0 0 0-.198.523v.016c0 .414.336.75.75.75h2.5a.75.75 0 0 0 0-1.5h-.82l1.034-1.124C6.809 16 7 15.51 7 15h-.75H7v-.039l-.004-.068a2.285 2.285 0 0 0-.231-.853 1.846 1.846 0 0 0-.626-.719A2.02 2.02 0 0 0 5 13Zm-.5 2.003V15v.01-.008Z" + }) + }); +} +; +ListNumberedIcon.displayName = "ListNumberedIcon"; +module.exports = ListNumberedIcon; \ No newline at end of file diff --git a/assets/web/icons/location-navigator-centred.cjs b/assets/web/icons/location-navigator-centred.cjs new file mode 100644 index 00000000..6bcc68d6 --- /dev/null +++ b/assets/web/icons/location-navigator-centred.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LocationNavigatorCentredIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11 21.95v-1c-2.084-.233-3.871-1.096-5.363-2.587C4.146 16.87 3.283 15.083 3.05 13h-1a.967.967 0 0 1-.713-.287A.968.968 0 0 1 1.05 12c0-.283.096-.52.287-.713A.967.967 0 0 1 2.05 11h1c.233-2.083 1.096-3.87 2.587-5.363C7.13 4.146 8.917 3.283 11 3.05v-1c0-.283.096-.52.287-.713A.968.968 0 0 1 12 1.05a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v1c2.083.233 3.87 1.096 5.362 2.587C19.854 7.13 20.717 8.917 20.95 11h1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713a.968.968 0 0 1-.712.287h-1c-.233 2.083-1.096 3.87-2.588 5.363-1.491 1.491-3.279 2.354-5.362 2.587v1a.97.97 0 0 1-.288.713.968.968 0 0 1-.712.287.968.968 0 0 1-.713-.287.968.968 0 0 1-.287-.713ZM12 19c1.933 0 3.583-.683 4.95-2.05C18.317 15.583 19 13.933 19 12c0-1.933-.683-3.583-2.05-4.95C15.583 5.683 13.933 5 12 5c-1.934 0-3.584.683-4.95 2.05C5.683 8.417 5 10.067 5 12c0 1.933.683 3.583 2.05 4.95C8.416 18.317 10.066 19 12 19Zm0-3c-1.1 0-2.042-.392-2.825-1.175C8.39 14.042 8 13.1 8 12s.391-2.042 1.175-2.825C9.958 8.392 10.9 8 12 8s2.041.392 2.825 1.175C15.608 9.958 16 10.9 16 12s-.392 2.042-1.175 2.825C14.04 15.608 13.1 16 12 16Z" + }) + }); +} +; +LocationNavigatorCentredIcon.displayName = "LocationNavigatorCentredIcon"; +module.exports = LocationNavigatorCentredIcon; \ No newline at end of file diff --git a/assets/web/icons/location-navigator.cjs b/assets/web/icons/location-navigator.cjs new file mode 100644 index 00000000..e0e422f3 --- /dev/null +++ b/assets/web/icons/location-navigator.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LocationNavigatorIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11 22v-1c-2.084-.233-3.871-1.096-5.363-2.587-1.491-1.492-2.354-3.28-2.587-5.363h-1a.968.968 0 0 1-.713-.288.968.968 0 0 1-.287-.712c0-.283.096-.52.287-.713a.967.967 0 0 1 .713-.287h1c.233-2.083 1.096-3.87 2.587-5.363C7.13 4.196 8.917 3.333 11 3.1v-1c0-.283.096-.52.287-.713A.968.968 0 0 1 12 1.1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v1c2.083.233 3.87 1.096 5.362 2.587 1.492 1.492 2.355 3.28 2.588 5.363h1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.712a.968.968 0 0 1-.712.288h-1c-.233 2.083-1.096 3.87-2.588 5.363C16.871 19.904 15.083 20.767 13 21v1c0 .283-.096.52-.288.712A.968.968 0 0 1 12 23a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 22Zm1-2.95c1.933 0 3.583-.683 4.95-2.05 1.367-1.367 2.05-3.017 2.05-4.95 0-1.933-.683-3.583-2.05-4.95-1.367-1.367-3.017-2.05-4.95-2.05-1.934 0-3.584.683-4.95 2.05C5.683 8.467 5 10.117 5 12.05c0 1.933.683 3.583 2.05 4.95 1.366 1.367 3.016 2.05 4.95 2.05Z" + }) + }); +} +; +LocationNavigatorIcon.displayName = "LocationNavigatorIcon"; +module.exports = LocationNavigatorIcon; \ No newline at end of file diff --git a/assets/web/icons/location-pin-solid.cjs b/assets/web/icons/location-pin-solid.cjs new file mode 100644 index 00000000..afbda4cf --- /dev/null +++ b/assets/web/icons/location-pin-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LocationPinSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 21.325a2.07 2.07 0 0 1-.7-.125 1.84 1.84 0 0 1-.625-.375A39.112 39.112 0 0 1 7.8 17.9c-.833-.95-1.53-1.87-2.087-2.762-.559-.892-.984-1.75-1.276-2.575C4.146 11.738 4 10.95 4 10.2c0-2.5.804-4.492 2.412-5.975C8.021 2.742 9.883 2 12 2s3.98.742 5.587 2.225C19.197 5.708 20 7.7 20 10.2c0 .75-.146 1.538-.438 2.363-.291.824-.716 1.683-1.274 2.574A21.678 21.678 0 0 1 16.2 17.9a39.112 39.112 0 0 1-2.875 2.925 1.84 1.84 0 0 1-.625.375 2.07 2.07 0 0 1-.7.125ZM12 12c.55 0 1.02-.196 1.412-.588.392-.391.588-.862.588-1.412 0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 12 8c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 10 10c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Z" + }) + }); +} +; +LocationPinSolidIcon.displayName = "LocationPinSolidIcon"; +module.exports = LocationPinSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/location-pin.cjs b/assets/web/icons/location-pin.cjs new file mode 100644 index 00000000..febdc715 --- /dev/null +++ b/assets/web/icons/location-pin.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LocationPinIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 19.35c2.033-1.867 3.542-3.563 4.525-5.088C17.508 12.738 18 11.383 18 10.2c0-1.817-.58-3.304-1.738-4.462C15.104 4.579 13.683 4 12 4c-1.683 0-3.104.58-4.263 1.737C6.58 6.896 6 8.383 6 10.2c0 1.183.492 2.538 1.475 4.063.983 1.524 2.492 3.22 4.525 5.087Zm0 1.975a2.07 2.07 0 0 1-.7-.125 1.84 1.84 0 0 1-.625-.375A39.112 39.112 0 0 1 7.8 17.9c-.833-.95-1.53-1.87-2.087-2.762-.559-.892-.984-1.75-1.276-2.575C4.146 11.738 4 10.95 4 10.2c0-2.5.804-4.492 2.412-5.975C8.021 2.742 9.883 2 12 2s3.98.742 5.587 2.225C19.197 5.708 20 7.7 20 10.2c0 .75-.146 1.538-.438 2.363-.291.824-.716 1.683-1.274 2.574A21.678 21.678 0 0 1 16.2 17.9a39.112 39.112 0 0 1-2.875 2.925 1.84 1.84 0 0 1-.625.375 2.07 2.07 0 0 1-.7.125ZM12 12c.55 0 1.02-.196 1.412-.588.392-.391.588-.862.588-1.412 0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 12 8c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 10 10c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Z" + }) + }); +} +; +LocationPinIcon.displayName = "LocationPinIcon"; +module.exports = LocationPinIcon; \ No newline at end of file diff --git a/assets/web/icons/lock-off.cjs b/assets/web/icons/lock-off.cjs new file mode 100644 index 00000000..c990fbf9 --- /dev/null +++ b/assets/web/icons/lock-off.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LockOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V10c0-.55.196-1.02.588-1.412a1.98 1.98 0 0 1 .702-.463L1.333 4.167a1 1 0 0 1 1.414-1.414L7 7.006v-.012l13 13v.012l1.247 1.247a1 1 0 1 1-1.414 1.414l-.896-.896A1.935 1.935 0 0 1 18 22H6Zm14-4.834V10c0-.55-.196-1.02-.587-1.412A1.926 1.926 0 0 0 18 8h-1V6c0-1.383-.488-2.563-1.463-3.538C14.563 1.487 13.383 1 12 1s-2.562.488-3.537 1.462a4.876 4.876 0 0 0-1.22 1.947L9 6.166V6c0-.833.292-1.542.875-2.125A2.893 2.893 0 0 1 12 3c.833 0 1.542.292 2.125.875S15 5.167 15 6v2h-4.166L20 17.166Z" + }) + }); +} +; +LockOffIcon.displayName = "LockOffIcon"; +module.exports = LockOffIcon; \ No newline at end of file diff --git a/assets/web/icons/lock-solid.cjs b/assets/web/icons/lock-solid.cjs new file mode 100644 index 00000000..5d4be560 --- /dev/null +++ b/assets/web/icons/lock-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LockSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V10c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 8h1V6c0-1.383.487-2.563 1.463-3.538C9.438 1.487 10.617 1 12 1s2.563.488 3.537 1.462C16.512 3.438 17 4.617 17 6v2h1c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v10c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6ZM9 8h6V6c0-.833-.292-1.542-.875-2.125A2.893 2.893 0 0 0 12 3c-.833 0-1.542.292-2.125.875A2.893 2.893 0 0 0 9 6v2Z" + }) + }); +} +; +LockSolidIcon.displayName = "LockSolidIcon"; +module.exports = LockSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/lock.cjs b/assets/web/icons/lock.cjs new file mode 100644 index 00000000..7a784439 --- /dev/null +++ b/assets/web/icons/lock.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function LockIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 22c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 20V10c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 8h1V6c0-1.383.487-2.563 1.463-3.538C9.438 1.487 10.617 1 12 1s2.563.488 3.537 1.462C16.512 3.438 17 4.617 17 6v2h1c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v10c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 22H6Zm0-2h12V10H6v10ZM9 8h6V6c0-.833-.292-1.542-.875-2.125A2.893 2.893 0 0 0 12 3c-.833 0-1.542.292-2.125.875A2.893 2.893 0 0 0 9 6v2Z" + }) + }); +} +; +LockIcon.displayName = "LockIcon"; +module.exports = LockIcon; \ No newline at end of file diff --git a/assets/web/icons/mark-as-read.cjs b/assets/web/icons/mark-as-read.cjs new file mode 100644 index 00000000..8239c49b --- /dev/null +++ b/assets/web/icons/mark-as-read.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MarkAsReadIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M21.324 9.13c0-.66-.339-1.237-.862-1.558l-7.37-4.318a1.812 1.812 0 0 0-1.851 0L3.87 7.572C3.348 7.892 3 8.47 3 9.13v9.167c0 1.008.825 1.833 1.833 1.833H19.5a1.839 1.839 0 0 0 1.833-1.833l-.009-9.167Zm-10.129 3.978-6.6-4.124 6.646-3.896a1.812 1.812 0 0 1 1.851 0l6.646 3.896-6.6 4.124a1.854 1.854 0 0 1-1.943 0Z" + }) + }); +} +; +MarkAsReadIcon.displayName = "MarkAsReadIcon"; +module.exports = MarkAsReadIcon; \ No newline at end of file diff --git a/assets/web/icons/mark-as-unread.cjs b/assets/web/icons/mark-as-unread.cjs new file mode 100644 index 00000000..7cce368a --- /dev/null +++ b/assets/web/icons/mark-as-unread.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MarkAsUnreadIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M20 7a2 2 0 1 0 0-4 2 2 0 0 0 0 4Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M17 5H5a2 2 0 0 0-2 2v10.4a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2V7.83a2.995 2.995 0 0 1-2 0 3.056 3.056 0 0 1-.595-.288L12 11.89 5 7.138V7h12.764A2.99 2.99 0 0 1 17 5Zm-4.438 8.927L19 9.555V17.4H5V9.555l6.438 4.372a1 1 0 0 0 1.124 0Z", + clipRule: "evenodd" + })] + }); +} +; +MarkAsUnreadIcon.displayName = "MarkAsUnreadIcon"; +module.exports = MarkAsUnreadIcon; \ No newline at end of file diff --git a/assets/web/icons/marker-read-receipts.cjs b/assets/web/icons/marker-read-receipts.cjs new file mode 100644 index 00000000..48b79190 --- /dev/null +++ b/assets/web/icons/marker-read-receipts.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MarkerReadReceiptsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14.707 10.707a1 1 0 0 0-1.414-1.414L10 12.586l-1.293-1.293a1 1 0 0 0-1.414 1.414l2 2a1 1 0 0 0 1.414 0l4-4Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M22.4 12.625c.067-.2.1-.408.1-.625 0-.217-.033-.425-.1-.625a2.112 2.112 0 0 0-.3-.575l-4.5-6A1.986 1.986 0 0 0 16 4H4c-.55 0-1.02.196-1.413.588A1.926 1.926 0 0 0 2 6v12c0 .55.196 1.02.587 1.413.393.39.863.587 1.413.587h12a1.985 1.985 0 0 0 1.6-.8l4.5-6c.133-.183.233-.375.3-.575ZM16 6l4.5 6-4.5 6H4V6h12Z" + })] + }); +} +; +MarkerReadReceiptsIcon.displayName = "MarkerReadReceiptsIcon"; +module.exports = MarkerReadReceiptsIcon; \ No newline at end of file diff --git a/assets/web/icons/mention.cjs b/assets/web/icons/mention.cjs new file mode 100644 index 00000000..6a858daf --- /dev/null +++ b/assets/web/icons/mention.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MentionIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 4a8 8 0 1 0 0 16 1 1 0 1 1 0 2C6.477 22 2 17.523 2 12S6.477 2 12 2s10 4.477 10 10v1.5a3.5 3.5 0 0 1-6.396 1.966A5 5 0 1 1 17 12v1.5a1.5 1.5 0 0 0 3 0V12a8 8 0 0 0-8-8Zm3 8a3 3 0 1 0-6 0 3 3 0 0 0 6 0Z" + }) + }); +} +; +MentionIcon.displayName = "MentionIcon"; +module.exports = MentionIcon; \ No newline at end of file diff --git a/assets/web/icons/menu.cjs b/assets/web/icons/menu.cjs new file mode 100644 index 00000000..665b3647 --- /dev/null +++ b/assets/web/icons/menu.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MenuIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 8a1 1 0 0 1 1-1h14a1 1 0 1 1 0 2H5a1 1 0 0 1-1-1Zm0 4a1 1 0 0 1 1-1h14a1 1 0 1 1 0 2H5a1 1 0 0 1-1-1Zm1 3a1 1 0 1 0 0 2h14a1 1 0 1 0 0-2H5Z" + }) + }); +} +; +MenuIcon.displayName = "MenuIcon"; +module.exports = MenuIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-off-solid.cjs b/assets/web/icons/mic-off-solid.cjs new file mode 100644 index 00000000..efdb288f --- /dev/null +++ b/assets/web/icons/mic-off-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MicOffSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8 8v-.006l6.831 6.832-.002.002 1.414 1.415.003-.003 1.414 1.414-.003.003L20.5 20.5a1 1 0 0 1-1.414 1.414l-3.022-3.022A7.949 7.949 0 0 1 13 19.938V21a1 1 0 0 1-2 0v-1.062A8.001 8.001 0 0 1 4 12a1 1 0 1 1 2 0 6 6 0 0 0 8.587 5.415l-1.55-1.55A4.005 4.005 0 0 1 8 12v-1.172L2.086 4.914A1 1 0 0 1 3.5 3.5L8 8Zm9.417 6.583 1.478 1.477A7.963 7.963 0 0 0 20 12a1 1 0 0 0-2 0c0 .925-.21 1.8-.583 2.583ZM8.073 5.238l7.793 7.793c.087-.329.134-.674.134-1.031V6a4 4 0 0 0-7.927-.762Z" + }) + }); +} +; +MicOffSolidIcon.displayName = "MicOffSolidIcon"; +module.exports = MicOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-off.cjs b/assets/web/icons/mic-off.cjs new file mode 100644 index 00000000..a0f51f26 --- /dev/null +++ b/assets/web/icons/mic-off.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MicOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M8 8v-.006l2 2V10l3.414 3.414.003-.003 1.414 1.415-.002.002 1.414 1.415.003-.003 1.414 1.414-.003.003L20.5 20.5a1 1 0 0 1-1.414 1.414l-3.022-3.022A7.947 7.947 0 0 1 13 19.938V21a1 1 0 1 1-2 0v-1.062A8.001 8.001 0 0 1 4 12a1 1 0 1 1 2 0 6 6 0 0 0 8.587 5.415l-1.55-1.55A4.005 4.005 0 0 1 8 12v-1.172L2.086 4.914A1 1 0 0 1 3.5 3.5L8 8Z", + clipRule: "evenodd" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14 6v5.166l1.866 1.866c.087-.33.134-.675.134-1.032V6a4 4 0 0 0-7.928-.762L10 7.166V6a2 2 0 1 1 4 0Zm3.417 8.583 1.477 1.477A7.963 7.963 0 0 0 20 12a1 1 0 1 0-2 0c0 .925-.21 1.8-.583 2.583Z" + })] + }); +} +; +MicOffIcon.displayName = "MicOffIcon"; +module.exports = MicOffIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-on-solid.cjs b/assets/web/icons/mic-on-solid.cjs new file mode 100644 index 00000000..0c82fb60 --- /dev/null +++ b/assets/web/icons/mic-on-solid.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MicOnSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8 6a4 4 0 1 1 8 0v6a4 4 0 0 1-8 0V6Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 11a1 1 0 0 1 1 1 6 6 0 0 0 12 0 1 1 0 1 1 2 0 8.001 8.001 0 0 1-7 7.938V21a1 1 0 1 1-2 0v-1.062A8.001 8.001 0 0 1 4 12a1 1 0 0 1 1-1Z" + })] + }); +} +; +MicOnSolidIcon.displayName = "MicOnSolidIcon"; +module.exports = MicOnSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/mic-on.cjs b/assets/web/icons/mic-on.cjs new file mode 100644 index 00000000..cc639ab3 --- /dev/null +++ b/assets/web/icons/mic-on.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MicOnIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 12a1 1 0 1 0-2 0 8.001 8.001 0 0 0 7 7.938V21a1 1 0 1 0 2 0v-1.062A8.001 8.001 0 0 0 20 12a1 1 0 1 0-2 0 6 6 0 0 1-12 0Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M14 12V6a2 2 0 1 0-4 0v6a2 2 0 1 0 4 0ZM12 2a4 4 0 0 0-4 4v6a4 4 0 0 0 8 0V6a4 4 0 0 0-4-4Z", + clipRule: "evenodd" + })] + }); +} +; +MicOnIcon.displayName = "MicOnIcon"; +module.exports = MicOnIcon; \ No newline at end of file diff --git a/assets/web/icons/minus.cjs b/assets/web/icons/minus.cjs new file mode 100644 index 00000000..ed56efbd --- /dev/null +++ b/assets/web/icons/minus.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MinusIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 13a.967.967 0 0 1-.713-.287A.968.968 0 0 1 5 12c0-.283.096-.52.287-.713A.967.967 0 0 1 6 11h12a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 18 13H6Z" + }) + }); +} +; +MinusIcon.displayName = "MinusIcon"; +module.exports = MinusIcon; \ No newline at end of file diff --git a/assets/web/icons/mobile.cjs b/assets/web/icons/mobile.cjs new file mode 100644 index 00000000..3d23c265 --- /dev/null +++ b/assets/web/icons/mobile.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function MobileIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M7 23c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 5 21V3c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 7 1h10c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v18c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 17 23H7Zm0-5h10V6H7v12Z" + }) + }); +} +; +MobileIcon.displayName = "MobileIcon"; +module.exports = MobileIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications-off-solid.cjs b/assets/web/icons/notifications-off-solid.cjs new file mode 100644 index 00000000..0507892f --- /dev/null +++ b/assets/web/icons/notifications-off-solid.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function NotificationsOffSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m4.917 2.083 17 17a1 1 0 0 1-1.414 1.414L19.006 19H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-2.034 1.096-3.91L3.503 3.498a1 1 0 0 1 1.414-1.414ZM19 13.349 9.136 3.485C9.93 3.181 10.874 3 12 3c7 0 7 7 7 7v3.349Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M10 20h4a2 2 0 1 1-4 0Z" + })] + }); +} +; +NotificationsOffSolidIcon.displayName = "NotificationsOffSolidIcon"; +module.exports = NotificationsOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications-off.cjs b/assets/web/icons/notifications-off.cjs new file mode 100644 index 00000000..54826802 --- /dev/null +++ b/assets/web/icons/notifications-off.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function NotificationsOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m4.917 2.083 17 17a1 1 0 0 1-1.414 1.414L19.006 19H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-2.034 1.096-3.91L3.503 3.498a1 1 0 0 1 1.414-1.414ZM17.006 17 7.579 7.573a6.731 6.731 0 0 0-.497 1.662 6.596 6.596 0 0 0-.081.753L7 10.01v6.818L6.828 17h10.178ZM17 11.349V9.988l-.009-.146a6.591 6.591 0 0 0-.073-.607 6.608 6.608 0 0 0-.582-1.84c-.319-.638-.766-1.215-1.398-1.637C14.318 5.344 13.4 5 12 5c-.466 0-.879.038-1.245.104L9.136 3.485C9.93 3.181 10.874 3 12 3c7 0 7 7 7 7v3.349l-2-2Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M10 20h4a2 2 0 1 1-4 0Z" + })] + }); +} +; +NotificationsOffIcon.displayName = "NotificationsOffIcon"; +module.exports = NotificationsOffIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications-solid.cjs b/assets/web/icons/notifications-solid.cjs new file mode 100644 index 00000000..c04d3769 --- /dev/null +++ b/assets/web/icons/notifications-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function NotificationsSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M20.293 17.293c.63.63.184 1.707-.707 1.707H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-7 7-7 7 7 7 7v6l1.293 1.293ZM12 22a2 2 0 0 1-2-2h4a2 2 0 0 1-2 2Z" + }) + }); +} +; +NotificationsSolidIcon.displayName = "NotificationsSolidIcon"; +module.exports = NotificationsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/notifications.cjs b/assets/web/icons/notifications.cjs new file mode 100644 index 00000000..5352e390 --- /dev/null +++ b/assets/web/icons/notifications.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function NotificationsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 3c7 0 7 7 7 7v6l1.293 1.293c.63.63.184 1.707-.707 1.707H4.414c-.89 0-1.337-1.077-.707-1.707L5 16v-6s0-7 7-7Zm5 7.01v-.022l-.009-.146a6.598 6.598 0 0 0-.073-.607 6.604 6.604 0 0 0-.582-1.84c-.319-.638-.766-1.215-1.399-1.637C14.317 5.344 13.4 5 12 5s-2.317.344-2.938.758c-.632.422-1.08.999-1.398 1.636a6.607 6.607 0 0 0-.582 1.841A6.593 6.593 0 0 0 7 9.988v6.84L6.828 17h10.344L17 16.828V10.01ZM12 22a2 2 0 0 1-2-2h4a2 2 0 0 1-2 2Z" + }) + }); +} +; +NotificationsIcon.displayName = "NotificationsIcon"; +module.exports = NotificationsIcon; \ No newline at end of file diff --git a/assets/web/icons/offline.cjs b/assets/web/icons/offline.cjs new file mode 100644 index 00000000..00b6170f --- /dev/null +++ b/assets/web/icons/offline.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function OfflineIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3.5 3.5a1 1 0 1 0-1.414 1.414l4.113 4.114a5.484 5.484 0 0 0-.184 1.07A5.002 5.002 0 0 0 7 20h10.172l1.914 1.914A1 1 0 1 0 20.5 20.5l-.979-.979.004-.001L7.145 7.14l-.002.003L3.5 3.5Zm18.5 12a4.48 4.48 0 0 1-.928 2.738L8.637 5.803A5.474 5.474 0 0 1 11.5 5a5.49 5.49 0 0 1 4.25 2.008 4 4 0 0 1 4.187 4.708A4.496 4.496 0 0 1 22 15.5Z" + }) + }); +} +; +OfflineIcon.displayName = "OfflineIcon"; +module.exports = OfflineIcon; \ No newline at end of file diff --git a/assets/web/icons/overflow-horizontal.cjs b/assets/web/icons/overflow-horizontal.cjs new file mode 100644 index 00000000..db326b31 --- /dev/null +++ b/assets/web/icons/overflow-horizontal.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function OverflowHorizontalIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 14c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 4 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 6 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 6 14Zm6 0c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 12 14Zm6 0c-.55 0-1.02-.196-1.413-.588A1.926 1.926 0 0 1 16 12c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 18 10c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412 0 .55-.196 1.02-.587 1.412A1.926 1.926 0 0 1 18 14Z" + }) + }); +} +; +OverflowHorizontalIcon.displayName = "OverflowHorizontalIcon"; +module.exports = OverflowHorizontalIcon; \ No newline at end of file diff --git a/assets/web/icons/overflow-vertical.cjs b/assets/web/icons/overflow-vertical.cjs new file mode 100644 index 00000000..3a6d23f9 --- /dev/null +++ b/assets/web/icons/overflow-vertical.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function OverflowVerticalIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 20c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 10 18c0-.55.196-1.02.588-1.413A1.926 1.926 0 0 1 12 16c.55 0 1.02.196 1.412.587.392.392.588.863.588 1.413s-.196 1.02-.588 1.413A1.926 1.926 0 0 1 12 20Zm0-6c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 12c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 10c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 12 14Zm0-6c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 6c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 4c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 12 8Z" + }) + }); +} +; +OverflowVerticalIcon.displayName = "OverflowVerticalIcon"; +module.exports = OverflowVerticalIcon; \ No newline at end of file diff --git a/assets/web/icons/pause-solid.cjs b/assets/web/icons/pause-solid.cjs new file mode 100644 index 00000000..98dcd81f --- /dev/null +++ b/assets/web/icons/pause-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PauseSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8 4a2 2 0 0 0-2 2v12a2 2 0 1 0 4 0V6a2 2 0 0 0-2-2Zm8 0a2 2 0 0 0-2 2v12a2 2 0 1 0 4 0V6a2 2 0 0 0-2-2Z" + }) + }); +} +; +PauseSolidIcon.displayName = "PauseSolidIcon"; +module.exports = PauseSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/pause.cjs b/assets/web/icons/pause.cjs new file mode 100644 index 00000000..c8f1a387 --- /dev/null +++ b/assets/web/icons/pause.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PauseIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 6a2 2 0 0 1 2-2h2a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H7a2 2 0 0 1-2-2V6Zm2 0v12h2V6H7Zm6 0a2 2 0 0 1 2-2h2a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2h-2a2 2 0 0 1-2-2V6Zm2 0v12h2V6h-2Z" + }) + }); +} +; +PauseIcon.displayName = "PauseIcon"; +module.exports = PauseIcon; \ No newline at end of file diff --git a/assets/web/icons/pin-solid.cjs b/assets/web/icons/pin-solid.cjs new file mode 100644 index 00000000..2ea06050 --- /dev/null +++ b/assets/web/icons/pin-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PinSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5.769 2.857A.5.5 0 0 1 6.119 2h11.762a.5.5 0 0 1 .35.857L16.15 4.9a.5.5 0 0 0-.15.357v4.487a.5.5 0 0 0 .15.356l3.7 3.644a.5.5 0 0 1 .15.356v1.4a.5.5 0 0 1-.5.5H13v6a1 1 0 1 1-2 0v-6H4.5a.5.5 0 0 1-.5-.5v-1.4a.5.5 0 0 1 .15-.356l3.7-3.644A.5.5 0 0 0 8 9.744V5.257a.5.5 0 0 0-.15-.357L5.77 2.857Z" + }) + }); +} +; +PinSolidIcon.displayName = "PinSolidIcon"; +module.exports = PinSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/pin.cjs b/assets/web/icons/pin.cjs new file mode 100644 index 00000000..e23a92a0 --- /dev/null +++ b/assets/web/icons/pin.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PinIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M6.119 2a.5.5 0 0 0-.35.857L7.85 4.9a.5.5 0 0 1 .15.357v4.487a.5.5 0 0 1-.15.356l-3.7 3.644A.5.5 0 0 0 4 14.1v1.4a.5.5 0 0 0 .5.5H11v6a1 1 0 1 0 2 0v-6h6.5a.5.5 0 0 0 .5-.5v-1.4a.5.5 0 0 0-.15-.356l-3.7-3.644a.5.5 0 0 1-.15-.356V5.257a.5.5 0 0 1 .15-.357l2.081-2.043a.5.5 0 0 0-.35-.857H6.119ZM10 4h4v5.744a2.5 2.5 0 0 0 .746 1.781L17.26 14H6.74l2.514-2.475A2.5 2.5 0 0 0 10 9.744V4Z", + clipRule: "evenodd" + }) + }); +} +; +PinIcon.displayName = "PinIcon"; +module.exports = PinIcon; \ No newline at end of file diff --git a/assets/web/icons/play-solid.cjs b/assets/web/icons/play-solid.cjs new file mode 100644 index 00000000..6efcfabc --- /dev/null +++ b/assets/web/icons/play-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PlaySolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m8.98 4.677 9.921 5.58c1.36.764 1.36 2.722 0 3.486l-9.92 5.58C7.647 20.073 6 19.11 6 17.58V6.42c0-1.53 1.647-2.493 2.98-1.743Z" + }) + }); +} +; +PlaySolidIcon.displayName = "PlaySolidIcon"; +module.exports = PlaySolidIcon; \ No newline at end of file diff --git a/assets/web/icons/play.cjs b/assets/web/icons/play.cjs new file mode 100644 index 00000000..1e395750 --- /dev/null +++ b/assets/web/icons/play.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PlayIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17.92 12 8 17.58V6.42L17.92 12Zm.981-1.743-9.92-5.58C7.647 3.927 6 4.89 6 6.42v11.16c0 1.53 1.647 2.493 2.98 1.743l9.921-5.58c1.36-.764 1.36-2.722 0-3.486Z" + }) + }); +} +; +PlayIcon.displayName = "PlayIcon"; +module.exports = PlayIcon; \ No newline at end of file diff --git a/assets/web/icons/plus.cjs b/assets/web/icons/plus.cjs new file mode 100644 index 00000000..f7d0e80a --- /dev/null +++ b/assets/web/icons/plus.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PlusIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11 13H6a.967.967 0 0 1-.713-.287A.968.968 0 0 1 5 12c0-.283.096-.52.287-.713A.967.967 0 0 1 6 11h5V6c0-.283.096-.52.287-.713A.968.968 0 0 1 12 5c.283 0 .52.096.713.287.191.192.287.43.287.713v5h5a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 18 13h-5v5a.97.97 0 0 1-.287.712A.968.968 0 0 1 12 19a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 18v-5Z" + }) + }); +} +; +PlusIcon.displayName = "PlusIcon"; +module.exports = PlusIcon; \ No newline at end of file diff --git a/assets/web/icons/polls-end.cjs b/assets/web/icons/polls-end.cjs new file mode 100644 index 00000000..a295d7c6 --- /dev/null +++ b/assets/web/icons/polls-end.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PollsEndIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M21 10.659V19c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h8.341A5.99 5.99 0 0 0 13 5H5v14h14v-8a5.99 5.99 0 0 0 2-.341Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M13.803 8a6.03 6.03 0 0 0 1.88 2H13a.968.968 0 0 1-.713-.287A.967.967 0 0 1 12 9c0-.283.096-.52.287-.713A.968.968 0 0 1 13 8h.803Zm2.909 7.713A.968.968 0 0 1 16 16h-3a.968.968 0 0 1-.713-.287A.968.968 0 0 1 12 15c0-.283.096-.52.287-.713A.968.968 0 0 1 13 14h3a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713Zm-6.3-5.301A1.926 1.926 0 0 1 9 11c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 7 9c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 7c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412Zm0 6.001A1.926 1.926 0 0 1 9 17c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 7 15c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 9 13c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.413Zm12.295-14.12a1 1 0 0 1 0 1.414l-4 4a1 1 0 0 1-1.414 0l-2-2a1 1 0 0 1 1.414-1.414L18 5.586l3.293-3.293a1 1 0 0 1 1.414 0Z" + })] + }); +} +; +PollsEndIcon.displayName = "PollsEndIcon"; +module.exports = PollsEndIcon; \ No newline at end of file diff --git a/assets/web/icons/polls.cjs b/assets/web/icons/polls.cjs new file mode 100644 index 00000000..ad380edb --- /dev/null +++ b/assets/web/icons/polls.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PollsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M16 10a.97.97 0 0 0 .712-.287A.967.967 0 0 0 17 9a.967.967 0 0 0-.288-.713A.968.968 0 0 0 16 8h-3a.968.968 0 0 0-.713.287A.967.967 0 0 0 12 9c0 .283.096.52.287.713.192.191.43.287.713.287h3Zm0 6a.97.97 0 0 0 .712-.287A.968.968 0 0 0 17 15a.968.968 0 0 0-.288-.713A.968.968 0 0 0 16 14h-3a.968.968 0 0 0-.713.287A.968.968 0 0 0 12 15c0 .283.096.52.287.713.192.191.43.287.713.287h3Zm-7-5c.55 0 1.02-.196 1.412-.588C10.804 10.021 11 9.55 11 9c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 9 7c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 7 9c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Zm0 6c.55 0 1.02-.196 1.412-.587.392-.392.588-.863.588-1.413s-.196-1.02-.588-1.412A1.926 1.926 0 0 0 9 13c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 7 15c0 .55.196 1.02.588 1.413.391.391.862.587 1.412.587Zm-4 4c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }) + }); +} +; +PollsIcon.displayName = "PollsIcon"; +module.exports = PollsIcon; \ No newline at end of file diff --git a/assets/web/icons/pop-out.cjs b/assets/web/icons/pop-out.cjs new file mode 100644 index 00000000..b6d22101 --- /dev/null +++ b/assets/web/icons/pop-out.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PopOutIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 3h6a1 1 0 1 1 0 2H5v14h14v-6a1 1 0 1 1 2 0v6a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M15 3h5a1 1 0 0 1 1 1v5a1 1 0 1 1-2 0V6.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L17.586 5H15a1 1 0 1 1 0-2Z" + })] + }); +} +; +PopOutIcon.displayName = "PopOutIcon"; +module.exports = PopOutIcon; \ No newline at end of file diff --git a/assets/web/icons/preferences.cjs b/assets/web/icons/preferences.cjs new file mode 100644 index 00000000..657370da --- /dev/null +++ b/assets/web/icons/preferences.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PreferencesIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M6.5 2h11a4.5 4.5 0 1 1 0 9h-11a4.5 4.5 0 0 1 0-9Zm0 2h7.258A4.479 4.479 0 0 0 13 6.5c0 .925.28 1.785.758 2.5H6.5a2.5 2.5 0 0 1 0-5ZM15 6.5a2.5 2.5 0 1 1 5 0 2.5 2.5 0 0 1-5 0Zm-13 11A4.5 4.5 0 0 1 6.5 13h11a4.5 4.5 0 1 1 0 9h-11A4.5 4.5 0 0 1 2 17.5Zm8.242-2.5H17.5a2.5 2.5 0 0 1 0 5h-7.258A4.478 4.478 0 0 0 11 17.5c0-.925-.28-1.785-.758-2.5ZM6.5 15a2.5 2.5 0 1 0 0 5 2.5 2.5 0 0 0 0-5Z", + clipRule: "evenodd" + }) + }); +} +; +PreferencesIcon.displayName = "PreferencesIcon"; +module.exports = PreferencesIcon; \ No newline at end of file diff --git a/assets/web/icons/public.cjs b/assets/web/icons/public.cjs new file mode 100644 index 00000000..44775f4c --- /dev/null +++ b/assets/web/icons/public.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function PublicIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 22a9.738 9.738 0 0 1-3.9-.788 10.099 10.099 0 0 1-3.175-2.137c-.9-.9-1.612-1.958-2.137-3.175A9.738 9.738 0 0 1 2 12a9.74 9.74 0 0 1 .788-3.9 10.099 10.099 0 0 1 2.137-3.175c.9-.9 1.958-1.612 3.175-2.137A9.738 9.738 0 0 1 12 2a9.74 9.74 0 0 1 3.9.788 10.098 10.098 0 0 1 3.175 2.137c.9.9 1.613 1.958 2.137 3.175A9.738 9.738 0 0 1 22 12a9.738 9.738 0 0 1-.788 3.9 10.098 10.098 0 0 1-2.137 3.175c-.9.9-1.958 1.613-3.175 2.137A9.738 9.738 0 0 1 12 22Zm-1-2.05V18c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 9 16v-1l-4.8-4.8c-.05.3-.096.6-.138.9-.041.3-.062.6-.062.9 0 2.017.662 3.783 1.987 5.3 1.325 1.517 2.996 2.4 5.013 2.65Zm6.9-2.55c.333-.367.633-.762.9-1.188a7.45 7.45 0 0 0 .662-1.325c.175-.458.309-.929.4-1.412.092-.483.138-.975.138-1.475a7.845 7.845 0 0 0-1.363-4.475A7.701 7.701 0 0 0 15 4.6V5c0 .55-.196 1.02-.588 1.412A1.926 1.926 0 0 1 13 7h-2v2c0 .283-.096.52-.287.713A.968.968 0 0 1 10 10H8v2h6c.283 0 .52.096.713.287.191.192.287.43.287.713v3h1c.433 0 .825.13 1.175.387.35.259.592.596.725 1.013Z" + }) + }); +} +; +PublicIcon.displayName = "PublicIcon"; +module.exports = PublicIcon; \ No newline at end of file diff --git a/assets/web/icons/qr-code.cjs b/assets/web/icons/qr-code.cjs new file mode 100644 index 00000000..99693ecb --- /dev/null +++ b/assets/web/icons/qr-code.cjs @@ -0,0 +1,23 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function QrCodeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M3 4a1 1 0 0 1 1-1h6a1 1 0 0 1 1 1v6a1 1 0 0 1-1 1H4a1 1 0 0 1-1-1V4Zm2 5V5h4v4H5Zm-2 5a1 1 0 0 1 1-1h6a1 1 0 0 1 1 1v6a1 1 0 0 1-1 1H4a1 1 0 0 1-1-1v-6Zm2 5v-4h4v4H5Zm9-16a1 1 0 0 0-1 1v6a1 1 0 0 0 1 1h6a1 1 0 0 0 1-1V4a1 1 0 0 0-1-1h-6Zm1 2v4h4V5h-4Z", + clipRule: "evenodd" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M15 16v-3h-2v3h2Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M17 16h-2v2h-2v3h2v-3h2v2h4v-2h-2v-5h-2v3Z" + })] + }); +} +; +QrCodeIcon.displayName = "QrCodeIcon"; +module.exports = QrCodeIcon; \ No newline at end of file diff --git a/assets/web/icons/quote.cjs b/assets/web/icons/quote.cjs new file mode 100644 index 00000000..1fa3d77d --- /dev/null +++ b/assets/web/icons/quote.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function QuoteIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4.719 4.34c.094-.642-.366-1.236-1.028-1.328-.663-.092-1.276.354-1.371.996l-.808 5.478c-.094.642.366 1.237 1.028 1.328.663.092 1.276-.354 1.371-.996l.808-5.478Zm12.115 10.174c.095-.642-.366-1.237-1.028-1.328-.662-.092-1.276.354-1.37.996l-.809 5.478c-.094.642.366 1.236 1.028 1.328.663.092 1.277-.354 1.371-.996l.808-5.478ZM9.318 3.009c.665.077 1.138.662 1.058 1.306l-.022.175a220.467 220.467 0 0 1-.266 2.006c-.161 1.171-.368 2.579-.535 3.386-.13.636-.769 1.049-1.425.921-.656-.127-1.082-.745-.95-1.381.148-.72.345-2.052.509-3.237a190.652 190.652 0 0 0 .262-1.981l.021-.17c.08-.644.684-1.103 1.348-1.025Zm13.17 11.505c.094-.642-.366-1.237-1.028-1.328-.663-.092-1.276.354-1.371.996l-.808 5.478c-.094.642.366 1.236 1.028 1.328.663.092 1.276-.354 1.371-.996l.808-5.478Z" + }) + }); +} +; +QuoteIcon.displayName = "QuoteIcon"; +module.exports = QuoteIcon; \ No newline at end of file diff --git a/assets/web/icons/reaction-add.cjs b/assets/web/icons/reaction-add.cjs new file mode 100644 index 00000000..85437962 --- /dev/null +++ b/assets/web/icons/reaction-add.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ReactionAddIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M14.74 2.38C13.87 2.133 12.95 2 12 2 6.477 2 2 6.477 2 12s4.477 10 10 10 10-4.477 10-10c0-.95-.133-1.87-.38-2.74a4.969 4.969 0 0 1-1.886.687 8 8 0 1 1-5.68-5.68c.1-.684.339-1.323.687-1.887Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M15.536 14.121a1 1 0 0 1 0 1.415A4.987 4.987 0 0 1 12 17c-1.38 0-2.632-.56-3.535-1.464a1 1 0 1 1 1.414-1.415A2.988 2.988 0 0 0 12 15c.829 0 1.577-.335 2.121-.879a1 1 0 0 1 1.415 0ZM8.5 12a1.5 1.5 0 1 0 0-3 1.5 1.5 0 0 0 0 3Zm8.5-1.5a1.5 1.5 0 1 1-3 0 1.5 1.5 0 0 1 3 0ZM18 6h-1a.968.968 0 0 1-.712-.287A.967.967 0 0 1 16 5a.97.97 0 0 1 .288-.713A.968.968 0 0 1 17 4h1V3c0-.283.096-.52.288-.712A.968.968 0 0 1 19 2c.283 0 .52.096.712.288A.965.965 0 0 1 20 3v1h1a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 21 6h-1v1a.97.97 0 0 1-.288.713A.968.968 0 0 1 19 8a.968.968 0 0 1-.712-.287A.967.967 0 0 1 18 7V6Z" + })] + }); +} +; +ReactionAddIcon.displayName = "ReactionAddIcon"; +module.exports = ReactionAddIcon; \ No newline at end of file diff --git a/assets/web/icons/reaction.cjs b/assets/web/icons/reaction.cjs new file mode 100644 index 00000000..feea7790 --- /dev/null +++ b/assets/web/icons/reaction.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ReactionIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M15.536 15.536a1 1 0 0 0-1.415-1.415 2.987 2.987 0 0 1-2.12.879 2.988 2.988 0 0 1-2.122-.879 1 1 0 1 0-1.414 1.415A4.987 4.987 0 0 0 12 17c1.38 0 2.632-.56 3.536-1.464ZM10 10.5a1.5 1.5 0 1 1-3 0 1.5 1.5 0 0 1 3 0Zm5.5 1.5a1.5 1.5 0 1 0 0-3 1.5 1.5 0 0 0 0 3Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M22 12c0 5.523-4.477 10-10 10S2 17.523 2 12 6.477 2 12 2s10 4.477 10 10Zm-2 0a8 8 0 1 0-16 0 8 8 0 0 0 16 0Z" + })] + }); +} +; +ReactionIcon.displayName = "ReactionIcon"; +module.exports = ReactionIcon; \ No newline at end of file diff --git a/assets/web/icons/reply.cjs b/assets/web/icons/reply.cjs new file mode 100644 index 00000000..0e99f689 --- /dev/null +++ b/assets/web/icons/reply.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ReplyIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9.405 5.708c.39-.39.39-1.025 0-1.416a.996.996 0 0 0-1.412 0L3.294 9.006a1.004 1.004 0 0 0 0 1.416l4.699 4.714a.996.996 0 0 0 1.412 0c.39-.39.39-1.025 0-1.416l-3.043-3.053h9.153c1.887 0 3.485 1.604 3.485 3.666C19 16.396 17.402 18 15.515 18h-2.093a1 1 0 1 0 0 2h2.093C18.58 20 21 17.425 21 14.333c0-3.091-2.419-5.666-5.485-5.666H6.456l2.949-2.959Z" + }) + }); +} +; +ReplyIcon.displayName = "ReplyIcon"; +module.exports = ReplyIcon; \ No newline at end of file diff --git a/assets/web/icons/restart.cjs b/assets/web/icons/restart.cjs new file mode 100644 index 00000000..f395bfc3 --- /dev/null +++ b/assets/web/icons/restart.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function RestartIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M18.93 8A8 8 0 1 1 4 12a1 1 0 1 0-2 0c0 5.523 4.477 10 10 10s10-4.477 10-10a9.966 9.966 0 0 0-.832-4A10.002 10.002 0 0 0 12 2a9.985 9.985 0 0 0-8 3.999V4a1 1 0 0 0-2 0v4a1 1 0 0 0 1 1h4a1 1 0 0 0 0-2H5.755A7.985 7.985 0 0 1 12 4a7.997 7.997 0 0 1 6.93 4Z" + }) + }); +} +; +RestartIcon.displayName = "RestartIcon"; +module.exports = RestartIcon; \ No newline at end of file diff --git a/assets/web/icons/search.cjs b/assets/web/icons/search.cjs new file mode 100644 index 00000000..f7390669 --- /dev/null +++ b/assets/web/icons/search.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SearchIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M15.05 16.463a7.5 7.5 0 1 1 1.414-1.414l3.243 3.244a1 1 0 0 1-1.414 1.414l-3.244-3.244ZM16 10.5a5.5 5.5 0 1 0-11 0 5.5 5.5 0 0 0 11 0Z" + }) + }); +} +; +SearchIcon.displayName = "SearchIcon"; +module.exports = SearchIcon; \ No newline at end of file diff --git a/assets/web/icons/send-solid.cjs b/assets/web/icons/send-solid.cjs new file mode 100644 index 00000000..19e4f267 --- /dev/null +++ b/assets/web/icons/send-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SendSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m21.211 12.895-16.14 8.07c-.785.392-1.658-.342-1.406-1.182L5.7 13h6.55a1 1 0 1 0 0-2H5.7L3.665 4.217c-.252-.84.621-1.574 1.405-1.182l16.141 8.07a1 1 0 0 1 0 1.79Z" + }) + }); +} +; +SendSolidIcon.displayName = "SendSolidIcon"; +module.exports = SendSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/send.cjs b/assets/web/icons/send.cjs new file mode 100644 index 00000000..b60d6b71 --- /dev/null +++ b/assets/web/icons/send.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SendIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "m5.07 20.965 16.141-8.07a1 1 0 0 0 0-1.79l-16.14-8.07c-.785-.392-1.658.342-1.406 1.182l2.249 7.496a1 1 0 0 1 0 .574l-2.249 7.496c-.252.84.621 1.574 1.405 1.182ZM6.246 5.859 18.528 12 6.246 18.141 7.788 13h4.462a1 1 0 1 0 0-2H7.788L6.246 5.859Z", + clipRule: "evenodd" + }) + }); +} +; +SendIcon.displayName = "SendIcon"; +module.exports = SendIcon; \ No newline at end of file diff --git a/assets/web/icons/settings-solid.cjs b/assets/web/icons/settings-solid.cjs new file mode 100644 index 00000000..d6e838b7 --- /dev/null +++ b/assets/web/icons/settings-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SettingsSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.731 2C13.432 2 14 2.568 14 3.269c0 .578.396 1.074.935 1.286.085.034.17.07.253.106.531.23 1.162.16 1.572-.25a1.269 1.269 0 0 1 1.794 0l1.034 1.035a1.269 1.269 0 0 1 0 1.794c-.41.41-.48 1.04-.248 1.572.036.084.07.168.105.253.212.539.708.935 1.286.935.701 0 1.269.568 1.269 1.269v1.462c0 .701-.568 1.269-1.269 1.269-.578 0-1.074.396-1.287.935-.033.085-.068.17-.104.253-.232.531-.161 1.162.248 1.572a1.269 1.269 0 0 1 0 1.794l-1.034 1.034a1.269 1.269 0 0 1-1.794 0c-.41-.41-1.04-.48-1.572-.248a7.935 7.935 0 0 1-.253.105c-.539.212-.935.708-.935 1.286 0 .701-.568 1.269-1.269 1.269H11.27c-.702 0-1.27-.568-1.27-1.269 0-.578-.396-1.074-.935-1.287a7.975 7.975 0 0 1-.253-.104c-.531-.232-1.162-.161-1.572.248a1.269 1.269 0 0 1-1.794 0l-1.034-1.034a1.269 1.269 0 0 1 0-1.794c.41-.41.48-1.04.249-1.572a7.89 7.89 0 0 1-.106-.253C4.343 14.396 3.847 14 3.27 14 2.568 14 2 13.432 2 12.731V11.27c0-.702.568-1.27 1.269-1.27.578 0 1.074-.396 1.286-.935.034-.085.07-.17.106-.253.23-.531.16-1.162-.25-1.572a1.269 1.269 0 0 1 0-1.794l1.035-1.034a1.269 1.269 0 0 1 1.794 0c.41.41 1.04.48 1.572.249a7.93 7.93 0 0 1 .253-.106c.539-.212.935-.708.935-1.286C10 2.568 10.568 2 11.269 2h1.462ZM12 16a4 4 0 1 0 0-8 4 4 0 0 0 0 8Z" + }) + }); +} +; +SettingsSolidIcon.displayName = "SettingsSolidIcon"; +module.exports = SettingsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/settings.cjs b/assets/web/icons/settings.cjs new file mode 100644 index 00000000..0ca0f358 --- /dev/null +++ b/assets/web/icons/settings.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SettingsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M16 12a4 4 0 1 1-8 0 4 4 0 0 1 8 0Zm-2 0a2 2 0 1 0-4 0 2 2 0 0 0 4 0Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11.312 2h1.376A2.312 2.312 0 0 1 15 4.312v.247l.002.003c.01.014.031.033.064.047.03.013.056.013.07.01h.002l.177-.177a2.312 2.312 0 0 1 3.27 0l.973.974a2.312 2.312 0 0 1 0 3.269l-.177.177v.003a.134.134 0 0 0 .01.07.153.153 0 0 0 .047.063l.003.002h.247A2.312 2.312 0 0 1 22 11.312v1.376A2.312 2.312 0 0 1 19.688 15h-.247l-.003.002a.152.152 0 0 0-.047.064.134.134 0 0 0-.01.07v.002l.177.177a2.312 2.312 0 0 1 0 3.27l-.974.973a2.312 2.312 0 0 1-3.269 0l-.177-.177h-.003a.134.134 0 0 0-.07.01.152.152 0 0 0-.063.047l-.002.003v.247A2.312 2.312 0 0 1 12.688 22h-1.376A2.312 2.312 0 0 1 9 19.688v-.247l-.002-.003a.153.153 0 0 0-.064-.047.134.134 0 0 0-.07-.01h-.002l-.177.177a2.312 2.312 0 0 1-3.27 0l-.973-.974a2.312 2.312 0 0 1 0-3.269l.177-.177v-.003a.135.135 0 0 0-.01-.07.152.152 0 0 0-.047-.063L4.559 15h-.247A2.312 2.312 0 0 1 2 12.688v-1.376A2.312 2.312 0 0 1 4.312 9h.247l.003-.002a.153.153 0 0 0 .047-.064.135.135 0 0 0 .01-.07v-.002l-.177-.177a2.312 2.312 0 0 1 0-3.27l.974-.973a2.312 2.312 0 0 1 3.269 0l.177.177h.003a.135.135 0 0 0 .07-.01.153.153 0 0 0 .063-.047L9 4.559v-.247A2.312 2.312 0 0 1 11.312 2ZM11 4.312v.257c0 .893-.59 1.593-1.299 1.887-.716.297-1.622.21-2.248-.418l-.182-.182a.312.312 0 0 0-.441 0l-.974.974a.312.312 0 0 0 0 .44l.182.183c.627.626.715 1.531.418 2.248C6.162 10.41 5.462 11 4.569 11h-.257a.312.312 0 0 0-.312.312v1.376c0 .172.14.312.312.312h.257c.893 0 1.593.59 1.887 1.299.297.716.21 1.622-.418 2.248l-.182.182a.312.312 0 0 0 0 .441l.974.973a.31.31 0 0 0 .44 0l.183-.181c.626-.627 1.532-.715 2.248-.418.709.294 1.299.994 1.299 1.887v.257c0 .172.14.312.312.312h1.376c.172 0 .312-.14.312-.312v-.257c0-.893.59-1.593 1.299-1.887.716-.297 1.622-.21 2.248.418l.182.181c.122.122.32.122.441 0l.973-.973a.312.312 0 0 0 0-.44l-.181-.183c-.627-.627-.715-1.532-.418-2.248.294-.709.994-1.299 1.887-1.299h.257c.172 0 .312-.14.312-.312v-1.376a.312.312 0 0 0-.312-.312h-.257c-.893 0-1.593-.59-1.887-1.299-.297-.717-.21-1.622.418-2.248l.181-.182a.312.312 0 0 0 0-.441l-.973-.974a.312.312 0 0 0-.44 0l-.183.182c-.627.627-1.532.715-2.248.418C13.59 6.162 13 5.462 13 4.569v-.257A.312.312 0 0 0 12.688 4h-1.376a.312.312 0 0 0-.312.312Z" + })] + }); +} +; +SettingsIcon.displayName = "SettingsIcon"; +module.exports = SettingsIcon; \ No newline at end of file diff --git a/assets/web/icons/share-android.cjs b/assets/web/icons/share-android.cjs new file mode 100644 index 00000000..263a76a5 --- /dev/null +++ b/assets/web/icons/share-android.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ShareAndroidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M13 5a4 4 0 1 1 1.4 3.04l-3.653 2.558a3.998 3.998 0 0 1 0 2.804L14.4 15.96a4 4 0 1 1-1.148 1.638L9.6 15.04a4 4 0 1 1 0-6.08l3.654-2.558A3.992 3.992 0 0 1 13 5Zm4-2a2 2 0 1 0 0 4 2 2 0 0 0 0-4ZM7 10a2 2 0 1 0 0 4 2 2 0 0 0 0-4Zm10 7a2 2 0 1 0 0 4 2 2 0 0 0 0-4Z" + }) + }); +} +; +ShareAndroidIcon.displayName = "ShareAndroidIcon"; +module.exports = ShareAndroidIcon; \ No newline at end of file diff --git a/assets/web/icons/share-ios.cjs b/assets/web/icons/share-ios.cjs new file mode 100644 index 00000000..148c20ad --- /dev/null +++ b/assets/web/icons/share-ios.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ShareIosIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.707 2.293a1 1 0 0 0-1.414 0l-2.5 2.5a1 1 0 0 0 1.414 1.414L11 5.414V14a1 1 0 1 0 2 0V5.414l.793.793a1 1 0 1 0 1.414-1.414l-2.5-2.5Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 20V10h2a1 1 0 0 0 0-2H6a2 2 0 0 0-2 2v10a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V10a2 2 0 0 0-2-2h-2a1 1 0 1 0 0 2h2v10H6Z" + })] + }); +} +; +ShareIosIcon.displayName = "ShareIosIcon"; +module.exports = ShareIosIcon; \ No newline at end of file diff --git a/assets/web/icons/share-screen-solid.cjs b/assets/web/icons/share-screen-solid.cjs new file mode 100644 index 00000000..b6afd438 --- /dev/null +++ b/assets/web/icons/share-screen-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ShareScreenSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M1.288 20.712A.965.965 0 0 0 2 21h20c.283 0 .52-.096.712-.288A.968.968 0 0 0 23 20a.968.968 0 0 0-.288-.712A.968.968 0 0 0 22 19H2a.967.967 0 0 0-.712.288A.968.968 0 0 0 1 20c0 .283.096.52.288.712Zm1.299-3.299A1.926 1.926 0 0 1 2 16V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 4 3h16c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v11c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 18H4c-.55 0-1.02-.196-1.413-.587Zm10.12-10.12a1 1 0 0 0-1.414 0l-2.5 2.5a1 1 0 0 0 1.414 1.414l.793-.793V13a1 1 0 1 0 2 0v-2.586l.793.793a1 1 0 0 0 1.414-1.414l-2.5-2.5Z" + }) + }); +} +; +ShareScreenSolidIcon.displayName = "ShareScreenSolidIcon"; +module.exports = ShareScreenSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/share-screen.cjs b/assets/web/icons/share-screen.cjs new file mode 100644 index 00000000..d9ebfb1e --- /dev/null +++ b/assets/web/icons/share-screen.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ShareScreenIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M1.288 20.712A.965.965 0 0 0 2 21h20c.283 0 .52-.096.712-.288A.968.968 0 0 0 23 20a.968.968 0 0 0-.288-.712A.968.968 0 0 0 22 19H2a.967.967 0 0 0-.712.288A.968.968 0 0 0 1 20c0 .283.096.52.288.712ZM12.707 7.293a1 1 0 0 0-1.414 0l-2.5 2.5a1 1 0 0 0 1.414 1.414l.793-.793V13a1 1 0 1 0 2 0v-2.586l.793.793a1 1 0 0 0 1.414-1.414l-2.5-2.5Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2.587 17.413C2.98 17.803 3.45 18 4 18h16c.55 0 1.02-.196 1.413-.587A1.93 1.93 0 0 0 22 16V5c0-.55-.196-1.02-.587-1.413A1.926 1.926 0 0 0 20 3H4c-.55 0-1.02.196-1.413.587A1.926 1.926 0 0 0 2 5v11c0 .55.196 1.02.587 1.413ZM20 5v11H4V5h16Z" + })] + }); +} +; +ShareScreenIcon.displayName = "ShareScreenIcon"; +module.exports = ShareScreenIcon; \ No newline at end of file diff --git a/assets/web/icons/share.cjs b/assets/web/icons/share.cjs new file mode 100644 index 00000000..0b2db18a --- /dev/null +++ b/assets/web/icons/share.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ShareIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 16a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 15V7.85L9.125 9.725c-.2.2-.433.3-.7.3-.267 0-.508-.108-.725-.325a.93.93 0 0 1-.288-.713A.977.977 0 0 1 7.7 8.3l3.6-3.6c.1-.1.208-.17.325-.213.117-.041.242-.062.375-.062s.258.02.375.062a.877.877 0 0 1 .325.213l3.6 3.6c.2.2.296.437.287.712a.977.977 0 0 1-.287.688c-.2.2-.438.304-.713.313a.93.93 0 0 1-.712-.288L13 7.85V15c0 .283-.096.52-.287.713A.968.968 0 0 1 12 16Zm-6 4c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18v-2c0-.283.096-.52.287-.713A.967.967 0 0 1 5 15c.283 0 .52.096.713.287.191.192.287.43.287.713v2h12v-2a.97.97 0 0 1 .288-.713A.968.968 0 0 1 19 15a.97.97 0 0 1 .712.287c.192.192.288.43.288.713v2c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6Z" + }) + }); +} +; +ShareIcon.displayName = "ShareIcon"; +module.exports = ShareIcon; \ No newline at end of file diff --git a/assets/web/icons/sidebar.cjs b/assets/web/icons/sidebar.cjs new file mode 100644 index 00000000..28264b3a --- /dev/null +++ b/assets/web/icons/sidebar.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SidebarIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M18 3a4 4 0 0 1 4 4v10a4 4 0 0 1-4 4H6a4 4 0 0 1-4-4V7a4 4 0 0 1 4-4h12Zm-8 2h8a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2h-8V5ZM8 19H6a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2h2v14Z", + clipRule: "evenodd" + }) + }); +} +; +SidebarIcon.displayName = "SidebarIcon"; +module.exports = SidebarIcon; \ No newline at end of file diff --git a/assets/web/icons/sign-out.cjs b/assets/web/icons/sign-out.cjs new file mode 100644 index 00000000..ebd86aeb --- /dev/null +++ b/assets/web/icons/sign-out.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SignOutIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9 12.031a.97.97 0 0 1 .287-.712.968.968 0 0 1 .713-.289h7.15l-1.875-1.875a.96.96 0 0 1-.3-.7c0-.266.108-.508.325-.725a.93.93 0 0 1 .712-.287.977.977 0 0 1 .688.287l3.6 3.6c.1.1.17.209.212.325.042.117.063.242.063.375 0 .134-.02.259-.063.375a.877.877 0 0 1-.212.325l-3.6 3.6a.93.93 0 0 1-.712.288.977.977 0 0 1-.688-.288 1.02 1.02 0 0 1-.313-.712.93.93 0 0 1 .288-.713l1.875-1.875H10a.968.968 0 0 1-.713-.287A.968.968 0 0 1 9 12.03Zm-6-7c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 5 3.03h6a.97.97 0 0 1 .713.288.968.968 0 0 1 .287.712.97.97 0 0 1-.287.713.968.968 0 0 1-.713.287H5v14h6a.97.97 0 0 1 .713.288.968.968 0 0 1 .287.712.97.97 0 0 1-.287.713.968.968 0 0 1-.713.287H5c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19.03v-14Z" + }) + }); +} +; +SignOutIcon.displayName = "SignOutIcon"; +module.exports = SignOutIcon; \ No newline at end of file diff --git a/assets/web/icons/spinner.cjs b/assets/web/icons/spinner.cjs new file mode 100644 index 00000000..9548fec9 --- /dev/null +++ b/assets/web/icons/spinner.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SpinnerIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M12 4.031a8 8 0 1 0 8 8 1 1 0 0 1 2 0c0 5.523-4.477 10-10 10s-10-4.477-10-10 4.477-10 10-10a1 1 0 1 1 0 2Z", + clipRule: "evenodd" + }) + }); +} +; +SpinnerIcon.displayName = "SpinnerIcon"; +module.exports = SpinnerIcon; \ No newline at end of file diff --git a/assets/web/icons/spotlight.cjs b/assets/web/icons/spotlight.cjs new file mode 100644 index 00000000..9aa76e74 --- /dev/null +++ b/assets/web/icons/spotlight.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SpotlightIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 5h14v8h-5a1 1 0 0 0-1 1v5H5V5Zm10 14v-4h4v4h-4ZM5 21h14a2 2 0 0 0 2-2V5a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2Z" + }) + }); +} +; +SpotlightIcon.displayName = "SpotlightIcon"; +module.exports = SpotlightIcon; \ No newline at end of file diff --git a/assets/web/icons/strikethrough.cjs b/assets/web/icons/strikethrough.cjs new file mode 100644 index 00000000..5d04d76e --- /dev/null +++ b/assets/web/icons/strikethrough.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function StrikethroughIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.15 20c-1.267 0-2.392-.375-3.375-1.125-.983-.75-1.692-1.775-2.125-3.075l2.2-.95c.233.8.638 1.458 1.213 1.975.574.517 1.287.775 2.137.775.7 0 1.333-.167 1.9-.5.567-.333.85-.867.85-1.6 0-.3-.058-.575-.175-.825A2.362 2.362 0 0 0 14.3 14h2.8a4.279 4.279 0 0 1 .25 1.5c0 1.433-.513 2.542-1.538 3.325C14.788 19.608 13.567 20 12.15 20ZM3 12a.968.968 0 0 1-.712-.287A.968.968 0 0 1 2 11a.97.97 0 0 1 .288-.713A.967.967 0 0 1 3 10h18a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 21 12H3Zm9.05-8.15c1.1 0 2.063.27 2.887.812.825.542 1.463 1.371 1.913 2.488l-2.2.975a2.987 2.987 0 0 0-.838-1.3c-.408-.383-.979-.575-1.712-.575-.683 0-1.25.154-1.7.462-.45.309-.7.738-.75 1.288h-2.4c.033-1.15.487-2.13 1.363-2.938.875-.808 2.02-1.212 3.437-1.212Z" + }) + }); +} +; +StrikethroughIcon.displayName = "StrikethroughIcon"; +module.exports = StrikethroughIcon; \ No newline at end of file diff --git a/assets/web/icons/switch-camera-solid.cjs b/assets/web/icons/switch-camera-solid.cjs new file mode 100644 index 00000000..caae19c2 --- /dev/null +++ b/assets/web/icons/switch-camera-solid.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function SwitchCameraSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M15.793 2.293a1 1 0 0 1 1.414 0l2 2a1 1 0 0 1 0 1.414l-2 2a1 1 0 1 1-1.414-1.414L16.086 6H5.5a2 2 0 0 0-2 2v7a1 1 0 1 1-2 0V8a4 4 0 0 1 4-4h10.586l-.293-.293a1 1 0 0 1 0-1.414ZM17.5 18H6.914l.293-.293a1 1 0 1 0-1.414-1.414l-2 2a1 1 0 0 0 0 1.414l2 2a1 1 0 1 0 1.414-1.414L6.914 20H17.5a4 4 0 0 0 4-4V9a1 1 0 1 0-2 0v7a2 2 0 0 1-2 2Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11.5 15a3 3 0 1 0 0-6 3 3 0 0 0 0 6Z" + })] + }); +} +; +SwitchCameraSolidIcon.displayName = "SwitchCameraSolidIcon"; +module.exports = SwitchCameraSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/take-photo-solid.cjs b/assets/web/icons/take-photo-solid.cjs new file mode 100644 index 00000000..2d47fe47 --- /dev/null +++ b/assets/web/icons/take-photo-solid.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function TakePhotoSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M2.587 20.413C2.98 20.803 3.45 21 4 21h16c.55 0 1.02-.196 1.413-.587A1.93 1.93 0 0 0 22 19V7c0-.55-.196-1.02-.587-1.412A1.926 1.926 0 0 0 20 5h-3.15L15.6 3.65a2.009 2.009 0 0 0-.662-.475A1.952 1.952 0 0 0 14.124 3h-4.25a2.011 2.011 0 0 0-1.475.65L7.15 5H4c-.55 0-1.02.196-1.413.588A1.926 1.926 0 0 0 2 7v12c0 .55.196 1.02.587 1.413ZM12 16.5a3.5 3.5 0 1 0 0-7 3.5 3.5 0 0 0 0 7Z", + clipRule: "evenodd" + }) + }); +} +; +TakePhotoSolidIcon.displayName = "TakePhotoSolidIcon"; +module.exports = TakePhotoSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/take-photo.cjs b/assets/web/icons/take-photo.cjs new file mode 100644 index 00000000..f2a93433 --- /dev/null +++ b/assets/web/icons/take-photo.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function TakePhotoIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 17.5c1.25 0 2.313-.438 3.188-1.313.874-.875 1.312-1.937 1.312-3.187 0-1.25-.438-2.313-1.313-3.188C14.313 8.938 13.25 8.5 12 8.5c-1.25 0-2.313.438-3.188 1.313C7.939 10.687 7.5 11.75 7.5 13c0 1.25.438 2.313 1.313 3.188.874.875 1.937 1.312 3.187 1.312Zm0-2c-.7 0-1.292-.242-1.775-.725C9.742 14.292 9.5 13.7 9.5 13s.242-1.292.725-1.775c.483-.483 1.075-.725 1.775-.725s1.292.242 1.775.725c.483.483.725 1.075.725 1.775s-.242 1.292-.725 1.775c-.483.483-1.075.725-1.775.725ZM4 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 19V7c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 4 5h3.15L8.4 3.65A2.011 2.011 0 0 1 9.875 3h4.25a2.011 2.011 0 0 1 1.475.65L16.85 5H20c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v12c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 21H4Zm0-2h16V7h-4.05l-1.825-2h-4.25L8.05 7H4v12Z" + }) + }); +} +; +TakePhotoIcon.displayName = "TakePhotoIcon"; +module.exports = TakePhotoIcon; \ No newline at end of file diff --git a/assets/web/icons/text-formatting.cjs b/assets/web/icons/text-formatting.cjs new file mode 100644 index 00000000..eeef5ca3 --- /dev/null +++ b/assets/web/icons/text-formatting.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function TextFormattingIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 19a.967.967 0 0 1-.713-.288A.968.968 0 0 1 5 18a.97.97 0 0 1 .287-.712A.967.967 0 0 1 6 17h12c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 18 19H6Zm1.35-5.2 3.425-9.2a.882.882 0 0 1 .338-.438A.93.93 0 0 1 11.65 4h.7c.2 0 .38.054.537.162a.886.886 0 0 1 .338.438l3.425 9.225c.1.283.067.55-.1.8a.795.795 0 0 1-.7.375.89.89 0 0 1-.512-.162A.882.882 0 0 1 15 14.4l-.75-2.2H9.8L9 14.425a.838.838 0 0 1-.325.425c-.15.1-.317.15-.5.15a.84.84 0 0 1-.738-.387.815.815 0 0 1-.087-.813Zm3-3.2h3.3l-1.6-4.55h-.1l-1.6 4.55Z" + }) + }); +} +; +TextFormattingIcon.displayName = "TextFormattingIcon"; +module.exports = TextFormattingIcon; \ No newline at end of file diff --git a/assets/web/icons/threads-solid.cjs b/assets/web/icons/threads-solid.cjs new file mode 100644 index 00000000..dce2a96f --- /dev/null +++ b/assets/web/icons/threads-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ThreadsSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 3h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H6l-2.293 2.293c-.63.63-1.707.184-1.707-.707V5a2 2 0 0 1 2-2Zm3 7h10a.97.97 0 0 0 .712-.287A.967.967 0 0 0 18 9a.967.967 0 0 0-.288-.713A.968.968 0 0 0 17 8H7a.968.968 0 0 0-.713.287A.968.968 0 0 0 6 9c0 .283.096.52.287.713.192.191.43.287.713.287Zm0 4h6c.283 0 .52-.096.713-.287A.968.968 0 0 0 14 13a.968.968 0 0 0-.287-.713A.968.968 0 0 0 13 12H7a.967.967 0 0 0-.713.287A.968.968 0 0 0 6 13c0 .283.096.52.287.713.192.191.43.287.713.287Z" + }) + }); +} +; +ThreadsSolidIcon.displayName = "ThreadsSolidIcon"; +module.exports = ThreadsSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/threads.cjs b/assets/web/icons/threads.cjs new file mode 100644 index 00000000..9b5298e7 --- /dev/null +++ b/assets/web/icons/threads.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function ThreadsIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M7 10a.968.968 0 0 1-.713-.287A.968.968 0 0 1 6 9c0-.283.096-.52.287-.713A.968.968 0 0 1 7 8h10a.97.97 0 0 1 .712.287c.192.192.288.43.288.713s-.096.52-.288.713A.968.968 0 0 1 17 10H7Zm0 4a.967.967 0 0 1-.713-.287A.968.968 0 0 1 6 13c0-.283.096-.52.287-.713A.967.967 0 0 1 7 12h6c.283 0 .52.096.713.287.191.192.287.43.287.713s-.096.52-.287.713A.968.968 0 0 1 13 14H7Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3.707 21.293c-.63.63-1.707.184-1.707-.707V5a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2H6l-2.293 2.293ZM6 17h14V5H4v13.172l.586-.586A2 2 0 0 1 6 17Z" + })] + }); +} +; +ThreadsIcon.displayName = "ThreadsIcon"; +module.exports = ThreadsIcon; \ No newline at end of file diff --git a/assets/web/icons/time.cjs b/assets/web/icons/time.cjs new file mode 100644 index 00000000..0e60715d --- /dev/null +++ b/assets/web/icons/time.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function TimeIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M13 8a1 1 0 1 0-2 0v4a1 1 0 0 0 .293.707l2.83 2.83a1 1 0 0 0 1.414-1.414L13 11.586V8Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M22 11.915c0 5.523-4.477 10-10 10s-10-4.477-10-10 4.477-10 10-10 10 4.477 10 10Zm-2 0a8 8 0 1 1-16 0 8 8 0 0 1 16 0Z", + clipRule: "evenodd" + })] + }); +} +; +TimeIcon.displayName = "TimeIcon"; +module.exports = TimeIcon; \ No newline at end of file diff --git a/assets/web/icons/underline.cjs b/assets/web/icons/underline.cjs new file mode 100644 index 00000000..a2c5a357 --- /dev/null +++ b/assets/web/icons/underline.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UnderlineIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 21a.967.967 0 0 1-.713-.288A.968.968 0 0 1 5 20a.97.97 0 0 1 .287-.712A.967.967 0 0 1 6 19h12c.283 0 .52.096.712.288.192.191.288.429.288.712s-.096.52-.288.712A.968.968 0 0 1 18 21H6Zm6-4c-1.683 0-2.992-.525-3.925-1.575-.933-1.05-1.4-2.442-1.4-4.175V4.275c0-.35.13-.65.388-.9A1.27 1.27 0 0 1 7.974 3c.35 0 .65.125.9.375s.375.55.375.9V11.4c0 .933.233 1.692.7 2.275.467.583 1.15.875 2.05.875.9 0 1.583-.292 2.05-.875.467-.583.7-1.342.7-2.275V4.275c0-.35.13-.65.387-.9A1.27 1.27 0 0 1 16.05 3c.35 0 .65.125.9.375s.375.55.375.9v6.975c0 1.733-.467 3.125-1.4 4.175C14.992 16.475 13.683 17 12 17Z" + }) + }); +} +; +UnderlineIcon.displayName = "UnderlineIcon"; +module.exports = UnderlineIcon; \ No newline at end of file diff --git a/assets/web/icons/unknown-solid.cjs b/assets/web/icons/unknown-solid.cjs new file mode 100644 index 00000000..f6d50dc0 --- /dev/null +++ b/assets/web/icons/unknown-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UnknownSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.999 13.011v-.004.005Zm-9.412 7.402C3.98 20.803 4.45 21 5 21h14c.55 0 1.02-.196 1.413-.587A1.93 1.93 0 0 0 21 19V5c0-.55-.196-1.02-.587-1.413A1.926 1.926 0 0 0 19 3H5c-.55 0-1.02.196-1.413.587A1.926 1.926 0 0 0 3 5v14c0 .55.196 1.02.587 1.413ZM12 9a1 1 0 0 0-1 1 1 1 0 1 1-2 0 3 3 0 1 1 4.44 2.633 1.404 1.404 0 0 0-.383.288.3.3 0 0 0-.057.085A1 1 0 0 1 11 13c0-.58.253-1.047.539-1.38.281-.33.63-.572.94-.742A1 1 0 0 0 12 9Zm1 7a1 1 0 1 1-2 0 1 1 0 0 1 2 0Z" + }) + }); +} +; +UnknownSolidIcon.displayName = "UnknownSolidIcon"; +module.exports = UnknownSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/unknown.cjs b/assets/web/icons/unknown.cjs new file mode 100644 index 00000000..7b8c7ebb --- /dev/null +++ b/assets/web/icons/unknown.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UnknownIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M5 21c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 3 19V5c0-.55.196-1.02.587-1.413A1.926 1.926 0 0 1 5 3h14c.55 0 1.02.196 1.413.587.39.393.587.863.587 1.413v14c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 19 21H5Zm0-2h14V5H5v14Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M11 10a1 1 0 1 1 1.479.878c-.31.17-.659.413-.94.741-.286.334-.539.8-.539 1.381a1 1 0 0 0 2 .006.3.3 0 0 1 .057-.085 1.39 1.39 0 0 1 .382-.288A3 3 0 1 0 9 10a1 1 0 1 0 2 0Zm1.999 3.011v-.004.005ZM12 17a1 1 0 1 0 0-2 1 1 0 0 0 0 2Z" + })] + }); +} +; +UnknownIcon.displayName = "UnknownIcon"; +module.exports = UnknownIcon; \ No newline at end of file diff --git a/assets/web/icons/user-add-solid.cjs b/assets/web/icons/user-add-solid.cjs new file mode 100644 index 00000000..49b677be --- /dev/null +++ b/assets/web/icons/user-add-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UserAddSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M10 12c-1.1 0-2.042-.392-2.825-1.175C6.392 10.042 6 9.1 6 8s.392-2.042 1.175-2.825C7.958 4.392 8.9 4 10 4s2.042.392 2.825 1.175C13.608 5.958 14 6.9 14 8s-.392 2.042-1.175 2.825C12.042 11.608 11.1 12 10 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 3.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 10 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 16 20H4c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 18Zm15-7h2v2c0 .283.096.52.288.713.191.191.429.287.712.287s.52-.096.712-.287A.968.968 0 0 0 21 13v-2h2a.97.97 0 0 0 .712-.287A.968.968 0 0 0 24 10a.967.967 0 0 0-.288-.713A.968.968 0 0 0 23 9h-2V7a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 6a.968.968 0 0 0-.712.287A.967.967 0 0 0 19 7v2h-2a.968.968 0 0 0-.712.287A.967.967 0 0 0 16 10c0 .283.096.52.288.713A.968.968 0 0 0 17 11Z" + }) + }); +} +; +UserAddSolidIcon.displayName = "UserAddSolidIcon"; +module.exports = UserAddSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/user-add.cjs b/assets/web/icons/user-add.cjs new file mode 100644 index 00000000..b7261e0b --- /dev/null +++ b/assets/web/icons/user-add.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UserAddIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M10 12c-1.1 0-2.042-.392-2.825-1.175C6.392 10.042 6 9.1 6 8s.392-2.042 1.175-2.825C7.958 4.392 8.9 4 10 4s2.042.392 2.825 1.175C13.608 5.958 14 6.9 14 8s-.392 2.042-1.175 2.825C12.042 11.608 11.1 12 10 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 3.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 10 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 16 20H4c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 18Zm2 0h12v-.8a.973.973 0 0 0-.5-.85c-.9-.45-1.808-.787-2.725-1.012a11.6 11.6 0 0 0-5.55 0c-.917.225-1.825.562-2.725 1.012a.973.973 0 0 0-.5.85v.8Zm6-8c.55 0 1.02-.196 1.412-.588C11.804 9.021 12 8.55 12 8c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 10 6c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 8 8c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Zm7 1h2v2c0 .283.096.52.288.713.191.191.429.287.712.287s.52-.096.712-.287A.968.968 0 0 0 21 13v-2h2a.97.97 0 0 0 .712-.287A.968.968 0 0 0 24 10a.967.967 0 0 0-.288-.713A.968.968 0 0 0 23 9h-2V7a.967.967 0 0 0-.288-.713A.968.968 0 0 0 20 6a.968.968 0 0 0-.712.287A.967.967 0 0 0 19 7v2h-2a.968.968 0 0 0-.712.287A.967.967 0 0 0 16 10c0 .283.096.52.288.713A.968.968 0 0 0 17 11Z" + }) + }); +} +; +UserAddIcon.displayName = "UserAddIcon"; +module.exports = UserAddIcon; \ No newline at end of file diff --git a/assets/web/icons/user-profile-solid.cjs b/assets/web/icons/user-profile-solid.cjs new file mode 100644 index 00000000..289572c4 --- /dev/null +++ b/assets/web/icons/user-profile-solid.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UserProfileSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 15c-1.1 0-2.042-.392-2.825-1.175C8.392 13.042 8 12.1 8 11s.392-2.042 1.175-2.825C9.958 7.392 10.9 7 12 7s2.042.392 2.825 1.175C15.608 8.958 16 9.9 16 11s-.392 2.042-1.175 2.825C14.042 14.608 13.1 15 12 15Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M19.528 18.583A9.962 9.962 0 0 0 22 12c0-5.523-4.477-10-10-10S2 6.477 2 12c0 2.52.933 4.824 2.472 6.583A9.976 9.976 0 0 0 12 22a9.976 9.976 0 0 0 7.528-3.417ZM8.75 16.388c-.915.221-1.818.538-2.709.95a8 8 0 1 1 11.918 0 14.679 14.679 0 0 0-2.709-.95A13.76 13.76 0 0 0 12 16c-1.1 0-2.183.13-3.25.387Z" + })] + }); +} +; +UserProfileSolidIcon.displayName = "UserProfileSolidIcon"; +module.exports = UserProfileSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/user-profile.cjs b/assets/web/icons/user-profile.cjs new file mode 100644 index 00000000..4f1c9e7f --- /dev/null +++ b/assets/web/icons/user-profile.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UserProfileIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M9.175 13.825C9.958 14.608 10.9 15 12 15s2.042-.392 2.825-1.175C15.608 13.042 16 12.1 16 11s-.392-2.042-1.175-2.825C14.042 7.392 13.1 7 12 7s-2.042.392-2.825 1.175C8.392 8.958 8 9.9 8 11s.392 2.042 1.175 2.825Zm4.237-1.412A1.926 1.926 0 0 1 12 13c-.55 0-1.02-.196-1.412-.588A1.926 1.926 0 0 1 10 11c0-.55.196-1.02.588-1.412A1.926 1.926 0 0 1 12 9c.55 0 1.02.196 1.412.588.392.391.588.862.588 1.412 0 .55-.196 1.02-.588 1.412Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M22 12c0 5.523-4.477 10-10 10S2 17.523 2 12 6.477 2 12 2s10 4.477 10 10Zm-2 0a8 8 0 1 0-16 0 8 8 0 0 0 16 0Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M16.23 18.792a12.47 12.47 0 0 0-1.455-.455 11.6 11.6 0 0 0-5.55 0c-.487.12-.972.271-1.455.455a8.04 8.04 0 0 1-1.729-1.454c.89-.412 1.794-.729 2.709-.95A13.76 13.76 0 0 1 12 16c1.1 0 2.183.13 3.25.387a14.78 14.78 0 0 1 2.709.95 8.042 8.042 0 0 1-1.73 1.455Z" + })] + }); +} +; +UserProfileIcon.displayName = "UserProfileIcon"; +module.exports = UserProfileIcon; \ No newline at end of file diff --git a/assets/web/icons/user-solid.cjs b/assets/web/icons/user-solid.cjs new file mode 100644 index 00000000..f75a5a57 --- /dev/null +++ b/assets/web/icons/user-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UserSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 12c-1.1 0-2.042-.392-2.825-1.175C8.392 10.042 8 9.1 8 8s.392-2.042 1.175-2.825C9.958 4.392 10.9 4 12 4s2.042.392 2.825 1.175C15.608 5.958 16 6.9 16 8s-.392 2.042-1.175 2.825C14.042 11.608 13.1 12 12 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 5.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 12 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18Z" + }) + }); +} +; +UserSolidIcon.displayName = "UserSolidIcon"; +module.exports = UserSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/user.cjs b/assets/web/icons/user.cjs new file mode 100644 index 00000000..0bad483c --- /dev/null +++ b/assets/web/icons/user.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function UserIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 12c-1.1 0-2.042-.392-2.825-1.175C8.392 10.042 8 9.1 8 8s.392-2.042 1.175-2.825C9.958 4.392 10.9 4 12 4s2.042.392 2.825 1.175C15.608 5.958 16 6.9 16 8s-.392 2.042-1.175 2.825C14.042 11.608 13.1 12 12 12Zm-8 6v-.8c0-.567.146-1.087.438-1.563A2.911 2.911 0 0 1 5.6 14.55a14.843 14.843 0 0 1 3.15-1.163A13.76 13.76 0 0 1 12 13c1.1 0 2.183.13 3.25.387 1.067.259 2.117.646 3.15 1.163.483.25.87.612 1.163 1.087.291.476.437.996.437 1.563v.8c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 18 20H6c-.55 0-1.02-.196-1.412-.587A1.926 1.926 0 0 1 4 18Zm2 0h12v-.8a.973.973 0 0 0-.5-.85c-.9-.45-1.808-.787-2.725-1.012a11.6 11.6 0 0 0-5.55 0c-.917.225-1.825.562-2.725 1.012a.973.973 0 0 0-.5.85v.8Zm6-8c.55 0 1.02-.196 1.412-.588C13.804 9.021 14 8.55 14 8c0-.55-.196-1.02-.588-1.412A1.926 1.926 0 0 0 12 6c-.55 0-1.02.196-1.412.588A1.926 1.926 0 0 0 10 8c0 .55.196 1.02.588 1.412.391.392.862.588 1.412.588Z" + }) + }); +} +; +UserIcon.displayName = "UserIcon"; +module.exports = UserIcon; \ No newline at end of file diff --git a/assets/web/icons/verified.cjs b/assets/web/icons/verified.cjs new file mode 100644 index 00000000..5ac8234d --- /dev/null +++ b/assets/web/icons/verified.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VerifiedIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M8.15 21.75 6.7 19.3l-2.75-.6a.943.943 0 0 1-.6-.387.928.928 0 0 1-.175-.688L3.45 14.8l-1.875-2.15a.934.934 0 0 1-.25-.65c0-.25.084-.467.25-.65L3.45 9.2l-.275-2.825a.928.928 0 0 1 .175-.688.943.943 0 0 1 .6-.387l2.75-.6 1.45-2.45a.983.983 0 0 1 .55-.438.97.97 0 0 1 .7.038l2.6 1.1 2.6-1.1a.97.97 0 0 1 .7-.038.983.983 0 0 1 .55.438L17.3 4.7l2.75.6c.25.05.45.18.6.388.15.208.209.437.175.687L20.55 9.2l1.875 2.15c.167.183.25.4.25.65s-.083.467-.25.65L20.55 14.8l.275 2.825a.928.928 0 0 1-.175.688.943.943 0 0 1-.6.387l-2.75.6-1.45 2.45a.983.983 0 0 1-.55.438.97.97 0 0 1-.7-.038l-2.6-1.1-2.6 1.1a.97.97 0 0 1-.7.038.983.983 0 0 1-.55-.438Zm2.8-9.05L9.5 11.275A.933.933 0 0 0 8.813 11c-.275 0-.513.1-.713.3a.948.948 0 0 0-.275.7.95.95 0 0 0 .275.7l2.15 2.15c.2.2.434.3.7.3.267 0 .5-.1.7-.3l4.25-4.25c.2-.2.296-.433.288-.7a1.055 1.055 0 0 0-.288-.7 1.02 1.02 0 0 0-.712-.313.93.93 0 0 0-.713.288L10.95 12.7Z" + }) + }); +} +; +VerifiedIcon.displayName = "VerifiedIcon"; +module.exports = VerifiedIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-declined-solid.cjs b/assets/web/icons/video-call-declined-solid.cjs new file mode 100644 index 00000000..ef32da20 --- /dev/null +++ b/assets/web/icons/video-call-declined-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VideoCallDeclinedSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2 8a4 4 0 0 1 4-4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8Zm10.828 6.828c.2-.2.3-.436.3-.707 0-.27-.1-.506-.3-.707L11.414 12l1.414-1.414c.2-.2.3-.436.3-.707 0-.271-.1-.507-.3-.707a.969.969 0 0 0-.707-.301c-.27 0-.506.1-.707.3L10 10.587 8.586 9.172a.969.969 0 0 0-.707-.301c-.271 0-.507.1-.707.3-.2.2-.3.437-.3.708 0 .27.1.506.3.707L8.586 12l-1.414 1.414c-.2.2-.3.436-.3.707 0 .271.1.507.3.707.2.2.436.3.707.3.27 0 .506-.1.707-.3L10 13.414l1.414 1.414c.2.2.436.3.707.3.271 0 .507-.1.707-.3Z" + }) + }); +} +; +VideoCallDeclinedSolidIcon.displayName = "VideoCallDeclinedSolidIcon"; +module.exports = VideoCallDeclinedSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-missed-solid.cjs b/assets/web/icons/video-call-missed-solid.cjs new file mode 100644 index 00000000..78549fed --- /dev/null +++ b/assets/web/icons/video-call-missed-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VideoCallMissedSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2 8a4 4 0 0 1 4-4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8Zm8.7 5.15L8.5 11H9c.283 0 .52-.096.713-.287A.968.968 0 0 0 10 10a.968.968 0 0 0-.287-.713A.968.968 0 0 0 9 9H6a.968.968 0 0 0-.713.287A.968.968 0 0 0 5 10v3c0 .283.096.52.287.713.192.191.43.287.713.287s.52-.096.713-.287A.968.968 0 0 0 7 13v-.7l3 3a1.034 1.034 0 0 0 1.088.2.773.773 0 0 0 .312-.225l3.125-3.15a.918.918 0 0 0 .275-.675c0-.267-.1-.5-.3-.7a.948.948 0 0 0-.7-.275.948.948 0 0 0-.7.275l-2.4 2.4Z" + }) + }); +} +; +VideoCallMissedSolidIcon.displayName = "VideoCallMissedSolidIcon"; +module.exports = VideoCallMissedSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-off-solid.cjs b/assets/web/icons/video-call-off-solid.cjs new file mode 100644 index 00000000..912211c5 --- /dev/null +++ b/assets/web/icons/video-call-off-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VideoCallOffSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2.747 2.753 4.35 4.355l.008-.003L18 17.994v.012l3.247 3.247a1 1 0 1 1-1.414 1.414l-2.898-2.898A1.99 1.99 0 0 1 16 20H6a4 4 0 0 1-4-4V8c0-.892.292-1.715.785-2.38L1.333 4.166a1 1 0 0 1 1.414-1.414ZM18 15.166 6.834 4H16a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715v1.45Z" + }) + }); +} +; +VideoCallOffSolidIcon.displayName = "VideoCallOffSolidIcon"; +module.exports = VideoCallOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-off.cjs b/assets/web/icons/video-call-off.cjs new file mode 100644 index 00000000..68207181 --- /dev/null +++ b/assets/web/icons/video-call-off.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VideoCallOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2.747 2.753 4.35 4.355l.008-.003L6.006 6h-.012L16 16.006v-.012l2 2v.012l3.247 3.247a1 1 0 1 1-1.414 1.414l-2.898-2.898A1.99 1.99 0 0 1 16 20H6a4 4 0 0 1-4-4V8c0-.892.292-1.715.785-2.38L1.333 4.166a1 1 0 0 1 1.414-1.414Zm1.484 4.313a1.991 1.991 0 0 0-.23.934v8A2 2 0 0 0 6 18h9.166L4.23 7.066ZM16 6H8.834l-2-2H16a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715v1.45l-2-2V6Zm5 7.652v-3.303L19.073 12 21 13.652Z" + }) + }); +} +; +VideoCallOffIcon.displayName = "VideoCallOffIcon"; +module.exports = VideoCallOffIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call-solid.cjs b/assets/web/icons/video-call-solid.cjs new file mode 100644 index 00000000..2b51e921 --- /dev/null +++ b/assets/web/icons/video-call-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VideoCallSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M6 4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8a4 4 0 0 1 4-4Z" + }) + }); +} +; +VideoCallSolidIcon.displayName = "VideoCallSolidIcon"; +module.exports = VideoCallSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/video-call.cjs b/assets/web/icons/video-call.cjs new file mode 100644 index 00000000..65f818b7 --- /dev/null +++ b/assets/web/icons/video-call.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VideoCallIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M2 8a4 4 0 0 1 4-4h10a2 2 0 0 1 2 2v4.286l3.35-2.871a1 1 0 0 1 1.65.76v7.65a1 1 0 0 1-1.65.76L18 13.715V18a2 2 0 0 1-2 2H6a4 4 0 0 1-4-4V8Zm4-2a2 2 0 0 0-2 2v8a2 2 0 0 0 2 2h10V6H6Zm15 7.652v-3.303L19.073 12 21 13.652Z" + }) + }); +} +; +VideoCallIcon.displayName = "VideoCallIcon"; +module.exports = VideoCallIcon; \ No newline at end of file diff --git a/assets/web/icons/visibility-off.cjs b/assets/web/icons/visibility-off.cjs new file mode 100644 index 00000000..15a29d81 --- /dev/null +++ b/assets/web/icons/visibility-off.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VisibilityOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m16.1 13.3-1.45-1.45c.15-.783-.075-1.517-.675-2.2-.6-.683-1.375-.95-2.325-.8L10.2 7.4a4.24 4.24 0 0 1 .862-.3A4.2 4.2 0 0 1 12 7c1.25 0 2.312.437 3.187 1.312S16.5 10.25 16.5 11.5c0 .333-.034.646-.1.938a4.25 4.25 0 0 1-.3.862Zm3.2 3.15-1.45-1.4a10.956 10.956 0 0 0 1.687-1.588A8.898 8.898 0 0 0 20.8 11.5c-.834-1.683-2.03-3.02-3.588-4.013C15.654 6.496 13.916 6 12 6c-.483 0-.959.033-1.425.1a9.622 9.622 0 0 0-1.375.3L7.65 4.85A11.08 11.08 0 0 1 12 4c2.383 0 4.525.63 6.425 1.887 1.9 1.259 3.325 2.896 4.275 4.913.05.083.083.188.1.313s.025.254.025.387a1.972 1.972 0 0 1-.125.7 10.896 10.896 0 0 1-3.4 4.25Zm-.2 5.45-3.5-3.45c-.583.183-1.171.32-1.763.413-.591.091-1.204.137-1.837.137-2.384 0-4.525-.63-6.425-1.887-1.9-1.259-3.325-2.896-4.275-4.913a.813.813 0 0 1-.1-.313 2.932 2.932 0 0 1 0-.762.796.796 0 0 1 .1-.3A11.2 11.2 0 0 1 2.55 8.75 13.292 13.292 0 0 1 4.15 7L2.075 4.9a.933.933 0 0 1-.275-.688c0-.275.1-.512.3-.712a.948.948 0 0 1 .7-.275c.283 0 .516.092.7.275l17 17a.977.977 0 0 1 .287.688.93.93 0 0 1-.287.712.948.948 0 0 1-.7.275.948.948 0 0 1-.7-.275ZM5.55 8.4c-.484.433-.925.908-1.325 1.425A9.014 9.014 0 0 0 3.2 11.5c.833 1.683 2.029 3.02 3.587 4.012C8.346 16.505 10.083 17 12 17c.333 0 .658-.02.975-.063.316-.041.642-.087.975-.137l-.9-.95c-.184.05-.359.088-.525.113A3.539 3.539 0 0 1 12 16c-1.25 0-2.313-.438-3.188-1.313C7.937 13.813 7.5 12.75 7.5 11.5c0-.183.012-.358.037-.525.025-.167.063-.342.113-.525L5.55 8.4Z" + }) + }); +} +; +VisibilityOffIcon.displayName = "VisibilityOffIcon"; +module.exports = VisibilityOffIcon; \ No newline at end of file diff --git a/assets/web/icons/visibility-on.cjs b/assets/web/icons/visibility-on.cjs new file mode 100644 index 00000000..6427033b --- /dev/null +++ b/assets/web/icons/visibility-on.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VisibilityOnIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12 16c1.25 0 2.313-.438 3.188-1.313.874-.874 1.312-1.937 1.312-3.187 0-1.25-.438-2.313-1.313-3.188C14.313 7.439 13.25 7 12 7c-1.25 0-2.312.438-3.187 1.313C7.938 9.187 7.5 10.25 7.5 11.5c0 1.25.438 2.313 1.313 3.188C9.688 15.562 10.75 16 12 16Zm0-1.8c-.75 0-1.387-.262-1.912-.787A2.604 2.604 0 0 1 9.3 11.5c0-.75.263-1.387.787-1.912A2.604 2.604 0 0 1 12 8.8c.75 0 1.387.262 1.912.787.525.526.788 1.163.788 1.913s-.262 1.387-.787 1.912A2.604 2.604 0 0 1 12 14.2Zm0 4.8c-2.317 0-4.433-.613-6.35-1.837-1.917-1.226-3.367-2.88-4.35-4.963a.812.812 0 0 1-.1-.313 2.93 2.93 0 0 1 0-.774.812.812 0 0 1 .1-.313c.983-2.083 2.433-3.738 4.35-4.963C7.567 4.614 9.683 4 12 4c2.317 0 4.433.612 6.35 1.838 1.917 1.224 3.367 2.879 4.35 4.962a.81.81 0 0 1 .1.313 2.925 2.925 0 0 1 0 .774.81.81 0 0 1-.1.313c-.983 2.083-2.433 3.738-4.35 4.963C16.433 18.387 14.317 19 12 19Zm0-2a9.544 9.544 0 0 0 5.188-1.488A9.773 9.773 0 0 0 20.8 11.5a9.773 9.773 0 0 0-3.613-4.013A9.544 9.544 0 0 0 12 6a9.545 9.545 0 0 0-5.187 1.487A9.773 9.773 0 0 0 3.2 11.5a9.773 9.773 0 0 0 3.613 4.012A9.544 9.544 0 0 0 12 17Z" + }) + }); +} +; +VisibilityOnIcon.displayName = "VisibilityOnIcon"; +module.exports = VisibilityOnIcon; \ No newline at end of file diff --git a/assets/web/icons/voice-call.cjs b/assets/web/icons/voice-call.cjs new file mode 100644 index 00000000..1b721b7c --- /dev/null +++ b/assets/web/icons/voice-call.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VoiceCallIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m20.958 16.374.039 3.527c0 .284-.11.536-.33.756-.22.22-.472.33-.756.33a15.97 15.97 0 0 1-6.57-1.105 16.225 16.225 0 0 1-5.563-3.663 16.084 16.084 0 0 1-3.653-5.573 16.313 16.313 0 0 1-1.115-6.56c0-.285.11-.537.33-.757.22-.22.471-.33.755-.33l3.528.04a1.069 1.069 0 0 1 1.085.93l.543 3.954c.026.18.013.349-.039.504a1.088 1.088 0 0 1-.271.426l-1.64 1.64c.337.672.721 1.308 1.154 1.909.433.6 1.444 1.696 1.444 1.696s1.095 1.01 1.696 1.444c.6.433 1.237.817 1.909 1.153l1.64-1.64a1.07 1.07 0 0 1 .426-.27c.155-.052.323-.065.504-.04l3.954.543a1.068 1.068 0 0 1 .93 1.085Z" + }) + }); +} +; +VoiceCallIcon.displayName = "VoiceCallIcon"; +module.exports = VoiceCallIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-off-solid.cjs b/assets/web/icons/volume-off-solid.cjs new file mode 100644 index 00000000..17e6e330 --- /dev/null +++ b/assets/web/icons/volume-off-solid.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VolumeOffSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3.5 3.5a1 1 0 1 0-1.414 1.414L5.172 8H5a2 2 0 0 0-2 2v4a2 2 0 0 0 2 2h2l3.293 3.293c.63.63 1.707.184 1.707-.707v-3.758l7.086 7.086A1 1 0 0 0 20.5 20.5l-2.136-2.136.003-.003-1.414-1.414-.003.003-1.414-1.414.003-.003-1.415-1.415-.002.003L12 12v-.006L7.503 7.497 7.5 7.5l-4-4Zm11.496 8.662 1.661 1.66c.222-.564.343-1.18.343-1.822 0-1.38-.56-2.632-1.464-3.536a1 1 0 1 0-1.414 1.414 2.987 2.987 0 0 1 .874 2.284Zm3.164 3.164 1.462 1.462A8.961 8.961 0 0 0 21 12a8.975 8.975 0 0 0-2.636-6.364A1 1 0 0 0 16.95 7.05 6.975 6.975 0 0 1 19 12a6.966 6.966 0 0 1-.84 3.326ZM8.917 6.083 12 9.166V5.414c0-.89-1.077-1.337-1.707-.707L8.917 6.083Z" + }) + }); +} +; +VolumeOffSolidIcon.displayName = "VolumeOffSolidIcon"; +module.exports = VolumeOffSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-off.cjs b/assets/web/icons/volume-off.cjs new file mode 100644 index 00000000..4f166c04 --- /dev/null +++ b/assets/web/icons/volume-off.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VolumeOffIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "m3.5 3.5 4 4 .003-.003L8.917 8.91l-.003.003L10 10v-.006l2 2V12l2.122 2.121.002-.003 1.415 1.415-.003.003 1.414 1.414.003-.003 1.414 1.414-.003.003L20.5 20.5a1 1 0 0 1-1.414 1.414L12 14.828v3.758c0 .89-1.077 1.337-1.707.707L7 16H5a2 2 0 0 1-2-2v-4a2 2 0 0 1 2-2h.172L2.086 4.914A1 1 0 0 1 3.5 3.5ZM7.172 10H5v4h2.828L10 16.17v-3.343L7.172 10Zm7.824 2.162 1.661 1.66c.222-.564.343-1.18.343-1.822 0-1.38-.56-2.632-1.464-3.536a1 1 0 1 0-1.414 1.414 2.987 2.987 0 0 1 .874 2.284Zm3.164 3.164 1.462 1.462A8.961 8.961 0 0 0 21 12a8.975 8.975 0 0 0-2.636-6.364A1 1 0 0 0 16.95 7.05 6.975 6.975 0 0 1 19 12a6.966 6.966 0 0 1-.84 3.326ZM8.917 6.083 12 9.166V5.414c0-.89-1.077-1.337-1.707-.707L8.917 6.083Z" + }) + }); +} +; +VolumeOffIcon.displayName = "VolumeOffIcon"; +module.exports = VolumeOffIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-on-solid.cjs b/assets/web/icons/volume-on-solid.cjs new file mode 100644 index 00000000..60082269 --- /dev/null +++ b/assets/web/icons/volume-on-solid.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VolumeOnSolidIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3 14v-4a2 2 0 0 1 2-2h2l3.293-3.293c.63-.63 1.707-.184 1.707.707v13.172c0 .89-1.077 1.337-1.707.707L7 16H5a2 2 0 0 1-2-2Zm11.121-5.536a1 1 0 0 1 1.415 0A4.987 4.987 0 0 1 17 12c0 1.38-.56 2.632-1.464 3.536a1 1 0 0 1-1.415-1.415 2.988 2.988 0 0 0 .88-2.121c0-.829-.335-1.577-.88-2.121a1 1 0 0 1 0-1.415Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M16.95 5.636a1 1 0 0 1 1.414 0A8.975 8.975 0 0 1 21 12a8.975 8.975 0 0 1-2.636 6.364 1 1 0 0 1-1.414-1.414A6.975 6.975 0 0 0 19 12a6.975 6.975 0 0 0-2.05-4.95 1 1 0 0 1 0-1.414Z" + })] + }); +} +; +VolumeOnSolidIcon.displayName = "VolumeOnSolidIcon"; +module.exports = VolumeOnSolidIcon; \ No newline at end of file diff --git a/assets/web/icons/volume-on.cjs b/assets/web/icons/volume-on.cjs new file mode 100644 index 00000000..dc4c0ed7 --- /dev/null +++ b/assets/web/icons/volume-on.cjs @@ -0,0 +1,19 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function VolumeOnIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M3 10a2 2 0 0 1 2-2h2l3.293-3.293c.63-.63 1.707-.184 1.707.707v13.172c0 .89-1.077 1.337-1.707.707L7 16H5a2 2 0 0 1-2-2v-4Zm4.828 4L10 16.172V7.828L7.828 10H5v4h2.828Zm6.293-5.536a1 1 0 0 1 1.415 0A4.988 4.988 0 0 1 17 12c0 1.38-.56 2.632-1.464 3.535a1 1 0 1 1-1.415-1.414 2.987 2.987 0 0 0 .88-2.121c0-.829-.335-1.578-.88-2.122a1 1 0 0 1 0-1.414Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M18.364 5.636A1 1 0 1 0 16.95 7.05 6.975 6.975 0 0 1 19 12a6.975 6.975 0 0 1-2.05 4.95 1 1 0 0 0 1.414 1.414A8.975 8.975 0 0 0 21 12a8.975 8.975 0 0 0-2.636-6.364Z" + })] + }); +} +; +VolumeOnIcon.displayName = "VolumeOnIcon"; +module.exports = VolumeOnIcon; \ No newline at end of file diff --git a/assets/web/icons/warning.cjs b/assets/web/icons/warning.cjs new file mode 100644 index 00000000..67777c8f --- /dev/null +++ b/assets/web/icons/warning.cjs @@ -0,0 +1,21 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function WarningIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsxs("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: [/*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M12.713 17.712A.968.968 0 0 1 12 18a.968.968 0 0 1-.713-.288A.968.968 0 0 1 11 17a.97.97 0 0 1 .287-.712A.968.968 0 0 1 12 16a.97.97 0 0 1 .713.288c.191.191.287.429.287.712s-.096.52-.287.712Zm0-3.999A.968.968 0 0 1 12 14a.968.968 0 0 1-.713-.287A.968.968 0 0 1 11 13V9c0-.283.096-.52.287-.713A.968.968 0 0 1 12 8c.283 0 .52.096.713.287.191.192.287.43.287.713v4c0 .283-.096.52-.287.713Z" + }), /*#__PURE__*/_reactJsxRuntime.jsx("path", { + fillRule: "evenodd", + d: "M10.264 3.039c.767-1.344 2.705-1.344 3.472 0l8.554 14.969c.762 1.333-.2 2.992-1.736 2.992H3.446c-1.535 0-2.498-1.659-1.736-2.992l8.553-14.97ZM3.446 19 12 4.031 20.554 19H3.446Z", + clipRule: "evenodd" + })] + }); +} +; +WarningIcon.displayName = "WarningIcon"; +module.exports = WarningIcon; \ No newline at end of file diff --git a/assets/web/icons/web-browser.cjs b/assets/web/icons/web-browser.cjs new file mode 100644 index 00000000..da0d8b17 --- /dev/null +++ b/assets/web/icons/web-browser.cjs @@ -0,0 +1,17 @@ +var _reactJsxRuntime = require("react/jsx-runtime"); +function WebBrowserIcon(props) { + return /*#__PURE__*/_reactJsxRuntime.jsx("svg", { + xmlns: "http://www.w3.org/2000/svg", + width: "1em", + height: "1em", + fill: "currentColor", + viewBox: "0 0 24 24", + ...props, + children: /*#__PURE__*/_reactJsxRuntime.jsx("path", { + d: "M4 20c-.55 0-1.02-.196-1.413-.587A1.926 1.926 0 0 1 2 18V6c0-.55.196-1.02.587-1.412A1.926 1.926 0 0 1 4 4h16c.55 0 1.02.196 1.413.588.391.391.587.862.587 1.412v12c0 .55-.196 1.02-.587 1.413A1.926 1.926 0 0 1 20 20H4Zm0-2h16V8H4v10Z" + }) + }); +} +; +WebBrowserIcon.displayName = "WebBrowserIcon"; +module.exports = WebBrowserIcon; \ No newline at end of file From 788c5567fb3b9b02d05bc8507df9b20a626785ea Mon Sep 17 00:00:00 2001 From: Quentin Gliech Date: Thu, 20 Jun 2024 18:11:06 +0200 Subject: [PATCH 4/6] Tweak the build script to also generate CJS variants of the components --- package.json | 2 + src/utils/generateIconTokens.ts | 94 +++++++++++++++++++++++++++------ 2 files changed, 79 insertions(+), 17 deletions(-) diff --git a/package.json b/package.json index 2b9e1d73..a08575a2 100644 --- a/package.json +++ b/package.json @@ -23,10 +23,12 @@ }, "./assets/web/icons": { "import": "./assets/web/icons/index.js", + "require": "./assets/web/icons/index.cjs", "types": "./assets/web/icons/index.d.ts" }, "./assets/web/icons/*": { "import": "./assets/web/icons/*.js", + "require": "./assets/web/icons/*.cjs", "types": "./assets/web/icons/*.d.ts" } }, diff --git a/src/utils/generateIconTokens.ts b/src/utils/generateIconTokens.ts index 74d49724..5343d53d 100644 --- a/src/utils/generateIconTokens.ts +++ b/src/utils/generateIconTokens.ts @@ -27,8 +27,8 @@ import svgrPluginJsx from "@svgr/plugin-jsx"; import { camelCase, startCase } from "lodash-es"; /** - * Generates `icons/$icons.json` off all the SVG icons discovered in the - * `icons/` folder + * Generates `icons/$icons.json` and React components off all the + * SVG icons discovered in the `icons/` folder */ export default async function generateIconTokens(): Promise { const outputFileName = "$icons.json"; @@ -45,7 +45,9 @@ export default async function generateIconTokens(): Promise { const manifest: Record = {}; // List of statements to be added to the assets/web/icons/index.js file - const statements = []; + const indexEsmStatements = []; + // The 'module.exports' object for the index.cjs file + const indexCjsExportsProperties = []; for (const icon of icons) { const assetPath = path.join(iconsFolder, icon); @@ -62,7 +64,7 @@ export default async function generateIconTokens(): Promise { const componentName = `${startCase(camelCase(parsedPath.name)).replace(/\s/g, "")}Icon`; // This generates a React component for the icon - const result = await svgrTransform( + const esm = await svgrTransform( svg, { plugins: [svgrPluginJsx as unknown as ConfigPlugin], @@ -72,8 +74,7 @@ export default async function generateIconTokens(): Promise { babelConfig: { plugins: [ { - // For some reason, svgr emits ESM code but without specifying the sourceType, it is treated as CommonJS - // This patches the sourceType so that the JSX transform also emits ESM code + // This patches the sourceType so that the JSX transform emits ESM code visitor: { Program(program) { program.node.sourceType = "module"; @@ -85,11 +86,38 @@ export default async function generateIconTokens(): Promise { } satisfies BabelOptions, }, - // Custom template which uses a function instead of an arrow function and sets the component displayName template(variables, { tpl }) { return tpl` - ${variables.imports}; + function ${variables.componentName}(${variables.props}) { + return ( + ${variables.jsx} + ); + }; + ${variables.componentName}.displayName = '${variables.componentName}' + + export default ${variables.componentName}; + `; + }, + }, + { + componentName, + }, + ); + const cjs = await svgrTransform( + svg, + { + plugins: [svgrPluginJsx as unknown as ConfigPlugin], + icon: true, + jsxRuntime: "automatic", + jsx: { + babelConfig: { + plugins: [[babelTransformReactJsx, { runtime: "automatic" }]], + } satisfies BabelOptions, + }, + + template(variables, { tpl }) { + return tpl` function ${variables.componentName}(${variables.props}) { return ( ${variables.jsx} @@ -97,7 +125,7 @@ export default async function generateIconTokens(): Promise { }; ${variables.componentName}.displayName = '${variables.componentName}' - ${variables.exports}; + module.exports = ${variables.componentName}; `; }, }, @@ -106,10 +134,15 @@ export default async function generateIconTokens(): Promise { }, ); - // Write the react component to the web output folder + // Write the react component to the web output folder, both in cjs and esm format await fs.writeFile( path.join(webOutput, `${parsedPath.name}.js`), - result, + esm, + "utf-8", + ); + await fs.writeFile( + path.join(webOutput, `${parsedPath.name}.cjs`), + cjs, "utf-8", ); @@ -134,7 +167,7 @@ export default ${componentName}; // Add the import statement to the list of statements for the index.js // import { default as SomeIcon } from "./some-icon.js"; - statements.push( + indexEsmStatements.push( t.exportNamedDeclaration( null, [ @@ -146,15 +179,42 @@ export default ${componentName}; t.stringLiteral(`./${parsedPath.name}.js`), ), ); + + // Add the component to the module.exports object for the index.cjs + // SomeIcon: require("./some-icon.cjs"), + indexCjsExportsProperties.push( + t.objectProperty( + t.identifier(componentName), + t.callExpression(t.identifier("require"), [ + t.stringLiteral(`./${parsedPath.name}.cjs`), + ]), + ), + ); } + // Craft a program for the index.cjs file + // module.exports = { ... }; + const cjsProgram = t.program([ + t.expressionStatement( + t.assignmentExpression( + "=", + t.memberExpression(t.identifier("module"), t.identifier("exports")), + t.objectExpression(indexCjsExportsProperties), + ), + ), + ]); + + // Generate the index.cjs file + const cjsCode = generate.default(cjsProgram).code; + await fs.writeFile(path.join(webOutput, "index.cjs"), cjsCode, "utf-8"); + // Generate the index.js file - const program = t.program(statements, [], "module"); - const result = generate.default(program).code; + const esmProgram = t.program(indexEsmStatements, [], "module"); + const esmCode = generate.default(esmProgram).code; + await fs.writeFile(path.join(webOutput, "index.js"), esmCode, "utf-8"); - await fs.writeFile(path.join(webOutput, "index.js"), result, "utf-8"); - // The index.d.ts is identical to the index as it only re-exports the icons - await fs.writeFile(path.join(webOutput, "index.d.ts"), result, "utf-8"); + // The index.d.ts is identical to the index.js as it only re-exports the icons + await fs.writeFile(path.join(webOutput, "index.d.ts"), esmCode, "utf-8"); // Write the icons manifest to the icons folder await fs.writeFile( From 658b17526e9958287051473976d1a76d83c7df03 Mon Sep 17 00:00:00 2001 From: Quentin Gliech Date: Thu, 20 Jun 2024 18:15:01 +0200 Subject: [PATCH 5/6] Mark the package as side-effect free This should help with tree-shaking in downstream packages --- package.json | 1 + 1 file changed, 1 insertion(+) diff --git a/package.json b/package.json index a08575a2..95be4126 100644 --- a/package.json +++ b/package.json @@ -2,6 +2,7 @@ "name": "@vector-im/compound-design-tokens", "version": "1.5.0", "description": "Compound design tokens", + "sideEffects": false, "scripts": { "build": "tsx ./build.ts", "dev": "http-server .", From 6b72ca0fd818cee30b614442a1b82dc72f8decbd Mon Sep 17 00:00:00 2001 From: Quentin Gliech Date: Thu, 11 Jul 2024 21:54:04 +0200 Subject: [PATCH 6/6] Fix types --- src/global.d.ts | 32 ++++++++++++++++++++++++++++++++ src/utils/generateIconTokens.ts | 10 +++++++--- 2 files changed, 39 insertions(+), 3 deletions(-) create mode 100644 src/global.d.ts diff --git a/src/global.d.ts b/src/global.d.ts new file mode 100644 index 00000000..124c2214 --- /dev/null +++ b/src/global.d.ts @@ -0,0 +1,32 @@ +/* +Copyright 2024 New Vector Ltd. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Stub declarations, as svgr types depend on these, but we don't have them installed +declare module "prettier" { + export interface Options {} +} + +declare module "svgo" { + export interface Config {} +} + +// This module doens't have a type definition +declare module "@babel/plugin-transform-react-jsx" { + import type { PluginItem } from "@babel/core"; + + const babelTransformReactJsx: PluginItem; + export default babelTransformReactJsx; +} diff --git a/src/utils/generateIconTokens.ts b/src/utils/generateIconTokens.ts index 5343d53d..b27d8827 100644 --- a/src/utils/generateIconTokens.ts +++ b/src/utils/generateIconTokens.ts @@ -19,13 +19,17 @@ import path from "node:path"; import { fileURLToPath } from "node:url"; import type { TransformOptions as BabelOptions } from "@babel/core"; -import generate from "@babel/generator"; +import generate_ from "@babel/generator"; import babelTransformReactJsx from "@babel/plugin-transform-react-jsx"; import t from "@babel/types"; import { type ConfigPlugin, transform as svgrTransform } from "@svgr/core"; import svgrPluginJsx from "@svgr/plugin-jsx"; import { camelCase, startCase } from "lodash-es"; +// Types for the default export of @babel/generator are wrong +const generate = (generate_ as unknown as { default: typeof generate_ }) + .default; + /** * Generates `icons/$icons.json` and React components off all the * SVG icons discovered in the `icons/` folder @@ -205,12 +209,12 @@ export default ${componentName}; ]); // Generate the index.cjs file - const cjsCode = generate.default(cjsProgram).code; + const cjsCode = generate(cjsProgram).code; await fs.writeFile(path.join(webOutput, "index.cjs"), cjsCode, "utf-8"); // Generate the index.js file const esmProgram = t.program(indexEsmStatements, [], "module"); - const esmCode = generate.default(esmProgram).code; + const esmCode = generate(esmProgram).code; await fs.writeFile(path.join(webOutput, "index.js"), esmCode, "utf-8"); // The index.d.ts is identical to the index.js as it only re-exports the icons